/* overlib/overlib.js */

//\/////
//\  overLIB 4.21 - You may not remove or change this notice.
//\  Copyright Erik Bosrup 1998-2004. All rights reserved.
//\
//\  Contributors are listed on the homepage.
//\  This file might be old, always check for the latest version at:
//\  http://www.bosrup.com/web/overlib/
//\
//\  Please read the license agreement (available through the link above)
//\  before using overLIB. Direct any licensing questions to erik@bosrup.com.
//\
//\  Do not sell this as your own work or remove this copyright notice. 
//\  For full details on copying or changing this script please read the
//\  license agreement at the link above. Please give credit on sites that
//\  use overLIB and submit changes of the script so other people can use
//\  them as well.
//   $Revision: 1.119 $                $Date: 2005/07/02 23:41:44 $
//\/////
//\mini

////////
// PRE-INIT
// Ignore these lines, configuration is below.
////////
var olLoaded = 0;var pmStart = 10000000; var pmUpper = 10001000; var pmCount = pmStart+1; var pmt=''; var pms = new Array(); var olInfo = new Info('4.21', 1);
var FREPLACE = 0; var FBEFORE = 1; var FAFTER = 2; var FALTERNATE = 3; var FCHAIN=4;
var olHideForm=0;  // parameter for hiding SELECT and ActiveX elements in IE5.5+ 
var olHautoFlag = 0;  // flags for over-riding VAUTO and HAUTO if corresponding
var olVautoFlag = 0;  // positioning commands are used on the command line
var hookPts = new Array(), postParse = new Array(), cmdLine = new Array(), runTime = new Array();
// for plugins
registerCommands('donothing,inarray,caparray,sticky,background,noclose,caption,left,right,center,offsetx,offsety,fgcolor,bgcolor,textcolor,capcolor,closecolor,width,border,cellpad,status,autostatus,autostatuscap,height,closetext,snapx,snapy,fixx,fixy,relx,rely,fgbackground,bgbackground,padx,pady,fullhtml,above,below,capicon,textfont,captionfont,closefont,textsize,captionsize,closesize,timeout,function,delay,hauto,vauto,closeclick,wrap,followmouse,mouseoff,closetitle,cssoff,compatmode,cssclass,fgclass,bgclass,textfontclass,captionfontclass,closefontclass');

////////
// DEFAULT CONFIGURATION
// Settings you want everywhere are set here. All of this can also be
// changed on your html page or through an overLIB call.
////////
if (typeof ol_fgcolor=='undefined') var ol_fgcolor="#CCCCFF";
if (typeof ol_bgcolor=='undefined') var ol_bgcolor="#333399";
if (typeof ol_textcolor=='undefined') var ol_textcolor="#000000";
if (typeof ol_capcolor=='undefined') var ol_capcolor="#FFFFFF";
if (typeof ol_closecolor=='undefined') var ol_closecolor="#9999FF";
if (typeof ol_textfont=='undefined') var ol_textfont="Verdana,Arial,Helvetica";
if (typeof ol_captionfont=='undefined') var ol_captionfont="Verdana,Arial,Helvetica";
if (typeof ol_closefont=='undefined') var ol_closefont="Verdana,Arial,Helvetica";
if (typeof ol_textsize=='undefined') var ol_textsize="1";
if (typeof ol_captionsize=='undefined') var ol_captionsize="1";
if (typeof ol_closesize=='undefined') var ol_closesize="1";
if (typeof ol_width=='undefined') var ol_width="200";
if (typeof ol_border=='undefined') var ol_border="1";
if (typeof ol_cellpad=='undefined') var ol_cellpad=2;
if (typeof ol_offsetx=='undefined') var ol_offsetx=10;
if (typeof ol_offsety=='undefined') var ol_offsety=10;
if (typeof ol_text=='undefined') var ol_text="Default Text";
if (typeof ol_cap=='undefined') var ol_cap="";
if (typeof ol_sticky=='undefined') var ol_sticky=0;
if (typeof ol_background=='undefined') var ol_background="";
if (typeof ol_close=='undefined') var ol_close="Close";
if (typeof ol_hpos=='undefined') var ol_hpos=RIGHT;
if (typeof ol_status=='undefined') var ol_status="";
if (typeof ol_autostatus=='undefined') var ol_autostatus=0;
if (typeof ol_height=='undefined') var ol_height=-1;
if (typeof ol_snapx=='undefined') var ol_snapx=0;
if (typeof ol_snapy=='undefined') var ol_snapy=0;
if (typeof ol_fixx=='undefined') var ol_fixx=-1;
if (typeof ol_fixy=='undefined') var ol_fixy=-1;
if (typeof ol_relx=='undefined') var ol_relx=null;
if (typeof ol_rely=='undefined') var ol_rely=null;
if (typeof ol_fgbackground=='undefined') var ol_fgbackground="";
if (typeof ol_bgbackground=='undefined') var ol_bgbackground="";
if (typeof ol_padxl=='undefined') var ol_padxl=1;
if (typeof ol_padxr=='undefined') var ol_padxr=1;
if (typeof ol_padyt=='undefined') var ol_padyt=1;
if (typeof ol_padyb=='undefined') var ol_padyb=1;
if (typeof ol_fullhtml=='undefined') var ol_fullhtml=0;
if (typeof ol_vpos=='undefined') var ol_vpos=BELOW;
if (typeof ol_aboveheight=='undefined') var ol_aboveheight=0;
if (typeof ol_capicon=='undefined') var ol_capicon="";
if (typeof ol_frame=='undefined') var ol_frame=self;
if (typeof ol_timeout=='undefined') var ol_timeout=0;
if (typeof ol_function=='undefined') var ol_function=null;
if (typeof ol_delay=='undefined') var ol_delay=0;
if (typeof ol_hauto=='undefined') var ol_hauto=0;
if (typeof ol_vauto=='undefined') var ol_vauto=0;
if (typeof ol_closeclick=='undefined') var ol_closeclick=0;
if (typeof ol_wrap=='undefined') var ol_wrap=0;
if (typeof ol_followmouse=='undefined') var ol_followmouse=1;
if (typeof ol_mouseoff=='undefined') var ol_mouseoff=0;
if (typeof ol_closetitle=='undefined') var ol_closetitle='Close';
if (typeof ol_compatmode=='undefined') var ol_compatmode=0;
if (typeof ol_css=='undefined') var ol_css=CSSOFF;
if (typeof ol_fgclass=='undefined') var ol_fgclass="";
if (typeof ol_bgclass=='undefined') var ol_bgclass="";
if (typeof ol_textfontclass=='undefined') var ol_textfontclass="";
if (typeof ol_captionfontclass=='undefined') var ol_captionfontclass="";
if (typeof ol_closefontclass=='undefined') var ol_closefontclass="";

////////
// ARRAY CONFIGURATION
////////

// You can use these arrays to store popup text here instead of in the html.
if (typeof ol_texts=='undefined') var ol_texts = new Array("Text 0", "Text 1");
if (typeof ol_caps=='undefined') var ol_caps = new Array("Caption 0", "Caption 1");

////////
// END OF CONFIGURATION
// Don't change anything below this line, all configuration is above.
////////





////////
// INIT
////////
// Runtime variables init. Don't change for config!
var o3_text="";
var o3_cap="";
var o3_sticky=0;
var o3_background="";
var o3_close="Close";
var o3_hpos=RIGHT;
var o3_offsetx=2;
var o3_offsety=2;
var o3_fgcolor="";
var o3_bgcolor="";
var o3_textcolor="";
var o3_capcolor="";
var o3_closecolor="";
var o3_width=100;
var o3_border=1;
var o3_cellpad=2;
var o3_status="";
var o3_autostatus=0;
var o3_height=-1;
var o3_snapx=0;
var o3_snapy=0;
var o3_fixx=-1;
var o3_fixy=-1;
var o3_relx=null;
var o3_rely=null;
var o3_fgbackground="";
var o3_bgbackground="";
var o3_padxl=0;
var o3_padxr=0;
var o3_padyt=0;
var o3_padyb=0;
var o3_fullhtml=0;
var o3_vpos=BELOW;
var o3_aboveheight=0;
var o3_capicon="";
var o3_textfont="Verdana,Arial,Helvetica";
var o3_captionfont="Verdana,Arial,Helvetica";
var o3_closefont="Verdana,Arial,Helvetica";
var o3_textsize="1";
var o3_captionsize="1";
var o3_closesize="1";
var o3_frame=self;
var o3_timeout=0;
var o3_timerid=0;
var o3_allowmove=0;
var o3_function=null; 
var o3_delay=0;
var o3_delayid=0;
var o3_hauto=0;
var o3_vauto=0;
var o3_closeclick=0;
var o3_wrap=0;
var o3_followmouse=1;
var o3_mouseoff=0;
var o3_closetitle='';
var o3_compatmode=0;
var o3_css=CSSOFF;
var o3_fgclass="";
var o3_bgclass="";
var o3_textfontclass="";
var o3_captionfontclass="";
var o3_closefontclass="";

// Display state variables
var o3_x = 0;
var o3_y = 0;
var o3_showingsticky = 0;
var o3_removecounter = 0;

// Our layer
var over = null;
var fnRef, hoveringSwitch = false;
var olHideDelay;

// Decide browser version
var isMac = (navigator.userAgent.indexOf("Mac") != -1);
var olOp = (navigator.userAgent.toLowerCase().indexOf('opera') > -1 && document.createTextNode);  // Opera 7
var olNs4 = (navigator.appName=='Netscape' && parseInt(navigator.appVersion) == 4);
var olNs6 = (document.getElementById) ? true : false;
var olKq = (olNs6 && /konqueror/i.test(navigator.userAgent));
var olIe4 = (document.all) ? true : false;
var olIe5 = false; 
var olIe55 = false; // Added additional variable to identify IE5.5+
var docRoot = 'document.body';

// Resize fix for NS4.x to keep track of layer
if (olNs4) {
	var oW = window.innerWidth;
	var oH = window.innerHeight;
	window.onresize = function() { if (oW != window.innerWidth || oH != window.innerHeight) location.reload(); }
}

// Microsoft Stupidity Check(tm).
if (olIe4) {
	var agent = navigator.userAgent;
	if (/MSIE/.test(agent)) {
		var versNum = parseFloat(agent.match(/MSIE[ ](\d\.\d+)\.*/i)[1]);
		if (versNum >= 5){
			olIe5=true;
			olIe55=(versNum>=5.5&&!olOp) ? true : false;
			if (olNs6) olNs6=false;
		}
	}
	if (olNs6) olIe4 = false;
}

// Check for compatability mode.
if (document.compatMode && document.compatMode == 'CSS1Compat') {
	docRoot= ((olIe4 && !olOp) ? 'document.documentElement' : docRoot);
}

// Add window onload handlers to indicate when all modules have been loaded
// For Netscape 6+ and Mozilla, uses addEventListener method on the window object
// For IE it uses the attachEvent method of the window object and for Netscape 4.x
// it sets the window.onload handler to the OLonload_handler function for Bubbling
if(window.addEventListener) window.addEventListener("load",OLonLoad_handler,false);
else if (window.attachEvent) window.attachEvent("onload",OLonLoad_handler);

var capExtent;

////////
// PUBLIC FUNCTIONS
////////

// overlib(arg0,...,argN)
// Loads parameters into global runtime variables.
function overlib() {
	if (!olLoaded || isExclusive(overlib.arguments)) return true;
	if (olCheckMouseCapture) olMouseCapture();
	if (over) {
		over = (typeof over.id != 'string') ? o3_frame.document.all['overDiv'] : over;
		cClick();
	}

	// Load defaults to runtime.
  olHideDelay=0;
	o3_text=ol_text;
	o3_cap=ol_cap;
	o3_sticky=ol_sticky;
	o3_background=ol_background;
	o3_close=ol_close;
	o3_hpos=ol_hpos;
	o3_offsetx=ol_offsetx;
	o3_offsety=ol_offsety;
	o3_fgcolor=ol_fgcolor;
	o3_bgcolor=ol_bgcolor;
	o3_textcolor=ol_textcolor;
	o3_capcolor=ol_capcolor;
	o3_closecolor=ol_closecolor;
	o3_width=ol_width;
	o3_border=ol_border;
	o3_cellpad=ol_cellpad;
	o3_status=ol_status;
	o3_autostatus=ol_autostatus;
	o3_height=ol_height;
	o3_snapx=ol_snapx;
	o3_snapy=ol_snapy;
	o3_fixx=ol_fixx;
	o3_fixy=ol_fixy;
	o3_relx=ol_relx;
	o3_rely=ol_rely;
	o3_fgbackground=ol_fgbackground;
	o3_bgbackground=ol_bgbackground;
	o3_padxl=ol_padxl;
	o3_padxr=ol_padxr;
	o3_padyt=ol_padyt;
	o3_padyb=ol_padyb;
	o3_fullhtml=ol_fullhtml;
	o3_vpos=ol_vpos;
	o3_aboveheight=ol_aboveheight;
	o3_capicon=ol_capicon;
	o3_textfont=ol_textfont;
	o3_captionfont=ol_captionfont;
	o3_closefont=ol_closefont;
	o3_textsize=ol_textsize;
	o3_captionsize=ol_captionsize;
	o3_closesize=ol_closesize;
	o3_timeout=ol_timeout;
	o3_function=ol_function;
	o3_delay=ol_delay;
	o3_hauto=ol_hauto;
	o3_vauto=ol_vauto;
	o3_closeclick=ol_closeclick;
	o3_wrap=ol_wrap;	
	o3_followmouse=ol_followmouse;
	o3_mouseoff=ol_mouseoff;
	o3_closetitle=ol_closetitle;
	o3_css=ol_css;
	o3_compatmode=ol_compatmode;
	o3_fgclass=ol_fgclass;
	o3_bgclass=ol_bgclass;
	o3_textfontclass=ol_textfontclass;
	o3_captionfontclass=ol_captionfontclass;
	o3_closefontclass=ol_closefontclass;
	
	setRunTimeVariables();
	
	fnRef = '';
	
	// Special for frame support, over must be reset...
	o3_frame = ol_frame;
	
	if(!(over=createDivContainer())) return false;

	parseTokens('o3_', overlib.arguments);
	if (!postParseChecks()) return false;

	if (o3_delay == 0) {
		return runHook("olMain", FREPLACE);
 	} else {
		o3_delayid = setTimeout("runHook('olMain', FREPLACE)", o3_delay);
		return false;
	}
}

// Clears popups if appropriate
function nd(time) {
	if (olLoaded && !isExclusive()) {
		hideDelay(time);  // delay popup close if time specified

		if (o3_removecounter >= 1) { o3_showingsticky = 0 };
		
		if (o3_showingsticky == 0) {
			o3_allowmove = 0;
			if (over != null && o3_timerid == 0) runHook("hideObject", FREPLACE, over);
		} else {
			o3_removecounter++;
		}
	}
	
	return true;
}

// The Close onMouseOver function for stickies
function cClick() {
	if (olLoaded) {
		runHook("hideObject", FREPLACE, over);
		o3_showingsticky = 0;	
	}	
	return false;
}

// Method for setting page specific defaults.
function overlib_pagedefaults() {
	parseTokens('ol_', overlib_pagedefaults.arguments);
}


////////
// OVERLIB MAIN FUNCTION
////////

// This function decides what it is we want to display and how we want it done.
function olMain() {
	var layerhtml, styleType;
 	runHook("olMain", FBEFORE);
 	
	if (o3_background!="" || o3_fullhtml) {
		// Use background instead of box.
		layerhtml = runHook('ol_content_background', FALTERNATE, o3_css, o3_text, o3_background, o3_fullhtml);
	} else {
		// They want a popup box.
		styleType = (pms[o3_css-1-pmStart] == "cssoff" || pms[o3_css-1-pmStart] == "cssclass");

		// Prepare popup background
		if (o3_fgbackground != "") o3_fgbackground = "background=\""+o3_fgbackground+"\"";
		if (o3_bgbackground != "") o3_bgbackground = (styleType ? "background=\""+o3_bgbackground+"\"" : o3_bgbackground);

		// Prepare popup colors
		if (o3_fgcolor != "") o3_fgcolor = (styleType ? "bgcolor=\""+o3_fgcolor+"\"" : o3_fgcolor);
		if (o3_bgcolor != "") o3_bgcolor = (styleType ? "bgcolor=\""+o3_bgcolor+"\"" : o3_bgcolor);

		// Prepare popup height
		if (o3_height > 0) o3_height = (styleType ? "height=\""+o3_height+"\"" : o3_height);
		else o3_height = "";

		// Decide which kinda box.
		if (o3_cap=="") {
			// Plain
			layerhtml = runHook('ol_content_simple', FALTERNATE, o3_css, o3_text);
		} else {
			// With caption
			if (o3_sticky) {
				// Show close text
				layerhtml = runHook('ol_content_caption', FALTERNATE, o3_css, o3_text, o3_cap, o3_close);
			} else {
				// No close text
				layerhtml = runHook('ol_content_caption', FALTERNATE, o3_css, o3_text, o3_cap, "");
			}
		}
	}	

	// We want it to stick!
	if (o3_sticky) {
		if (o3_timerid > 0) {
			clearTimeout(o3_timerid);
			o3_timerid = 0;
		}
		o3_showingsticky = 1;
		o3_removecounter = 0;
	}

	// Created a separate routine to generate the popup to make it easier
	// to implement a plugin capability
	if (!runHook("createPopup", FREPLACE, layerhtml)) return false;

	// Prepare status bar
	if (o3_autostatus > 0) {
		o3_status = o3_text;
		if (o3_autostatus > 1) o3_status = o3_cap;
	}

	// When placing the layer the first time, even stickies may be moved.
	o3_allowmove = 0;

	// Initiate a timer for timeout
	if (o3_timeout > 0) {          
		if (o3_timerid > 0) clearTimeout(o3_timerid);
		o3_timerid = setTimeout("cClick()", o3_timeout);
	}

	// Show layer
	runHook("disp", FREPLACE, o3_status);
	runHook("olMain", FAFTER);

	return (olOp && event && event.type == 'mouseover' && !o3_status) ? '' : (o3_status != '');
}

////////
// LAYER GENERATION FUNCTIONS
////////
// These functions just handle popup content with tags that should adhere to the W3C standards specification.

// Makes simple table without caption
function ol_content_simple(text) {
	var cpIsMultiple = /,/.test(o3_cellpad);
	var txt = '<table width="'+o3_width+ '" border="0" cellpadding="'+o3_border+'" cellspacing="0" '+(o3_bgclass ? 'class="'+o3_bgclass+'"' : o3_bgcolor+' '+o3_height)+'><tr><td><table width="100%" border="0" '+((olNs4||!cpIsMultiple) ? 'cellpadding="'+o3_cellpad+'" ' : '')+'cellspacing="0" '+(o3_fgclass ? 'class="'+o3_fgclass+'"' : o3_fgcolor+' '+o3_fgbackground+' '+o3_height)+'><tr><td valign="TOP"'+(o3_textfontclass ? ' class="'+o3_textfontclass+'">' : ((!olNs4&&cpIsMultiple) ? ' style="'+setCellPadStr(o3_cellpad)+'">' : '>'))+(o3_textfontclass ? '' : wrapStr(0,o3_textsize,'text'))+text+(o3_textfontclass ? '' : wrapStr(1,o3_textsize))+'</td></tr></table></td></tr></table>';

	set_background("");
	return txt;
}

// Makes table with caption and optional close link
function ol_content_caption(text,title,close) {
	var nameId, txt, cpIsMultiple = /,/.test(o3_cellpad);
	var closing, closeevent;

	closing = "";
	closeevent = "onmouseover";
	if (o3_closeclick == 1) closeevent = (o3_closetitle ? "title='" + o3_closetitle +"'" : "") + " onclick";
	if (o3_capicon != "") {
	  nameId = ' hspace = \"5\"'+' align = \"middle\" alt = \"\"';
	  if (typeof o3_dragimg != 'undefined' && o3_dragimg) nameId =' hspace=\"5\"'+' name=\"'+o3_dragimg+'\" id=\"'+o3_dragimg+'\" align=\"middle\" alt=\"Drag Enabled\" title=\"Drag Enabled\"';
	  o3_capicon = '<img src=\"'+o3_capicon+'\"'+nameId+' />';
	}

	if (close != "")
		closing = '<td '+(!o3_compatmode && o3_closefontclass ? 'class="'+o3_closefontclass : 'align="RIGHT')+'"><a href="javascript:return '+fnRef+'cClick();"'+((o3_compatmode && o3_closefontclass) ? ' class="' + o3_closefontclass + '" ' : ' ')+closeevent+'="return '+fnRef+'cClick();">'+(o3_closefontclass ? '' : wrapStr(0,o3_closesize,'close'))+close+(o3_closefontclass ? '' : wrapStr(1,o3_closesize,'close'))+'</a></td>';
	txt = '<table width="'+o3_width+ '" border="0" cellpadding="'+o3_border+'" cellspacing="0" '+(o3_bgclass ? 'class="'+o3_bgclass+'"' : o3_bgcolor+' '+o3_bgbackground+' '+o3_height)+'><tr><td><table width="100%" border="0" cellpadding="2" cellspacing="0"><tr><td'+(o3_captionfontclass ? ' class="'+o3_captionfontclass+'">' : '>')+(o3_captionfontclass ? '' : '<b>'+wrapStr(0,o3_captionsize,'caption'))+o3_capicon+title+(o3_captionfontclass ? '' : wrapStr(1,o3_captionsize)+'</b>')+'</td>'+closing+'</tr></table><table width="100%" border="0" '+((olNs4||!cpIsMultiple) ? 'cellpadding="'+o3_cellpad+'" ' : '')+'cellspacing="0" '+(o3_fgclass ? 'class="'+o3_fgclass+'"' : o3_fgcolor+' '+o3_fgbackground+' '+o3_height)+'><tr><td valign="TOP"'+(o3_textfontclass ? ' class="'+o3_textfontclass+'">' :((!olNs4&&cpIsMultiple) ? ' style="'+setCellPadStr(o3_cellpad)+'">' : '>'))+(o3_textfontclass ? '' : wrapStr(0,o3_textsize,'text'))+text+(o3_textfontclass ? '' : wrapStr(1,o3_textsize)) + '</td></tr></table></td></tr></table>';

	set_background("");
	return txt;
}

// Sets the background picture,padding and lots more. :)
function ol_content_background(text,picture,hasfullhtml) {
	if (hasfullhtml) {
		txt=text;
	} else {
		txt='<table width="'+o3_width+'" border="0" cellpadding="0" cellspacing="0" height="'+o3_height+'"><tr><td colspan="3" height="'+o3_padyt+'"></td></tr><tr><td width="'+o3_padxl+'"></td><td valign="TOP" width="'+(o3_width-o3_padxl-o3_padxr)+(o3_textfontclass ? '" class="'+o3_textfontclass : '')+'">'+(o3_textfontclass ? '' : wrapStr(0,o3_textsize,'text'))+text+(o3_textfontclass ? '' : wrapStr(1,o3_textsize))+'</td><td width="'+o3_padxr+'"></td></tr><tr><td colspan="3" height="'+o3_padyb+'"></td></tr></table>';
	}

	set_background(picture);
	return txt;
}

// Loads a picture into the div.
function set_background(pic) {
	if (pic == "") {
		if (olNs4) {
			over.background.src = null; 
		} else if (over.style) {
			over.style.backgroundImage = "none";
		}
	} else {
		if (olNs4) {
			over.background.src = pic;
		} else if (over.style) {
			over.style.width=o3_width + 'px';
			over.style.backgroundImage = "url("+pic+")";
		}
	}
}

////////
// HANDLING FUNCTIONS
////////
var olShowId=-1;

// Displays the popup
function disp(statustext) {
	runHook("disp", FBEFORE);
	
	if (o3_allowmove == 0) {
		runHook("placeLayer", FREPLACE);
		(olNs6&&olShowId<0) ? olShowId=setTimeout("runHook('showObject', FREPLACE, over)", 1) : runHook("showObject", FREPLACE, over);
		o3_allowmove = (o3_sticky || o3_followmouse==0) ? 0 : 1;
	}
	
	runHook("disp", FAFTER);

	if (statustext != "") self.status = statustext;
}

// Creates the actual popup structure
function createPopup(lyrContent){
	runHook("createPopup", FBEFORE);
	
	if (o3_wrap) {
		var wd,ww,theObj = (olNs4 ? over : over.style);
		theObj.top = theObj.left = ((olIe4&&!olOp) ? 0 : -10000) + (!olNs4 ? 'px' : 0);
		layerWrite(lyrContent);
		wd = (olNs4 ? over.clip.width : over.offsetWidth);
		if (wd > (ww=windowWidth())) {
			lyrContent=lyrContent.replace(/\&nbsp;/g, ' ');
			o3_width=ww;
			o3_wrap=0;
		} 
	}

	layerWrite(lyrContent);
	
	// Have to set o3_width for placeLayer() routine if o3_wrap is turned on
	if (o3_wrap) o3_width=(olNs4 ? over.clip.width : over.offsetWidth);
	
	runHook("createPopup", FAFTER, lyrContent);

	return true;
}

// Decides where we want the popup.
function placeLayer() {
	var placeX, placeY, widthFix = 0;
	
	// HORIZONTAL PLACEMENT, re-arranged to work in Safari
	if (o3_frame.innerWidth) widthFix=18; 
	iwidth = windowWidth();

	// Horizontal scroll offset
	winoffset=(olIe4) ? eval('o3_frame.'+docRoot+'.scrollLeft') : o3_frame.pageXOffset;

	placeX = runHook('horizontalPlacement',FCHAIN,iwidth,winoffset,widthFix);

	// VERTICAL PLACEMENT, re-arranged to work in Safari
	if (o3_frame.innerHeight) {
		iheight=o3_frame.innerHeight;
	} else if (eval('o3_frame.'+docRoot)&&eval("typeof o3_frame."+docRoot+".clientHeight=='number'")&&eval('o3_frame.'+docRoot+'.clientHeight')) { 
		iheight=eval('o3_frame.'+docRoot+'.clientHeight');
	}			

	// Vertical scroll offset
	scrolloffset=(olIe4) ? eval('o3_frame.'+docRoot+'.scrollTop') : o3_frame.pageYOffset;
	placeY = runHook('verticalPlacement',FCHAIN,iheight,scrolloffset);

	// Actually move the object.
	repositionTo(over, placeX, placeY);
}

// Moves the layer
function olMouseMove(e) {
	var e = (e) ? e : event;

	if (e.pageX) {
		o3_x = e.pageX;
		o3_y = e.pageY;
	} else if (e.clientX) {
		o3_x = eval('e.clientX+o3_frame.'+docRoot+'.scrollLeft');
		o3_y = eval('e.clientY+o3_frame.'+docRoot+'.scrollTop');
	}
	
	if (o3_allowmove == 1) runHook("placeLayer", FREPLACE);

	// MouseOut handler
	if (hoveringSwitch && !olNs4 && runHook("cursorOff", FREPLACE)) {
		(olHideDelay ? hideDelay(olHideDelay) : cClick());
		hoveringSwitch = !hoveringSwitch;
	}
}

// Fake function for 3.0 users.
function no_overlib() { return ver3fix; }

// Capture the mouse and chain other scripts.
function olMouseCapture() {
	capExtent = document;
	var fN, str = '', l, k, f, wMv, sS, mseHandler = olMouseMove;
	var re = /function[ ]*(\w*)\(/;
	
	wMv = (!olIe4 && window.onmousemove);
	if (document.onmousemove || wMv) {
		if (wMv) capExtent = window;
		f = capExtent.onmousemove.toString();
		fN = f.match(re);
		if (fN == null) {
			str = f+'(e); ';
		} else if (fN[1] == 'anonymous' || fN[1] == 'olMouseMove' || (wMv && fN[1] == 'onmousemove')) {
			if (!olOp && wMv) {
				l = f.indexOf('{')+1;
				k = f.lastIndexOf('}');
				sS = f.substring(l,k);
				if ((l = sS.indexOf('(')) != -1) {
					sS = sS.substring(0,l).replace(/^\s+/,'').replace(/\s+$/,'');
					if (eval("typeof " + sS + " == 'undefined'")) window.onmousemove = null;
					else str = sS + '(e);';
				}
			}
			if (!str) {
				olCheckMouseCapture = false;
				return;
			}
		} else {
			if (fN[1]) str = fN[1]+'(e); ';
			else {
				l = f.indexOf('{')+1;
				k = f.lastIndexOf('}');
				str = f.substring(l,k) + '\n';
			}
		}
		str += 'olMouseMove(e); ';
		mseHandler = new Function('e', str);
	}

	capExtent.onmousemove = mseHandler;
	if (olNs4) capExtent.captureEvents(Event.MOUSEMOVE);
}

////////
// PARSING FUNCTIONS
////////

// Does the actual command parsing.
function parseTokens(pf, ar) {
	// What the next argument is expected to be.
	var v, i, mode=-1, par = (pf != 'ol_');	
	var fnMark = (par && !ar.length ? 1 : 0);

	for (i = 0; i < ar.length; i++) {
		if (mode < 0) {
			// Arg is maintext,unless its a number between pmStart and pmUpper
			// then its a command.
			if (typeof ar[i] == 'number' && ar[i] > pmStart && ar[i] < pmUpper) {
				fnMark = (par ? 1 : 0);
				i--;   // backup one so that the next block can parse it
			} else {
				switch(pf) {
					case 'ol_':
						ol_text = ar[i].toString();
						break;
					default:
						o3_text=ar[i].toString();  
				}
			}
			mode = 0;
		} else {
			// Note: NS4 doesn't like switch cases with vars.
			if (ar[i] >= pmCount || ar[i]==DONOTHING) { continue; }
			if (ar[i]==INARRAY) { fnMark = 0; eval(pf+'text=ol_texts['+ar[++i]+'].toString()'); continue; }
			if (ar[i]==CAPARRAY) { eval(pf+'cap=ol_caps['+ar[++i]+'].toString()'); continue; }
			if (ar[i]==STICKY) { if (pf!='ol_') eval(pf+'sticky=1'); continue; }
			if (ar[i]==BACKGROUND) { eval(pf+'background="'+ar[++i]+'"'); continue; }
			if (ar[i]==NOCLOSE) { if (pf!='ol_') opt_NOCLOSE(); continue; }
			if (ar[i]==CAPTION) { eval(pf+"cap='"+escSglQuote(ar[++i])+"'"); continue; }
			if (ar[i]==CENTER || ar[i]==LEFT || ar[i]==RIGHT) { eval(pf+'hpos='+ar[i]); if(pf!='ol_') olHautoFlag=1; continue; }
			if (ar[i]==OFFSETX) { eval(pf+'offsetx='+ar[++i]); continue; }
			if (ar[i]==OFFSETY) { eval(pf+'offsety='+ar[++i]); continue; }
			if (ar[i]==FGCOLOR) { eval(pf+'fgcolor="'+ar[++i]+'"'); continue; }
			if (ar[i]==BGCOLOR) { eval(pf+'bgcolor="'+ar[++i]+'"'); continue; }
			if (ar[i]==TEXTCOLOR) { eval(pf+'textcolor="'+ar[++i]+'"'); continue; }
			if (ar[i]==CAPCOLOR) { eval(pf+'capcolor="'+ar[++i]+'"'); continue; }
			if (ar[i]==CLOSECOLOR) { eval(pf+'closecolor="'+ar[++i]+'"'); continue; }
			if (ar[i]==WIDTH) { eval(pf+'width='+ar[++i]); continue; }
			if (ar[i]==BORDER) { eval(pf+'border='+ar[++i]); continue; }
			if (ar[i]==CELLPAD) { i=opt_MULTIPLEARGS(++i,ar,(pf+'cellpad')); continue; }
			if (ar[i]==STATUS) { eval(pf+"status='"+escSglQuote(ar[++i])+"'"); continue; }
			if (ar[i]==AUTOSTATUS) { eval(pf +'autostatus=('+pf+'autostatus == 1) ? 0 : 1'); continue; }
			if (ar[i]==AUTOSTATUSCAP) { eval(pf +'autostatus=('+pf+'autostatus == 2) ? 0 : 2'); continue; }
			if (ar[i]==HEIGHT) { eval(pf+'height='+pf+'aboveheight='+ar[++i]); continue; } // Same param again.
			if (ar[i]==CLOSETEXT) { eval(pf+"close='"+escSglQuote(ar[++i])+"'"); continue; }
			if (ar[i]==SNAPX) { eval(pf+'snapx='+ar[++i]); continue; }
			if (ar[i]==SNAPY) { eval(pf+'snapy='+ar[++i]); continue; }
			if (ar[i]==FIXX) { eval(pf+'fixx='+ar[++i]); continue; }
			if (ar[i]==FIXY) { eval(pf+'fixy='+ar[++i]); continue; }
			if (ar[i]==RELX) { eval(pf+'relx='+ar[++i]); continue; }
			if (ar[i]==RELY) { eval(pf+'rely='+ar[++i]); continue; }
			if (ar[i]==FGBACKGROUND) { eval(pf+'fgbackground="'+ar[++i]+'"'); continue; }
			if (ar[i]==BGBACKGROUND) { eval(pf+'bgbackground="'+ar[++i]+'"'); continue; }
			if (ar[i]==PADX) { eval(pf+'padxl='+ar[++i]); eval(pf+'padxr='+ar[++i]); continue; }
			if (ar[i]==PADY) { eval(pf+'padyt='+ar[++i]); eval(pf+'padyb='+ar[++i]); continue; }
			if (ar[i]==FULLHTML) { if (pf!='ol_') eval(pf+'fullhtml=1'); continue; }
			if (ar[i]==BELOW || ar[i]==ABOVE) { eval(pf+'vpos='+ar[i]); if (pf!='ol_') olVautoFlag=1; continue; }
			if (ar[i]==CAPICON) { eval(pf+'capicon="'+ar[++i]+'"'); continue; }
			if (ar[i]==TEXTFONT) { eval(pf+"textfont='"+escSglQuote(ar[++i])+"'"); continue; }
			if (ar[i]==CAPTIONFONT) { eval(pf+"captionfont='"+escSglQuote(ar[++i])+"'"); continue; }
			if (ar[i]==CLOSEFONT) { eval(pf+"closefont='"+escSglQuote(ar[++i])+"'"); continue; }
			if (ar[i]==TEXTSIZE) { eval(pf+'textsize="'+ar[++i]+'"'); continue; }
			if (ar[i]==CAPTIONSIZE) { eval(pf+'captionsize="'+ar[++i]+'"'); continue; }
			if (ar[i]==CLOSESIZE) { eval(pf+'closesize="'+ar[++i]+'"'); continue; }
			if (ar[i]==TIMEOUT) { eval(pf+'timeout='+ar[++i]); continue; }
			if (ar[i]==FUNCTION) { if (pf=='ol_') { if (typeof ar[i+1]!='number') { v=ar[++i]; ol_function=(typeof v=='function' ? v : null); }} else {fnMark = 0; v = null; if (typeof ar[i+1]!='number') v = ar[++i];  opt_FUNCTION(v); } continue; }
			if (ar[i]==DELAY) { eval(pf+'delay='+ar[++i]); continue; }
			if (ar[i]==HAUTO) { eval(pf+'hauto=('+pf+'hauto == 0) ? 1 : 0'); continue; }
			if (ar[i]==VAUTO) { eval(pf+'vauto=('+pf+'vauto == 0) ? 1 : 0'); continue; }
			if (ar[i]==CLOSECLICK) { eval(pf +'closeclick=('+pf+'closeclick == 0) ? 1 : 0'); continue; }
			if (ar[i]==WRAP) { eval(pf +'wrap=('+pf+'wrap == 0) ? 1 : 0'); continue; }
			if (ar[i]==FOLLOWMOUSE) { eval(pf +'followmouse=('+pf+'followmouse == 1) ? 0 : 1'); continue; }
			if (ar[i]==MOUSEOFF) { eval(pf +'mouseoff=('+pf+'mouseoff==0) ? 1 : 0'); v=ar[i+1]; if (pf != 'ol_' && eval(pf+'mouseoff') && typeof v == 'number' && (v < pmStart || v > pmUpper)) olHideDelay=ar[++i]; continue; }
			if (ar[i]==CLOSETITLE) { eval(pf+"closetitle='"+escSglQuote(ar[++i])+"'"); continue; }
			if (ar[i]==CSSOFF||ar[i]==CSSCLASS) { eval(pf+'css='+ar[i]); continue; }
			if (ar[i]==COMPATMODE) { eval(pf+'compatmode=('+pf+'compatmode==0) ? 1 : 0'); continue; }
			if (ar[i]==FGCLASS) { eval(pf+'fgclass="'+ar[++i]+'"'); continue; }
			if (ar[i]==BGCLASS) { eval(pf+'bgclass="'+ar[++i]+'"'); continue; }
			if (ar[i]==TEXTFONTCLASS) { eval(pf+'textfontclass="'+ar[++i]+'"'); continue; }
			if (ar[i]==CAPTIONFONTCLASS) { eval(pf+'captionfontclass="'+ar[++i]+'"'); continue; }
			if (ar[i]==CLOSEFONTCLASS) { eval(pf+'closefontclass="'+ar[++i]+'"'); continue; }
			i = parseCmdLine(pf, i, ar);
		}
	}

	if (fnMark && o3_function) o3_text = o3_function();
	
	if ((pf == 'o3_') && o3_wrap) {
		o3_width = 0;
		
		var tReg=/<.*\n*>/ig;
		if (!tReg.test(o3_text)) o3_text = o3_text.replace(/[ ]+/g, '&nbsp;');
		if (!tReg.test(o3_cap))o3_cap = o3_cap.replace(/[ ]+/g, '&nbsp;');
	}
	if ((pf == 'o3_') && o3_sticky) {
		if (!o3_close && (o3_frame != ol_frame)) o3_close = ol_close;
		if (o3_mouseoff && (o3_frame == ol_frame)) opt_NOCLOSE(' ');
	}
}


////////
// LAYER FUNCTIONS
////////

// Writes to a layer
function layerWrite(txt) {
	txt += "\n";
	if (olNs4) {
		var lyr = o3_frame.document.layers['overDiv'].document
		lyr.write(txt)
		lyr.close()
	} else if (typeof over.innerHTML != 'undefined') {
		if (olIe5 && isMac) over.innerHTML = '';
		over.innerHTML = txt;
	} else {
		range = o3_frame.document.createRange();
		range.setStartAfter(over);
		domfrag = range.createContextualFragment(txt);
		
		while (over.hasChildNodes()) {
			over.removeChild(over.lastChild);
		}
		
		over.appendChild(domfrag);
	}
}

// Make an object visible
function showObject(obj) {
	runHook("showObject", FBEFORE);

	var theObj=(olNs4 ? obj : obj.style);
	theObj.visibility = 'visible';

	runHook("showObject", FAFTER);
}

// Hides an object
function hideObject(obj) {
	runHook("hideObject", FBEFORE);

	var theObj=(olNs4 ? obj : obj.style);
	if (olNs6 && olShowId>0) { clearTimeout(olShowId); olShowId=0; }
	theObj.visibility = 'hidden';
	theObj.top = theObj.left = ((olIe4&&!olOp) ? 0 : -10000) + (!olNs4 ? 'px' : 0);

	if (o3_timerid > 0) clearTimeout(o3_timerid);
	if (o3_delayid > 0) clearTimeout(o3_delayid);

	o3_timerid = 0;
	o3_delayid = 0;
	self.status = "";

	if (obj.onmouseout||obj.onmouseover) {
		if (olNs4) obj.releaseEvents(Event.MOUSEOUT || Event.MOUSEOVER);
		obj.onmouseout = obj.onmouseover = null;
	}

	runHook("hideObject", FAFTER);
}

// Move a layer
function repositionTo(obj, xL, yL) {
	var theObj=(olNs4 ? obj : obj.style);
	theObj.left = xL + (!olNs4 ? 'px' : 0);
	theObj.top = yL + (!olNs4 ? 'px' : 0);
}

// Check position of cursor relative to overDiv DIVision; mouseOut function
function cursorOff() {
	var left = parseInt(over.style.left);
	var top = parseInt(over.style.top);
	var right = left + (over.offsetWidth >= parseInt(o3_width) ? over.offsetWidth : parseInt(o3_width));
	var bottom = top + (over.offsetHeight >= o3_aboveheight ? over.offsetHeight : o3_aboveheight);

	if (o3_x < left || o3_x > right || o3_y < top || o3_y > bottom) return true;

	return false;
}


////////
// COMMAND FUNCTIONS
////////

// Calls callme or the default function.
function opt_FUNCTION(callme) {
	o3_text = (callme ? (typeof callme=='string' ? (/.+\(.*\)/.test(callme) ? eval(callme) : callme) : callme()) : (o3_function ? o3_function() : 'No Function'));

	return 0;
}

// Handle hovering
function opt_NOCLOSE(unused) {
	if (!unused) o3_close = "";

	if (olNs4) {
		over.captureEvents(Event.MOUSEOUT || Event.MOUSEOVER);
		over.onmouseover = function () { if (o3_timerid > 0) { clearTimeout(o3_timerid); o3_timerid = 0; } }
		over.onmouseout = function (e) { if (olHideDelay) hideDelay(olHideDelay); else cClick(e); }
	} else {
		over.onmouseover = function () {hoveringSwitch = true; if (o3_timerid > 0) { clearTimeout(o3_timerid); o3_timerid =0; } }
	}

	return 0;
}

// Function to scan command line arguments for multiples
function opt_MULTIPLEARGS(i, args, parameter) {
  var k=i, re, pV, str='';

  for(k=i; k<args.length; k++) {
		if(typeof args[k] == 'number' && args[k]>pmStart) break;
		str += args[k] + ',';
	}
	if (str) str = str.substring(0,--str.length);

	k--;  // reduce by one so the for loop this is in works correctly
	pV=(olNs4 && /cellpad/i.test(parameter)) ? str.split(',')[0] : str;
	eval(parameter + '="' + pV + '"');

	return k;
}

// Remove &nbsp; in texts when done.
function nbspCleanup() {
	if (o3_wrap) {
		o3_text = o3_text.replace(/\&nbsp;/g, ' ');
		o3_cap = o3_cap.replace(/\&nbsp;/g, ' ');
	}
}

// Escape embedded single quotes in text strings
function escSglQuote(str) {
  return str.toString().replace(/'/g,"\\'");
}

// Onload handler for window onload event
function OLonLoad_handler(e) {
	var re = /\w+\(.*\)[;\s]+/g, olre = /overlib\(|nd\(|cClick\(/, fn, l, i;

	if(!olLoaded) olLoaded=1;

  // Remove it for Gecko based browsers
	if(window.removeEventListener && e.eventPhase == 3) window.removeEventListener("load",OLonLoad_handler,false);
	else if(window.detachEvent) { // and for IE and Opera 4.x but execute calls to overlib, nd, or cClick()
		window.detachEvent("onload",OLonLoad_handler);
		var fN = document.body.getAttribute('onload');
		if (fN) {
			fN=fN.toString().match(re);
			if (fN && fN.length) {
				for (i=0; i<fN.length; i++) {
					if (/anonymous/.test(fN[i])) continue;
					while((l=fN[i].search(/\)[;\s]+/)) != -1) {
						fn=fN[i].substring(0,l+1);
						fN[i] = fN[i].substring(l+2);
						if (olre.test(fn)) eval(fn);
					}
				}
			}
		}
	}
}

// Wraps strings in Layer Generation Functions with the correct tags
//    endWrap true(if end tag) or false if start tag
//    fontSizeStr - font size string such as '1' or '10px'
//    whichString is being wrapped -- 'text', 'caption', or 'close'
function wrapStr(endWrap,fontSizeStr,whichString) {
	var fontStr, fontColor, isClose=((whichString=='close') ? 1 : 0), hasDims=/[%\-a-z]+$/.test(fontSizeStr);
	fontSizeStr = (olNs4) ? (!hasDims ? fontSizeStr : '1') : fontSizeStr;
	if (endWrap) return (hasDims&&!olNs4) ? (isClose ? '</span>' : '</div>') : '</font>';
	else {
		fontStr='o3_'+whichString+'font';
		fontColor='o3_'+((whichString=='caption')? 'cap' : whichString)+'color';
		return (hasDims&&!olNs4) ? (isClose ? '<span style="font-family: '+quoteMultiNameFonts(eval(fontStr))+'; color: '+eval(fontColor)+'; font-size: '+fontSizeStr+';">' : '<div style="font-family: '+quoteMultiNameFonts(eval(fontStr))+'; color: '+eval(fontColor)+'; font-size: '+fontSizeStr+';">') : '<font face="'+eval(fontStr)+'" color="'+eval(fontColor)+'" size="'+(parseInt(fontSizeStr)>7 ? '7' : fontSizeStr)+'">';
	}
}

// Quotes Multi word font names; needed for CSS Standards adherence in font-family
function quoteMultiNameFonts(theFont) {
	var v, pM=theFont.split(',');
	for (var i=0; i<pM.length; i++) {
		v=pM[i];
		v=v.replace(/^\s+/,'').replace(/\s+$/,'');
		if(/\s/.test(v) && !/['"]/.test(v)) {
			v="\'"+v+"\'";
			pM[i]=v;
		}
	}
	return pM.join();
}

// dummy function which will be overridden 
function isExclusive(args) {
	return false;
}

// Sets cellpadding style string value
function setCellPadStr(parameter) {
	var Str='', j=0, ary = new Array(), top, bottom, left, right;

	Str+='padding: ';
	ary=parameter.replace(/\s+/g,'').split(',');

	switch(ary.length) {
		case 2:
			top=bottom=ary[j];
			left=right=ary[++j];
			break;
		case 3:
			top=ary[j];
			left=right=ary[++j];
			bottom=ary[++j];
			break;
		case 4:
			top=ary[j];
			right=ary[++j];
			bottom=ary[++j];
			left=ary[++j];
			break;
	}

	Str+= ((ary.length==1) ? ary[0] + 'px;' : top + 'px ' + right + 'px ' + bottom + 'px ' + left + 'px;');

	return Str;
}

// function will delay close by time milliseconds
function hideDelay(time) {
	if (time&&!o3_delay) {
		if (o3_timerid > 0) clearTimeout(o3_timerid);

		o3_timerid=setTimeout("cClick()",(o3_timeout=time));
	}
}

// Was originally in the placeLayer() routine; separated out for future ease
function horizontalPlacement(browserWidth, horizontalScrollAmount, widthFix) {
	var placeX, iwidth=browserWidth, winoffset=horizontalScrollAmount;
	var parsedWidth = parseInt(o3_width);

	if (o3_fixx > -1 || o3_relx != null) {
		// Fixed position
		placeX=(o3_relx != null ? ( o3_relx < 0 ? winoffset +o3_relx+ iwidth - parsedWidth - widthFix : winoffset+o3_relx) : o3_fixx);
	} else {  
		// If HAUTO, decide what to use.
		if (o3_hauto == 1) {
			if ((o3_x - winoffset) > (iwidth / 2)) {
				o3_hpos = LEFT;
			} else {
				o3_hpos = RIGHT;
			}
		}  		

		// From mouse
		if (o3_hpos == CENTER) { // Center
			placeX = o3_x+o3_offsetx-(parsedWidth/2);

			if (placeX < winoffset) placeX = winoffset;
		}

		if (o3_hpos == RIGHT) { // Right
			placeX = o3_x+o3_offsetx;

			if ((placeX+parsedWidth) > (winoffset+iwidth - widthFix)) {
				placeX = iwidth+winoffset - parsedWidth - widthFix;
				if (placeX < 0) placeX = 0;
			}
		}
		if (o3_hpos == LEFT) { // Left
			placeX = o3_x-o3_offsetx-parsedWidth;
			if (placeX < winoffset) placeX = winoffset;
		}  	

		// Snapping!
		if (o3_snapx > 1) {
			var snapping = placeX % o3_snapx;

			if (o3_hpos == LEFT) {
				placeX = placeX - (o3_snapx+snapping);
			} else {
				// CENTER and RIGHT
				placeX = placeX+(o3_snapx - snapping);
			}

			if (placeX < winoffset) placeX = winoffset;
		}
	}	

	return placeX;
}

// was originally in the placeLayer() routine; separated out for future ease
function verticalPlacement(browserHeight,verticalScrollAmount) {
	var placeY, iheight=browserHeight, scrolloffset=verticalScrollAmount;
	var parsedHeight=(o3_aboveheight ? parseInt(o3_aboveheight) : (olNs4 ? over.clip.height : over.offsetHeight));

	if (o3_fixy > -1 || o3_rely != null) {
		// Fixed position
		placeY=(o3_rely != null ? (o3_rely < 0 ? scrolloffset+o3_rely+iheight - parsedHeight : scrolloffset+o3_rely) : o3_fixy);
	} else {
		// If VAUTO, decide what to use.
		if (o3_vauto == 1) {
			if ((o3_y - scrolloffset) > (iheight / 2) && o3_vpos == BELOW && (o3_y + parsedHeight + o3_offsety - (scrolloffset + iheight) > 0)) {
				o3_vpos = ABOVE;
			} else if (o3_vpos == ABOVE && (o3_y - (parsedHeight + o3_offsety) - scrolloffset < 0)) {
				o3_vpos = BELOW;
			}
		}

		// From mouse
		if (o3_vpos == ABOVE) {
			if (o3_aboveheight == 0) o3_aboveheight = parsedHeight; 

			placeY = o3_y - (o3_aboveheight+o3_offsety);
			if (placeY < scrolloffset) placeY = scrolloffset;
		} else {
			// BELOW
			placeY = o3_y+o3_offsety;
		} 

		// Snapping!
		if (o3_snapy > 1) {
			var snapping = placeY % o3_snapy;  			

			if (o3_aboveheight > 0 && o3_vpos == ABOVE) {
				placeY = placeY - (o3_snapy+snapping);
			} else {
				placeY = placeY+(o3_snapy - snapping);
			} 			

			if (placeY < scrolloffset) placeY = scrolloffset;
		}
	}

	return placeY;
}

// checks positioning flags
function checkPositionFlags() {
	if (olHautoFlag) olHautoFlag = o3_hauto=0;
	if (olVautoFlag) olVautoFlag = o3_vauto=0;
	return true;
}

// get Browser window width
function windowWidth() {
	var w;
	if (o3_frame.innerWidth) w=o3_frame.innerWidth;
	else if (eval('o3_frame.'+docRoot)&&eval("typeof o3_frame."+docRoot+".clientWidth=='number'")&&eval('o3_frame.'+docRoot+'.clientWidth')) 
		w=eval('o3_frame.'+docRoot+'.clientWidth');
	return w;			
}

// create the div container for popup content if it doesn't exist
function createDivContainer(id,frm,zValue) {
	id = (id || 'overDiv'), frm = (frm || o3_frame), zValue = (zValue || 1000);
	var objRef, divContainer = layerReference(id);

	if (divContainer == null) {
		if (olNs4) {
			divContainer = frm.document.layers[id] = new Layer(window.innerWidth, frm);
			objRef = divContainer;
		} else {
			var body = (olIe4 ? frm.document.all.tags('BODY')[0] : frm.document.getElementsByTagName("BODY")[0]);
			if (olIe4&&!document.getElementById) {
				body.insertAdjacentHTML("beforeEnd",'<div id="'+id+'"></div>');
				divContainer=layerReference(id);
			} else {
				divContainer = frm.document.createElement("DIV");
				divContainer.id = id;
				body.appendChild(divContainer);
			}
			objRef = divContainer.style;
		}

		objRef.position = 'absolute';
		objRef.visibility = 'hidden';
		objRef.zIndex = zValue;
		if (olIe4&&!olOp) objRef.left = objRef.top = '0px';
		else objRef.left = objRef.top =  -10000 + (!olNs4 ? 'px' : 0);
	}

	return divContainer;
}

// get reference to a layer with ID=id
function layerReference(id) {
	return (olNs4 ? o3_frame.document.layers[id] : (document.all ? o3_frame.document.all[id] : o3_frame.document.getElementById(id)));
}
////////
//  UTILITY FUNCTIONS
////////

// Checks if something is a function.
function isFunction(fnRef) {
	var rtn = true;

	if (typeof fnRef == 'object') {
		for (var i = 0; i < fnRef.length; i++) {
			if (typeof fnRef[i]=='function') continue;
			rtn = false;
			break;
		}
	} else if (typeof fnRef != 'function') {
		rtn = false;
	}
	
	return rtn;
}

// Converts an array into an argument string for use in eval.
function argToString(array, strtInd, argName) {
	var jS = strtInd, aS = '', ar = array;
	argName=(argName ? argName : 'ar');
	
	if (ar.length > jS) {
		for (var k = jS; k < ar.length; k++) aS += argName+'['+k+'], ';
		aS = aS.substring(0, aS.length-2);
	}
	
	return aS;
}

// Places a hook in the correct position in a hook point.
function reOrder(hookPt, fnRef, order) {
	var newPt = new Array(), match, i, j;

	if (!order || typeof order == 'undefined' || typeof order == 'number') return hookPt;
	
	if (typeof order=='function') {
		if (typeof fnRef=='object') {
			newPt = newPt.concat(fnRef);
		} else {
			newPt[newPt.length++]=fnRef;
		}
		
		for (i = 0; i < hookPt.length; i++) {
			match = false;
			if (typeof fnRef == 'function' && hookPt[i] == fnRef) {
				continue;
			} else {
				for(j = 0; j < fnRef.length; j++) if (hookPt[i] == fnRef[j]) {
					match = true;
					break;
				}
			}
			if (!match) newPt[newPt.length++] = hookPt[i];
		}

		newPt[newPt.length++] = order;

	} else if (typeof order == 'object') {
		if (typeof fnRef == 'object') {
			newPt = newPt.concat(fnRef);
		} else {
			newPt[newPt.length++] = fnRef;
		}
		
		for (j = 0; j < hookPt.length; j++) {
			match = false;
			if (typeof fnRef == 'function' && hookPt[j] == fnRef) {
				continue;
			} else {
				for (i = 0; i < fnRef.length; i++) if (hookPt[j] == fnRef[i]) {
					match = true;
					break;
				}
			}
			if (!match) newPt[newPt.length++]=hookPt[j];
		}

		for (i = 0; i < newPt.length; i++) hookPt[i] = newPt[i];
		newPt.length = 0;
		
		for (j = 0; j < hookPt.length; j++) {
			match = false;
			for (i = 0; i < order.length; i++) {
				if (hookPt[j] == order[i]) {
					match = true;
					break;
				}
			}
			if (!match) newPt[newPt.length++] = hookPt[j];
		}
		newPt = newPt.concat(order);
	}

	hookPt = newPt;

	return hookPt;
}

////////
//  PLUGIN ACTIVATION FUNCTIONS
////////

// Runs plugin functions to set runtime variables.
function setRunTimeVariables(){
	if (typeof runTime != 'undefined' && runTime.length) {
		for (var k = 0; k < runTime.length; k++) {
			runTime[k]();
		}
	}
}

// Runs plugin functions to parse commands.
function parseCmdLine(pf, i, args) {
	if (typeof cmdLine != 'undefined' && cmdLine.length) { 
		for (var k = 0; k < cmdLine.length; k++) { 
			var j = cmdLine[k](pf, i, args);
			if (j >- 1) {
				i = j;
				break;
			}
		}
	}

	return i;
}

// Runs plugin functions to do things after parse.
function postParseChecks(pf,args){
	if (typeof postParse != 'undefined' && postParse.length) {
		for (var k = 0; k < postParse.length; k++) {
			if (postParse[k](pf,args)) continue;
			return false;  // end now since have an error
		}
	}
	return true;
}


////////
//  PLUGIN REGISTRATION FUNCTIONS
////////

// Registers commands and creates constants.
function registerCommands(cmdStr) {
	if (typeof cmdStr!='string') return;

	var pM = cmdStr.split(',');
	pms = pms.concat(pM);

	for (var i = 0; i< pM.length; i++) {
		eval(pM[i].toUpperCase()+'='+pmCount++);
	}
}

// Registers no-parameter commands
function registerNoParameterCommands(cmdStr) {
	if (!cmdStr && typeof cmdStr != 'string') return;
	pmt=(!pmt) ? cmdStr : pmt + ',' + cmdStr;
}

// Register a function to hook at a certain point.
function registerHook(fnHookTo, fnRef, hookType, optPm) {
	var hookPt, last = typeof optPm;
	
	if (fnHookTo == 'plgIn'||fnHookTo == 'postParse') return;
	if (typeof hookPts[fnHookTo] == 'undefined') hookPts[fnHookTo] = new FunctionReference();

	hookPt = hookPts[fnHookTo];

	if (hookType != null) {
		if (hookType == FREPLACE) {
			hookPt.ovload = fnRef;  // replace normal overlib routine
			if (fnHookTo.indexOf('ol_content_') > -1) hookPt.alt[pms[CSSOFF-1-pmStart]]=fnRef; 

		} else if (hookType == FBEFORE || hookType == FAFTER) {
			var hookPt=(hookType == 1 ? hookPt.before : hookPt.after);

			if (typeof fnRef == 'object') {
				hookPt = hookPt.concat(fnRef);
			} else {
				hookPt[hookPt.length++] = fnRef;
			}

			if (optPm) hookPt = reOrder(hookPt, fnRef, optPm);

		} else if (hookType == FALTERNATE) {
			if (last=='number') hookPt.alt[pms[optPm-1-pmStart]] = fnRef;
		} else if (hookType == FCHAIN) {
			hookPt = hookPt.chain; 
			if (typeof fnRef=='object') hookPt=hookPt.concat(fnRef); // add other functions 
			else hookPt[hookPt.length++]=fnRef;
		}

		return;
	}
}

// Register a function that will set runtime variables.
function registerRunTimeFunction(fn) {
	if (isFunction(fn)) {
		if (typeof fn == 'object') {
			runTime = runTime.concat(fn);
		} else {
			runTime[runTime.length++] = fn;
		}
	}
}

// Register a function that will handle command parsing.
function registerCmdLineFunction(fn){
	if (isFunction(fn)) {
		if (typeof fn == 'object') {
			cmdLine = cmdLine.concat(fn);
		} else {
			cmdLine[cmdLine.length++] = fn;
		}
	}
}

// Register a function that does things after command parsing. 
function registerPostParseFunction(fn){
	if (isFunction(fn)) {
		if (typeof fn == 'object') {
			postParse = postParse.concat(fn);
		} else {
			postParse[postParse.length++] = fn;
		}
	}
}

////////
//  PLUGIN REGISTRATION FUNCTIONS
////////

// Runs any hooks registered.
function runHook(fnHookTo, hookType) {
	var l = hookPts[fnHookTo], k, rtnVal = null, optPm, arS, ar = runHook.arguments;

	if (hookType == FREPLACE) {
		arS = argToString(ar, 2);

		if (typeof l == 'undefined' || !(l = l.ovload)) rtnVal = eval(fnHookTo+'('+arS+')');
		else rtnVal = eval('l('+arS+')');

	} else if (hookType == FBEFORE || hookType == FAFTER) {
		if (typeof l != 'undefined') {
			l=(hookType == 1 ? l.before : l.after);
	
			if (l.length) {
				arS = argToString(ar, 2);
				for (var k = 0; k < l.length; k++) eval('l[k]('+arS+')');
			}
		}
	} else if (hookType == FALTERNATE) {
		optPm = ar[2];
		arS = argToString(ar, 3);

		if (typeof l == 'undefined' || (l = l.alt[pms[optPm-1-pmStart]]) == 'undefined') {
			rtnVal = eval(fnHookTo+'('+arS+')');
		} else {
			rtnVal = eval('l('+arS+')');
		}
	} else if (hookType == FCHAIN) {
		arS=argToString(ar,2);
		l=l.chain;

		for (k=l.length; k > 0; k--) if((rtnVal=eval('l[k-1]('+arS+')'))!=void(0)) break;
	}

	return rtnVal;
}

////////
// OBJECT CONSTRUCTORS
////////

// Object for handling hooks.
function FunctionReference() {
	this.ovload = null;
	this.before = new Array();
	this.after = new Array();
	this.alt = new Array();
	this.chain = new Array();
}

// Object for simple access to the overLIB version used.
// Examples: simpleversion:351 major:3 minor:5 revision:1
function Info(version, prerelease) {
	this.version = version;
	this.prerelease = prerelease;

	this.simpleversion = Math.round(this.version*100);
	this.major = parseInt(this.simpleversion / 100);
	this.minor = parseInt(this.simpleversion / 10) - this.major * 10;
	this.revision = parseInt(this.simpleversion) - this.major * 100 - this.minor * 10;
	this.meets = meets;
}

// checks for Core Version required
function meets(reqdVersion) {
	return (!reqdVersion) ? false : this.simpleversion >= Math.round(100*parseFloat(reqdVersion));
}


////////
// STANDARD REGISTRATIONS
////////
registerHook("ol_content_simple", ol_content_simple, FALTERNATE, CSSOFF);
registerHook("ol_content_caption", ol_content_caption, FALTERNATE, CSSOFF);
registerHook("ol_content_background", ol_content_background, FALTERNATE, CSSOFF);
registerHook("ol_content_simple", ol_content_simple, FALTERNATE, CSSCLASS);
registerHook("ol_content_caption", ol_content_caption, FALTERNATE, CSSCLASS);
registerHook("ol_content_background", ol_content_background, FALTERNATE, CSSCLASS);
registerPostParseFunction(checkPositionFlags);
registerHook("hideObject", nbspCleanup, FAFTER);
registerHook("horizontalPlacement", horizontalPlacement, FCHAIN);
registerHook("verticalPlacement", verticalPlacement, FCHAIN);
if (olNs4||(olIe5&&isMac)||olKq) olLoaded=1;
registerNoParameterCommands('sticky,autostatus,autostatuscap,fullhtml,hauto,vauto,closeclick,wrap,followmouse,mouseoff,compatmode');
///////
// ESTABLISH MOUSECAPTURING
///////

// Capture events, alt. diffuses the overlib function.
var olCheckMouseCapture=true;
if ((olNs4 || olNs6 || olIe4)) {
	olMouseCapture();
} else {
	overlib = no_overlib;
	nd = no_overlib;
	ver3fix = true;
}


/* jquery/jquery.js */

/*!
 * jQuery JavaScript Library v1.4.1
 * http://jquery.com/
 *
 * Copyright 2010, John Resig
 * Dual licensed under the MIT or GPL Version 2 licenses.
 * http://jquery.org/license
 *
 * Includes Sizzle.js
 * http://sizzlejs.com/
 * Copyright 2010, The Dojo Foundation
 * Released under the MIT, BSD, and GPL Licenses.
 *
 * Date: Mon Jan 25 19:43:33 2010 -0500
 */
(function(z,v){function la(){if(!c.isReady){try{r.documentElement.doScroll("left")}catch(a){setTimeout(la,1);return}c.ready()}}function Ma(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function X(a,b,d,f,e,i){var j=a.length;if(typeof b==="object"){for(var n in b)X(a,n,b[n],f,e,d);return a}if(d!==v){f=!i&&f&&c.isFunction(d);for(n=0;n<j;n++)e(a[n],b,f?d.call(a[n],n,e(a[n],b)):d,i);return a}return j?
e(a[0],b):null}function J(){return(new Date).getTime()}function Y(){return false}function Z(){return true}function ma(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function na(a){var b,d=[],f=[],e=arguments,i,j,n,o,m,s,x=c.extend({},c.data(this,"events").live);if(!(a.button&&a.type==="click")){for(o in x){j=x[o];if(j.live===a.type||j.altLive&&c.inArray(a.type,j.altLive)>-1){i=j.data;i.beforeFilter&&i.beforeFilter[a.type]&&!i.beforeFilter[a.type](a)||f.push(j.selector)}else delete x[o]}i=c(a.target).closest(f,
a.currentTarget);m=0;for(s=i.length;m<s;m++)for(o in x){j=x[o];n=i[m].elem;f=null;if(i[m].selector===j.selector){if(j.live==="mouseenter"||j.live==="mouseleave")f=c(a.relatedTarget).closest(j.selector)[0];if(!f||f!==n)d.push({elem:n,fn:j})}}m=0;for(s=d.length;m<s;m++){i=d[m];a.currentTarget=i.elem;a.data=i.fn.data;if(i.fn.apply(i.elem,e)===false){b=false;break}}return b}}function oa(a,b){return"live."+(a?a+".":"")+b.replace(/\./g,"`").replace(/ /g,"&")}function pa(a){return!a||!a.parentNode||a.parentNode.nodeType===
11}function qa(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var f=c.data(a[d++]),e=c.data(this,f);if(f=f&&f.events){delete e.handle;e.events={};for(var i in f)for(var j in f[i])c.event.add(this,i,f[i][j],f[i][j].data)}}})}function ra(a,b,d){var f,e,i;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&a[0].indexOf("<option")<0&&(c.support.checkClone||!sa.test(a[0]))){e=true;if(i=c.fragments[a[0]])if(i!==1)f=i}if(!f){b=b&&b[0]?b[0].ownerDocument||b[0]:r;f=b.createDocumentFragment();
c.clean(a,b,f,d)}if(e)c.fragments[a[0]]=i?f:1;return{fragment:f,cacheable:e}}function K(a,b){var d={};c.each(ta.concat.apply([],ta.slice(0,b)),function(){d[this]=a});return d}function ua(a){return"scrollTo"in a&&a.document?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var c=function(a,b){return new c.fn.init(a,b)},Na=z.jQuery,Oa=z.$,r=z.document,S,Pa=/^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,Qa=/^.[^:#\[\.,]*$/,Ra=/\S/,Sa=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,Ta=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,O=navigator.userAgent,
va=false,P=[],L,$=Object.prototype.toString,aa=Object.prototype.hasOwnProperty,ba=Array.prototype.push,Q=Array.prototype.slice,wa=Array.prototype.indexOf;c.fn=c.prototype={init:function(a,b){var d,f;if(!a)return this;if(a.nodeType){this.context=this[0]=a;this.length=1;return this}if(typeof a==="string")if((d=Pa.exec(a))&&(d[1]||!b))if(d[1]){f=b?b.ownerDocument||b:r;if(a=Ta.exec(a))if(c.isPlainObject(b)){a=[r.createElement(a[1])];c.fn.attr.call(a,b,true)}else a=[f.createElement(a[1])];else{a=ra([d[1]],
[f]);a=(a.cacheable?a.fragment.cloneNode(true):a.fragment).childNodes}}else{if(b=r.getElementById(d[2])){if(b.id!==d[2])return S.find(a);this.length=1;this[0]=b}this.context=r;this.selector=a;return this}else if(!b&&/^\w+$/.test(a)){this.selector=a;this.context=r;a=r.getElementsByTagName(a)}else return!b||b.jquery?(b||S).find(a):c(b).find(a);else if(c.isFunction(a))return S.ready(a);if(a.selector!==v){this.selector=a.selector;this.context=a.context}return c.isArray(a)?this.setArray(a):c.makeArray(a,
this)},selector:"",jquery:"1.4.1",length:0,size:function(){return this.length},toArray:function(){return Q.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this.slice(a)[0]:this[a]},pushStack:function(a,b,d){a=c(a||null);a.prevObject=this;a.context=this.context;if(b==="find")a.selector=this.selector+(this.selector?" ":"")+d;else if(b)a.selector=this.selector+"."+b+"("+d+")";return a},setArray:function(a){this.length=0;ba.apply(this,a);return this},each:function(a,b){return c.each(this,
a,b)},ready:function(a){c.bindReady();if(c.isReady)a.call(r,c);else P&&P.push(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(Q.apply(this,arguments),"slice",Q.call(arguments).join(","))},map:function(a){return this.pushStack(c.map(this,function(b,d){return a.call(b,d,b)}))},end:function(){return this.prevObject||c(null)},push:ba,sort:[].sort,splice:[].splice};
c.fn.init.prototype=c.fn;c.extend=c.fn.extend=function(){var a=arguments[0]||{},b=1,d=arguments.length,f=false,e,i,j,n;if(typeof a==="boolean"){f=a;a=arguments[1]||{};b=2}if(typeof a!=="object"&&!c.isFunction(a))a={};if(d===b){a=this;--b}for(;b<d;b++)if((e=arguments[b])!=null)for(i in e){j=a[i];n=e[i];if(a!==n)if(f&&n&&(c.isPlainObject(n)||c.isArray(n))){j=j&&(c.isPlainObject(j)||c.isArray(j))?j:c.isArray(n)?[]:{};a[i]=c.extend(f,j,n)}else if(n!==v)a[i]=n}return a};c.extend({noConflict:function(a){z.$=
Oa;if(a)z.jQuery=Na;return c},isReady:false,ready:function(){if(!c.isReady){if(!r.body)return setTimeout(c.ready,13);c.isReady=true;if(P){for(var a,b=0;a=P[b++];)a.call(r,c);P=null}c.fn.triggerHandler&&c(r).triggerHandler("ready")}},bindReady:function(){if(!va){va=true;if(r.readyState==="complete")return c.ready();if(r.addEventListener){r.addEventListener("DOMContentLoaded",L,false);z.addEventListener("load",c.ready,false)}else if(r.attachEvent){r.attachEvent("onreadystatechange",L);z.attachEvent("onload",
c.ready);var a=false;try{a=z.frameElement==null}catch(b){}r.documentElement.doScroll&&a&&la()}}},isFunction:function(a){return $.call(a)==="[object Function]"},isArray:function(a){return $.call(a)==="[object Array]"},isPlainObject:function(a){if(!a||$.call(a)!=="[object Object]"||a.nodeType||a.setInterval)return false;if(a.constructor&&!aa.call(a,"constructor")&&!aa.call(a.constructor.prototype,"isPrototypeOf"))return false;var b;for(b in a);return b===v||aa.call(a,b)},isEmptyObject:function(a){for(var b in a)return false;
return true},error:function(a){throw a;},parseJSON:function(a){if(typeof a!=="string"||!a)return null;if(/^[\],:{}\s]*$/.test(a.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"")))return z.JSON&&z.JSON.parse?z.JSON.parse(a):(new Function("return "+a))();else c.error("Invalid JSON: "+a)},noop:function(){},globalEval:function(a){if(a&&Ra.test(a)){var b=r.getElementsByTagName("head")[0]||
r.documentElement,d=r.createElement("script");d.type="text/javascript";if(c.support.scriptEval)d.appendChild(r.createTextNode(a));else d.text=a;b.insertBefore(d,b.firstChild);b.removeChild(d)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,b,d){var f,e=0,i=a.length,j=i===v||c.isFunction(a);if(d)if(j)for(f in a){if(b.apply(a[f],d)===false)break}else for(;e<i;){if(b.apply(a[e++],d)===false)break}else if(j)for(f in a){if(b.call(a[f],f,a[f])===false)break}else for(d=
a[0];e<i&&b.call(d,e,d)!==false;d=a[++e]);return a},trim:function(a){return(a||"").replace(Sa,"")},makeArray:function(a,b){b=b||[];if(a!=null)a.length==null||typeof a==="string"||c.isFunction(a)||typeof a!=="function"&&a.setInterval?ba.call(b,a):c.merge(b,a);return b},inArray:function(a,b){if(b.indexOf)return b.indexOf(a);for(var d=0,f=b.length;d<f;d++)if(b[d]===a)return d;return-1},merge:function(a,b){var d=a.length,f=0;if(typeof b.length==="number")for(var e=b.length;f<e;f++)a[d++]=b[f];else for(;b[f]!==
v;)a[d++]=b[f++];a.length=d;return a},grep:function(a,b,d){for(var f=[],e=0,i=a.length;e<i;e++)!d!==!b(a[e],e)&&f.push(a[e]);return f},map:function(a,b,d){for(var f=[],e,i=0,j=a.length;i<j;i++){e=b(a[i],i,d);if(e!=null)f[f.length]=e}return f.concat.apply([],f)},guid:1,proxy:function(a,b,d){if(arguments.length===2)if(typeof b==="string"){d=a;a=d[b];b=v}else if(b&&!c.isFunction(b)){d=b;b=v}if(!b&&a)b=function(){return a.apply(d||this,arguments)};if(a)b.guid=a.guid=a.guid||b.guid||c.guid++;return b},
uaMatch:function(a){a=a.toLowerCase();a=/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version)?[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||!/compatible/.test(a)&&/(mozilla)(?:.*? rv:([\w.]+))?/.exec(a)||[];return{browser:a[1]||"",version:a[2]||"0"}},browser:{}});O=c.uaMatch(O);if(O.browser){c.browser[O.browser]=true;c.browser.version=O.version}if(c.browser.webkit)c.browser.safari=true;if(wa)c.inArray=function(a,b){return wa.call(b,a)};S=c(r);if(r.addEventListener)L=function(){r.removeEventListener("DOMContentLoaded",
L,false);c.ready()};else if(r.attachEvent)L=function(){if(r.readyState==="complete"){r.detachEvent("onreadystatechange",L);c.ready()}};(function(){c.support={};var a=r.documentElement,b=r.createElement("script"),d=r.createElement("div"),f="script"+J();d.style.display="none";d.innerHTML="   <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";var e=d.getElementsByTagName("*"),i=d.getElementsByTagName("a")[0];if(!(!e||!e.length||!i)){c.support=
{leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(i.getAttribute("style")),hrefNormalized:i.getAttribute("href")==="/a",opacity:/^0.55$/.test(i.style.opacity),cssFloat:!!i.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:r.createElement("select").appendChild(r.createElement("option")).selected,checkClone:false,scriptEval:false,noCloneEvent:true,boxModel:null};
b.type="text/javascript";try{b.appendChild(r.createTextNode("window."+f+"=1;"))}catch(j){}a.insertBefore(b,a.firstChild);if(z[f]){c.support.scriptEval=true;delete z[f]}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function n(){c.support.noCloneEvent=false;d.detachEvent("onclick",n)});d.cloneNode(true).fireEvent("onclick")}d=r.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=r.createDocumentFragment();a.appendChild(d.firstChild);
c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var n=r.createElement("div");n.style.width=n.style.paddingLeft="1px";r.body.appendChild(n);c.boxModel=c.support.boxModel=n.offsetWidth===2;r.body.removeChild(n).style.display="none"});a=function(n){var o=r.createElement("div");n="on"+n;var m=n in o;if(!m){o.setAttribute(n,"return;");m=typeof o[n]==="function"}return m};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=e=i=null}})();c.props=
{"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};var G="jQuery"+J(),Ua=0,xa={},Va={};c.extend({cache:{},expando:G,noData:{embed:true,object:true,applet:true},data:function(a,b,d){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==z?xa:a;var f=a[G],e=c.cache;if(!b&&!f)return null;f||(f=++Ua);if(typeof b==="object"){a[G]=f;e=e[f]=c.extend(true,
{},b)}else e=e[f]?e[f]:typeof d==="undefined"?Va:(e[f]={});if(d!==v){a[G]=f;e[b]=d}return typeof b==="string"?e[b]:e}},removeData:function(a,b){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==z?xa:a;var d=a[G],f=c.cache,e=f[d];if(b){if(e){delete e[b];c.isEmptyObject(e)&&c.removeData(a)}}else{try{delete a[G]}catch(i){a.removeAttribute&&a.removeAttribute(G)}delete f[d]}}}});c.fn.extend({data:function(a,b){if(typeof a==="undefined"&&this.length)return c.data(this[0]);else if(typeof a==="object")return this.each(function(){c.data(this,
a)});var d=a.split(".");d[1]=d[1]?"."+d[1]:"";if(b===v){var f=this.triggerHandler("getData"+d[1]+"!",[d[0]]);if(f===v&&this.length)f=c.data(this[0],a);return f===v&&d[1]?this.data(d[0]):f}else return this.trigger("setData"+d[1]+"!",[d[0],b]).each(function(){c.data(this,a,b)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var f=c.data(a,b);if(!d)return f||[];if(!f||c.isArray(d))f=c.data(a,b,c.makeArray(d));else f.push(d);
return f}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),f=d.shift();if(f==="inprogress")f=d.shift();if(f){b==="fx"&&d.unshift("inprogress");f.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===v)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this,a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||
a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var ya=/[\n\t]/g,ca=/\s+/,Wa=/\r/g,Xa=/href|src|style/,Ya=/(button|input)/i,Za=/(button|input|object|select|textarea)/i,$a=/^(a|area)$/i,za=/radio|checkbox/;c.fn.extend({attr:function(a,b){return X(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(o){var m=
c(this);m.addClass(a.call(this,o,m.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1)if(e.className)for(var i=" "+e.className+" ",j=0,n=b.length;j<n;j++){if(i.indexOf(" "+b[j]+" ")<0)e.className+=" "+b[j]}else e.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(o){var m=c(this);m.removeClass(a.call(this,o,m.attr("class")))});if(a&&typeof a==="string"||a===v)for(var b=(a||"").split(ca),
d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1&&e.className)if(a){for(var i=(" "+e.className+" ").replace(ya," "),j=0,n=b.length;j<n;j++)i=i.replace(" "+b[j]+" "," ");e.className=i.substring(1,i.length-1)}else e.className=""}return this},toggleClass:function(a,b){var d=typeof a,f=typeof b==="boolean";if(c.isFunction(a))return this.each(function(e){var i=c(this);i.toggleClass(a.call(this,e,i.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var e,i=0,j=c(this),n=b,o=
a.split(ca);e=o[i++];){n=f?n:!j.hasClass(e);j[n?"addClass":"removeClass"](e)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this,"__className__",this.className);this.className=this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(ya," ").indexOf(a)>-1)return true;return false},val:function(a){if(a===v){var b=this[0];if(b){if(c.nodeName(b,"option"))return(b.attributes.value||
{}).specified?b.value:b.text;if(c.nodeName(b,"select")){var d=b.selectedIndex,f=[],e=b.options;b=b.type==="select-one";if(d<0)return null;var i=b?d:0;for(d=b?d+1:e.length;i<d;i++){var j=e[i];if(j.selected){a=c(j).val();if(b)return a;f.push(a)}}return f}if(za.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Wa,"")}return v}var n=c.isFunction(a);return this.each(function(o){var m=c(this),s=a;if(this.nodeType===1){if(n)s=a.call(this,o,m.val());
if(typeof s==="number")s+="";if(c.isArray(s)&&za.test(this.type))this.checked=c.inArray(m.val(),s)>=0;else if(c.nodeName(this,"select")){var x=c.makeArray(s);c("option",this).each(function(){this.selected=c.inArray(c(this).val(),x)>=0});if(!x.length)this.selectedIndex=-1}else this.value=s}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(a,b,d,f){if(!a||a.nodeType===3||a.nodeType===8)return v;if(f&&b in c.attrFn)return c(a)[b](d);
f=a.nodeType!==1||!c.isXMLDoc(a);var e=d!==v;b=f&&c.props[b]||b;if(a.nodeType===1){var i=Xa.test(b);if(b in a&&f&&!i){if(e){b==="type"&&Ya.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&&b.specified?b.value:Za.test(a.nodeName)||$a.test(a.nodeName)&&a.href?0:v;return a[b]}if(!c.support.style&&f&&b==="style"){if(e)a.style.cssText=
""+d;return a.style.cssText}e&&a.setAttribute(b,""+d);a=!c.support.hrefNormalized&&f&&i?a.getAttribute(b,2):a.getAttribute(b);return a===null?v:a}return c.style(a,b,d)}});var ab=function(a){return a.replace(/[^\w\s\.\|`]/g,function(b){return"\\"+b})};c.event={add:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){if(a.setInterval&&a!==z&&!a.frameElement)a=z;if(!d.guid)d.guid=c.guid++;if(f!==v){d=c.proxy(d);d.data=f}var e=c.data(a,"events")||c.data(a,"events",{}),i=c.data(a,"handle"),j;if(!i){j=
function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(j.elem,arguments):v};i=c.data(a,"handle",j)}if(i){i.elem=a;b=b.split(/\s+/);for(var n,o=0;n=b[o++];){var m=n.split(".");n=m.shift();if(o>1){d=c.proxy(d);if(f!==v)d.data=f}d.type=m.slice(0).sort().join(".");var s=e[n],x=this.special[n]||{};if(!s){s=e[n]={};if(!x.setup||x.setup.call(a,f,m,d)===false)if(a.addEventListener)a.addEventListener(n,i,false);else a.attachEvent&&a.attachEvent("on"+n,i)}if(x.add)if((m=x.add.call(a,
d,f,m,s))&&c.isFunction(m)){m.guid=m.guid||d.guid;m.data=m.data||d.data;m.type=m.type||d.type;d=m}s[d.guid]=d;this.global[n]=true}a=null}}},global:{},remove:function(a,b,d){if(!(a.nodeType===3||a.nodeType===8)){var f=c.data(a,"events"),e,i,j;if(f){if(b===v||typeof b==="string"&&b.charAt(0)===".")for(i in f)this.remove(a,i+(b||""));else{if(b.type){d=b.handler;b=b.type}b=b.split(/\s+/);for(var n=0;i=b[n++];){var o=i.split(".");i=o.shift();var m=!o.length,s=c.map(o.slice(0).sort(),ab);s=new RegExp("(^|\\.)"+
s.join("\\.(?:.*\\.)?")+"(\\.|$)");var x=this.special[i]||{};if(f[i]){if(d){j=f[i][d.guid];delete f[i][d.guid]}else for(var A in f[i])if(m||s.test(f[i][A].type))delete f[i][A];x.remove&&x.remove.call(a,o,j);for(e in f[i])break;if(!e){if(!x.teardown||x.teardown.call(a,o)===false)if(a.removeEventListener)a.removeEventListener(i,c.data(a,"handle"),false);else a.detachEvent&&a.detachEvent("on"+i,c.data(a,"handle"));e=null;delete f[i]}}}}for(e in f)break;if(!e){if(A=c.data(a,"handle"))A.elem=null;c.removeData(a,
"events");c.removeData(a,"handle")}}}},trigger:function(a,b,d,f){var e=a.type||a;if(!f){a=typeof a==="object"?a[G]?a:c.extend(c.Event(e),a):c.Event(e);if(e.indexOf("!")>=0){a.type=e=e.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();this.global[e]&&c.each(c.cache,function(){this.events&&this.events[e]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType===8)return v;a.result=v;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(f=c.data(d,"handle"))&&f.apply(d,
b);f=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+e]&&d["on"+e].apply(d,b)===false)a.result=false}catch(i){}if(!a.isPropagationStopped()&&f)c.event.trigger(a,b,f,true);else if(!a.isDefaultPrevented()){d=a.target;var j;if(!(c.nodeName(d,"a")&&e==="click")&&!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()])){try{if(d[e]){if(j=d["on"+e])d["on"+e]=null;this.triggered=true;d[e]()}}catch(n){}if(j)d["on"+e]=j;this.triggered=false}}},handle:function(a){var b,
d;a=arguments[0]=c.event.fix(a||z.event);a.currentTarget=this;d=a.type.split(".");a.type=d.shift();b=!d.length&&!a.exclusive;var f=new RegExp("(^|\\.)"+d.slice(0).sort().join("\\.(?:.*\\.)?")+"(\\.|$)");d=(c.data(this,"events")||{})[a.type];for(var e in d){var i=d[e];if(b||f.test(i.type)){a.handler=i;a.data=i.data;i=i.apply(this,arguments);if(i!==v){a.result=i;if(i===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
fix:function(a){if(a[G])return a;var b=a;a=c.Event(b);for(var d=this.props.length,f;d;){f=this.props[--d];a[f]=b[f]}if(!a.target)a.target=a.srcElement||r;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=r.documentElement;d=r.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop||
d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(!a.which&&(a.charCode||a.charCode===0?a.charCode:a.keyCode))a.which=a.charCode||a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==v)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a,b){c.extend(a,b||{});a.guid+=b.selector+b.live;b.liveProxy=a;c.event.add(this,b.live,na,b)},remove:function(a){if(a.length){var b=
0,d=new RegExp("(^|\\.)"+a[0]+"(\\.|$)");c.each(c.data(this,"events").live||{},function(){d.test(this.type)&&b++});b<1&&c.event.remove(this,a[0],na)}},special:{}},beforeunload:{setup:function(a,b,d){if(this.setInterval)this.onbeforeunload=d;return false},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=a;this.type=a.type}else this.type=a;this.timeStamp=J();this[G]=true};
c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=Z;var a=this.originalEvent;if(a){a.preventDefault&&a.preventDefault();a.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=Z;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=Z;this.stopPropagation()},isDefaultPrevented:Y,isPropagationStopped:Y,isImmediatePropagationStopped:Y};var Aa=function(a){for(var b=
a.relatedTarget;b&&b!==this;)try{b=b.parentNode}catch(d){break}if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}},Ba=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?Ba:Aa,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?Ba:Aa)}}});if(!c.support.submitBubbles)c.event.special.submit={setup:function(a,b,d){if(this.nodeName.toLowerCase()!==
"form"){c.event.add(this,"click.specialSubmit."+d.guid,function(f){var e=f.target,i=e.type;if((i==="submit"||i==="image")&&c(e).closest("form").length)return ma("submit",this,arguments)});c.event.add(this,"keypress.specialSubmit."+d.guid,function(f){var e=f.target,i=e.type;if((i==="text"||i==="password")&&c(e).closest("form").length&&f.keyCode===13)return ma("submit",this,arguments)})}else return false},remove:function(a,b){c.event.remove(this,"click.specialSubmit"+(b?"."+b.guid:""));c.event.remove(this,
"keypress.specialSubmit"+(b?"."+b.guid:""))}};if(!c.support.changeBubbles){var da=/textarea|input|select/i;function Ca(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(f){return f.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d}function ea(a,b){var d=a.target,f,e;if(!(!da.test(d.nodeName)||d.readOnly)){f=c.data(d,"_change_data");e=Ca(d);if(a.type!=="focusout"||
d.type!=="radio")c.data(d,"_change_data",e);if(!(f===v||e===f))if(f!=null||e){a.type="change";return c.event.trigger(a,b,d)}}}c.event.special.change={filters:{focusout:ea,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return ea.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return ea.call(this,a)},beforeactivate:function(a){a=
a.target;a.nodeName.toLowerCase()==="input"&&a.type==="radio"&&c.data(a,"_change_data",Ca(a))}},setup:function(a,b,d){for(var f in T)c.event.add(this,f+".specialChange."+d.guid,T[f]);return da.test(this.nodeName)},remove:function(a,b){for(var d in T)c.event.remove(this,d+".specialChange"+(b?"."+b.guid:""),T[d]);return da.test(this.nodeName)}};var T=c.event.special.change.filters}r.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(f){f=c.event.fix(f);f.type=b;return c.event.handle.call(this,
f)}c.event.special[b]={setup:function(){this.addEventListener(a,d,true)},teardown:function(){this.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,f,e){if(typeof d==="object"){for(var i in d)this[b](i,f,d[i],e);return this}if(c.isFunction(f)){e=f;f=v}var j=b==="one"?c.proxy(e,function(n){c(this).unbind(n,j);return e.apply(this,arguments)}):e;return d==="unload"&&b!=="one"?this.one(d,f,e):this.each(function(){c.event.add(this,d,j,f)})}});c.fn.extend({unbind:function(a,
b){if(typeof a==="object"&&!a.preventDefault){for(var d in a)this.unbind(d,a[d]);return this}return this.each(function(){c.event.remove(this,a,b)})},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){a=c.Event(a);a.preventDefault();a.stopPropagation();c.event.trigger(a,b,this[0]);return a.result}},toggle:function(a){for(var b=arguments,d=1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(f){var e=(c.data(this,"lastToggle"+
a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,e+1);f.preventDefault();return b[e].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});c.each(["live","die"],function(a,b){c.fn[b]=function(d,f,e){var i,j=0;if(c.isFunction(f)){e=f;f=v}for(d=(d||"").split(/\s+/);(i=d[j++])!=null;){i=i==="focus"?"focusin":i==="blur"?"focusout":i==="hover"?d.push("mouseleave")&&"mouseenter":i;b==="live"?c(this.context).bind(oa(i,this.selector),{data:f,selector:this.selector,
live:i},e):c(this.context).unbind(oa(i,this.selector),e?{guid:e.guid+this.selector+i}:null)}return this}});c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){c.fn[b]=function(d){return d?this.bind(b,d):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});z.attachEvent&&!z.addEventListener&&z.attachEvent("onunload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}});
(function(){function a(g){for(var h="",k,l=0;g[l];l++){k=g[l];if(k.nodeType===3||k.nodeType===4)h+=k.nodeValue;else if(k.nodeType!==8)h+=a(k.childNodes)}return h}function b(g,h,k,l,q,p){q=0;for(var u=l.length;q<u;q++){var t=l[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===k){y=l[t.sizset];break}if(t.nodeType===1&&!p){t.sizcache=k;t.sizset=q}if(t.nodeName.toLowerCase()===h){y=t;break}t=t[g]}l[q]=y}}}function d(g,h,k,l,q,p){q=0;for(var u=l.length;q<u;q++){var t=l[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===
k){y=l[t.sizset];break}if(t.nodeType===1){if(!p){t.sizcache=k;t.sizset=q}if(typeof h!=="string"){if(t===h){y=true;break}}else if(o.filter(h,[t]).length>0){y=t;break}}t=t[g]}l[q]=y}}}var f=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,i=Object.prototype.toString,j=false,n=true;[0,0].sort(function(){n=false;return 0});var o=function(g,h,k,l){k=k||[];var q=h=h||r;if(h.nodeType!==1&&h.nodeType!==9)return[];if(!g||
typeof g!=="string")return k;for(var p=[],u,t,y,R,H=true,M=w(h),I=g;(f.exec(""),u=f.exec(I))!==null;){I=u[3];p.push(u[1]);if(u[2]){R=u[3];break}}if(p.length>1&&s.exec(g))if(p.length===2&&m.relative[p[0]])t=fa(p[0]+p[1],h);else for(t=m.relative[p[0]]?[h]:o(p.shift(),h);p.length;){g=p.shift();if(m.relative[g])g+=p.shift();t=fa(g,t)}else{if(!l&&p.length>1&&h.nodeType===9&&!M&&m.match.ID.test(p[0])&&!m.match.ID.test(p[p.length-1])){u=o.find(p.shift(),h,M);h=u.expr?o.filter(u.expr,u.set)[0]:u.set[0]}if(h){u=
l?{expr:p.pop(),set:A(l)}:o.find(p.pop(),p.length===1&&(p[0]==="~"||p[0]==="+")&&h.parentNode?h.parentNode:h,M);t=u.expr?o.filter(u.expr,u.set):u.set;if(p.length>0)y=A(t);else H=false;for(;p.length;){var D=p.pop();u=D;if(m.relative[D])u=p.pop();else D="";if(u==null)u=h;m.relative[D](y,u,M)}}else y=[]}y||(y=t);y||o.error(D||g);if(i.call(y)==="[object Array]")if(H)if(h&&h.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&E(h,y[g])))k.push(t[g])}else for(g=0;y[g]!=null;g++)y[g]&&
y[g].nodeType===1&&k.push(t[g]);else k.push.apply(k,y);else A(y,k);if(R){o(R,q,k,l);o.uniqueSort(k)}return k};o.uniqueSort=function(g){if(C){j=n;g.sort(C);if(j)for(var h=1;h<g.length;h++)g[h]===g[h-1]&&g.splice(h--,1)}return g};o.matches=function(g,h){return o(g,null,null,h)};o.find=function(g,h,k){var l,q;if(!g)return[];for(var p=0,u=m.order.length;p<u;p++){var t=m.order[p];if(q=m.leftMatch[t].exec(g)){var y=q[1];q.splice(1,1);if(y.substr(y.length-1)!=="\\"){q[1]=(q[1]||"").replace(/\\/g,"");l=m.find[t](q,
h,k);if(l!=null){g=g.replace(m.match[t],"");break}}}}l||(l=h.getElementsByTagName("*"));return{set:l,expr:g}};o.filter=function(g,h,k,l){for(var q=g,p=[],u=h,t,y,R=h&&h[0]&&w(h[0]);g&&h.length;){for(var H in m.filter)if((t=m.leftMatch[H].exec(g))!=null&&t[2]){var M=m.filter[H],I,D;D=t[1];y=false;t.splice(1,1);if(D.substr(D.length-1)!=="\\"){if(u===p)p=[];if(m.preFilter[H])if(t=m.preFilter[H](t,u,k,p,l,R)){if(t===true)continue}else y=I=true;if(t)for(var U=0;(D=u[U])!=null;U++)if(D){I=M(D,t,U,u);var Da=
l^!!I;if(k&&I!=null)if(Da)y=true;else u[U]=false;else if(Da){p.push(D);y=true}}if(I!==v){k||(u=p);g=g.replace(m.match[H],"");if(!y)return[];break}}}if(g===q)if(y==null)o.error(g);else break;q=g}return u};o.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var m=o.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
TAG:/^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},relative:{"+":function(g,h){var k=typeof h==="string",l=k&&!/\W/.test(h);k=k&&!l;if(l)h=h.toLowerCase();l=0;for(var q=g.length,
p;l<q;l++)if(p=g[l]){for(;(p=p.previousSibling)&&p.nodeType!==1;);g[l]=k||p&&p.nodeName.toLowerCase()===h?p||false:p===h}k&&o.filter(h,g,true)},">":function(g,h){var k=typeof h==="string";if(k&&!/\W/.test(h)){h=h.toLowerCase();for(var l=0,q=g.length;l<q;l++){var p=g[l];if(p){k=p.parentNode;g[l]=k.nodeName.toLowerCase()===h?k:false}}}else{l=0;for(q=g.length;l<q;l++)if(p=g[l])g[l]=k?p.parentNode:p.parentNode===h;k&&o.filter(h,g,true)}},"":function(g,h,k){var l=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=
h=h.toLowerCase();q=b}q("parentNode",h,l,g,p,k)},"~":function(g,h,k){var l=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("previousSibling",h,l,g,p,k)}},find:{ID:function(g,h,k){if(typeof h.getElementById!=="undefined"&&!k)return(g=h.getElementById(g[1]))?[g]:[]},NAME:function(g,h){if(typeof h.getElementsByName!=="undefined"){var k=[];h=h.getElementsByName(g[1]);for(var l=0,q=h.length;l<q;l++)h[l].getAttribute("name")===g[1]&&k.push(h[l]);return k.length===0?null:k}},
TAG:function(g,h){return h.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,h,k,l,q,p){g=" "+g[1].replace(/\\/g,"")+" ";if(p)return g;p=0;for(var u;(u=h[p])!=null;p++)if(u)if(q^(u.className&&(" "+u.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))k||l.push(u);else if(k)h[p]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},CHILD:function(g){if(g[1]==="nth"){var h=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&
"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=h[1]+(h[2]||1)-0;g[3]=h[3]-0}g[0]=e++;return g},ATTR:function(g,h,k,l,q,p){h=g[1].replace(/\\/g,"");if(!p&&m.attrMap[h])g[1]=m.attrMap[h];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,h,k,l,q){if(g[1]==="not")if((f.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=o(g[3],null,null,h);else{g=o.filter(g[3],h,k,true^q);k||l.push.apply(l,g);return false}else if(m.match.POS.test(g[0])||m.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);
return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled===true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,h,k){return!!o(k[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===
g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"===g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},setFilters:{first:function(g,h){return h===0},last:function(g,h,k,l){return h===l.length-1},even:function(g,h){return h%2===
0},odd:function(g,h){return h%2===1},lt:function(g,h,k){return h<k[3]-0},gt:function(g,h,k){return h>k[3]-0},nth:function(g,h,k){return k[3]-0===h},eq:function(g,h,k){return k[3]-0===h}},filter:{PSEUDO:function(g,h,k,l){var q=h[1],p=m.filters[q];if(p)return p(g,k,h,l);else if(q==="contains")return(g.textContent||g.innerText||a([g])||"").indexOf(h[3])>=0;else if(q==="not"){h=h[3];k=0;for(l=h.length;k<l;k++)if(h[k]===g)return false;return true}else o.error("Syntax error, unrecognized expression: "+
q)},CHILD:function(g,h){var k=h[1],l=g;switch(k){case "only":case "first":for(;l=l.previousSibling;)if(l.nodeType===1)return false;if(k==="first")return true;l=g;case "last":for(;l=l.nextSibling;)if(l.nodeType===1)return false;return true;case "nth":k=h[2];var q=h[3];if(k===1&&q===0)return true;h=h[0];var p=g.parentNode;if(p&&(p.sizcache!==h||!g.nodeIndex)){var u=0;for(l=p.firstChild;l;l=l.nextSibling)if(l.nodeType===1)l.nodeIndex=++u;p.sizcache=h}g=g.nodeIndex-q;return k===0?g===0:g%k===0&&g/k>=
0}},ID:function(g,h){return g.nodeType===1&&g.getAttribute("id")===h},TAG:function(g,h){return h==="*"&&g.nodeType===1||g.nodeName.toLowerCase()===h},CLASS:function(g,h){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(h)>-1},ATTR:function(g,h){var k=h[1];g=m.attrHandle[k]?m.attrHandle[k](g):g[k]!=null?g[k]:g.getAttribute(k);k=g+"";var l=h[2];h=h[4];return g==null?l==="!=":l==="="?k===h:l==="*="?k.indexOf(h)>=0:l==="~="?(" "+k+" ").indexOf(h)>=0:!h?k&&g!==false:l==="!="?k!==h:l==="^="?
k.indexOf(h)===0:l==="$="?k.substr(k.length-h.length)===h:l==="|="?k===h||k.substr(0,h.length+1)===h+"-":false},POS:function(g,h,k,l){var q=m.setFilters[h[2]];if(q)return q(g,k,h,l)}}},s=m.match.POS;for(var x in m.match){m.match[x]=new RegExp(m.match[x].source+/(?![^\[]*\])(?![^\(]*\))/.source);m.leftMatch[x]=new RegExp(/(^(?:.|\r|\n)*?)/.source+m.match[x].source.replace(/\\(\d+)/g,function(g,h){return"\\"+(h-0+1)}))}var A=function(g,h){g=Array.prototype.slice.call(g,0);if(h){h.push.apply(h,g);return h}return g};
try{Array.prototype.slice.call(r.documentElement.childNodes,0)}catch(B){A=function(g,h){h=h||[];if(i.call(g)==="[object Array]")Array.prototype.push.apply(h,g);else if(typeof g.length==="number")for(var k=0,l=g.length;k<l;k++)h.push(g[k]);else for(k=0;g[k];k++)h.push(g[k]);return h}}var C;if(r.documentElement.compareDocumentPosition)C=function(g,h){if(!g.compareDocumentPosition||!h.compareDocumentPosition){if(g==h)j=true;return g.compareDocumentPosition?-1:1}g=g.compareDocumentPosition(h)&4?-1:g===
h?0:1;if(g===0)j=true;return g};else if("sourceIndex"in r.documentElement)C=function(g,h){if(!g.sourceIndex||!h.sourceIndex){if(g==h)j=true;return g.sourceIndex?-1:1}g=g.sourceIndex-h.sourceIndex;if(g===0)j=true;return g};else if(r.createRange)C=function(g,h){if(!g.ownerDocument||!h.ownerDocument){if(g==h)j=true;return g.ownerDocument?-1:1}var k=g.ownerDocument.createRange(),l=h.ownerDocument.createRange();k.setStart(g,0);k.setEnd(g,0);l.setStart(h,0);l.setEnd(h,0);g=k.compareBoundaryPoints(Range.START_TO_END,
l);if(g===0)j=true;return g};(function(){var g=r.createElement("div"),h="script"+(new Date).getTime();g.innerHTML="<a name='"+h+"'/>";var k=r.documentElement;k.insertBefore(g,k.firstChild);if(r.getElementById(h)){m.find.ID=function(l,q,p){if(typeof q.getElementById!=="undefined"&&!p)return(q=q.getElementById(l[1]))?q.id===l[1]||typeof q.getAttributeNode!=="undefined"&&q.getAttributeNode("id").nodeValue===l[1]?[q]:v:[]};m.filter.ID=function(l,q){var p=typeof l.getAttributeNode!=="undefined"&&l.getAttributeNode("id");
return l.nodeType===1&&p&&p.nodeValue===q}}k.removeChild(g);k=g=null})();(function(){var g=r.createElement("div");g.appendChild(r.createComment(""));if(g.getElementsByTagName("*").length>0)m.find.TAG=function(h,k){k=k.getElementsByTagName(h[1]);if(h[1]==="*"){h=[];for(var l=0;k[l];l++)k[l].nodeType===1&&h.push(k[l]);k=h}return k};g.innerHTML="<a href='#'></a>";if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")m.attrHandle.href=function(h){return h.getAttribute("href",
2)};g=null})();r.querySelectorAll&&function(){var g=o,h=r.createElement("div");h.innerHTML="<p class='TEST'></p>";if(!(h.querySelectorAll&&h.querySelectorAll(".TEST").length===0)){o=function(l,q,p,u){q=q||r;if(!u&&q.nodeType===9&&!w(q))try{return A(q.querySelectorAll(l),p)}catch(t){}return g(l,q,p,u)};for(var k in g)o[k]=g[k];h=null}}();(function(){var g=r.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===
0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){m.order.splice(1,0,"CLASS");m.find.CLASS=function(h,k,l){if(typeof k.getElementsByClassName!=="undefined"&&!l)return k.getElementsByClassName(h[1])};g=null}}})();var E=r.compareDocumentPosition?function(g,h){return g.compareDocumentPosition(h)&16}:function(g,h){return g!==h&&(g.contains?g.contains(h):true)},w=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false},fa=function(g,h){var k=[],
l="",q;for(h=h.nodeType?[h]:h;q=m.match.PSEUDO.exec(g);){l+=q[0];g=g.replace(m.match.PSEUDO,"")}g=m.relative[g]?g+"*":g;q=0;for(var p=h.length;q<p;q++)o(g,h[q],k);return o.filter(l,k)};c.find=o;c.expr=o.selectors;c.expr[":"]=c.expr.filters;c.unique=o.uniqueSort;c.getText=a;c.isXMLDoc=w;c.contains=E})();var bb=/Until$/,cb=/^(?:parents|prevUntil|prevAll)/,db=/,/;Q=Array.prototype.slice;var Ea=function(a,b,d){if(c.isFunction(b))return c.grep(a,function(e,i){return!!b.call(e,i,e)===d});else if(b.nodeType)return c.grep(a,
function(e){return e===b===d});else if(typeof b==="string"){var f=c.grep(a,function(e){return e.nodeType===1});if(Qa.test(b))return c.filter(b,f,!d);else b=c.filter(b,f)}return c.grep(a,function(e){return c.inArray(e,b)>=0===d})};c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,f=0,e=this.length;f<e;f++){d=b.length;c.find(a,this[f],b);if(f>0)for(var i=d;i<b.length;i++)for(var j=0;j<d;j++)if(b[j]===b[i]){b.splice(i--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=
0,f=b.length;d<f;d++)if(c.contains(this,b[d]))return true})},not:function(a){return this.pushStack(Ea(this,a,false),"not",a)},filter:function(a){return this.pushStack(Ea(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){if(c.isArray(a)){var d=[],f=this[0],e,i={},j;if(f&&a.length){e=0;for(var n=a.length;e<n;e++){j=a[e];i[j]||(i[j]=c.expr.match.POS.test(j)?c(j,b||this.context):j)}for(;f&&f.ownerDocument&&f!==b;){for(j in i){e=i[j];if(e.jquery?e.index(f)>
-1:c(f).is(e)){d.push({selector:j,elem:f});delete i[j]}}f=f.parentNode}}return d}var o=c.expr.match.POS.test(a)?c(a,b||this.context):null;return this.map(function(m,s){for(;s&&s.ownerDocument&&s!==b;){if(o?o.index(s)>-1:c(s).is(a))return s;s=s.parentNode}return null})},index:function(a){if(!a||typeof a==="string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){a=typeof a==="string"?c(a,b||this.context):c.makeArray(a);b=c.merge(this.get(),
a);return this.pushStack(pa(a[0])||pa(b[0])?b:c.unique(b))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a,2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},
nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a,b){c.fn[a]=function(d,f){var e=c.map(this,b,d);bb.test(a)||(f=d);if(f&&typeof f==="string")e=c.filter(f,e);e=this.length>1?c.unique(e):
e;if((this.length>1||db.test(f))&&cb.test(a))e=e.reverse();return this.pushStack(e,a,Q.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return c.find.matches(a,b)},dir:function(a,b,d){var f=[];for(a=a[b];a&&a.nodeType!==9&&(d===v||a.nodeType!==1||!c(a).is(d));){a.nodeType===1&&f.push(a);a=a[b]}return f},nth:function(a,b,d){b=b||1;for(var f=0;a;a=a[d])if(a.nodeType===1&&++f===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==
b&&d.push(a);return d}});var Fa=/ jQuery\d+="(?:\d+|null)"/g,V=/^\s+/,Ga=/(<([\w:]+)[^>]*?)\/>/g,eb=/^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,Ha=/<([\w:]+)/,fb=/<tbody/i,gb=/<|&\w+;/,sa=/checked\s*(?:[^=]|=\s*.checked.)/i,Ia=function(a,b,d){return eb.test(d)?a:b+"></"+d+">"},F={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],
col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};F.optgroup=F.option;F.tbody=F.tfoot=F.colgroup=F.caption=F.thead;F.th=F.td;if(!c.support.htmlSerialize)F._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d=c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==v)return this.empty().append((this[0]&&this[0].ownerDocument||r).createTextNode(a));return c.getText(this)},
wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this},wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?
d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,
false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&
!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Fa,"").replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){qa(this,b);qa(this.find("*"),b.find("*"))}return b},html:function(a){if(a===v)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Fa,""):null;else if(typeof a==="string"&&!/<script/i.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(Ha.exec(a)||
["",""])[1].toLowerCase()]){a=a.replace(Ga,Ia);try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(f){this.empty().append(a)}}else c.isFunction(a)?this.each(function(e){var i=c(this),j=i.html();i.empty().append(function(){return a.call(this,e,j)})}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d=c(this),f=d.html();d.replaceWith(a.call(this,
b,f))});else a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){function f(s){return c.nodeName(s,"table")?s.getElementsByTagName("tbody")[0]||s.appendChild(s.ownerDocument.createElement("tbody")):s}var e,i,j=a[0],n=[];if(!c.support.checkClone&&arguments.length===3&&typeof j===
"string"&&sa.test(j))return this.each(function(){c(this).domManip(a,b,d,true)});if(c.isFunction(j))return this.each(function(s){var x=c(this);a[0]=j.call(this,s,b?x.html():v);x.domManip(a,b,d)});if(this[0]){e=a[0]&&a[0].parentNode&&a[0].parentNode.nodeType===11?{fragment:a[0].parentNode}:ra(a,this,n);if(i=e.fragment.firstChild){b=b&&c.nodeName(i,"tr");for(var o=0,m=this.length;o<m;o++)d.call(b?f(this[o],i):this[o],e.cacheable||this.length>1||o>0?e.fragment.cloneNode(true):e.fragment)}n&&c.each(n,
Ma)}return this}});c.fragments={};c.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var f=[];d=c(d);for(var e=0,i=d.length;e<i;e++){var j=(e>0?this.clone(true):this).get();c.fn[b].apply(c(d[e]),j);f=f.concat(j)}return this.pushStack(f,a,d.selector)}});c.each({remove:function(a,b){if(!a||c.filter(a,[this]).length){if(!b&&this.nodeType===1){c.cleanData(this.getElementsByTagName("*"));c.cleanData([this])}this.parentNode&&
this.parentNode.removeChild(this)}},empty:function(){for(this.nodeType===1&&c.cleanData(this.getElementsByTagName("*"));this.firstChild;)this.removeChild(this.firstChild)}},function(a,b){c.fn[a]=function(){return this.each(b,arguments)}});c.extend({clean:function(a,b,d,f){b=b||r;if(typeof b.createElement==="undefined")b=b.ownerDocument||b[0]&&b[0].ownerDocument||r;var e=[];c.each(a,function(i,j){if(typeof j==="number")j+="";if(j){if(typeof j==="string"&&!gb.test(j))j=b.createTextNode(j);else if(typeof j===
"string"){j=j.replace(Ga,Ia);var n=(Ha.exec(j)||["",""])[1].toLowerCase(),o=F[n]||F._default,m=o[0];i=b.createElement("div");for(i.innerHTML=o[1]+j+o[2];m--;)i=i.lastChild;if(!c.support.tbody){m=fb.test(j);n=n==="table"&&!m?i.firstChild&&i.firstChild.childNodes:o[1]==="<table>"&&!m?i.childNodes:[];for(o=n.length-1;o>=0;--o)c.nodeName(n[o],"tbody")&&!n[o].childNodes.length&&n[o].parentNode.removeChild(n[o])}!c.support.leadingWhitespace&&V.test(j)&&i.insertBefore(b.createTextNode(V.exec(j)[0]),i.firstChild);
j=c.makeArray(i.childNodes)}if(j.nodeType)e.push(j);else e=c.merge(e,j)}});if(d)for(a=0;e[a];a++)if(f&&c.nodeName(e[a],"script")&&(!e[a].type||e[a].type.toLowerCase()==="text/javascript"))f.push(e[a].parentNode?e[a].parentNode.removeChild(e[a]):e[a]);else{e[a].nodeType===1&&e.splice.apply(e,[a+1,0].concat(c.makeArray(e[a].getElementsByTagName("script"))));d.appendChild(e[a])}return e},cleanData:function(a){for(var b=0,d;(d=a[b])!=null;b++){c.event.remove(d);c.removeData(d)}}});var hb=/z-?index|font-?weight|opacity|zoom|line-?height/i,
Ja=/alpha\([^)]*\)/,Ka=/opacity=([^)]*)/,ga=/float/i,ha=/-([a-z])/ig,ib=/([A-Z])/g,jb=/^-?\d+(?:px)?$/i,kb=/^-?\d/,lb={position:"absolute",visibility:"hidden",display:"block"},mb=["Left","Right"],nb=["Top","Bottom"],ob=r.defaultView&&r.defaultView.getComputedStyle,La=c.support.cssFloat?"cssFloat":"styleFloat",ia=function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){return X(this,a,b,true,function(d,f,e){if(e===v)return c.curCSS(d,f);if(typeof e==="number"&&!hb.test(f))e+="px";c.style(d,f,e)})};
c.extend({style:function(a,b,d){if(!a||a.nodeType===3||a.nodeType===8)return v;if((b==="width"||b==="height")&&parseFloat(d)<0)d=v;var f=a.style||a,e=d!==v;if(!c.support.opacity&&b==="opacity"){if(e){f.zoom=1;b=parseInt(d,10)+""==="NaN"?"":"alpha(opacity="+d*100+")";a=f.filter||c.curCSS(a,"filter")||"";f.filter=Ja.test(a)?a.replace(Ja,b):b}return f.filter&&f.filter.indexOf("opacity=")>=0?parseFloat(Ka.exec(f.filter)[1])/100+"":""}if(ga.test(b))b=La;b=b.replace(ha,ia);if(e)f[b]=d;return f[b]},css:function(a,
b,d,f){if(b==="width"||b==="height"){var e,i=b==="width"?mb:nb;function j(){e=b==="width"?a.offsetWidth:a.offsetHeight;f!=="border"&&c.each(i,function(){f||(e-=parseFloat(c.curCSS(a,"padding"+this,true))||0);if(f==="margin")e+=parseFloat(c.curCSS(a,"margin"+this,true))||0;else e-=parseFloat(c.curCSS(a,"border"+this+"Width",true))||0})}a.offsetWidth!==0?j():c.swap(a,lb,j);return Math.max(0,Math.round(e))}return c.curCSS(a,b,d)},curCSS:function(a,b,d){var f,e=a.style;if(!c.support.opacity&&b==="opacity"&&
a.currentStyle){f=Ka.test(a.currentStyle.filter||"")?parseFloat(RegExp.$1)/100+"":"";return f===""?"1":f}if(ga.test(b))b=La;if(!d&&e&&e[b])f=e[b];else if(ob){if(ga.test(b))b="float";b=b.replace(ib,"-$1").toLowerCase();e=a.ownerDocument.defaultView;if(!e)return null;if(a=e.getComputedStyle(a,null))f=a.getPropertyValue(b);if(b==="opacity"&&f==="")f="1"}else if(a.currentStyle){d=b.replace(ha,ia);f=a.currentStyle[b]||a.currentStyle[d];if(!jb.test(f)&&kb.test(f)){b=e.left;var i=a.runtimeStyle.left;a.runtimeStyle.left=
a.currentStyle.left;e.left=d==="fontSize"?"1em":f||0;f=e.pixelLeft+"px";e.left=b;a.runtimeStyle.left=i}}return f},swap:function(a,b,d){var f={};for(var e in b){f[e]=a.style[e];a.style[e]=b[e]}d.call(a);for(e in b)a.style[e]=f[e]}});if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=a.offsetWidth,d=a.offsetHeight,f=a.nodeName.toLowerCase()==="tr";return b===0&&d===0&&!f?true:b>0&&d>0&&!f?false:c.curCSS(a,"display")==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var pb=
J(),qb=/<script(.|\s)*?\/script>/gi,rb=/select|textarea/i,sb=/color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,N=/=\?(&|$)/,ja=/\?/,tb=/(\?|&)_=.*?(&|$)/,ub=/^(\w+:)?\/\/([^\/?#]+)/,vb=/%20/g;c.fn.extend({_load:c.fn.load,load:function(a,b,d){if(typeof a!=="string")return this._load(a);else if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var e=a.slice(f,a.length);a=a.slice(0,f)}f="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b==="object"){b=
c.param(b,c.ajaxSettings.traditional);f="POST"}var i=this;c.ajax({url:a,type:f,dataType:"html",data:b,complete:function(j,n){if(n==="success"||n==="notmodified")i.html(e?c("<div />").append(j.responseText.replace(qb,"")).find(e):j.responseText);d&&i.each(d,[j.responseText,n,j])}});return this},serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&
(this.checked||rb.test(this.nodeName)||sb.test(this.type))}).map(function(a,b){a=c(this).val();return a==null?null:c.isArray(a)?c.map(a,function(d){return{name:b.name,value:d}}):{name:b.name,value:a}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:f})},getScript:function(a,
b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:f})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:z.XMLHttpRequest&&(z.location.protocol!=="file:"||!z.ActiveXObject)?function(){return new z.XMLHttpRequest}:
function(){try{return new z.ActiveXObject("Microsoft.XMLHTTP")}catch(a){}},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},etag:{},ajax:function(a){function b(){e.success&&e.success.call(o,n,j,w);e.global&&f("ajaxSuccess",[w,e])}function d(){e.complete&&e.complete.call(o,w,j);e.global&&f("ajaxComplete",[w,e]);e.global&&!--c.active&&c.event.trigger("ajaxStop")}
function f(q,p){(e.context?c(e.context):c.event).trigger(q,p)}var e=c.extend(true,{},c.ajaxSettings,a),i,j,n,o=a&&a.context||e,m=e.type.toUpperCase();if(e.data&&e.processData&&typeof e.data!=="string")e.data=c.param(e.data,e.traditional);if(e.dataType==="jsonp"){if(m==="GET")N.test(e.url)||(e.url+=(ja.test(e.url)?"&":"?")+(e.jsonp||"callback")+"=?");else if(!e.data||!N.test(e.data))e.data=(e.data?e.data+"&":"")+(e.jsonp||"callback")+"=?";e.dataType="json"}if(e.dataType==="json"&&(e.data&&N.test(e.data)||
N.test(e.url))){i=e.jsonpCallback||"jsonp"+pb++;if(e.data)e.data=(e.data+"").replace(N,"="+i+"$1");e.url=e.url.replace(N,"="+i+"$1");e.dataType="script";z[i]=z[i]||function(q){n=q;b();d();z[i]=v;try{delete z[i]}catch(p){}A&&A.removeChild(B)}}if(e.dataType==="script"&&e.cache===null)e.cache=false;if(e.cache===false&&m==="GET"){var s=J(),x=e.url.replace(tb,"$1_="+s+"$2");e.url=x+(x===e.url?(ja.test(e.url)?"&":"?")+"_="+s:"")}if(e.data&&m==="GET")e.url+=(ja.test(e.url)?"&":"?")+e.data;e.global&&!c.active++&&
c.event.trigger("ajaxStart");s=(s=ub.exec(e.url))&&(s[1]&&s[1]!==location.protocol||s[2]!==location.host);if(e.dataType==="script"&&m==="GET"&&s){var A=r.getElementsByTagName("head")[0]||r.documentElement,B=r.createElement("script");B.src=e.url;if(e.scriptCharset)B.charset=e.scriptCharset;if(!i){var C=false;B.onload=B.onreadystatechange=function(){if(!C&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){C=true;b();d();B.onload=B.onreadystatechange=null;A&&B.parentNode&&
A.removeChild(B)}}}A.insertBefore(B,A.firstChild);return v}var E=false,w=e.xhr();if(w){e.username?w.open(m,e.url,e.async,e.username,e.password):w.open(m,e.url,e.async);try{if(e.data||a&&a.contentType)w.setRequestHeader("Content-Type",e.contentType);if(e.ifModified){c.lastModified[e.url]&&w.setRequestHeader("If-Modified-Since",c.lastModified[e.url]);c.etag[e.url]&&w.setRequestHeader("If-None-Match",c.etag[e.url])}s||w.setRequestHeader("X-Requested-With","XMLHttpRequest");w.setRequestHeader("Accept",
e.dataType&&e.accepts[e.dataType]?e.accepts[e.dataType]+", */*":e.accepts._default)}catch(fa){}if(e.beforeSend&&e.beforeSend.call(o,w,e)===false){e.global&&!--c.active&&c.event.trigger("ajaxStop");w.abort();return false}e.global&&f("ajaxSend",[w,e]);var g=w.onreadystatechange=function(q){if(!w||w.readyState===0||q==="abort"){E||d();E=true;if(w)w.onreadystatechange=c.noop}else if(!E&&w&&(w.readyState===4||q==="timeout")){E=true;w.onreadystatechange=c.noop;j=q==="timeout"?"timeout":!c.httpSuccess(w)?
"error":e.ifModified&&c.httpNotModified(w,e.url)?"notmodified":"success";var p;if(j==="success")try{n=c.httpData(w,e.dataType,e)}catch(u){j="parsererror";p=u}if(j==="success"||j==="notmodified")i||b();else c.handleError(e,w,j,p);d();q==="timeout"&&w.abort();if(e.async)w=null}};try{var h=w.abort;w.abort=function(){w&&h.call(w);g("abort")}}catch(k){}e.async&&e.timeout>0&&setTimeout(function(){w&&!E&&g("timeout")},e.timeout);try{w.send(m==="POST"||m==="PUT"||m==="DELETE"?e.data:null)}catch(l){c.handleError(e,
w,null,l);d()}e.async||g();return w}},handleError:function(a,b,d,f){if(a.error)a.error.call(a.context||a,b,d,f);if(a.global)(a.context?c(a.context):c.event).trigger("ajaxError",[b,a,f])},active:0,httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===1223||a.status===0}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"),f=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(f)c.etag[b]=
f;return a.status===304||a.status===0},httpData:function(a,b,d){var f=a.getResponseHeader("content-type")||"",e=b==="xml"||!b&&f.indexOf("xml")>=0;a=e?a.responseXML:a.responseText;e&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b==="json"||!b&&f.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&f.indexOf("javascript")>=0)c.globalEval(a);return a},param:function(a,b){function d(j,n){if(c.isArray(n))c.each(n,
function(o,m){b?f(j,m):d(j+"["+(typeof m==="object"||c.isArray(m)?o:"")+"]",m)});else!b&&n!=null&&typeof n==="object"?c.each(n,function(o,m){d(j+"["+o+"]",m)}):f(j,n)}function f(j,n){n=c.isFunction(n)?n():n;e[e.length]=encodeURIComponent(j)+"="+encodeURIComponent(n)}var e=[];if(b===v)b=c.ajaxSettings.traditional;if(c.isArray(a)||a.jquery)c.each(a,function(){f(this.name,this.value)});else for(var i in a)d(i,a[i]);return e.join("&").replace(vb,"+")}});var ka={},wb=/toggle|show|hide/,xb=/^([+-]=)?([\d+-.]+)(.*)$/,
W,ta=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b){if(a||a===0)return this.animate(K("show",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");this[a].style.display=d||"";if(c.css(this[a],"display")==="none"){d=this[a].nodeName;var f;if(ka[d])f=ka[d];else{var e=c("<"+d+" />").appendTo("body");f=e.css("display");if(f==="none")f="block";e.remove();
ka[d]=f}c.data(this[a],"olddisplay",f)}}a=0;for(b=this.length;a<b;a++)this[a].style.display=c.data(this[a],"olddisplay")||"";return this}},hide:function(a,b){if(a||a===0)return this.animate(K("hide",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");!d&&d!=="none"&&c.data(this[a],"olddisplay",c.css(this[a],"display"))}a=0;for(b=this.length;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b){var d=typeof a==="boolean";if(c.isFunction(a)&&
c.isFunction(b))this._toggle.apply(this,arguments);else a==null||d?this.each(function(){var f=d?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(K("toggle",3),a,b);return this},fadeTo:function(a,b,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d)},animate:function(a,b,d,f){var e=c.speed(b,d,f);if(c.isEmptyObject(a))return this.each(e.complete);return this[e.queue===false?"each":"queue"](function(){var i=c.extend({},e),j,n=this.nodeType===1&&c(this).is(":hidden"),
o=this;for(j in a){var m=j.replace(ha,ia);if(j!==m){a[m]=a[j];delete a[j];j=m}if(a[j]==="hide"&&n||a[j]==="show"&&!n)return i.complete.call(this);if((j==="height"||j==="width")&&this.style){i.display=c.css(this,"display");i.overflow=this.style.overflow}if(c.isArray(a[j])){(i.specialEasing=i.specialEasing||{})[j]=a[j][1];a[j]=a[j][0]}}if(i.overflow!=null)this.style.overflow="hidden";i.curAnim=c.extend({},a);c.each(a,function(s,x){var A=new c.fx(o,i,s);if(wb.test(x))A[x==="toggle"?n?"show":"hide":x](a);
else{var B=xb.exec(x),C=A.cur(true)||0;if(B){x=parseFloat(B[2]);var E=B[3]||"px";if(E!=="px"){o.style[s]=(x||1)+E;C=(x||1)/A.cur(true)*C;o.style[s]=C+E}if(B[1])x=(B[1]==="-="?-1:1)*x+C;A.custom(C,x,E)}else A.custom(C,x,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);this.each(function(){for(var f=d.length-1;f>=0;f--)if(d[f].elem===this){b&&d[f](true);d.splice(f,1)}});b||this.dequeue();return this}});c.each({slideDown:K("show",1),slideUp:K("hide",1),slideToggle:K("toggle",
1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(a,b){c.fn[a]=function(d,f){return this.animate(b,d,f)}});c.extend({speed:function(a,b,d){var f=a&&typeof a==="object"?a:{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};f.duration=c.fx.off?0:typeof f.duration==="number"?f.duration:c.fx.speeds[f.duration]||c.fx.speeds._default;f.old=f.complete;f.complete=function(){f.queue!==false&&c(this).dequeue();c.isFunction(f.old)&&f.old.call(this)};return f},easing:{linear:function(a,
b,d,f){return d+f*a},swing:function(a,b,d,f){return(-Math.cos(a*Math.PI)/2+0.5)*f+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||c.fx.step._default)(this);if((this.prop==="height"||this.prop==="width")&&this.elem.style)this.elem.style.display="block"},cur:function(a){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==
null))return this.elem[this.prop];return(a=parseFloat(c.css(this.elem,this.prop,a)))&&a>-10000?a:parseFloat(c.curCSS(this.elem,this.prop))||0},custom:function(a,b,d){function f(i){return e.step(i)}this.startTime=J();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;this.pos=this.state=0;var e=this;f.elem=this.elem;if(f()&&c.timers.push(f)&&!W)W=setInterval(c.fx.tick,13)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop===
"width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(a){var b=J(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var f in this.options.curAnim)if(this.options.curAnim[f]!==true)d=false;if(d){if(this.options.display!=null){this.elem.style.overflow=
this.options.overflow;a=c.data(this.elem,"olddisplay");this.elem.style.display=a?a:this.options.display;if(c.css(this.elem,"display")==="none")this.elem.style.display="block"}this.options.hide&&c(this.elem).hide();if(this.options.hide||this.options.show)for(var e in this.options.curAnim)c.style(this.elem,e,this.options.orig[e]);this.options.complete.call(this.elem)}return false}else{e=b-this.startTime;this.state=e/this.options.duration;a=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=
c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||a](this.state,e,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a=c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||c.fx.stop()},stop:function(){clearInterval(W);W=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=
null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a===b.elem}).length};c.fn.offset="getBoundingClientRect"in r.documentElement?function(a){var b=this[0];if(a)return this.each(function(e){c.offset.setOffset(this,a,e)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);var d=b.getBoundingClientRect(),
f=b.ownerDocument;b=f.body;f=f.documentElement;return{top:d.top+(self.pageYOffset||c.support.boxModel&&f.scrollTop||b.scrollTop)-(f.clientTop||b.clientTop||0),left:d.left+(self.pageXOffset||c.support.boxModel&&f.scrollLeft||b.scrollLeft)-(f.clientLeft||b.clientLeft||0)}}:function(a){var b=this[0];if(a)return this.each(function(s){c.offset.setOffset(this,a,s)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d=b.offsetParent,f=
b,e=b.ownerDocument,i,j=e.documentElement,n=e.body;f=(e=e.defaultView)?e.getComputedStyle(b,null):b.currentStyle;for(var o=b.offsetTop,m=b.offsetLeft;(b=b.parentNode)&&b!==n&&b!==j;){if(c.offset.supportsFixedPosition&&f.position==="fixed")break;i=e?e.getComputedStyle(b,null):b.currentStyle;o-=b.scrollTop;m-=b.scrollLeft;if(b===d){o+=b.offsetTop;m+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(b.nodeName))){o+=parseFloat(i.borderTopWidth)||
0;m+=parseFloat(i.borderLeftWidth)||0}f=d;d=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&i.overflow!=="visible"){o+=parseFloat(i.borderTopWidth)||0;m+=parseFloat(i.borderLeftWidth)||0}f=i}if(f.position==="relative"||f.position==="static"){o+=n.offsetTop;m+=n.offsetLeft}if(c.offset.supportsFixedPosition&&f.position==="fixed"){o+=Math.max(j.scrollTop,n.scrollTop);m+=Math.max(j.scrollLeft,n.scrollLeft)}return{top:o,left:m}};c.offset={initialize:function(){var a=r.body,b=r.createElement("div"),
d,f,e,i=parseFloat(c.curCSS(a,"marginTop",true))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";a.insertBefore(b,a.firstChild);
d=b.firstChild;f=d.firstChild;e=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=f.offsetTop!==5;this.doesAddBorderForTableAndCells=e.offsetTop===5;f.style.position="fixed";f.style.top="20px";this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15;f.style.position=f.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i;a.removeChild(b);c.offset.initialize=c.noop},
bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.curCSS(a,"marginTop",true))||0;d+=parseFloat(c.curCSS(a,"marginLeft",true))||0}return{top:b,left:d}},setOffset:function(a,b,d){if(/static/.test(c.curCSS(a,"position")))a.style.position="relative";var f=c(a),e=f.offset(),i=parseInt(c.curCSS(a,"top",true),10)||0,j=parseInt(c.curCSS(a,"left",true),10)||0;if(c.isFunction(b))b=b.call(a,d,e);d={top:b.top-e.top+i,left:b.left-
e.left+j};"using"in b?b.using.call(a,d):f.css(d)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),f=/^body|html$/i.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.curCSS(a,"marginTop",true))||0;d.left-=parseFloat(c.curCSS(a,"marginLeft",true))||0;f.top+=parseFloat(c.curCSS(b[0],"borderTopWidth",true))||0;f.left+=parseFloat(c.curCSS(b[0],"borderLeftWidth",true))||0;return{top:d.top-f.top,left:d.left-f.left}},offsetParent:function(){return this.map(function(){for(var a=
this.offsetParent||r.body;a&&!/^body|html$/i.test(a.nodeName)&&c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(f){var e=this[0],i;if(!e)return null;if(f!==v)return this.each(function(){if(i=ua(this))i.scrollTo(!a?f:c(i).scrollLeft(),a?f:c(i).scrollTop());else this[d]=f});else return(i=ua(e))?"pageXOffset"in i?i[a?"pageYOffset":"pageXOffset"]:c.support.boxModel&&i.document.documentElement[d]||i.document.body[d]:e[d]}});
c.each(["Height","Width"],function(a,b){var d=b.toLowerCase();c.fn["inner"+b]=function(){return this[0]?c.css(this[0],d,false,"padding"):null};c.fn["outer"+b]=function(f){return this[0]?c.css(this[0],d,false,f?"margin":"border"):null};c.fn[d]=function(f){var e=this[0];if(!e)return f==null?null:this;if(c.isFunction(f))return this.each(function(i){var j=c(this);j[d](f.call(this,i,j[d]()))});return"scrollTo"in e&&e.document?e.document.compatMode==="CSS1Compat"&&e.document.documentElement["client"+b]||
e.document.body["client"+b]:e.nodeType===9?Math.max(e.documentElement["client"+b],e.body["scroll"+b],e.documentElement["scroll"+b],e.body["offset"+b],e.documentElement["offset"+b]):f===v?c.css(e,d):this.css(d,typeof f==="string"?f:f+"px")}});z.jQuery=z.$=c})(window);


/* jquery/jquery.corner.js */

/*!
 * jQuery corner plugin: simple corner rounding
 * Examples and documentation at: http://jquery.malsup.com/corner/
 * version 2.09 (11-MAR-2010)
 * Requires jQuery v1.3.2 or later
 * Dual licensed under the MIT and GPL licenses:
 * http://www.opensource.org/licenses/mit-license.php
 * http://www.gnu.org/licenses/gpl.html
 * Authors: Dave Methvin and Mike Alsup
 */

/**
 *  corner() takes a single string argument:  $('#myDiv').corner("effect corners width")
 *
 *  effect:  name of the effect to apply, such as round, bevel, notch, bite, etc (default is round). 
 *  corners: one or more of: top, bottom, tr, tl, br, or bl.  (default is all corners)
 *  width:   width of the effect; in the case of rounded corners this is the radius. 
 *           specify this value using the px suffix such as 10px (yes, it must be pixels).
 */
;(function($) { 

var style = document.createElement('div').style;
var moz = style['MozBorderRadius'] !== undefined;
var webkit = style['WebkitBorderRadius'] !== undefined;
var radius = style['borderRadius'] !== undefined || style['BorderRadius'] !== undefined;
var mode = document.documentMode || 0;
var noBottomFold = $.browser.msie && (($.browser.version < 8 && !mode) || mode < 8);

var expr = $.browser.msie && (function() {
    var div = document.createElement('div');
    try { div.style.setExpression('width','0+0'); div.style.removeExpression('width'); }
    catch(e) { return false; }
    return true;
})();
    
function sz(el, p) { 
    return parseInt($.css(el,p))||0; 
};
function hex2(s) {
    var s = parseInt(s).toString(16);
    return ( s.length < 2 ) ? '0'+s : s;
};
function gpc(node) {
    while(node) {
        var v = $.css(node,'backgroundColor');
        if (v && v != 'transparent' && v != 'rgba(0, 0, 0, 0)') {
	        if (v.indexOf('rgb') >= 0) { 
	            var rgb = v.match(/\d+/g); 
	            return '#'+ hex2(rgb[0]) + hex2(rgb[1]) + hex2(rgb[2]);
	        }
            return v;
		}
		node = node.parentNode; // keep walking if transparent
    }
    return '#ffffff';
};

function getWidth(fx, i, width) {
    switch(fx) {
    case 'round':  return Math.round(width*(1-Math.cos(Math.asin(i/width))));
    case 'cool':   return Math.round(width*(1+Math.cos(Math.asin(i/width))));
    case 'sharp':  return Math.round(width*(1-Math.cos(Math.acos(i/width))));
    case 'bite':   return Math.round(width*(Math.cos(Math.asin((width-i-1)/width))));
    case 'slide':  return Math.round(width*(Math.atan2(i,width/i)));
    case 'jut':    return Math.round(width*(Math.atan2(width,(width-i-1))));
    case 'curl':   return Math.round(width*(Math.atan(i)));
    case 'tear':   return Math.round(width*(Math.cos(i)));
    case 'wicked': return Math.round(width*(Math.tan(i)));
    case 'long':   return Math.round(width*(Math.sqrt(i)));
    case 'sculpt': return Math.round(width*(Math.log((width-i-1),width)));
	case 'dogfold':
    case 'dog':    return (i&1) ? (i+1) : width;
    case 'dog2':   return (i&2) ? (i+1) : width;
    case 'dog3':   return (i&3) ? (i+1) : width;
    case 'fray':   return (i%2)*width;
    case 'notch':  return width; 
	case 'bevelfold':
    case 'bevel':  return i+1;
    }
};

$.fn.corner = function(options) {
    // in 1.3+ we can fix mistakes with the ready state
	if (this.length == 0) {
        if (!$.isReady && this.selector) {
            var s = this.selector, c = this.context;
            $(function() {
                $(s,c).corner(options);
            });
        }
        return this;
	}

    return this.each(function(index){
		var $this = $(this);
		// meta values override options
		var o = [$this.attr($.fn.corner.defaults.metaAttr) || '', options || ''].join(' ').toLowerCase();
		var keep = /keep/.test(o);                       // keep borders?
		var cc = ((o.match(/cc:(#[0-9a-f]+)/)||[])[1]);  // corner color
		var sc = ((o.match(/sc:(#[0-9a-f]+)/)||[])[1]);  // strip color
		var width = parseInt((o.match(/(\d+)px/)||[])[1]) || 10; // corner width
		var re = /round|bevelfold|bevel|notch|bite|cool|sharp|slide|jut|curl|tear|fray|wicked|sculpt|long|dog3|dog2|dogfold|dog/;
		var fx = ((o.match(re)||['round'])[0]);
		var fold = /dogfold|bevelfold/.test(o);
		var edges = { T:0, B:1 };
		var opts = {
			TL:  /top|tl|left/.test(o),       TR:  /top|tr|right/.test(o),
			BL:  /bottom|bl|left/.test(o),    BR:  /bottom|br|right/.test(o)
		};
		if ( !opts.TL && !opts.TR && !opts.BL && !opts.BR )
			opts = { TL:1, TR:1, BL:1, BR:1 };
			
		// support native rounding
		if ($.fn.corner.defaults.useNative && fx == 'round' && (radius || moz || webkit) && !cc && !sc) {
			if (opts.TL)
				$this.css(radius ? 'border-top-left-radius' : moz ? '-moz-border-radius-topleft' : '-webkit-border-top-left-radius', width + 'px');
			if (opts.TR)
				$this.css(radius ? 'border-top-right-radius' : moz ? '-moz-border-radius-topright' : '-webkit-border-top-right-radius', width + 'px');
			if (opts.BL)
				$this.css(radius ? 'border-bottom-left-radius' : moz ? '-moz-border-radius-bottomleft' : '-webkit-border-bottom-left-radius', width + 'px');
			if (opts.BR)
				$this.css(radius ? 'border-bottom-right-radius' : moz ? '-moz-border-radius-bottomright' : '-webkit-border-bottom-right-radius', width + 'px');
			return;
		}
			
		var strip = document.createElement('div');
		$(strip).css({
			overflow: 'hidden',
			height: '1px',
			minHeight: '1px',
			fontSize: '1px',
			backgroundColor: sc || 'transparent',
			borderStyle: 'solid'
		});
	
        var pad = {
            T: parseInt($.css(this,'paddingTop'))||0,     R: parseInt($.css(this,'paddingRight'))||0,
            B: parseInt($.css(this,'paddingBottom'))||0,  L: parseInt($.css(this,'paddingLeft'))||0
        };

        if (typeof this.style.zoom != undefined) this.style.zoom = 1; // force 'hasLayout' in IE
        if (!keep) this.style.border = 'none';
        strip.style.borderColor = cc || gpc(this.parentNode);
        var cssHeight = $(this).outerHeight();

        for (var j in edges) {
            var bot = edges[j];
            // only add stips if needed
            if ((bot && (opts.BL || opts.BR)) || (!bot && (opts.TL || opts.TR))) {
                strip.style.borderStyle = 'none '+(opts[j+'R']?'solid':'none')+' none '+(opts[j+'L']?'solid':'none');
                var d = document.createElement('div');
                $(d).addClass('jquery-corner');
                var ds = d.style;

                bot ? this.appendChild(d) : this.insertBefore(d, this.firstChild);

                if (bot && cssHeight != 'auto') {
                    if ($.css(this,'position') == 'static')
                        this.style.position = 'relative';
                    ds.position = 'absolute';
                    ds.bottom = ds.left = ds.padding = ds.margin = '0';
                    if (expr)
                        ds.setExpression('width', 'this.parentNode.offsetWidth');
                    else
                        ds.width = '100%';
                }
                else if (!bot && $.browser.msie) {
                    if ($.css(this,'position') == 'static')
                        this.style.position = 'relative';
                    ds.position = 'absolute';
                    ds.top = ds.left = ds.right = ds.padding = ds.margin = '0';
                    
                    // fix ie6 problem when blocked element has a border width
                    if (expr) {
                        var bw = sz(this,'borderLeftWidth') + sz(this,'borderRightWidth');
                        ds.setExpression('width', 'this.parentNode.offsetWidth - '+bw+'+ "px"');
                    }
                    else
                        ds.width = '100%';
                }
                else {
                	ds.position = 'relative';
                    ds.margin = !bot ? '-'+pad.T+'px -'+pad.R+'px '+(pad.T-width)+'px -'+pad.L+'px' : 
                                        (pad.B-width)+'px -'+pad.R+'px -'+pad.B+'px -'+pad.L+'px';                
                }

                for (var i=0; i < width; i++) {
                    var w = Math.max(0,getWidth(fx,i, width));
                    var e = strip.cloneNode(false);
                    e.style.borderWidth = '0 '+(opts[j+'R']?w:0)+'px 0 '+(opts[j+'L']?w:0)+'px';
                    bot ? d.appendChild(e) : d.insertBefore(e, d.firstChild);
                }
				
				if (fold && $.support.boxModel) {
					if (bot && noBottomFold) continue;
					for (var c in opts) {
						if (!opts[c]) continue;
						if (bot && (c == 'TL' || c == 'TR')) continue;
						if (!bot && (c == 'BL' || c == 'BR')) continue;
						
						var common = { position: 'absolute', border: 'none', margin: 0, padding: 0, overflow: 'hidden', backgroundColor: strip.style.borderColor };
						var $horz = $('<div/>').css(common).css({ width: width + 'px', height: '1px' });
						switch(c) {
						case 'TL': $horz.css({ bottom: 0, left: 0 }); break;
						case 'TR': $horz.css({ bottom: 0, right: 0 }); break;
						case 'BL': $horz.css({ top: 0, left: 0 }); break;
						case 'BR': $horz.css({ top: 0, right: 0 }); break;
						}
						d.appendChild($horz[0]);
						
						var $vert = $('<div/>').css(common).css({ top: 0, bottom: 0, width: '1px', height: width + 'px' });
						switch(c) {
						case 'TL': $vert.css({ left: width }); break;
						case 'TR': $vert.css({ right: width }); break;
						case 'BL': $vert.css({ left: width }); break;
						case 'BR': $vert.css({ right: width }); break;
						}
						d.appendChild($vert[0]);
					}
				}
            }
        }
    });
};

$.fn.uncorner = function() { 
	if (radius || moz || webkit)
		this.css(radius ? 'border-radius' : moz ? '-moz-border-radius' : '-webkit-border-radius', 0);
	$('div.jquery-corner', this).remove();
	return this;
};

// expose options
$.fn.corner.defaults = {
	useNative: true, // true if plugin should attempt to use native browser support for border radius rounding
	metaAttr:  'data-corner' // name of meta attribute to use for options
};
    
})(jQuery);


/* jquery/jquery.selectboxes.js */

/*
 *
 * Copyright (c) 2006-2009 Sam Collett (http://www.texotela.co.uk)
 * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
 * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
 *
 * Version 2.2.4
 * Demo: http://www.texotela.co.uk/code/jquery/select/
 *
 * $LastChangedDate$
 * $Rev$
 *
 */
 
;(function($) {
 
/**
 * Adds (single/multiple) options to a select box (or series of select boxes)
 *
 * @name     addOption
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     jQuery
 * @example  $("#myselect").addOption("Value", "Text"); // add single value (will be selected)
 * @example  $("#myselect").addOption("Value 2", "Text 2", false); // add single value (won't be selected)
 * @example  $("#myselect").addOption({"foo":"bar","bar":"baz"}, false); // add multiple values, but don't select
 *
 */
$.fn.addOption = function()
{
	var add = function(el, v, t, sO)
	{
		var option = document.createElement("option");
		option.value = v, option.text = t;
		// get options
		var o = el.options;
		// get number of options
		var oL = o.length;
		if(!el.cache)
		{
			el.cache = {};
			// loop through existing options, adding to cache
			for(var i = 0; i < oL; i++)
			{
				el.cache[o[i].value] = i;
			}
		}
		// add to cache if it isn't already
		if(typeof el.cache[v] == "undefined") el.cache[v] = oL;
		el.options[el.cache[v]] = option;
		if(sO)
		{
			option.selected = true;
		}
	};
	
	var a = arguments;
	if(a.length == 0) return this;
	// select option when added? default is true
	var sO = true;
	// multiple items
	var m = false;
	// other variables
	var items, v, t;
	if(typeof(a[0]) == "object")
	{
		m = true;
		items = a[0];
	}
	if(a.length >= 2)
	{
		if(typeof(a[1]) == "boolean") sO = a[1];
		else if(typeof(a[2]) == "boolean") sO = a[2];
		if(!m)
		{
			v = a[0];
			t = a[1];
		}
	}
	this.each(
		function()
		{
			if(this.nodeName.toLowerCase() != "select") return;
			if(m)
			{
				for(var item in items)
				{
					add(this, item, items[item], sO);
				}
			}
			else
			{
				add(this, v, t, sO);
			}
		}
	);
	return this;
};

/**
 * Add options via ajax
 *
 * @name     ajaxAddOption
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     jQuery
 * @param    String url      Page to get options from (must be valid JSON)
 * @param    Object params   (optional) Any parameters to send with the request
 * @param    Boolean select  (optional) Select the added options, default true
 * @param    Function fn     (optional) Call this function with the select object as param after completion
 * @param    Array args      (optional) Array with params to pass to the function afterwards
 * @example  $("#myselect").ajaxAddOption("myoptions.php");
 * @example  $("#myselect").ajaxAddOption("myoptions.php", {"code" : "007"});
 * @example  $("#myselect").ajaxAddOption("myoptions.php", {"code" : "007"}, false, sortoptions, [{"dir": "desc"}]);
 *
 */
$.fn.ajaxAddOption = function(url, params, select, fn, args)
{
	if(typeof(url) != "string") return this;
	if(typeof(params) != "object") params = {};
	if(typeof(select) != "boolean") select = true;
	this.each(
		function()
		{
			var el = this;
			$.getJSON(url,
				params,
				function(r)
				{
					$(el).addOption(r, select);
					if(typeof fn == "function")
					{
						if(typeof args == "object")
						{
							fn.apply(el, args);
						} 
						else
						{
							fn.call(el);
						}
					}
				}
			);
		}
	);
	return this;
};

/**
 * Removes an option (by value or index) from a select box (or series of select boxes)
 *
 * @name     removeOption
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     jQuery
 * @param    String|RegExp|Number what  Option to remove
 * @param    Boolean selectedOnly       (optional) Remove only if it has been selected (default false)   
 * @example  $("#myselect").removeOption("Value"); // remove by value
 * @example  $("#myselect").removeOption(/^val/i); // remove options with a value starting with 'val'
 * @example  $("#myselect").removeOption(/./); // remove all options
 * @example  $("#myselect").removeOption(/./, true); // remove all options that have been selected
 * @example  $("#myselect").removeOption(0); // remove by index
 * @example  $("#myselect").removeOption(["myselect_1","myselect_2"]); // values contained in passed array
 *
 */
$.fn.removeOption = function()
{
	var a = arguments;
	if(a.length == 0) return this;
	var ta = typeof(a[0]);
	var v, index;
	// has to be a string or regular expression (object in IE, function in Firefox)
	if(ta == "string" || ta == "object" || ta == "function" )
	{
		v = a[0];
		// if an array, remove items
		if(v.constructor == Array)
		{
			var l = v.length;
			for(var i = 0; i<l; i++)
			{
				this.removeOption(v[i], a[1]); 
			}
			return this;
		}
	}
	else if(ta == "number") index = a[0];
	else return this;
	this.each(
		function()
		{
			if(this.nodeName.toLowerCase() != "select") return;
			// clear cache
			if(this.cache) this.cache = null;
			// does the option need to be removed?
			var remove = false;
			// get options
			var o = this.options;
			if(!!v)
			{
				// get number of options
				var oL = o.length;
				for(var i=oL-1; i>=0; i--)
				{
					if(v.constructor == RegExp)
					{
						if(o[i].value.match(v))
						{
							remove = true;
						}
					}
					else if(o[i].value == v)
					{
						remove = true;
					}
					// if the option is only to be removed if selected
					if(remove && a[1] === true) remove = o[i].selected;
					if(remove)
					{
						o[i] = null;
					}
					remove = false;
				}
			}
			else
			{
				// only remove if selected?
				if(a[1] === true)
				{
					remove = o[index].selected;
				}
				else
				{
					remove = true;
				}
				if(remove)
				{
					this.remove(index);
				}
			}
		}
	);
	return this;
};

/**
 * Sort options (ascending or descending) in a select box (or series of select boxes)
 *
 * @name     sortOptions
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     jQuery
 * @param    Boolean ascending   (optional) Sort ascending (true/undefined), or descending (false)
 * @example  // ascending
 * $("#myselect").sortOptions(); // or $("#myselect").sortOptions(true);
 * @example  // descending
 * $("#myselect").sortOptions(false);
 *
 */
$.fn.sortOptions = function(ascending)
{
	// get selected values first
	var sel = $(this).selectedValues();
	var a = typeof(ascending) == "undefined" ? true : !!ascending;
	this.each(
		function()
		{
			if(this.nodeName.toLowerCase() != "select") return;
			// get options
			var o = this.options;
			// get number of options
			var oL = o.length;
			// create an array for sorting
			var sA = [];
			// loop through options, adding to sort array
			for(var i = 0; i<oL; i++)
			{
				sA[i] = {
					v: o[i].value,
					t: o[i].text
				}
			}
			// sort items in array
			sA.sort(
				function(o1, o2)
				{
					// option text is made lowercase for case insensitive sorting
					o1t = o1.t.toLowerCase(), o2t = o2.t.toLowerCase();
					// if options are the same, no sorting is needed
					if(o1t == o2t) return 0;
					if(a)
					{
						return o1t < o2t ? -1 : 1;
					}
					else
					{
						return o1t > o2t ? -1 : 1;
					}
				}
			);
			// change the options to match the sort array
			for(var i = 0; i<oL; i++)
			{
				o[i].text = sA[i].t;
				o[i].value = sA[i].v;
			}
		}
	).selectOptions(sel, true); // select values, clearing existing ones
	return this;
};
/**
 * Selects an option by value
 *
 * @name     selectOptions
 * @author   Mathias Bank (http://www.mathias-bank.de), original function
 * @author   Sam Collett (http://www.texotela.co.uk), addition of regular expression matching
 * @type     jQuery
 * @param    String|RegExp|Array value  Which options should be selected
 * can be a string or regular expression, or an array of strings / regular expressions
 * @param    Boolean clear  Clear existing selected options, default false
 * @example  $("#myselect").selectOptions("val1"); // with the value 'val1'
 * @example  $("#myselect").selectOptions(["val1","val2","val3"]); // with the values 'val1' 'val2' 'val3'
 * @example  $("#myselect").selectOptions(/^val/i); // with the value starting with 'val', case insensitive
 *
 */
$.fn.selectOptions = function(value, clear)
{
	var v = value;
	var vT = typeof(value);
	// handle arrays
	if(vT == "object" && v.constructor == Array)
	{
		var $this = this;
		$.each(v, function()
			{
      				$this.selectOptions(this, clear);
    			}
		);
	};
	var c = clear || false;
	// has to be a string or regular expression (object in IE, function in Firefox)
	if(vT != "string" && vT != "function" && vT != "object") return this;
	this.each(
		function()
		{
			if(this.nodeName.toLowerCase() != "select") return this;
			// get options
			var o = this.options;
			// get number of options
			var oL = o.length;
			for(var i = 0; i<oL; i++)
			{
				if(v.constructor == RegExp)
				{
					if(o[i].value.match(v))
					{
						o[i].selected = true;
					}
					else if(c)
					{
						o[i].selected = false;
					}
				}
				else
				{
					if(o[i].value == v)
					{
						o[i].selected = true;
					}
					else if(c)
					{
						o[i].selected = false;
					}
				}
			}
		}
	);
	return this;
};

/**
 * Copy options to another select
 *
 * @name     copyOptions
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     jQuery
 * @param    String to  Element to copy to
 * @param    String which  (optional) Specifies which options should be copied - 'all' or 'selected'. Default is 'selected'
 * @example  $("#myselect").copyOptions("#myselect2"); // copy selected options from 'myselect' to 'myselect2'
 * @example  $("#myselect").copyOptions("#myselect2","selected"); // same as above
 * @example  $("#myselect").copyOptions("#myselect2","all"); // copy all options from 'myselect' to 'myselect2'
 *
 */
$.fn.copyOptions = function(to, which)
{
	var w = which || "selected";
	if($(to).size() == 0) return this;
	this.each(
		function()
		{
			if(this.nodeName.toLowerCase() != "select") return this;
			// get options
			var o = this.options;
			// get number of options
			var oL = o.length;
			for(var i = 0; i<oL; i++)
			{
				if(w == "all" || (w == "selected" && o[i].selected))
				{
					$(to).addOption(o[i].value, o[i].text);
				}
			}
		}
	);
	return this;
};

/**
 * Checks if a select box has an option with the supplied value
 *
 * @name     containsOption
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     Boolean|jQuery
 * @param    String|RegExp value  Which value to check for. Can be a string or regular expression
 * @param    Function fn          (optional) Function to apply if an option with the given value is found.
 * Use this if you don't want to break the chaining
 * @example  if($("#myselect").containsOption("val1")) alert("Has an option with the value 'val1'");
 * @example  if($("#myselect").containsOption(/^val/i)) alert("Has an option with the value starting with 'val'");
 * @example  $("#myselect").containsOption("val1", copyoption).doSomethingElseWithSelect(); // calls copyoption (user defined function) for any options found, chain is continued
 *
 */
$.fn.containsOption = function(value, fn)
{
	var found = false;
	var v = value;
	var vT = typeof(v);
	var fT = typeof(fn);
	// has to be a string or regular expression (object in IE, function in Firefox)
	if(vT != "string" && vT != "function" && vT != "object") return fT == "function" ? this: found;
	this.each(
		function()
		{
			if(this.nodeName.toLowerCase() != "select") return this;
			// option already found
			if(found && fT != "function") return false;
			// get options
			var o = this.options;
			// get number of options
			var oL = o.length;
			for(var i = 0; i<oL; i++)
			{
				if(v.constructor == RegExp)
				{
					if (o[i].value.match(v))
					{
						found = true;
						if(fT == "function") fn.call(o[i], i);
					}
				}
				else
				{
					if (o[i].value == v)
					{
						found = true;
						if(fT == "function") fn.call(o[i], i);
					}
				}
			}
		}
	);
	return fT == "function" ? this : found;
};

/**
 * Returns values which have been selected
 *
 * @name     selectedValues
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     Array
 * @example  $("#myselect").selectedValues();
 *
 */
$.fn.selectedValues = function()
{
	var v = [];
	this.selectedOptions().each(
		function()
		{
			v[v.length] = this.value;
		}
	);
	return v;
};

/**
 * Returns text which has been selected
 *
 * @name     selectedTexts
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     Array
 * @example  $("#myselect").selectedTexts();
 *
 */
$.fn.selectedTexts = function()
{
	var t = [];
	this.selectedOptions().each(
		function()
		{
			t[t.length] = this.text;
		}
	);
	return t;
};

/**
 * Returns options which have been selected
 *
 * @name     selectedOptions
 * @author   Sam Collett (http://www.texotela.co.uk)
 * @type     jQuery
 * @example  $("#myselect").selectedOptions();
 *
 */
$.fn.selectedOptions = function()
{
	return this.find("option:selected");
};

})(jQuery);

/* jquery/jquery.qtip.js */

/*
 * jquery.qtip. The jQuery tooltip plugin
 *
 * Copyright (c) 2009 Craig Thompson
 * http://craigsworks.com
 *
 * Licensed under MIT
 * http://www.opensource.org/licenses/mit-license.php
 *
 * Launch  : February 2009
 * Version : 1.0.0-rc3
 * Released: Tuesday 12th May, 2009 - 00:00
 * Debug: jquery.qtip.debug.js
 */
(function(f){f.fn.qtip=function(B,u){var y,t,A,s,x,w,v,z;if(typeof B=="string"){if(typeof f(this).data("qtip")!=="object"){f.fn.qtip.log.error.call(self,1,f.fn.qtip.constants.NO_TOOLTIP_PRESENT,false)}if(B=="api"){return f(this).data("qtip").interfaces[f(this).data("qtip").current]}else{if(B=="interfaces"){return f(this).data("qtip").interfaces}}}else{if(!B){B={}}if(typeof B.content!=="object"||(B.content.jquery&&B.content.length>0)){B.content={text:B.content}}if(typeof B.content.title!=="object"){B.content.title={text:B.content.title}}if(typeof B.position!=="object"){B.position={corner:B.position}}if(typeof B.position.corner!=="object"){B.position.corner={target:B.position.corner,tooltip:B.position.corner}}if(typeof B.show!=="object"){B.show={when:B.show}}if(typeof B.show.when!=="object"){B.show.when={event:B.show.when}}if(typeof B.show.effect!=="object"){B.show.effect={type:B.show.effect}}if(typeof B.hide!=="object"){B.hide={when:B.hide}}if(typeof B.hide.when!=="object"){B.hide.when={event:B.hide.when}}if(typeof B.hide.effect!=="object"){B.hide.effect={type:B.hide.effect}}if(typeof B.style!=="object"){B.style={name:B.style}}B.style=c(B.style);s=f.extend(true,{},f.fn.qtip.defaults,B);s.style=a.call({options:s},s.style);s.user=f.extend(true,{},B)}return f(this).each(function(){if(typeof B=="string"){w=B.toLowerCase();A=f(this).qtip("interfaces");if(typeof A=="object"){if(u===true&&w=="destroy"){while(A.length>0){A[A.length-1].destroy()}}else{if(u!==true){A=[f(this).qtip("api")]}for(y=0;y<A.length;y++){if(w=="destroy"){A[y].destroy()}else{if(A[y].status.rendered===true){if(w=="show"){A[y].show()}else{if(w=="hide"){A[y].hide()}else{if(w=="focus"){A[y].focus()}else{if(w=="disable"){A[y].disable(true)}else{if(w=="enable"){A[y].disable(false)}}}}}}}}}}}else{v=f.extend(true,{},s);v.hide.effect.length=s.hide.effect.length;v.show.effect.length=s.show.effect.length;if(v.position.container===false){v.position.container=f(document.body)}if(v.position.target===false){v.position.target=f(this)}if(v.show.when.target===false){v.show.when.target=f(this)}if(v.hide.when.target===false){v.hide.when.target=f(this)}t=f.fn.qtip.interfaces.length;for(y=0;y<t;y++){if(typeof f.fn.qtip.interfaces[y]=="undefined"){t=y;break}}x=new d(f(this),v,t);f.fn.qtip.interfaces[t]=x;if(typeof f(this).data("qtip")=="object"){if(typeof f(this).attr("qtip")==="undefined"){f(this).data("qtip").current=f(this).data("qtip").interfaces.length}f(this).data("qtip").interfaces.push(x)}else{f(this).data("qtip",{current:0,interfaces:[x]})}if(v.content.prerender===false&&v.show.when.event!==false&&v.show.ready!==true){v.show.when.target.bind(v.show.when.event+".qtip-"+t+"-create",{qtip:t},function(C){z=f.fn.qtip.interfaces[C.data.qtip];z.options.show.when.target.unbind(z.options.show.when.event+".qtip-"+C.data.qtip+"-create");z.cache.mouse={x:C.pageX,y:C.pageY};p.call(z);z.options.show.when.target.trigger(z.options.show.when.event)})}else{x.cache.mouse={x:v.show.when.target.offset().left,y:v.show.when.target.offset().top};p.call(x)}}})};function d(u,t,v){var s=this;s.id=v;s.options=t;s.status={animated:false,rendered:false,disabled:false,focused:false};s.elements={target:u.addClass(s.options.style.classes.target),tooltip:null,wrapper:null,content:null,contentWrapper:null,title:null,button:null,tip:null,bgiframe:null};s.cache={mouse:{},position:{},toggle:0};s.timers={};f.extend(s,s.options.api,{show:function(y){var x,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"show")}if(s.elements.tooltip.css("display")!=="none"){return s}s.elements.tooltip.stop(true,false);x=s.beforeShow.call(s,y);if(x===false){return s}function w(){if(s.options.position.type!=="static"){s.focus()}s.onShow.call(s,y);if(f.browser.msie){s.elements.tooltip.get(0).style.removeAttribute("filter")}}s.cache.toggle=1;if(s.options.position.type!=="static"){s.updatePosition(y,(s.options.show.effect.length>0))}if(typeof s.options.show.solo=="object"){z=f(s.options.show.solo)}else{if(s.options.show.solo===true){z=f("div.qtip").not(s.elements.tooltip)}}if(z){z.each(function(){if(f(this).qtip("api").status.rendered===true){f(this).qtip("api").hide()}})}if(typeof s.options.show.effect.type=="function"){s.options.show.effect.type.call(s.elements.tooltip,s.options.show.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.show.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeIn(s.options.show.effect.length,w);break;case"slide":s.elements.tooltip.slideDown(s.options.show.effect.length,function(){w();if(s.options.position.type!=="static"){s.updatePosition(y,true)}});break;case"grow":s.elements.tooltip.show(s.options.show.effect.length,w);break;default:s.elements.tooltip.show(null,w);break}s.elements.tooltip.addClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_SHOWN,"show")},hide:function(y){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"hide")}else{if(s.elements.tooltip.css("display")==="none"){return s}}clearTimeout(s.timers.show);s.elements.tooltip.stop(true,false);x=s.beforeHide.call(s,y);if(x===false){return s}function w(){s.onHide.call(s,y)}s.cache.toggle=0;if(typeof s.options.hide.effect.type=="function"){s.options.hide.effect.type.call(s.elements.tooltip,s.options.hide.effect.length);s.elements.tooltip.queue(function(){w();f(this).dequeue()})}else{switch(s.options.hide.effect.type.toLowerCase()){case"fade":s.elements.tooltip.fadeOut(s.options.hide.effect.length,w);break;case"slide":s.elements.tooltip.slideUp(s.options.hide.effect.length,w);break;case"grow":s.elements.tooltip.hide(s.options.hide.effect.length,w);break;default:s.elements.tooltip.hide(null,w);break}s.elements.tooltip.removeClass(s.options.style.classes.active)}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_HIDDEN,"hide")},updatePosition:function(w,x){var C,G,L,J,H,E,y,I,B,D,K,A,F,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updatePosition")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_POSITION_STATIC,"updatePosition")}}G={position:{left:0,top:0},dimensions:{height:0,width:0},corner:s.options.position.corner.target};L={position:s.getPosition(),dimensions:s.getDimensions(),corner:s.options.position.corner.tooltip};if(s.options.position.target!=="mouse"){if(s.options.position.target.get(0).nodeName.toLowerCase()=="area"){J=s.options.position.target.attr("coords").split(",");for(C=0;C<J.length;C++){J[C]=parseInt(J[C])}H=s.options.position.target.parent("map").attr("name");E=f('img[usemap="#'+H+'"]:first').offset();G.position={left:Math.floor(E.left+J[0]),top:Math.floor(E.top+J[1])};switch(s.options.position.target.attr("shape").toLowerCase()){case"rect":G.dimensions={width:Math.ceil(Math.abs(J[2]-J[0])),height:Math.ceil(Math.abs(J[3]-J[1]))};break;case"circle":G.dimensions={width:J[2]+1,height:J[2]+1};break;case"poly":G.dimensions={width:J[0],height:J[1]};for(C=0;C<J.length;C++){if(C%2==0){if(J[C]>G.dimensions.width){G.dimensions.width=J[C]}if(J[C]<J[0]){G.position.left=Math.floor(E.left+J[C])}}else{if(J[C]>G.dimensions.height){G.dimensions.height=J[C]}if(J[C]<J[1]){G.position.top=Math.floor(E.top+J[C])}}}G.dimensions.width=G.dimensions.width-(G.position.left-E.left);G.dimensions.height=G.dimensions.height-(G.position.top-E.top);break;default:return f.fn.qtip.log.error.call(s,4,f.fn.qtip.constants.INVALID_AREA_SHAPE,"updatePosition");break}G.dimensions.width-=2;G.dimensions.height-=2}else{if(s.options.position.target.add(document.body).length===1){G.position={left:f(document).scrollLeft(),top:f(document).scrollTop()};G.dimensions={height:f(window).height(),width:f(window).width()}}else{if(typeof s.options.position.target.attr("qtip")!=="undefined"){G.position=s.options.position.target.qtip("api").cache.position}else{G.position=s.options.position.target.offset()}G.dimensions={height:s.options.position.target.outerHeight(),width:s.options.position.target.outerWidth()}}}y=f.extend({},G.position);if(G.corner.search(/right/i)!==-1){y.left+=G.dimensions.width}if(G.corner.search(/bottom/i)!==-1){y.top+=G.dimensions.height}if(G.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left+=(G.dimensions.width/2)}if(G.corner.search(/((left|right)Middle)|center/)!==-1){y.top+=(G.dimensions.height/2)}}else{G.position=y={left:s.cache.mouse.x,top:s.cache.mouse.y};G.dimensions={height:1,width:1}}if(L.corner.search(/right/i)!==-1){y.left-=L.dimensions.width}if(L.corner.search(/bottom/i)!==-1){y.top-=L.dimensions.height}if(L.corner.search(/((top|bottom)Middle)|center/)!==-1){y.left-=(L.dimensions.width/2)}if(L.corner.search(/((left|right)Middle)|center/)!==-1){y.top-=(L.dimensions.height/2)}I=(f.browser.msie)?1:0;B=(f.browser.msie&&parseInt(f.browser.version.charAt(0))===6)?1:0;if(s.options.style.border.radius>0){if(L.corner.search(/Left/)!==-1){y.left-=s.options.style.border.radius}else{if(L.corner.search(/Right/)!==-1){y.left+=s.options.style.border.radius}}if(L.corner.search(/Top/)!==-1){y.top-=s.options.style.border.radius}else{if(L.corner.search(/Bottom/)!==-1){y.top+=s.options.style.border.radius}}}if(I){if(L.corner.search(/top/)!==-1){y.top-=I}else{if(L.corner.search(/bottom/)!==-1){y.top+=I}}if(L.corner.search(/left/)!==-1){y.left-=I}else{if(L.corner.search(/right/)!==-1){y.left+=I}}if(L.corner.search(/leftMiddle|rightMiddle/)!==-1){y.top-=1}}if(s.options.position.adjust.screen===true){y=o.call(s,y,G,L)}if(s.options.position.target==="mouse"&&s.options.position.adjust.mouse===true){if(s.options.position.adjust.screen===true&&s.elements.tip){K=s.elements.tip.attr("rel")}else{K=s.options.position.corner.tooltip}y.left+=(K.search(/right/i)!==-1)?-6:6;y.top+=(K.search(/bottom/i)!==-1)?-6:6}if(!s.elements.bgiframe&&f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){f("select, object").each(function(){A=f(this).offset();A.bottom=A.top+f(this).height();A.right=A.left+f(this).width();if(y.top+L.dimensions.height>=A.top&&y.left+L.dimensions.width>=A.left){k.call(s)}})}y.left+=s.options.position.adjust.x;y.top+=s.options.position.adjust.y;F=s.getPosition();if(y.left!=F.left||y.top!=F.top){z=s.beforePositionUpdate.call(s,w);if(z===false){return s}s.cache.position=y;if(x===true){s.status.animated=true;s.elements.tooltip.animate(y,200,"swing",function(){s.status.animated=false})}else{s.elements.tooltip.css(y)}s.onPositionUpdate.call(s,w);if(typeof w!=="undefined"&&w.type&&w.type!=="mousemove"){f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_POSITION_UPDATED,"updatePosition")}}return s},updateWidth:function(w){var x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateWidth")}else{if(w&&typeof w!=="number"){return f.fn.qtip.log.error.call(s,2,"newWidth must be of type number","updateWidth")}}x=s.elements.contentWrapper.siblings().add(s.elements.tip).add(s.elements.button);if(!w){if(typeof s.options.style.width.value=="number"){w=s.options.style.width.value}else{s.elements.tooltip.css({width:"auto"});x.hide();if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"normal"})}w=s.getDimensions().width+1;if(!s.options.style.width.value){if(w>s.options.style.width.max){w=s.options.style.width.max}if(w<s.options.style.width.min){w=s.options.style.width.min}}}}if(w%2!==0){w-=1}s.elements.tooltip.width(w);x.show();if(s.options.style.border.radius){s.elements.tooltip.find(".qtip-betweenCorners").each(function(y){f(this).width(w-(s.options.style.border.radius*2))})}if(f.browser.msie){s.elements.wrapper.add(s.elements.contentWrapper.children()).css({zoom:"1"});s.elements.wrapper.width(w);if(s.elements.bgiframe){s.elements.bgiframe.width(w).height(s.getDimensions.height)}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_WIDTH_UPDATED,"updateWidth")},updateStyle:function(w){var z,A,x,y,B;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateStyle")}else{if(typeof w!=="string"||!f.fn.qtip.styles[w]){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.STYLE_NOT_DEFINED,"updateStyle")}}s.options.style=a.call(s,f.fn.qtip.styles[w],s.options.user.style);s.elements.content.css(q(s.options.style));if(s.options.content.title.text!==false){s.elements.title.css(q(s.options.style.title,true))}s.elements.contentWrapper.css({borderColor:s.options.style.border.color});if(s.options.style.tip.corner!==false){if(f("<canvas>").get(0).getContext){z=s.elements.tooltip.find(".qtip-tip canvas:first");x=z.get(0).getContext("2d");x.clearRect(0,0,300,300);y=z.parent("div[rel]:first").attr("rel");B=b(y,s.options.style.tip.size.width,s.options.style.tip.size.height);h.call(s,z,B,s.options.style.tip.color||s.options.style.border.color)}else{if(f.browser.msie){z=s.elements.tooltip.find('.qtip-tip [nodeName="shape"]');z.attr("fillcolor",s.options.style.tip.color||s.options.style.border.color)}}}if(s.options.style.border.radius>0){s.elements.tooltip.find(".qtip-betweenCorners").css({backgroundColor:s.options.style.border.color});if(f("<canvas>").get(0).getContext){A=g(s.options.style.border.radius);s.elements.tooltip.find(".qtip-wrapper canvas").each(function(){x=f(this).get(0).getContext("2d");x.clearRect(0,0,300,300);y=f(this).parent("div[rel]:first").attr("rel");r.call(s,f(this),A[y],s.options.style.border.radius,s.options.style.border.color)})}else{if(f.browser.msie){s.elements.tooltip.find('.qtip-wrapper [nodeName="arc"]').each(function(){f(this).attr("fillcolor",s.options.style.border.color)})}}}return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_STYLE_UPDATED,"updateStyle")},updateContent:function(A,y){var z,x,w;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateContent")}else{if(!A){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateContent")}}z=s.beforeContentUpdate.call(s,A);if(typeof z=="string"){A=z}else{if(z===false){return}}if(f.browser.msie){s.elements.contentWrapper.children().css({zoom:"normal"})}if(A.jquery&&A.length>0){A.clone(true).appendTo(s.elements.content).show()}else{s.elements.content.html(A)}x=s.elements.content.find("img[complete=false]");if(x.length>0){w=0;x.each(function(C){f('<img src="'+f(this).attr("src")+'" />').load(function(){if(++w==x.length){B()}})})}else{B()}function B(){s.updateWidth();if(y!==false){if(s.options.position.type!=="static"){s.updatePosition(s.elements.tooltip.is(":visible"),true)}if(s.options.style.tip.corner!==false){n.call(s)}}}s.onContentUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_UPDATED,"loadContent")},loadContent:function(w,z,A){var y;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"loadContent")}y=s.beforeContentLoad.call(s);if(y===false){return s}if(A=="post"){f.post(w,z,x)}else{f.get(w,z,x)}function x(B){s.onContentLoad.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_CONTENT_LOADED,"loadContent");s.updateContent(B)}return s},updateTitle:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"updateTitle")}else{if(!w){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.NO_CONTENT_PROVIDED,"updateTitle")}}returned=s.beforeTitleUpdate.call(s);if(returned===false){return s}if(s.elements.button){s.elements.button=s.elements.button.clone(true)}s.elements.title.html(w);if(s.elements.button){s.elements.title.prepend(s.elements.button)}s.onTitleUpdate.call(s);return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_TITLE_UPDATED,"updateTitle")},focus:function(A){var y,x,w,z;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"focus")}else{if(s.options.position.type=="static"){return f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.CANNOT_FOCUS_STATIC,"focus")}}y=parseInt(s.elements.tooltip.css("z-index"));x=6000+f("div.qtip[qtip]").length-1;if(!s.status.focused&&y!==x){z=s.beforeFocus.call(s,A);if(z===false){return s}f("div.qtip[qtip]").not(s.elements.tooltip).each(function(){if(f(this).qtip("api").status.rendered===true){w=parseInt(f(this).css("z-index"));if(typeof w=="number"&&w>-1){f(this).css({zIndex:parseInt(f(this).css("z-index"))-1})}f(this).qtip("api").status.focused=false}});s.elements.tooltip.css({zIndex:x});s.status.focused=true;s.onFocus.call(s,A);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_FOCUSED,"focus")}return s},disable:function(w){if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"disable")}if(w){if(!s.status.disabled){s.status.disabled=true;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DISABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_DISABLED,"disable")}}else{if(s.status.disabled){s.status.disabled=false;f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_ENABLED,"disable")}else{f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.TOOLTIP_ALREADY_ENABLED,"disable")}}return s},destroy:function(){var w,x,y;x=s.beforeDestroy.call(s);if(x===false){return s}if(s.status.rendered){s.options.show.when.target.unbind("mousemove.qtip",s.updatePosition);s.options.show.when.target.unbind("mouseout.qtip",s.hide);s.options.show.when.target.unbind(s.options.show.when.event+".qtip");s.options.hide.when.target.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind(s.options.hide.when.event+".qtip");s.elements.tooltip.unbind("mouseover.qtip",s.focus);s.elements.tooltip.remove()}else{s.options.show.when.target.unbind(s.options.show.when.event+".qtip-create")}if(typeof s.elements.target.data("qtip")=="object"){y=s.elements.target.data("qtip").interfaces;if(typeof y=="object"&&y.length>0){for(w=0;w<y.length-1;w++){if(y[w].id==s.id){y.splice(w,1)}}}}delete f.fn.qtip.interfaces[s.id];if(typeof y=="object"&&y.length>0){s.elements.target.data("qtip").current=y.length-1}else{s.elements.target.removeData("qtip")}s.onDestroy.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_DESTROYED,"destroy");return s.elements.target},getPosition:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getPosition")}w=(s.elements.tooltip.css("display")!=="none")?false:true;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x=s.elements.tooltip.offset();if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x},getDimensions:function(){var w,x;if(!s.status.rendered){return f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.TOOLTIP_NOT_RENDERED,"getDimensions")}w=(!s.elements.tooltip.is(":visible"))?true:false;if(w){s.elements.tooltip.css({visiblity:"hidden"}).show()}x={height:s.elements.tooltip.outerHeight(),width:s.elements.tooltip.outerWidth()};if(w){s.elements.tooltip.css({visiblity:"visible"}).hide()}return x}})}function p(){var s,w,u,t,v,y,x;s=this;s.beforeRender.call(s);s.status.rendered=true;s.elements.tooltip='<div qtip="'+s.id+'" class="qtip '+(s.options.style.classes.tooltip||s.options.style)+'"style="display:none; -moz-border-radius:0; -webkit-border-radius:0; border-radius:0;position:'+s.options.position.type+';">  <div class="qtip-wrapper" style="position:relative; overflow:hidden; text-align:left;">    <div class="qtip-contentWrapper" style="overflow:hidden;">       <div class="qtip-content '+s.options.style.classes.content+'"></div></div></div></div>';s.elements.tooltip=f(s.elements.tooltip);s.elements.tooltip.appendTo(s.options.position.container);s.elements.tooltip.data("qtip",{current:0,interfaces:[s]});s.elements.wrapper=s.elements.tooltip.children("div:first");s.elements.contentWrapper=s.elements.wrapper.children("div:first").css({background:s.options.style.background});s.elements.content=s.elements.contentWrapper.children("div:first").css(q(s.options.style));if(f.browser.msie){s.elements.wrapper.add(s.elements.content).css({zoom:1})}if(s.options.hide.when.event=="unfocus"){s.elements.tooltip.attr("unfocus",true)}if(typeof s.options.style.width.value=="number"){s.updateWidth()}if(f("<canvas>").get(0).getContext||f.browser.msie){if(s.options.style.border.radius>0){m.call(s)}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color})}if(s.options.style.tip.corner!==false){e.call(s)}}else{s.elements.contentWrapper.css({border:s.options.style.border.width+"px solid "+s.options.style.border.color});s.options.style.border.radius=0;s.options.style.tip.corner=false;f.fn.qtip.log.error.call(s,2,f.fn.qtip.constants.CANVAS_VML_NOT_SUPPORTED,"render")}if((typeof s.options.content.text=="string"&&s.options.content.text.length>0)||(s.options.content.text.jquery&&s.options.content.text.length>0)){u=s.options.content.text}else{if(typeof s.elements.target.attr("title")=="string"&&s.elements.target.attr("title").length>0){u=s.elements.target.attr("title").replace("\\n","<br />");s.elements.target.attr("title","")}else{if(typeof s.elements.target.attr("alt")=="string"&&s.elements.target.attr("alt").length>0){u=s.elements.target.attr("alt").replace("\\n","<br />");s.elements.target.attr("alt","")}else{u=" ";f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.NO_VALID_CONTENT,"render")}}}if(s.options.content.title.text!==false){j.call(s)}s.updateContent(u);l.call(s);if(s.options.show.ready===true){s.show()}if(s.options.content.url!==false){t=s.options.content.url;v=s.options.content.data;y=s.options.content.method||"get";s.loadContent(t,v,y)}s.onRender.call(s);f.fn.qtip.log.error.call(s,1,f.fn.qtip.constants.EVENT_RENDERED,"render")}function m(){var F,z,t,B,x,E,u,G,D,y,w,C,A,s,v;F=this;F.elements.wrapper.find(".qtip-borderBottom, .qtip-borderTop").remove();t=F.options.style.border.width;B=F.options.style.border.radius;x=F.options.style.border.color||F.options.style.tip.color;E=g(B);u={};for(z in E){u[z]='<div rel="'+z+'" style="'+((z.search(/Left/)!==-1)?"left":"right")+":0; position:absolute; height:"+B+"px; width:"+B+'px; overflow:hidden; line-height:0.1px; font-size:1px">';if(f("<canvas>").get(0).getContext){u[z]+='<canvas height="'+B+'" width="'+B+'" style="vertical-align: top"></canvas>'}else{if(f.browser.msie){G=B*2+3;u[z]+='<v:arc stroked="false" fillcolor="'+x+'" startangle="'+E[z][0]+'" endangle="'+E[z][1]+'" style="width:'+G+"px; height:"+G+"px; margin-top:"+((z.search(/bottom/)!==-1)?-2:-1)+"px; margin-left:"+((z.search(/Right/)!==-1)?E[z][2]-3.5:-1)+'px; vertical-align:top; display:inline-block; behavior:url(#default#VML)"></v:arc>'}}u[z]+="</div>"}D=F.getDimensions().width-(Math.max(t,B)*2);y='<div class="qtip-betweenCorners" style="height:'+B+"px; width:"+D+"px; overflow:hidden; background-color:"+x+'; line-height:0.1px; font-size:1px;">';w='<div class="qtip-borderTop" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.topLeft+u.topRight+y;F.elements.wrapper.prepend(w);C='<div class="qtip-borderBottom" dir="ltr" style="height:'+B+"px; margin-left:"+B+'px; line-height:0.1px; font-size:1px; padding:0;">'+u.bottomLeft+u.bottomRight+y;F.elements.wrapper.append(C);if(f("<canvas>").get(0).getContext){F.elements.wrapper.find("canvas").each(function(){A=E[f(this).parent("[rel]:first").attr("rel")];r.call(F,f(this),A,B,x)})}else{if(f.browser.msie){F.elements.tooltip.append('<v:image style="behavior:url(#default#VML);"></v:image>')}}s=Math.max(B,(B+(t-B)));v=Math.max(t-B,0);F.elements.contentWrapper.css({border:"0px solid "+x,borderWidth:v+"px "+s+"px"})}function r(u,w,s,t){var v=u.get(0).getContext("2d");v.fillStyle=t;v.beginPath();v.arc(w[0],w[1],s,0,Math.PI*2,false);v.fill()}function e(v){var t,s,x,u,w;t=this;if(t.elements.tip!==null){t.elements.tip.remove()}s=t.options.style.tip.color||t.options.style.border.color;if(t.options.style.tip.corner===false){return}else{if(!v){v=t.options.style.tip.corner}}x=b(v,t.options.style.tip.size.width,t.options.style.tip.size.height);t.elements.tip='<div class="'+t.options.style.classes.tip+'" dir="ltr" rel="'+v+'" style="position:absolute; height:'+t.options.style.tip.size.height+"px; width:"+t.options.style.tip.size.width+'px; margin:0 auto; line-height:0.1px; font-size:1px;">';if(f("<canvas>").get(0).getContext){t.elements.tip+='<canvas height="'+t.options.style.tip.size.height+'" width="'+t.options.style.tip.size.width+'"></canvas>'}else{if(f.browser.msie){u=t.options.style.tip.size.width+","+t.options.style.tip.size.height;w="m"+x[0][0]+","+x[0][1];w+=" l"+x[1][0]+","+x[1][1];w+=" "+x[2][0]+","+x[2][1];w+=" xe";t.elements.tip+='<v:shape fillcolor="'+s+'" stroked="false" filled="true" path="'+w+'" coordsize="'+u+'" style="width:'+t.options.style.tip.size.width+"px; height:"+t.options.style.tip.size.height+"px; line-height:0.1px; display:inline-block; behavior:url(#default#VML); vertical-align:"+((v.search(/top/)!==-1)?"bottom":"top")+'"></v:shape>';t.elements.tip+='<v:image style="behavior:url(#default#VML);"></v:image>';t.elements.contentWrapper.css("position","relative")}}t.elements.tooltip.prepend(t.elements.tip+"</div>");t.elements.tip=t.elements.tooltip.find("."+t.options.style.classes.tip).eq(0);if(f("<canvas>").get(0).getContext){h.call(t,t.elements.tip.find("canvas:first"),x,s)}if(v.search(/top/)!==-1&&f.browser.msie&&parseInt(f.browser.version.charAt(0))===6){t.elements.tip.css({marginTop:-4})}n.call(t,v)}function h(t,v,s){var u=t.get(0).getContext("2d");u.fillStyle=s;u.beginPath();u.moveTo(v[0][0],v[0][1]);u.lineTo(v[1][0],v[1][1]);u.lineTo(v[2][0],v[2][1]);u.fill()}function n(u){var t,w,s,x,v;t=this;if(t.options.style.tip.corner===false||!t.elements.tip){return}if(!u){u=t.elements.tip.attr("rel")}w=positionAdjust=(f.browser.msie)?1:0;t.elements.tip.css(u.match(/left|right|top|bottom/)[0],0);if(u.search(/top|bottom/)!==-1){if(f.browser.msie){if(parseInt(f.browser.version.charAt(0))===6){positionAdjust=(u.search(/top/)!==-1)?-3:1}else{positionAdjust=(u.search(/top/)!==-1)?1:2}}if(u.search(/Middle/)!==-1){t.elements.tip.css({left:"50%",marginLeft:-(t.options.style.tip.size.width/2)})}else{if(u.search(/Left/)!==-1){t.elements.tip.css({left:t.options.style.border.radius-w})}else{if(u.search(/Right/)!==-1){t.elements.tip.css({right:t.options.style.border.radius+w})}}}if(u.search(/top/)!==-1){t.elements.tip.css({top:-positionAdjust})}else{t.elements.tip.css({bottom:positionAdjust})}}else{if(u.search(/left|right/)!==-1){if(f.browser.msie){positionAdjust=(parseInt(f.browser.version.charAt(0))===6)?1:((u.search(/left/)!==-1)?1:2)}if(u.search(/Middle/)!==-1){t.elements.tip.css({top:"50%",marginTop:-(t.options.style.tip.size.height/2)})}else{if(u.search(/Top/)!==-1){t.elements.tip.css({top:t.options.style.border.radius-w})}else{if(u.search(/Bottom/)!==-1){t.elements.tip.css({bottom:t.options.style.border.radius+w})}}}if(u.search(/left/)!==-1){t.elements.tip.css({left:-positionAdjust})}else{t.elements.tip.css({right:positionAdjust})}}}s="padding-"+u.match(/left|right|top|bottom/)[0];x=t.options.style.tip.size[(s.search(/left|right/)!==-1)?"width":"height"];t.elements.tooltip.css("padding",0);t.elements.tooltip.css(s,x);if(f.browser.msie&&parseInt(f.browser.version.charAt(0))==6){v=parseInt(t.elements.tip.css("margin-top"))||0;v+=parseInt(t.elements.content.css("margin-top"))||0;t.elements.tip.css({marginTop:v})}}function j(){var s=this;if(s.elements.title!==null){s.elements.title.remove()}s.elements.title=f('<div class="'+s.options.style.classes.title+'">').css(q(s.options.style.title,true)).css({zoom:(f.browser.msie)?1:0}).prependTo(s.elements.contentWrapper);if(s.options.content.title.text){s.updateTitle.call(s,s.options.content.title.text)}if(s.options.content.title.button!==false&&typeof s.options.content.title.button=="string"){s.elements.button=f('<a class="'+s.options.style.classes.button+'" style="float:right; position: relative"></a>').css(q(s.options.style.button,true)).html(s.options.content.title.button).prependTo(s.elements.title).click(function(t){if(!s.status.disabled){s.hide(t)}})}}function l(){var t,v,u,s;t=this;v=t.options.show.when.target;u=t.options.hide.when.target;if(t.options.hide.fixed){u=u.add(t.elements.tooltip)}if(t.options.hide.when.event=="inactive"){s=["click","dblclick","mousedown","mouseup","mousemove","mouseout","mouseenter","mouseleave","mouseover"];function y(z){if(t.status.disabled===true){return}clearTimeout(t.timers.inactive);t.timers.inactive=setTimeout(function(){f(s).each(function(){u.unbind(this+".qtip-inactive");t.elements.content.unbind(this+".qtip-inactive")});t.hide(z)},t.options.hide.delay)}}else{if(t.options.hide.fixed===true){t.elements.tooltip.bind("mouseover.qtip",function(){if(t.status.disabled===true){return}clearTimeout(t.timers.hide)})}}function x(z){if(t.status.disabled===true){return}if(t.options.hide.when.event=="inactive"){f(s).each(function(){u.bind(this+".qtip-inactive",y);t.elements.content.bind(this+".qtip-inactive",y)});y()}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.timers.show=setTimeout(function(){t.show(z)},t.options.show.delay)}function w(z){if(t.status.disabled===true){return}if(t.options.hide.fixed===true&&t.options.hide.when.event.search(/mouse(out|leave)/i)!==-1&&f(z.relatedTarget).parents("div.qtip[qtip]").length>0){z.stopPropagation();z.preventDefault();clearTimeout(t.timers.hide);return false}clearTimeout(t.timers.show);clearTimeout(t.timers.hide);t.elements.tooltip.stop(true,true);t.timers.hide=setTimeout(function(){t.hide(z)},t.options.hide.delay)}if((t.options.show.when.target.add(t.options.hide.when.target).length===1&&t.options.show.when.event==t.options.hide.when.event&&t.options.hide.when.event!=="inactive")||t.options.hide.when.event=="unfocus"){t.cache.toggle=0;v.bind(t.options.show.when.event+".qtip",function(z){if(t.cache.toggle==0){x(z)}else{w(z)}})}else{v.bind(t.options.show.when.event+".qtip",x);if(t.options.hide.when.event!=="inactive"){u.bind(t.options.hide.when.event+".qtip",w)}}if(t.options.position.type.search(/(fixed|absolute)/)!==-1){t.elements.tooltip.bind("mouseover.qtip",t.focus)}if(t.options.position.target==="mouse"&&t.options.position.type!=="static"){v.bind("mousemove.qtip",function(z){t.cache.mouse={x:z.pageX,y:z.pageY};if(t.status.disabled===false&&t.options.position.adjust.mouse===true&&t.options.position.type!=="static"&&t.elements.tooltip.css("display")!=="none"){t.updatePosition(z)}})}}function o(u,v,A){var z,s,x,y,t,w;z=this;if(A.corner=="center"){return v.position}s=f.extend({},u);y={x:false,y:false};t={left:(s.left<f.fn.qtip.cache.screen.scroll.left),right:(s.left+A.dimensions.width+2>=f.fn.qtip.cache.screen.width+f.fn.qtip.cache.screen.scroll.left),top:(s.top<f.fn.qtip.cache.screen.scroll.top),bottom:(s.top+A.dimensions.height+2>=f.fn.qtip.cache.screen.height+f.fn.qtip.cache.screen.scroll.top)};x={left:(t.left&&(A.corner.search(/right/i)!=-1||(A.corner.search(/right/i)==-1&&!t.right))),right:(t.right&&(A.corner.search(/left/i)!=-1||(A.corner.search(/left/i)==-1&&!t.left))),top:(t.top&&A.corner.search(/top/i)==-1),bottom:(t.bottom&&A.corner.search(/bottom/i)==-1)};if(x.left){if(z.options.position.target!=="mouse"){s.left=v.position.left+v.dimensions.width}else{s.left=z.cache.mouse.x}y.x="Left"}else{if(x.right){if(z.options.position.target!=="mouse"){s.left=v.position.left-A.dimensions.width}else{s.left=z.cache.mouse.x-A.dimensions.width}y.x="Right"}}if(x.top){if(z.options.position.target!=="mouse"){s.top=v.position.top+v.dimensions.height}else{s.top=z.cache.mouse.y}y.y="top"}else{if(x.bottom){if(z.options.position.target!=="mouse"){s.top=v.position.top-A.dimensions.height}else{s.top=z.cache.mouse.y-A.dimensions.height}y.y="bottom"}}if(s.left<0){s.left=u.left;y.x=false}if(s.top<0){s.top=u.top;y.y=false}if(z.options.style.tip.corner!==false){s.corner=new String(A.corner);if(y.x!==false){s.corner=s.corner.replace(/Left|Right|Middle/,y.x)}if(y.y!==false){s.corner=s.corner.replace(/top|bottom/,y.y)}if(s.corner!==z.elements.tip.attr("rel")){e.call(z,s.corner)}}return s}function q(u,t){var v,s;v=f.extend(true,{},u);for(s in v){if(t===true&&s.search(/(tip|classes)/i)!==-1){delete v[s]}else{if(!t&&s.search(/(width|border|tip|title|classes|user)/i)!==-1){delete v[s]}}}return v}function c(s){if(typeof s.tip!=="object"){s.tip={corner:s.tip}}if(typeof s.tip.size!=="object"){s.tip.size={width:s.tip.size,height:s.tip.size}}if(typeof s.border!=="object"){s.border={width:s.border}}if(typeof s.width!=="object"){s.width={value:s.width}}if(typeof s.width.max=="string"){s.width.max=parseInt(s.width.max.replace(/([0-9]+)/i,"$1"))}if(typeof s.width.min=="string"){s.width.min=parseInt(s.width.min.replace(/([0-9]+)/i,"$1"))}if(typeof s.tip.size.x=="number"){s.tip.size.width=s.tip.size.x;delete s.tip.size.x}if(typeof s.tip.size.y=="number"){s.tip.size.height=s.tip.size.y;delete s.tip.size.y}return s}function a(){var s,t,u,x,v,w;s=this;u=[true,{}];for(t=0;t<arguments.length;t++){u.push(arguments[t])}x=[f.extend.apply(f,u)];while(typeof x[0].name=="string"){x.unshift(c(f.fn.qtip.styles[x[0].name]))}x.unshift(true,{classes:{tooltip:"qtip-"+(arguments[0].name||"defaults")}},f.fn.qtip.styles.defaults);v=f.extend.apply(f,x);w=(f.browser.msie)?1:0;v.tip.size.width+=w;v.tip.size.height+=w;if(v.tip.size.width%2>0){v.tip.size.width+=1}if(v.tip.size.height%2>0){v.tip.size.height+=1}if(v.tip.corner===true){v.tip.corner=(s.options.position.corner.tooltip==="center")?false:s.options.position.corner.tooltip}return v}function b(v,u,t){var s={bottomRight:[[0,0],[u,t],[u,0]],bottomLeft:[[0,0],[u,0],[0,t]],topRight:[[0,t],[u,0],[u,t]],topLeft:[[0,0],[0,t],[u,t]],topMiddle:[[0,t],[u/2,0],[u,t]],bottomMiddle:[[0,0],[u,0],[u/2,t]],rightMiddle:[[0,0],[u,t/2],[0,t]],leftMiddle:[[u,0],[u,t],[0,t/2]]};s.leftTop=s.bottomRight;s.rightTop=s.bottomLeft;s.leftBottom=s.topRight;s.rightBottom=s.topLeft;return s[v]}function g(s){var t;if(f("<canvas>").get(0).getContext){t={topLeft:[s,s],topRight:[0,s],bottomLeft:[s,0],bottomRight:[0,0]}}else{if(f.browser.msie){t={topLeft:[-90,90,0],topRight:[-90,90,-s],bottomLeft:[90,270,0],bottomRight:[90,270,-s]}}}return t}function k(){var s,t,u;s=this;u=s.getDimensions();t='<iframe class="qtip-bgiframe" frameborder="0" tabindex="-1" src="javascript:false" style="display:block; position:absolute; z-index:-1; filter:alpha(opacity=\'0\'); border: 1px solid red; height:'+u.height+"px; width:"+u.width+'px" />';s.elements.bgiframe=s.elements.wrapper.prepend(t).children(".qtip-bgiframe:first")}f(document).ready(function(){f.fn.qtip.cache={screen:{scroll:{left:f(window).scrollLeft(),top:f(window).scrollTop()},width:f(window).width(),height:f(window).height()}};var s;f(window).bind("resize scroll",function(t){clearTimeout(s);s=setTimeout(function(){if(t.type==="scroll"){f.fn.qtip.cache.screen.scroll={left:f(window).scrollLeft(),top:f(window).scrollTop()}}else{f.fn.qtip.cache.screen.width=f(window).width();f.fn.qtip.cache.screen.height=f(window).height()}for(i=0;i<f.fn.qtip.interfaces.length;i++){var u=f.fn.qtip.interfaces[i];if(u.status.rendered===true&&(u.options.position.type!=="static"||u.options.position.adjust.scroll&&t.type==="scroll"||u.options.position.adjust.resize&&t.type==="resize")){u.updatePosition(t,true)}}},100)});f(document).bind("mousedown.qtip",function(t){if(f(t.target).parents("div.qtip").length===0){f(".qtip[unfocus]").each(function(){var u=f(this).qtip("api");if(f(this).is(":visible")&&!u.status.disabled&&f(t.target).add(u.elements.target).length>1){u.hide(t)}})}})});f.fn.qtip.interfaces=[];f.fn.qtip.log={error:function(){return this}};f.fn.qtip.constants={};f.fn.qtip.defaults={content:{prerender:false,text:false,url:false,data:null,title:{text:false,button:false}},position:{target:false,corner:{target:"bottomRight",tooltip:"topLeft"},adjust:{x:0,y:0,mouse:true,screen:false,scroll:true,resize:true},type:"absolute",container:false},show:{when:{target:false,event:"mouseover"},effect:{type:"fade",length:100},delay:140,solo:false,ready:false},hide:{when:{target:false,event:"mouseout"},effect:{type:"fade",length:100},delay:0,fixed:false},api:{beforeRender:function(){},onRender:function(){},beforePositionUpdate:function(){},onPositionUpdate:function(){},beforeShow:function(){},onShow:function(){},beforeHide:function(){},onHide:function(){},beforeContentUpdate:function(){},onContentUpdate:function(){},beforeContentLoad:function(){},onContentLoad:function(){},beforeTitleUpdate:function(){},onTitleUpdate:function(){},beforeDestroy:function(){},onDestroy:function(){},beforeFocus:function(){},onFocus:function(){}}};f.fn.qtip.styles={defaults:{background:"white",color:"#111",overflow:"hidden",textAlign:"left",width:{min:0,max:250},padding:"5px 9px",border:{width:1,radius:0,color:"#d3d3d3"},tip:{corner:false,color:false,size:{width:13,height:13},opacity:1},title:{background:"#e1e1e1",fontWeight:"bold",padding:"7px 12px"},button:{cursor:"pointer"},classes:{target:"",tip:"qtip-tip",title:"qtip-title",button:"qtip-button",content:"qtip-content",active:"qtip-active"}},cream:{border:{width:3,radius:0,color:"#F9E98E"},title:{background:"#F0DE7D",color:"#A27D35"},background:"#FBF7AA",color:"#A27D35",classes:{tooltip:"qtip-cream"}},light:{border:{width:3,radius:0,color:"#E2E2E2"},title:{background:"#f1f1f1",color:"#454545"},background:"white",color:"#454545",classes:{tooltip:"qtip-light"}},dark:{border:{width:3,radius:0,color:"#303030"},title:{background:"#404040",color:"#f3f3f3"},background:"#505050",color:"#f3f3f3",classes:{tooltip:"qtip-dark"}},red:{border:{width:3,radius:0,color:"#CE6F6F"},title:{background:"#f28279",color:"#9C2F2F"},background:"#F79992",color:"#9C2F2F",classes:{tooltip:"qtip-red"}},green:{border:{width:3,radius:0,color:"#A9DB66"},title:{background:"#b9db8c",color:"#58792E"},background:"#CDE6AC",color:"#58792E",classes:{tooltip:"qtip-green"}},blue:{border:{width:3,radius:0,color:"#ADD9ED"},title:{background:"#D0E9F5",color:"#5E99BD"},background:"#E5F6FE",color:"#4D9FBF",classes:{tooltip:"qtip-blue"}}}})(jQuery);

/* jquery/jquery.ui.js */

/*
 * jQuery UI 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI
 */
;jQuery.ui || (function($) {

var _remove = $.fn.remove,
	isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);

//Helper functions and ui object
$.ui = {
	version: "1.7.2",

	// $.ui.plugin is deprecated.  Use the proxy pattern instead.
	plugin: {
		add: function(module, option, set) {
			var proto = $.ui[module].prototype;
			for(var i in set) {
				proto.plugins[i] = proto.plugins[i] || [];
				proto.plugins[i].push([option, set[i]]);
			}
		},
		call: function(instance, name, args) {
			var set = instance.plugins[name];
			if(!set || !instance.element[0].parentNode) { return; }

			for (var i = 0; i < set.length; i++) {
				if (instance.options[set[i][0]]) {
					set[i][1].apply(instance.element, args);
				}
			}
		}
	},

	contains: function(a, b) {
		return document.compareDocumentPosition
			? a.compareDocumentPosition(b) & 16
			: a !== b && a.contains(b);
	},

	hasScroll: function(el, a) {

		//If overflow is hidden, the element might have extra content, but the user wants to hide it
		if ($(el).css('overflow') == 'hidden') { return false; }

		var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
			has = false;

		if (el[scroll] > 0) { return true; }

		// TODO: determine which cases actually cause this to happen
		// if the element doesn't have the scroll set, see if it's possible to
		// set the scroll
		el[scroll] = 1;
		has = (el[scroll] > 0);
		el[scroll] = 0;
		return has;
	},

	isOverAxis: function(x, reference, size) {
		//Determines when x coordinate is over "b" element axis
		return (x > reference) && (x < (reference + size));
	},

	isOver: function(y, x, top, left, height, width) {
		//Determines when x, y coordinates is over "b" element
		return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
	},

	keyCode: {
		BACKSPACE: 8,
		CAPS_LOCK: 20,
		COMMA: 188,
		CONTROL: 17,
		DELETE: 46,
		DOWN: 40,
		END: 35,
		ENTER: 13,
		ESCAPE: 27,
		HOME: 36,
		INSERT: 45,
		LEFT: 37,
		NUMPAD_ADD: 107,
		NUMPAD_DECIMAL: 110,
		NUMPAD_DIVIDE: 111,
		NUMPAD_ENTER: 108,
		NUMPAD_MULTIPLY: 106,
		NUMPAD_SUBTRACT: 109,
		PAGE_DOWN: 34,
		PAGE_UP: 33,
		PERIOD: 190,
		RIGHT: 39,
		SHIFT: 16,
		SPACE: 32,
		TAB: 9,
		UP: 38
	}
};

// WAI-ARIA normalization
if (isFF2) {
	var attr = $.attr,
		removeAttr = $.fn.removeAttr,
		ariaNS = "http://www.w3.org/2005/07/aaa",
		ariaState = /^aria-/,
		ariaRole = /^wairole:/;

	$.attr = function(elem, name, value) {
		var set = value !== undefined;

		return (name == 'role'
			? (set
				? attr.call(this, elem, name, "wairole:" + value)
				: (attr.apply(this, arguments) || "").replace(ariaRole, ""))
			: (ariaState.test(name)
				? (set
					? elem.setAttributeNS(ariaNS,
						name.replace(ariaState, "aaa:"), value)
					: attr.call(this, elem, name.replace(ariaState, "aaa:")))
				: attr.apply(this, arguments)));
	};

	$.fn.removeAttr = function(name) {
		return (ariaState.test(name)
			? this.each(function() {
				this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
			}) : removeAttr.call(this, name));
	};
}

//jQuery plugins
$.fn.extend({
	remove: function() {
		// Safari has a native remove event which actually removes DOM elements,
		// so we have to use triggerHandler instead of trigger (#3037).
		$("*", this).add(this).each(function() {
			$(this).triggerHandler("remove");
		});
		return _remove.apply(this, arguments );
	},

	enableSelection: function() {
		return this
			.attr('unselectable', 'off')
			.css('MozUserSelect', '')
			.unbind('selectstart.ui');
	},

	disableSelection: function() {
		return this
			.attr('unselectable', 'on')
			.css('MozUserSelect', 'none')
			.bind('selectstart.ui', function() { return false; });
	},

	scrollParent: function() {
		var scrollParent;
		if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
			scrollParent = this.parents().filter(function() {
				return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
			}).eq(0);
		} else {
			scrollParent = this.parents().filter(function() {
				return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
			}).eq(0);
		}

		return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
	}
});


//Additional selectors
$.extend($.expr[':'], {
	data: function(elem, i, match) {
		return !!$.data(elem, match[3]);
	},

	focusable: function(element) {
		var nodeName = element.nodeName.toLowerCase(),
			tabIndex = $.attr(element, 'tabindex');
		return (/input|select|textarea|button|object/.test(nodeName)
			? !element.disabled
			: 'a' == nodeName || 'area' == nodeName
				? element.href || !isNaN(tabIndex)
				: !isNaN(tabIndex))
			// the element and all of its ancestors must be visible
			// the browser may report that the area is hidden
			&& !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
	},

	tabbable: function(element) {
		var tabIndex = $.attr(element, 'tabindex');
		return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
	}
});


// $.widget is a factory to create jQuery plugins
// taking some boilerplate code out of the plugin code
function getter(namespace, plugin, method, args) {
	function getMethods(type) {
		var methods = $[namespace][plugin][type] || [];
		return (typeof methods == 'string' ? methods.split(/,?\s+/) : methods);
	}

	var methods = getMethods('getter');
	if (args.length == 1 && typeof args[0] == 'string') {
		methods = methods.concat(getMethods('getterSetter'));
	}
	return ($.inArray(method, methods) != -1);
}

$.widget = function(name, prototype) {
	var namespace = name.split(".")[0];
	name = name.split(".")[1];

	// create plugin method
	$.fn[name] = function(options) {
		var isMethodCall = (typeof options == 'string'),
			args = Array.prototype.slice.call(arguments, 1);

		// prevent calls to internal methods
		if (isMethodCall && options.substring(0, 1) == '_') {
			return this;
		}

		// handle getter methods
		if (isMethodCall && getter(namespace, name, options, args)) {
			var instance = $.data(this[0], name);
			return (instance ? instance[options].apply(instance, args)
				: undefined);
		}

		// handle initialization and non-getter methods
		return this.each(function() {
			var instance = $.data(this, name);

			// constructor
			(!instance && !isMethodCall &&
				$.data(this, name, new $[namespace][name](this, options))._init());

			// method call
			(instance && isMethodCall && $.isFunction(instance[options]) &&
				instance[options].apply(instance, args));
		});
	};

	// create widget constructor
	$[namespace] = $[namespace] || {};
	$[namespace][name] = function(element, options) {
		var self = this;

		this.namespace = namespace;
		this.widgetName = name;
		this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
		this.widgetBaseClass = namespace + '-' + name;

		this.options = $.extend({},
			$.widget.defaults,
			$[namespace][name].defaults,
			$.metadata && $.metadata.get(element)[name],
			options);

		this.element = $(element)
			.bind('setData.' + name, function(event, key, value) {
				if (event.target == element) {
					return self._setData(key, value);
				}
			})
			.bind('getData.' + name, function(event, key) {
				if (event.target == element) {
					return self._getData(key);
				}
			})
			.bind('remove', function() {
				return self.destroy();
			});
	};

	// add widget prototype
	$[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);

	// TODO: merge getter and getterSetter properties from widget prototype
	// and plugin prototype
	$[namespace][name].getterSetter = 'option';
};

$.widget.prototype = {
	_init: function() {},
	destroy: function() {
		this.element.removeData(this.widgetName)
			.removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
			.removeAttr('aria-disabled');
	},

	option: function(key, value) {
		var options = key,
			self = this;

		if (typeof key == "string") {
			if (value === undefined) {
				return this._getData(key);
			}
			options = {};
			options[key] = value;
		}

		$.each(options, function(key, value) {
			self._setData(key, value);
		});
	},
	_getData: function(key) {
		return this.options[key];
	},
	_setData: function(key, value) {
		this.options[key] = value;

		if (key == 'disabled') {
			this.element
				[value ? 'addClass' : 'removeClass'](
					this.widgetBaseClass + '-disabled' + ' ' +
					this.namespace + '-state-disabled')
				.attr("aria-disabled", value);
		}
	},

	enable: function() {
		this._setData('disabled', false);
	},
	disable: function() {
		this._setData('disabled', true);
	},

	_trigger: function(type, event, data) {
		var callback = this.options[type],
			eventName = (type == this.widgetEventPrefix
				? type : this.widgetEventPrefix + type);

		event = $.Event(event);
		event.type = eventName;

		// copy original event properties over to the new event
		// this would happen if we could call $.event.fix instead of $.Event
		// but we don't have a way to force an event to be fixed multiple times
		if (event.originalEvent) {
			for (var i = $.event.props.length, prop; i;) {
				prop = $.event.props[--i];
				event[prop] = event.originalEvent[prop];
			}
		}

		this.element.trigger(event, data);

		return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
			|| event.isDefaultPrevented());
	}
};

$.widget.defaults = {
	disabled: false
};


/** Mouse Interaction Plugin **/

$.ui.mouse = {
	_mouseInit: function() {
		var self = this;

		this.element
			.bind('mousedown.'+this.widgetName, function(event) {
				return self._mouseDown(event);
			})
			.bind('click.'+this.widgetName, function(event) {
				if(self._preventClickEvent) {
					self._preventClickEvent = false;
					event.stopImmediatePropagation();
					return false;
				}
			});

		// Prevent text selection in IE
		if ($.browser.msie) {
			this._mouseUnselectable = this.element.attr('unselectable');
			this.element.attr('unselectable', 'on');
		}

		this.started = false;
	},

	// TODO: make sure destroying one instance of mouse doesn't mess with
	// other instances of mouse
	_mouseDestroy: function() {
		this.element.unbind('.'+this.widgetName);

		// Restore text selection in IE
		($.browser.msie
			&& this.element.attr('unselectable', this._mouseUnselectable));
	},

	_mouseDown: function(event) {
		// don't let more than one widget handle mouseStart
		// TODO: figure out why we have to use originalEvent
		event.originalEvent = event.originalEvent || {};
		if (event.originalEvent.mouseHandled) { return; }

		// we may have missed mouseup (out of window)
		(this._mouseStarted && this._mouseUp(event));

		this._mouseDownEvent = event;

		var self = this,
			btnIsLeft = (event.which == 1),
			elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
			return true;
		}

		this.mouseDelayMet = !this.options.delay;
		if (!this.mouseDelayMet) {
			this._mouseDelayTimer = setTimeout(function() {
				self.mouseDelayMet = true;
			}, this.options.delay);
		}

		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
			this._mouseStarted = (this._mouseStart(event) !== false);
			if (!this._mouseStarted) {
				event.preventDefault();
				return true;
			}
		}

		// these delegates are required to keep context
		this._mouseMoveDelegate = function(event) {
			return self._mouseMove(event);
		};
		this._mouseUpDelegate = function(event) {
			return self._mouseUp(event);
		};
		$(document)
			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);

		// preventDefault() is used to prevent the selection of text here -
		// however, in Safari, this causes select boxes not to be selectable
		// anymore, so this fix is needed
		($.browser.safari || event.preventDefault());

		event.originalEvent.mouseHandled = true;
		return true;
	},

	_mouseMove: function(event) {
		// IE mouseup check - mouseup happened when mouse was out of window
		if ($.browser.msie && !event.button) {
			return this._mouseUp(event);
		}

		if (this._mouseStarted) {
			this._mouseDrag(event);
			return event.preventDefault();
		}

		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
			this._mouseStarted =
				(this._mouseStart(this._mouseDownEvent, event) !== false);
			(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
		}

		return !this._mouseStarted;
	},

	_mouseUp: function(event) {
		$(document)
			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);

		if (this._mouseStarted) {
			this._mouseStarted = false;
			this._preventClickEvent = (event.target == this._mouseDownEvent.target);
			this._mouseStop(event);
		}

		return false;
	},

	_mouseDistanceMet: function(event) {
		return (Math.max(
				Math.abs(this._mouseDownEvent.pageX - event.pageX),
				Math.abs(this._mouseDownEvent.pageY - event.pageY)
			) >= this.options.distance
		);
	},

	_mouseDelayMet: function(event) {
		return this.mouseDelayMet;
	},

	// These are placeholder methods, to be overriden by extending plugin
	_mouseStart: function(event) {},
	_mouseDrag: function(event) {},
	_mouseStop: function(event) {},
	_mouseCapture: function(event) { return true; }
};

$.ui.mouse.defaults = {
	cancel: null,
	distance: 1,
	delay: 0
};

})(jQuery);
/*
 * jQuery UI Draggable 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Draggables
 *
 * Depends:
 *	ui.core.js
 */
(function($) {

$.widget("ui.draggable", $.extend({}, $.ui.mouse, {

	_init: function() {

		if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
			this.element[0].style.position = 'relative';

		(this.options.addClasses && this.element.addClass("ui-draggable"));
		(this.options.disabled && this.element.addClass("ui-draggable-disabled"));

		this._mouseInit();

	},

	destroy: function() {
		if(!this.element.data('draggable')) return;
		this.element
			.removeData("draggable")
			.unbind(".draggable")
			.removeClass("ui-draggable"
				+ " ui-draggable-dragging"
				+ " ui-draggable-disabled");
		this._mouseDestroy();
	},

	_mouseCapture: function(event) {

		var o = this.options;

		if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
			return false;

		//Quit if we're not on a valid handle
		this.handle = this._getHandle(event);
		if (!this.handle)
			return false;

		return true;

	},

	_mouseStart: function(event) {

		var o = this.options;

		//Create and append the visible helper
		this.helper = this._createHelper(event);

		//Cache the helper size
		this._cacheHelperProportions();

		//If ddmanager is used for droppables, set the global draggable
		if($.ui.ddmanager)
			$.ui.ddmanager.current = this;

		/*
		 * - Position generation -
		 * This block generates everything position related - it's the core of draggables.
		 */

		//Cache the margins of the original element
		this._cacheMargins();

		//Store the helper's css position
		this.cssPosition = this.helper.css("position");
		this.scrollParent = this.helper.scrollParent();

		//The element's absolute position on the page minus margins
		this.offset = this.element.offset();
		this.offset = {
			top: this.offset.top - this.margins.top,
			left: this.offset.left - this.margins.left
		};

		$.extend(this.offset, {
			click: { //Where the click happened, relative to the element
				left: event.pageX - this.offset.left,
				top: event.pageY - this.offset.top
			},
			parent: this._getParentOffset(),
			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
		});

		//Generate the original position
		this.originalPosition = this._generatePosition(event);
		this.originalPageX = event.pageX;
		this.originalPageY = event.pageY;

		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
		if(o.cursorAt)
			this._adjustOffsetFromHelper(o.cursorAt);

		//Set a containment if given in the options
		if(o.containment)
			this._setContainment();

		//Call plugins and callbacks
		this._trigger("start", event);

		//Recache the helper size
		this._cacheHelperProportions();

		//Prepare the droppable offsets
		if ($.ui.ddmanager && !o.dropBehaviour)
			$.ui.ddmanager.prepareOffsets(this, event);

		this.helper.addClass("ui-draggable-dragging");
		this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
		return true;
	},

	_mouseDrag: function(event, noPropagation) {

		//Compute the helpers position
		this.position = this._generatePosition(event);
		this.positionAbs = this._convertPositionTo("absolute");

		//Call plugins and callbacks and use the resulting position if something is returned
		if (!noPropagation) {
			var ui = this._uiHash();
			this._trigger('drag', event, ui);
			this.position = ui.position;
		}

		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);

		return false;
	},

	_mouseStop: function(event) {

		//If we are using droppables, inform the manager about the drop
		var dropped = false;
		if ($.ui.ddmanager && !this.options.dropBehaviour)
			dropped = $.ui.ddmanager.drop(this, event);

		//if a drop comes from outside (a sortable)
		if(this.dropped) {
			dropped = this.dropped;
			this.dropped = false;
		}

		if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
			var self = this;
			$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
				self._trigger("stop", event);
				self._clear();
			});
		} else {
			this._trigger("stop", event);
			this._clear();
		}

		return false;
	},

	_getHandle: function(event) {

		var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
		$(this.options.handle, this.element)
			.find("*")
			.andSelf()
			.each(function() {
				if(this == event.target) handle = true;
			});

		return handle;

	},

	_createHelper: function(event) {

		var o = this.options;
		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);

		if(!helper.parents('body').length)
			helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));

		if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
			helper.css("position", "absolute");

		return helper;

	},

	_adjustOffsetFromHelper: function(obj) {
		if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
		if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
		if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
		if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
	},

	_getParentOffset: function() {

		//Get the offsetParent and cache its position
		this.offsetParent = this.helper.offsetParent();
		var po = this.offsetParent.offset();

		// This is a special case where we need to modify a offset calculated on start, since the following happened:
		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
			po.left += this.scrollParent.scrollLeft();
			po.top += this.scrollParent.scrollTop();
		}

		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
			po = { top: 0, left: 0 };

		return {
			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
		};

	},

	_getRelativeOffset: function() {

		if(this.cssPosition == "relative") {
			var p = this.element.position();
			return {
				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
			};
		} else {
			return { top: 0, left: 0 };
		}

	},

	_cacheMargins: function() {
		this.margins = {
			left: (parseInt(this.element.css("marginLeft"),10) || 0),
			top: (parseInt(this.element.css("marginTop"),10) || 0)
		};
	},

	_cacheHelperProportions: function() {
		this.helperProportions = {
			width: this.helper.outerWidth(),
			height: this.helper.outerHeight()
		};
	},

	_setContainment: function() {

		var o = this.options;
		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
		if(o.containment == 'document' || o.containment == 'window') this.containment = [
			0 - this.offset.relative.left - this.offset.parent.left,
			0 - this.offset.relative.top - this.offset.parent.top,
			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
		];

		if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
			var ce = $(o.containment)[0]; if(!ce) return;
			var co = $(o.containment).offset();
			var over = ($(ce).css("overflow") != 'hidden');

			this.containment = [
				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
			];
		} else if(o.containment.constructor == Array) {
			this.containment = o.containment;
		}

	},

	_convertPositionTo: function(d, pos) {

		if(!pos) pos = this.position;
		var mod = d == "absolute" ? 1 : -1;
		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);

		return {
			top: (
				pos.top																	// The absolute mouse position
				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
			),
			left: (
				pos.left																// The absolute mouse position
				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
			)
		};

	},

	_generatePosition: function(event) {

		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);

		// This is another very weird special case that only happens for relative elements:
		// 1. If the css position is relative
		// 2. and the scroll parent is the document or similar to the offset parent
		// we have to refresh the relative offset during the scroll so there are no jumps
		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
			this.offset.relative = this._getRelativeOffset();
		}

		var pageX = event.pageX;
		var pageY = event.pageY;

		/*
		 * - Position constraining -
		 * Constrain the position to a mix of grid, containment.
		 */

		if(this.originalPosition) { //If we are not dragging yet, we won't check for options

			if(this.containment) {
				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
			}

			if(o.grid) {
				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;

				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
			}

		}

		return {
			top: (
				pageY																// The absolute mouse position
				- this.offset.click.top													// Click offset (relative to the element)
				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
			),
			left: (
				pageX																// The absolute mouse position
				- this.offset.click.left												// Click offset (relative to the element)
				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
			)
		};

	},

	_clear: function() {
		this.helper.removeClass("ui-draggable-dragging");
		if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
		//if($.ui.ddmanager) $.ui.ddmanager.current = null;
		this.helper = null;
		this.cancelHelperRemoval = false;
	},

	// From now on bulk stuff - mainly helpers

	_trigger: function(type, event, ui) {
		ui = ui || this._uiHash();
		$.ui.plugin.call(this, type, [event, ui]);
		if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
		return $.widget.prototype._trigger.call(this, type, event, ui);
	},

	plugins: {},

	_uiHash: function(event) {
		return {
			helper: this.helper,
			position: this.position,
			absolutePosition: this.positionAbs, //deprecated
			offset: this.positionAbs
		};
	}

}));

$.extend($.ui.draggable, {
	version: "1.7.2",
	eventPrefix: "drag",
	defaults: {
		addClasses: true,
		appendTo: "parent",
		axis: false,
		cancel: ":input,option",
		connectToSortable: false,
		containment: false,
		cursor: "auto",
		cursorAt: false,
		delay: 0,
		distance: 1,
		grid: false,
		handle: false,
		helper: "original",
		iframeFix: false,
		opacity: false,
		refreshPositions: false,
		revert: false,
		revertDuration: 500,
		scope: "default",
		scroll: true,
		scrollSensitivity: 20,
		scrollSpeed: 20,
		snap: false,
		snapMode: "both",
		snapTolerance: 20,
		stack: false,
		zIndex: false
	}
});

$.ui.plugin.add("draggable", "connectToSortable", {
	start: function(event, ui) {

		var inst = $(this).data("draggable"), o = inst.options,
			uiSortable = $.extend({}, ui, { item: inst.element });
		inst.sortables = [];
		$(o.connectToSortable).each(function() {
			var sortable = $.data(this, 'sortable');
			if (sortable && !sortable.options.disabled) {
				inst.sortables.push({
					instance: sortable,
					shouldRevert: sortable.options.revert
				});
				sortable._refreshItems();	//Do a one-time refresh at start to refresh the containerCache
				sortable._trigger("activate", event, uiSortable);
			}
		});

	},
	stop: function(event, ui) {

		//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
		var inst = $(this).data("draggable"),
			uiSortable = $.extend({}, ui, { item: inst.element });

		$.each(inst.sortables, function() {
			if(this.instance.isOver) {

				this.instance.isOver = 0;

				inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
				this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)

				//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
				if(this.shouldRevert) this.instance.options.revert = true;

				//Trigger the stop of the sortable
				this.instance._mouseStop(event);

				this.instance.options.helper = this.instance.options._helper;

				//If the helper has been the original item, restore properties in the sortable
				if(inst.options.helper == 'original')
					this.instance.currentItem.css({ top: 'auto', left: 'auto' });

			} else {
				this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
				this.instance._trigger("deactivate", event, uiSortable);
			}

		});

	},
	drag: function(event, ui) {

		var inst = $(this).data("draggable"), self = this;

		var checkPos = function(o) {
			var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
			var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
			var itemHeight = o.height, itemWidth = o.width;
			var itemTop = o.top, itemLeft = o.left;

			return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
		};

		$.each(inst.sortables, function(i) {
			
			//Copy over some variables to allow calling the sortable's native _intersectsWith
			this.instance.positionAbs = inst.positionAbs;
			this.instance.helperProportions = inst.helperProportions;
			this.instance.offset.click = inst.offset.click;
			
			if(this.instance._intersectsWith(this.instance.containerCache)) {

				//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
				if(!this.instance.isOver) {

					this.instance.isOver = 1;
					//Now we fake the start of dragging for the sortable instance,
					//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
					//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
					this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
					this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
					this.instance.options.helper = function() { return ui.helper[0]; };

					event.target = this.instance.currentItem[0];
					this.instance._mouseCapture(event, true);
					this.instance._mouseStart(event, true, true);

					//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
					this.instance.offset.click.top = inst.offset.click.top;
					this.instance.offset.click.left = inst.offset.click.left;
					this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
					this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;

					inst._trigger("toSortable", event);
					inst.dropped = this.instance.element; //draggable revert needs that
					//hack so receive/update callbacks work (mostly)
					inst.currentItem = inst.element;
					this.instance.fromOutside = inst;

				}

				//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
				if(this.instance.currentItem) this.instance._mouseDrag(event);

			} else {

				//If it doesn't intersect with the sortable, and it intersected before,
				//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
				if(this.instance.isOver) {

					this.instance.isOver = 0;
					this.instance.cancelHelperRemoval = true;
					
					//Prevent reverting on this forced stop
					this.instance.options.revert = false;
					
					// The out event needs to be triggered independently
					this.instance._trigger('out', event, this.instance._uiHash(this.instance));
					
					this.instance._mouseStop(event, true);
					this.instance.options.helper = this.instance.options._helper;

					//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
					this.instance.currentItem.remove();
					if(this.instance.placeholder) this.instance.placeholder.remove();

					inst._trigger("fromSortable", event);
					inst.dropped = false; //draggable revert needs that
				}

			};

		});

	}
});

$.ui.plugin.add("draggable", "cursor", {
	start: function(event, ui) {
		var t = $('body'), o = $(this).data('draggable').options;
		if (t.css("cursor")) o._cursor = t.css("cursor");
		t.css("cursor", o.cursor);
	},
	stop: function(event, ui) {
		var o = $(this).data('draggable').options;
		if (o._cursor) $('body').css("cursor", o._cursor);
	}
});

$.ui.plugin.add("draggable", "iframeFix", {
	start: function(event, ui) {
		var o = $(this).data('draggable').options;
		$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
			$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
			.css({
				width: this.offsetWidth+"px", height: this.offsetHeight+"px",
				position: "absolute", opacity: "0.001", zIndex: 1000
			})
			.css($(this).offset())
			.appendTo("body");
		});
	},
	stop: function(event, ui) {
		$("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
	}
});

$.ui.plugin.add("draggable", "opacity", {
	start: function(event, ui) {
		var t = $(ui.helper), o = $(this).data('draggable').options;
		if(t.css("opacity")) o._opacity = t.css("opacity");
		t.css('opacity', o.opacity);
	},
	stop: function(event, ui) {
		var o = $(this).data('draggable').options;
		if(o._opacity) $(ui.helper).css('opacity', o._opacity);
	}
});

$.ui.plugin.add("draggable", "scroll", {
	start: function(event, ui) {
		var i = $(this).data("draggable");
		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
	},
	drag: function(event, ui) {

		var i = $(this).data("draggable"), o = i.options, scrolled = false;

		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {

			if(!o.axis || o.axis != 'x') {
				if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
				else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
			}

			if(!o.axis || o.axis != 'y') {
				if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
				else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
			}

		} else {

			if(!o.axis || o.axis != 'x') {
				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
			}

			if(!o.axis || o.axis != 'y') {
				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
			}

		}

		if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
			$.ui.ddmanager.prepareOffsets(i, event);

	}
});

$.ui.plugin.add("draggable", "snap", {
	start: function(event, ui) {

		var i = $(this).data("draggable"), o = i.options;
		i.snapElements = [];

		$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
			var $t = $(this); var $o = $t.offset();
			if(this != i.element[0]) i.snapElements.push({
				item: this,
				width: $t.outerWidth(), height: $t.outerHeight(),
				top: $o.top, left: $o.left
			});
		});

	},
	drag: function(event, ui) {

		var inst = $(this).data("draggable"), o = inst.options;
		var d = o.snapTolerance;

		var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;

		for (var i = inst.snapElements.length - 1; i >= 0; i--){

			var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
				t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;

			//Yes, I know, this is insane ;)
			if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
				if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
				inst.snapElements[i].snapping = false;
				continue;
			}

			if(o.snapMode != 'inner') {
				var ts = Math.abs(t - y2) <= d;
				var bs = Math.abs(b - y1) <= d;
				var ls = Math.abs(l - x2) <= d;
				var rs = Math.abs(r - x1) <= d;
				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
			}

			var first = (ts || bs || ls || rs);

			if(o.snapMode != 'outer') {
				var ts = Math.abs(t - y1) <= d;
				var bs = Math.abs(b - y2) <= d;
				var ls = Math.abs(l - x1) <= d;
				var rs = Math.abs(r - x2) <= d;
				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
			}

			if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
				(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
			inst.snapElements[i].snapping = (ts || bs || ls || rs || first);

		};

	}
});

$.ui.plugin.add("draggable", "stack", {
	start: function(event, ui) {

		var o = $(this).data("draggable").options;

		var group = $.makeArray($(o.stack.group)).sort(function(a,b) {
			return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min);
		});

		$(group).each(function(i) {
			this.style.zIndex = o.stack.min + i;
		});

		this[0].style.zIndex = o.stack.min + group.length;

	}
});

$.ui.plugin.add("draggable", "zIndex", {
	start: function(event, ui) {
		var t = $(ui.helper), o = $(this).data("draggable").options;
		if(t.css("zIndex")) o._zIndex = t.css("zIndex");
		t.css('zIndex', o.zIndex);
	},
	stop: function(event, ui) {
		var o = $(this).data("draggable").options;
		if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
	}
});

})(jQuery);
/*
 * jQuery UI Droppable 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Droppables
 *
 * Depends:
 *	ui.core.js
 *	ui.draggable.js
 */
(function($) {

$.widget("ui.droppable", {

	_init: function() {

		var o = this.options, accept = o.accept;
		this.isover = 0; this.isout = 1;

		this.options.accept = this.options.accept && $.isFunction(this.options.accept) ? this.options.accept : function(d) {
			return d.is(accept);
		};

		//Store the droppable's proportions
		this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };

		// Add the reference and positions to the manager
		$.ui.ddmanager.droppables[this.options.scope] = $.ui.ddmanager.droppables[this.options.scope] || [];
		$.ui.ddmanager.droppables[this.options.scope].push(this);

		(this.options.addClasses && this.element.addClass("ui-droppable"));

	},

	destroy: function() {
		var drop = $.ui.ddmanager.droppables[this.options.scope];
		for ( var i = 0; i < drop.length; i++ )
			if ( drop[i] == this )
				drop.splice(i, 1);

		this.element
			.removeClass("ui-droppable ui-droppable-disabled")
			.removeData("droppable")
			.unbind(".droppable");
	},

	_setData: function(key, value) {

		if(key == 'accept') {
			this.options.accept = value && $.isFunction(value) ? value : function(d) {
				return d.is(value);
			};
		} else {
			$.widget.prototype._setData.apply(this, arguments);
		}

	},

	_activate: function(event) {
		var draggable = $.ui.ddmanager.current;
		if(this.options.activeClass) this.element.addClass(this.options.activeClass);
		(draggable && this._trigger('activate', event, this.ui(draggable)));
	},

	_deactivate: function(event) {
		var draggable = $.ui.ddmanager.current;
		if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
		(draggable && this._trigger('deactivate', event, this.ui(draggable)));
	},

	_over: function(event) {

		var draggable = $.ui.ddmanager.current;
		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element

		if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
			if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
			this._trigger('over', event, this.ui(draggable));
		}

	},

	_out: function(event) {

		var draggable = $.ui.ddmanager.current;
		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element

		if (this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
			this._trigger('out', event, this.ui(draggable));
		}

	},

	_drop: function(event,custom) {

		var draggable = custom || $.ui.ddmanager.current;
		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element

		var childrenIntersection = false;
		this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
			var inst = $.data(this, 'droppable');
			if(inst.options.greedy && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)) {
				childrenIntersection = true; return false;
			}
		});
		if(childrenIntersection) return false;

		if(this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
			if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
			this._trigger('drop', event, this.ui(draggable));
			return this.element;
		}

		return false;

	},

	ui: function(c) {
		return {
			draggable: (c.currentItem || c.element),
			helper: c.helper,
			position: c.position,
			absolutePosition: c.positionAbs, //deprecated
			offset: c.positionAbs
		};
	}

});

$.extend($.ui.droppable, {
	version: "1.7.2",
	eventPrefix: 'drop',
	defaults: {
		accept: '*',
		activeClass: false,
		addClasses: true,
		greedy: false,
		hoverClass: false,
		scope: 'default',
		tolerance: 'intersect'
	}
});

$.ui.intersect = function(draggable, droppable, toleranceMode) {

	if (!droppable.offset) return false;

	var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
		y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
	var l = droppable.offset.left, r = l + droppable.proportions.width,
		t = droppable.offset.top, b = t + droppable.proportions.height;

	switch (toleranceMode) {
		case 'fit':
			return (l < x1 && x2 < r
				&& t < y1 && y2 < b);
			break;
		case 'intersect':
			return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
				&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
				&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
				&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
			break;
		case 'pointer':
			var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
				isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
			return isOver;
			break;
		case 'touch':
			return (
					(y1 >= t && y1 <= b) ||	// Top edge touching
					(y2 >= t && y2 <= b) ||	// Bottom edge touching
					(y1 < t && y2 > b)		// Surrounded vertically
				) && (
					(x1 >= l && x1 <= r) ||	// Left edge touching
					(x2 >= l && x2 <= r) ||	// Right edge touching
					(x1 < l && x2 > r)		// Surrounded horizontally
				);
			break;
		default:
			return false;
			break;
		}

};

/*
	This manager tracks offsets of draggables and droppables
*/
$.ui.ddmanager = {
	current: null,
	droppables: { 'default': [] },
	prepareOffsets: function(t, event) {

		var m = $.ui.ddmanager.droppables[t.options.scope];
		var type = event ? event.type : null; // workaround for #2317
		var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();

		droppablesLoop: for (var i = 0; i < m.length; i++) {

			if(m[i].options.disabled || (t && !m[i].options.accept.call(m[i].element[0],(t.currentItem || t.element)))) continue;	//No disabled and non-accepted
			for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
			m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; 									//If the element is not visible, continue

			m[i].offset = m[i].element.offset();
			m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };

			if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables

		}

	},
	drop: function(draggable, event) {

		var dropped = false;
		$.each($.ui.ddmanager.droppables[draggable.options.scope], function() {

			if(!this.options) return;
			if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
				dropped = this._drop.call(this, event);

			if (!this.options.disabled && this.visible && this.options.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
				this.isout = 1; this.isover = 0;
				this._deactivate.call(this, event);
			}

		});
		return dropped;

	},
	drag: function(draggable, event) {

		//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
		if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);

		//Run through all droppables and check their positions based on specific tolerance options

		$.each($.ui.ddmanager.droppables[draggable.options.scope], function() {

			if(this.options.disabled || this.greedyChild || !this.visible) return;
			var intersects = $.ui.intersect(draggable, this, this.options.tolerance);

			var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
			if(!c) return;

			var parentInstance;
			if (this.options.greedy) {
				var parent = this.element.parents(':data(droppable):eq(0)');
				if (parent.length) {
					parentInstance = $.data(parent[0], 'droppable');
					parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
				}
			}

			// we just moved into a greedy child
			if (parentInstance && c == 'isover') {
				parentInstance['isover'] = 0;
				parentInstance['isout'] = 1;
				parentInstance._out.call(parentInstance, event);
			}

			this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
			this[c == "isover" ? "_over" : "_out"].call(this, event);

			// we just moved out of a greedy child
			if (parentInstance && c == 'isout') {
				parentInstance['isout'] = 0;
				parentInstance['isover'] = 1;
				parentInstance._over.call(parentInstance, event);
			}
		});

	}
};

})(jQuery);
/*
 * jQuery UI Resizable 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Resizables
 *
 * Depends:
 *	ui.core.js
 */
(function($) {

$.widget("ui.resizable", $.extend({}, $.ui.mouse, {

	_init: function() {

		var self = this, o = this.options;
		this.element.addClass("ui-resizable");

		$.extend(this, {
			_aspectRatio: !!(o.aspectRatio),
			aspectRatio: o.aspectRatio,
			originalElement: this.element,
			_proportionallyResizeElements: [],
			_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
		});

		//Wrap the element if it cannot hold child nodes
		if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {

			//Opera fix for relative positioning
			if (/relative/.test(this.element.css('position')) && $.browser.opera)
				this.element.css({ position: 'relative', top: 'auto', left: 'auto' });

			//Create a wrapper element and set the wrapper to the new current internal element
			this.element.wrap(
				$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
					position: this.element.css('position'),
					width: this.element.outerWidth(),
					height: this.element.outerHeight(),
					top: this.element.css('top'),
					left: this.element.css('left')
				})
			);

			//Overwrite the original this.element
			this.element = this.element.parent().data(
				"resizable", this.element.data('resizable')
			);

			this.elementIsWrapper = true;

			//Move margins to the wrapper
			this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
			this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});

			//Prevent Safari textarea resize
			this.originalResizeStyle = this.originalElement.css('resize');
			this.originalElement.css('resize', 'none');

			//Push the actual element to our proportionallyResize internal array
			this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));

			// avoid IE jump (hard set the margin)
			this.originalElement.css({ margin: this.originalElement.css('margin') });

			// fix handlers offset
			this._proportionallyResize();

		}

		this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
		if(this.handles.constructor == String) {

			if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
			var n = this.handles.split(","); this.handles = {};

			for(var i = 0; i < n.length; i++) {

				var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
				var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');

				// increase zIndex of sw, se, ne, nw axis
				//TODO : this modifies original option
				if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });

				//TODO : What's going on here?
				if ('se' == handle) {
					axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
				};

				//Insert into internal handles object and append to element
				this.handles[handle] = '.ui-resizable-'+handle;
				this.element.append(axis);
			}

		}

		this._renderAxis = function(target) {

			target = target || this.element;

			for(var i in this.handles) {

				if(this.handles[i].constructor == String)
					this.handles[i] = $(this.handles[i], this.element).show();

				//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
				if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {

					var axis = $(this.handles[i], this.element), padWrapper = 0;

					//Checking the correct pad and border
					padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();

					//The padding type i have to apply...
					var padPos = [ 'padding',
						/ne|nw|n/.test(i) ? 'Top' :
						/se|sw|s/.test(i) ? 'Bottom' :
						/^e$/.test(i) ? 'Right' : 'Left' ].join("");

					target.css(padPos, padWrapper);

					this._proportionallyResize();

				}

				//TODO: What's that good for? There's not anything to be executed left
				if(!$(this.handles[i]).length)
					continue;

			}
		};

		//TODO: make renderAxis a prototype function
		this._renderAxis(this.element);

		this._handles = $('.ui-resizable-handle', this.element)
			.disableSelection();

		//Matching axis name
		this._handles.mouseover(function() {
			if (!self.resizing) {
				if (this.className)
					var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
				//Axis, default = se
				self.axis = axis && axis[1] ? axis[1] : 'se';
			}
		});

		//If we want to auto hide the elements
		if (o.autoHide) {
			this._handles.hide();
			$(this.element)
				.addClass("ui-resizable-autohide")
				.hover(function() {
					$(this).removeClass("ui-resizable-autohide");
					self._handles.show();
				},
				function(){
					if (!self.resizing) {
						$(this).addClass("ui-resizable-autohide");
						self._handles.hide();
					}
				});
		}

		//Initialize the mouse interaction
		this._mouseInit();

	},

	destroy: function() {

		this._mouseDestroy();

		var _destroy = function(exp) {
			$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
				.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
		};

		//TODO: Unwrap at same DOM position
		if (this.elementIsWrapper) {
			_destroy(this.element);
			var wrapper = this.element;
			wrapper.parent().append(
				this.originalElement.css({
					position: wrapper.css('position'),
					width: wrapper.outerWidth(),
					height: wrapper.outerHeight(),
					top: wrapper.css('top'),
					left: wrapper.css('left')
				})
			).end().remove();
		}

		this.originalElement.css('resize', this.originalResizeStyle);
		_destroy(this.originalElement);

	},

	_mouseCapture: function(event) {

		var handle = false;
		for(var i in this.handles) {
			if($(this.handles[i])[0] == event.target) handle = true;
		}

		return this.options.disabled || !!handle;

	},

	_mouseStart: function(event) {

		var o = this.options, iniPos = this.element.position(), el = this.element;

		this.resizing = true;
		this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };

		// bugfix for http://dev.jquery.com/ticket/1749
		if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
			el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
		}

		//Opera fixing relative position
		if ($.browser.opera && (/relative/).test(el.css('position')))
			el.css({ position: 'relative', top: 'auto', left: 'auto' });

		this._renderProxy();

		var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));

		if (o.containment) {
			curleft += $(o.containment).scrollLeft() || 0;
			curtop += $(o.containment).scrollTop() || 0;
		}

		//Store needed variables
		this.offset = this.helper.offset();
		this.position = { left: curleft, top: curtop };
		this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
		this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
		this.originalPosition = { left: curleft, top: curtop };
		this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
		this.originalMousePosition = { left: event.pageX, top: event.pageY };

		//Aspect Ratio
		this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);

	    var cursor = $('.ui-resizable-' + this.axis).css('cursor');
	    $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);

		el.addClass("ui-resizable-resizing");
		this._propagate("start", event);
		return true;
	},

	_mouseDrag: function(event) {

		//Increase performance, avoid regex
		var el = this.helper, o = this.options, props = {},
			self = this, smp = this.originalMousePosition, a = this.axis;

		var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
		var trigger = this._change[a];
		if (!trigger) return false;

		// Calculate the attrs that will be change
		var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;

		if (this._aspectRatio || event.shiftKey)
			data = this._updateRatio(data, event);

		data = this._respectSize(data, event);

		// plugins callbacks need to be called first
		this._propagate("resize", event);

		el.css({
			top: this.position.top + "px", left: this.position.left + "px",
			width: this.size.width + "px", height: this.size.height + "px"
		});

		if (!this._helper && this._proportionallyResizeElements.length)
			this._proportionallyResize();

		this._updateCache(data);

		// calling the user callback at the end
		this._trigger('resize', event, this.ui());

		return false;
	},

	_mouseStop: function(event) {

		this.resizing = false;
		var o = this.options, self = this;

		if(this._helper) {
			var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
						soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
							soffsetw = ista ? 0 : self.sizeDiff.width;

			var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
				left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
				top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;

			if (!o.animate)
				this.element.css($.extend(s, { top: top, left: left }));

			self.helper.height(self.size.height);
			self.helper.width(self.size.width);

			if (this._helper && !o.animate) this._proportionallyResize();
		}

		$('body').css('cursor', 'auto');

		this.element.removeClass("ui-resizable-resizing");

		this._propagate("stop", event);

		if (this._helper) this.helper.remove();
		return false;

	},

	_updateCache: function(data) {
		var o = this.options;
		this.offset = this.helper.offset();
		if (isNumber(data.left)) this.position.left = data.left;
		if (isNumber(data.top)) this.position.top = data.top;
		if (isNumber(data.height)) this.size.height = data.height;
		if (isNumber(data.width)) this.size.width = data.width;
	},

	_updateRatio: function(data, event) {

		var o = this.options, cpos = this.position, csize = this.size, a = this.axis;

		if (data.height) data.width = (csize.height * this.aspectRatio);
		else if (data.width) data.height = (csize.width / this.aspectRatio);

		if (a == 'sw') {
			data.left = cpos.left + (csize.width - data.width);
			data.top = null;
		}
		if (a == 'nw') {
			data.top = cpos.top + (csize.height - data.height);
			data.left = cpos.left + (csize.width - data.width);
		}

		return data;
	},

	_respectSize: function(data, event) {

		var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
					isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);

		if (isminw) data.width = o.minWidth;
		if (isminh) data.height = o.minHeight;
		if (ismaxw) data.width = o.maxWidth;
		if (ismaxh) data.height = o.maxHeight;

		var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
		var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);

		if (isminw && cw) data.left = dw - o.minWidth;
		if (ismaxw && cw) data.left = dw - o.maxWidth;
		if (isminh && ch)	data.top = dh - o.minHeight;
		if (ismaxh && ch)	data.top = dh - o.maxHeight;

		// fixing jump error on top/left - bug #2330
		var isNotwh = !data.width && !data.height;
		if (isNotwh && !data.left && data.top) data.top = null;
		else if (isNotwh && !data.top && data.left) data.left = null;

		return data;
	},

	_proportionallyResize: function() {

		var o = this.options;
		if (!this._proportionallyResizeElements.length) return;
		var element = this.helper || this.element;

		for (var i=0; i < this._proportionallyResizeElements.length; i++) {

			var prel = this._proportionallyResizeElements[i];

			if (!this.borderDif) {
				var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
					p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];

				this.borderDif = $.map(b, function(v, i) {
					var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
					return border + padding;
				});
			}

			if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
				continue;

			prel.css({
				height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
				width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
			});

		};

	},

	_renderProxy: function() {

		var el = this.element, o = this.options;
		this.elementOffset = el.offset();

		if(this._helper) {

			this.helper = this.helper || $('<div style="overflow:hidden;"></div>');

			// fix ie6 offset TODO: This seems broken
			var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
			pxyoffset = ( ie6 ? 2 : -1 );

			this.helper.addClass(this._helper).css({
				width: this.element.outerWidth() + pxyoffset,
				height: this.element.outerHeight() + pxyoffset,
				position: 'absolute',
				left: this.elementOffset.left - ie6offset +'px',
				top: this.elementOffset.top - ie6offset +'px',
				zIndex: ++o.zIndex //TODO: Don't modify option
			});

			this.helper
				.appendTo("body")
				.disableSelection();

		} else {
			this.helper = this.element;
		}

	},

	_change: {
		e: function(event, dx, dy) {
			return { width: this.originalSize.width + dx };
		},
		w: function(event, dx, dy) {
			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
			return { left: sp.left + dx, width: cs.width - dx };
		},
		n: function(event, dx, dy) {
			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
			return { top: sp.top + dy, height: cs.height - dy };
		},
		s: function(event, dx, dy) {
			return { height: this.originalSize.height + dy };
		},
		se: function(event, dx, dy) {
			return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
		},
		sw: function(event, dx, dy) {
			return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
		},
		ne: function(event, dx, dy) {
			return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
		},
		nw: function(event, dx, dy) {
			return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
		}
	},

	_propagate: function(n, event) {
		$.ui.plugin.call(this, n, [event, this.ui()]);
		(n != "resize" && this._trigger(n, event, this.ui()));
	},

	plugins: {},

	ui: function() {
		return {
			originalElement: this.originalElement,
			element: this.element,
			helper: this.helper,
			position: this.position,
			size: this.size,
			originalSize: this.originalSize,
			originalPosition: this.originalPosition
		};
	}

}));

$.extend($.ui.resizable, {
	version: "1.7.2",
	eventPrefix: "resize",
	defaults: {
		alsoResize: false,
		animate: false,
		animateDuration: "slow",
		animateEasing: "swing",
		aspectRatio: false,
		autoHide: false,
		cancel: ":input,option",
		containment: false,
		delay: 0,
		distance: 1,
		ghost: false,
		grid: false,
		handles: "e,s,se",
		helper: false,
		maxHeight: null,
		maxWidth: null,
		minHeight: 10,
		minWidth: 10,
		zIndex: 1000
	}
});

/*
 * Resizable Extensions
 */

$.ui.plugin.add("resizable", "alsoResize", {

	start: function(event, ui) {

		var self = $(this).data("resizable"), o = self.options;

		_store = function(exp) {
			$(exp).each(function() {
				$(this).data("resizable-alsoresize", {
					width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
					left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
				});
			});
		};

		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
			if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0];	_store(o.alsoResize); }
			else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
		}else{
			_store(o.alsoResize);
		}
	},

	resize: function(event, ui){
		var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;

		var delta = {
			height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
			top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
		},

		_alsoResize = function(exp, c) {
			$(exp).each(function() {
				var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];

				$.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
					var sum = (start[prop]||0) + (delta[prop]||0);
					if (sum && sum >= 0)
						style[prop] = sum || null;
				});

				//Opera fixing relative position
				if (/relative/.test(el.css('position')) && $.browser.opera) {
					self._revertToRelativePosition = true;
					el.css({ position: 'absolute', top: 'auto', left: 'auto' });
				}

				el.css(style);
			});
		};

		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
			$.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
		}else{
			_alsoResize(o.alsoResize);
		}
	},

	stop: function(event, ui){
		var self = $(this).data("resizable");

		//Opera fixing relative position
		if (self._revertToRelativePosition && $.browser.opera) {
			self._revertToRelativePosition = false;
			el.css({ position: 'relative' });
		}

		$(this).removeData("resizable-alsoresize-start");
	}
});

$.ui.plugin.add("resizable", "animate", {

	stop: function(event, ui) {
		var self = $(this).data("resizable"), o = self.options;

		var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
					soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
						soffsetw = ista ? 0 : self.sizeDiff.width;

		var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
					left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
						top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;

		self.element.animate(
			$.extend(style, top && left ? { top: top, left: left } : {}), {
				duration: o.animateDuration,
				easing: o.animateEasing,
				step: function() {

					var data = {
						width: parseInt(self.element.css('width'), 10),
						height: parseInt(self.element.css('height'), 10),
						top: parseInt(self.element.css('top'), 10),
						left: parseInt(self.element.css('left'), 10)
					};

					if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });

					// propagating resize, and updating values for each animation step
					self._updateCache(data);
					self._propagate("resize", event);

				}
			}
		);
	}

});

$.ui.plugin.add("resizable", "containment", {

	start: function(event, ui) {
		var self = $(this).data("resizable"), o = self.options, el = self.element;
		var oc = o.containment,	ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
		if (!ce) return;

		self.containerElement = $(ce);

		if (/document/.test(oc) || oc == document) {
			self.containerOffset = { left: 0, top: 0 };
			self.containerPosition = { left: 0, top: 0 };

			self.parentData = {
				element: $(document), left: 0, top: 0,
				width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
			};
		}

		// i'm a node, so compute top, left, right, bottom
		else {
			var element = $(ce), p = [];
			$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });

			self.containerOffset = element.offset();
			self.containerPosition = element.position();
			self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };

			var co = self.containerOffset, ch = self.containerSize.height,	cw = self.containerSize.width,
						width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);

			self.parentData = {
				element: ce, left: co.left, top: co.top, width: width, height: height
			};
		}
	},

	resize: function(event, ui) {
		var self = $(this).data("resizable"), o = self.options,
				ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
				pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;

		if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;

		if (cp.left < (self._helper ? co.left : 0)) {
			self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
			if (pRatio) self.size.height = self.size.width / o.aspectRatio;
			self.position.left = o.helper ? co.left : 0;
		}

		if (cp.top < (self._helper ? co.top : 0)) {
			self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
			if (pRatio) self.size.width = self.size.height * o.aspectRatio;
			self.position.top = self._helper ? co.top : 0;
		}

		self.offset.left = self.parentData.left+self.position.left;
		self.offset.top = self.parentData.top+self.position.top;

		var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
					hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );

		var isParent = self.containerElement.get(0) == self.element.parent().get(0),
		    isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));

		if(isParent && isOffsetRelative) woset -= self.parentData.left;

		if (woset + self.size.width >= self.parentData.width) {
			self.size.width = self.parentData.width - woset;
			if (pRatio) self.size.height = self.size.width / self.aspectRatio;
		}

		if (hoset + self.size.height >= self.parentData.height) {
			self.size.height = self.parentData.height - hoset;
			if (pRatio) self.size.width = self.size.height * self.aspectRatio;
		}
	},

	stop: function(event, ui){
		var self = $(this).data("resizable"), o = self.options, cp = self.position,
				co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;

		var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;

		if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });

		if (self._helper && !o.animate && (/static/).test(ce.css('position')))
			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });

	}
});

$.ui.plugin.add("resizable", "ghost", {

	start: function(event, ui) {

		var self = $(this).data("resizable"), o = self.options, cs = self.size;

		self.ghost = self.originalElement.clone();
		self.ghost
			.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
			.addClass('ui-resizable-ghost')
			.addClass(typeof o.ghost == 'string' ? o.ghost : '');

		self.ghost.appendTo(self.helper);

	},

	resize: function(event, ui){
		var self = $(this).data("resizable"), o = self.options;
		if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
	},

	stop: function(event, ui){
		var self = $(this).data("resizable"), o = self.options;
		if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
	}

});

$.ui.plugin.add("resizable", "grid", {

	resize: function(event, ui) {
		var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
		o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
		var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);

		if (/^(se|s|e)$/.test(a)) {
			self.size.width = os.width + ox;
			self.size.height = os.height + oy;
		}
		else if (/^(ne)$/.test(a)) {
			self.size.width = os.width + ox;
			self.size.height = os.height + oy;
			self.position.top = op.top - oy;
		}
		else if (/^(sw)$/.test(a)) {
			self.size.width = os.width + ox;
			self.size.height = os.height + oy;
			self.position.left = op.left - ox;
		}
		else {
			self.size.width = os.width + ox;
			self.size.height = os.height + oy;
			self.position.top = op.top - oy;
			self.position.left = op.left - ox;
		}
	}

});

var num = function(v) {
	return parseInt(v, 10) || 0;
};

var isNumber = function(value) {
	return !isNaN(parseInt(value, 10));
};

})(jQuery);
/*
 * jQuery UI Selectable 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Selectables
 *
 * Depends:
 *	ui.core.js
 */
(function($) {

$.widget("ui.selectable", $.extend({}, $.ui.mouse, {

	_init: function() {
		var self = this;

		this.element.addClass("ui-selectable");

		this.dragged = false;

		// cache selectee children based on filter
		var selectees;
		this.refresh = function() {
			selectees = $(self.options.filter, self.element[0]);
			selectees.each(function() {
				var $this = $(this);
				var pos = $this.offset();
				$.data(this, "selectable-item", {
					element: this,
					$element: $this,
					left: pos.left,
					top: pos.top,
					right: pos.left + $this.outerWidth(),
					bottom: pos.top + $this.outerHeight(),
					startselected: false,
					selected: $this.hasClass('ui-selected'),
					selecting: $this.hasClass('ui-selecting'),
					unselecting: $this.hasClass('ui-unselecting')
				});
			});
		};
		this.refresh();

		this.selectees = selectees.addClass("ui-selectee");

		this._mouseInit();

		this.helper = $(document.createElement('div'))
			.css({border:'1px dotted black'})
			.addClass("ui-selectable-helper");
	},

	destroy: function() {
		this.element
			.removeClass("ui-selectable ui-selectable-disabled")
			.removeData("selectable")
			.unbind(".selectable");
		this._mouseDestroy();
	},

	_mouseStart: function(event) {
		var self = this;

		this.opos = [event.pageX, event.pageY];

		if (this.options.disabled)
			return;

		var options = this.options;

		this.selectees = $(options.filter, this.element[0]);

		this._trigger("start", event);

		$(options.appendTo).append(this.helper);
		// position helper (lasso)
		this.helper.css({
			"z-index": 100,
			"position": "absolute",
			"left": event.clientX,
			"top": event.clientY,
			"width": 0,
			"height": 0
		});

		if (options.autoRefresh) {
			this.refresh();
		}

		this.selectees.filter('.ui-selected').each(function() {
			var selectee = $.data(this, "selectable-item");
			selectee.startselected = true;
			if (!event.metaKey) {
				selectee.$element.removeClass('ui-selected');
				selectee.selected = false;
				selectee.$element.addClass('ui-unselecting');
				selectee.unselecting = true;
				// selectable UNSELECTING callback
				self._trigger("unselecting", event, {
					unselecting: selectee.element
				});
			}
		});

		$(event.target).parents().andSelf().each(function() {
			var selectee = $.data(this, "selectable-item");
			if (selectee) {
				selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
				selectee.unselecting = false;
				selectee.selecting = true;
				selectee.selected = true;
				// selectable SELECTING callback
				self._trigger("selecting", event, {
					selecting: selectee.element
				});
				return false;
			}
		});

	},

	_mouseDrag: function(event) {
		var self = this;
		this.dragged = true;

		if (this.options.disabled)
			return;

		var options = this.options;

		var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
		if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
		if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
		this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});

		this.selectees.each(function() {
			var selectee = $.data(this, "selectable-item");
			//prevent helper from being selected if appendTo: selectable
			if (!selectee || selectee.element == self.element[0])
				return;
			var hit = false;
			if (options.tolerance == 'touch') {
				hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
			} else if (options.tolerance == 'fit') {
				hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
			}

			if (hit) {
				// SELECT
				if (selectee.selected) {
					selectee.$element.removeClass('ui-selected');
					selectee.selected = false;
				}
				if (selectee.unselecting) {
					selectee.$element.removeClass('ui-unselecting');
					selectee.unselecting = false;
				}
				if (!selectee.selecting) {
					selectee.$element.addClass('ui-selecting');
					selectee.selecting = true;
					// selectable SELECTING callback
					self._trigger("selecting", event, {
						selecting: selectee.element
					});
				}
			} else {
				// UNSELECT
				if (selectee.selecting) {
					if (event.metaKey && selectee.startselected) {
						selectee.$element.removeClass('ui-selecting');
						selectee.selecting = false;
						selectee.$element.addClass('ui-selected');
						selectee.selected = true;
					} else {
						selectee.$element.removeClass('ui-selecting');
						selectee.selecting = false;
						if (selectee.startselected) {
							selectee.$element.addClass('ui-unselecting');
							selectee.unselecting = true;
						}
						// selectable UNSELECTING callback
						self._trigger("unselecting", event, {
							unselecting: selectee.element
						});
					}
				}
				if (selectee.selected) {
					if (!event.metaKey && !selectee.startselected) {
						selectee.$element.removeClass('ui-selected');
						selectee.selected = false;

						selectee.$element.addClass('ui-unselecting');
						selectee.unselecting = true;
						// selectable UNSELECTING callback
						self._trigger("unselecting", event, {
							unselecting: selectee.element
						});
					}
				}
			}
		});

		return false;
	},

	_mouseStop: function(event) {
		var self = this;

		this.dragged = false;

		var options = this.options;

		$('.ui-unselecting', this.element[0]).each(function() {
			var selectee = $.data(this, "selectable-item");
			selectee.$element.removeClass('ui-unselecting');
			selectee.unselecting = false;
			selectee.startselected = false;
			self._trigger("unselected", event, {
				unselected: selectee.element
			});
		});
		$('.ui-selecting', this.element[0]).each(function() {
			var selectee = $.data(this, "selectable-item");
			selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
			selectee.selecting = false;
			selectee.selected = true;
			selectee.startselected = true;
			self._trigger("selected", event, {
				selected: selectee.element
			});
		});
		this._trigger("stop", event);

		this.helper.remove();

		return false;
	}

}));

$.extend($.ui.selectable, {
	version: "1.7.2",
	defaults: {
		appendTo: 'body',
		autoRefresh: true,
		cancel: ":input,option",
		delay: 0,
		distance: 0,
		filter: '*',
		tolerance: 'touch'
	}
});

})(jQuery);
/*
 * jQuery UI Sortable 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Sortables
 *
 * Depends:
 *	ui.core.js
 */
(function($) {

$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
	_init: function() {

		var o = this.options;
		this.containerCache = {};
		this.element.addClass("ui-sortable");

		//Get the items
		this.refresh();

		//Let's determine if the items are floating
		this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;

		//Let's determine the parent's offset
		this.offset = this.element.offset();

		//Initialize mouse events for interaction
		this._mouseInit();

	},

	destroy: function() {
		this.element
			.removeClass("ui-sortable ui-sortable-disabled")
			.removeData("sortable")
			.unbind(".sortable");
		this._mouseDestroy();

		for ( var i = this.items.length - 1; i >= 0; i-- )
			this.items[i].item.removeData("sortable-item");
	},

	_mouseCapture: function(event, overrideHandle) {

		if (this.reverting) {
			return false;
		}

		if(this.options.disabled || this.options.type == 'static') return false;

		//We have to refresh the items data once first
		this._refreshItems(event);

		//Find out if the clicked node (or one of its parents) is a actual item in this.items
		var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
			if($.data(this, 'sortable-item') == self) {
				currentItem = $(this);
				return false;
			}
		});
		if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);

		if(!currentItem) return false;
		if(this.options.handle && !overrideHandle) {
			var validHandle = false;

			$(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
			if(!validHandle) return false;
		}

		this.currentItem = currentItem;
		this._removeCurrentsFromItems();
		return true;

	},

	_mouseStart: function(event, overrideHandle, noActivation) {

		var o = this.options, self = this;
		this.currentContainer = this;

		//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
		this.refreshPositions();

		//Create and append the visible helper
		this.helper = this._createHelper(event);

		//Cache the helper size
		this._cacheHelperProportions();

		/*
		 * - Position generation -
		 * This block generates everything position related - it's the core of draggables.
		 */

		//Cache the margins of the original element
		this._cacheMargins();

		//Get the next scrolling parent
		this.scrollParent = this.helper.scrollParent();

		//The element's absolute position on the page minus margins
		this.offset = this.currentItem.offset();
		this.offset = {
			top: this.offset.top - this.margins.top,
			left: this.offset.left - this.margins.left
		};

		// Only after we got the offset, we can change the helper's position to absolute
		// TODO: Still need to figure out a way to make relative sorting possible
		this.helper.css("position", "absolute");
		this.cssPosition = this.helper.css("position");

		$.extend(this.offset, {
			click: { //Where the click happened, relative to the element
				left: event.pageX - this.offset.left,
				top: event.pageY - this.offset.top
			},
			parent: this._getParentOffset(),
			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
		});

		//Generate the original position
		this.originalPosition = this._generatePosition(event);
		this.originalPageX = event.pageX;
		this.originalPageY = event.pageY;

		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
		if(o.cursorAt)
			this._adjustOffsetFromHelper(o.cursorAt);

		//Cache the former DOM position
		this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };

		//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
		if(this.helper[0] != this.currentItem[0]) {
			this.currentItem.hide();
		}

		//Create the placeholder
		this._createPlaceholder();

		//Set a containment if given in the options
		if(o.containment)
			this._setContainment();

		if(o.cursor) { // cursor option
			if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
			$('body').css("cursor", o.cursor);
		}

		if(o.opacity) { // opacity option
			if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
			this.helper.css("opacity", o.opacity);
		}

		if(o.zIndex) { // zIndex option
			if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
			this.helper.css("zIndex", o.zIndex);
		}

		//Prepare scrolling
		if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
			this.overflowOffset = this.scrollParent.offset();

		//Call callbacks
		this._trigger("start", event, this._uiHash());

		//Recache the helper size
		if(!this._preserveHelperProportions)
			this._cacheHelperProportions();


		//Post 'activate' events to possible containers
		if(!noActivation) {
			 for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
		}

		//Prepare possible droppables
		if($.ui.ddmanager)
			$.ui.ddmanager.current = this;

		if ($.ui.ddmanager && !o.dropBehaviour)
			$.ui.ddmanager.prepareOffsets(this, event);

		this.dragging = true;

		this.helper.addClass("ui-sortable-helper");
		this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
		return true;

	},

	_mouseDrag: function(event) {

		//Compute the helpers position
		this.position = this._generatePosition(event);
		this.positionAbs = this._convertPositionTo("absolute");

		if (!this.lastPositionAbs) {
			this.lastPositionAbs = this.positionAbs;
		}

		//Do scrolling
		if(this.options.scroll) {
			var o = this.options, scrolled = false;
			if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {

				if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
				else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;

				if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
				else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;

			} else {

				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);

				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);

			}

			if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
				$.ui.ddmanager.prepareOffsets(this, event);
		}

		//Regenerate the absolute position used for position checks
		this.positionAbs = this._convertPositionTo("absolute");

		//Set the helper position
		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';

		//Rearrange
		for (var i = this.items.length - 1; i >= 0; i--) {

			//Cache variables and intersection, continue if no intersection
			var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
			if (!intersection) continue;

			if(itemElement != this.currentItem[0] //cannot intersect with itself
				&&	this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
				&&	!$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
				&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
			) {

				this.direction = intersection == 1 ? "down" : "up";

				if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
					this._rearrange(event, item);
				} else {
					break;
				}

				this._trigger("change", event, this._uiHash());
				break;
			}
		}

		//Post events to containers
		this._contactContainers(event);

		//Interconnect with droppables
		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);

		//Call callbacks
		this._trigger('sort', event, this._uiHash());

		this.lastPositionAbs = this.positionAbs;
		return false;

	},

	_mouseStop: function(event, noPropagation) {

		if(!event) return;

		//If we are using droppables, inform the manager about the drop
		if ($.ui.ddmanager && !this.options.dropBehaviour)
			$.ui.ddmanager.drop(this, event);

		if(this.options.revert) {
			var self = this;
			var cur = self.placeholder.offset();

			self.reverting = true;

			$(this.helper).animate({
				left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
				top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
			}, parseInt(this.options.revert, 10) || 500, function() {
				self._clear(event);
			});
		} else {
			this._clear(event, noPropagation);
		}

		return false;

	},

	cancel: function() {

		var self = this;

		if(this.dragging) {

			this._mouseUp();

			if(this.options.helper == "original")
				this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
			else
				this.currentItem.show();

			//Post deactivating events to containers
			for (var i = this.containers.length - 1; i >= 0; i--){
				this.containers[i]._trigger("deactivate", null, self._uiHash(this));
				if(this.containers[i].containerCache.over) {
					this.containers[i]._trigger("out", null, self._uiHash(this));
					this.containers[i].containerCache.over = 0;
				}
			}

		}

		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
		if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
		if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();

		$.extend(this, {
			helper: null,
			dragging: false,
			reverting: false,
			_noFinalSort: null
		});

		if(this.domPosition.prev) {
			$(this.domPosition.prev).after(this.currentItem);
		} else {
			$(this.domPosition.parent).prepend(this.currentItem);
		}

		return true;

	},

	serialize: function(o) {

		var items = this._getItemsAsjQuery(o && o.connected);
		var str = []; o = o || {};

		$(items).each(function() {
			var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
			if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
		});

		return str.join('&');

	},

	toArray: function(o) {

		var items = this._getItemsAsjQuery(o && o.connected);
		var ret = []; o = o || {};

		items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
		return ret;

	},

	/* Be careful with the following core functions */
	_intersectsWith: function(item) {

		var x1 = this.positionAbs.left,
			x2 = x1 + this.helperProportions.width,
			y1 = this.positionAbs.top,
			y2 = y1 + this.helperProportions.height;

		var l = item.left,
			r = l + item.width,
			t = item.top,
			b = t + item.height;

		var dyClick = this.offset.click.top,
			dxClick = this.offset.click.left;

		var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;

		if(	   this.options.tolerance == "pointer"
			|| this.options.forcePointerForContainers
			|| (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
		) {
			return isOverElement;
		} else {

			return (l < x1 + (this.helperProportions.width / 2) // Right Half
				&& x2 - (this.helperProportions.width / 2) < r // Left Half
				&& t < y1 + (this.helperProportions.height / 2) // Bottom Half
				&& y2 - (this.helperProportions.height / 2) < b ); // Top Half

		}
	},

	_intersectsWithPointer: function(item) {

		var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
			isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
			isOverElement = isOverElementHeight && isOverElementWidth,
			verticalDirection = this._getDragVerticalDirection(),
			horizontalDirection = this._getDragHorizontalDirection();

		if (!isOverElement)
			return false;

		return this.floating ?
			( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
			: ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );

	},

	_intersectsWithSides: function(item) {

		var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
			isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
			verticalDirection = this._getDragVerticalDirection(),
			horizontalDirection = this._getDragHorizontalDirection();

		if (this.floating && horizontalDirection) {
			return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
		} else {
			return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
		}

	},

	_getDragVerticalDirection: function() {
		var delta = this.positionAbs.top - this.lastPositionAbs.top;
		return delta != 0 && (delta > 0 ? "down" : "up");
	},

	_getDragHorizontalDirection: function() {
		var delta = this.positionAbs.left - this.lastPositionAbs.left;
		return delta != 0 && (delta > 0 ? "right" : "left");
	},

	refresh: function(event) {
		this._refreshItems(event);
		this.refreshPositions();
	},

	_connectWith: function() {
		var options = this.options;
		return options.connectWith.constructor == String
			? [options.connectWith]
			: options.connectWith;
	},
	
	_getItemsAsjQuery: function(connected) {

		var self = this;
		var items = [];
		var queries = [];
		var connectWith = this._connectWith();

		if(connectWith && connected) {
			for (var i = connectWith.length - 1; i >= 0; i--){
				var cur = $(connectWith[i]);
				for (var j = cur.length - 1; j >= 0; j--){
					var inst = $.data(cur[j], 'sortable');
					if(inst && inst != this && !inst.options.disabled) {
						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper"), inst]);
					}
				};
			};
		}

		queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper"), this]);

		for (var i = queries.length - 1; i >= 0; i--){
			queries[i][0].each(function() {
				items.push(this);
			});
		};

		return $(items);

	},

	_removeCurrentsFromItems: function() {

		var list = this.currentItem.find(":data(sortable-item)");

		for (var i=0; i < this.items.length; i++) {

			for (var j=0; j < list.length; j++) {
				if(list[j] == this.items[i].item[0])
					this.items.splice(i,1);
			};

		};

	},

	_refreshItems: function(event) {

		this.items = [];
		this.containers = [this];
		var items = this.items;
		var self = this;
		var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
		var connectWith = this._connectWith();

		if(connectWith) {
			for (var i = connectWith.length - 1; i >= 0; i--){
				var cur = $(connectWith[i]);
				for (var j = cur.length - 1; j >= 0; j--){
					var inst = $.data(cur[j], 'sortable');
					if(inst && inst != this && !inst.options.disabled) {
						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
						this.containers.push(inst);
					}
				};
			};
		}

		for (var i = queries.length - 1; i >= 0; i--) {
			var targetData = queries[i][1];
			var _queries = queries[i][0];

			for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
				var item = $(_queries[j]);

				item.data('sortable-item', targetData); // Data for target checking (mouse manager)

				items.push({
					item: item,
					instance: targetData,
					width: 0, height: 0,
					left: 0, top: 0
				});
			};
		};

	},

	refreshPositions: function(fast) {

		//This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
		if(this.offsetParent && this.helper) {
			this.offset.parent = this._getParentOffset();
		}

		for (var i = this.items.length - 1; i >= 0; i--){
			var item = this.items[i];

			//We ignore calculating positions of all connected containers when we're not over them
			if(item.instance != this.currentContainer && this.currentContainer && item.item[0] != this.currentItem[0])
				continue;

			var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;

			if (!fast) {
				item.width = t.outerWidth();
				item.height = t.outerHeight();
			}

			var p = t.offset();
			item.left = p.left;
			item.top = p.top;
		};

		if(this.options.custom && this.options.custom.refreshContainers) {
			this.options.custom.refreshContainers.call(this);
		} else {
			for (var i = this.containers.length - 1; i >= 0; i--){
				var p = this.containers[i].element.offset();
				this.containers[i].containerCache.left = p.left;
				this.containers[i].containerCache.top = p.top;
				this.containers[i].containerCache.width	= this.containers[i].element.outerWidth();
				this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
			};
		}

	},

	_createPlaceholder: function(that) {

		var self = that || this, o = self.options;

		if(!o.placeholder || o.placeholder.constructor == String) {
			var className = o.placeholder;
			o.placeholder = {
				element: function() {

					var el = $(document.createElement(self.currentItem[0].nodeName))
						.addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
						.removeClass("ui-sortable-helper")[0];

					if(!className)
						el.style.visibility = "hidden";

					return el;
				},
				update: function(container, p) {

					// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
					if(className && !o.forcePlaceholderSize) return;

					//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
					if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
					if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
				}
			};
		}

		//Create the placeholder
		self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));

		//Append it after the actual current item
		self.currentItem.after(self.placeholder);

		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
		o.placeholder.update(self, self.placeholder);

	},

	_contactContainers: function(event) {
		for (var i = this.containers.length - 1; i >= 0; i--){

			if(this._intersectsWith(this.containers[i].containerCache)) {
				if(!this.containers[i].containerCache.over) {

					if(this.currentContainer != this.containers[i]) {

						//When entering a new container, we will find the item with the least distance and append our item near it
						var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[i].floating ? 'left' : 'top'];
						for (var j = this.items.length - 1; j >= 0; j--) {
							if(!$.ui.contains(this.containers[i].element[0], this.items[j].item[0])) continue;
							var cur = this.items[j][this.containers[i].floating ? 'left' : 'top'];
							if(Math.abs(cur - base) < dist) {
								dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
							}
						}

						if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
							continue;

						this.currentContainer = this.containers[i];
						itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[i].element, true);
						this._trigger("change", event, this._uiHash());
						this.containers[i]._trigger("change", event, this._uiHash(this));

						//Update the placeholder
						this.options.placeholder.update(this.currentContainer, this.placeholder);

					}

					this.containers[i]._trigger("over", event, this._uiHash(this));
					this.containers[i].containerCache.over = 1;
				}
			} else {
				if(this.containers[i].containerCache.over) {
					this.containers[i]._trigger("out", event, this._uiHash(this));
					this.containers[i].containerCache.over = 0;
				}
			}

		};
	},

	_createHelper: function(event) {

		var o = this.options;
		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);

		if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
			$(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);

		if(helper[0] == this.currentItem[0])
			this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };

		if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
		if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());

		return helper;

	},

	_adjustOffsetFromHelper: function(obj) {
		if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left;
		if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
		if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top;
		if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
	},

	_getParentOffset: function() {


		//Get the offsetParent and cache its position
		this.offsetParent = this.helper.offsetParent();
		var po = this.offsetParent.offset();

		// This is a special case where we need to modify a offset calculated on start, since the following happened:
		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
			po.left += this.scrollParent.scrollLeft();
			po.top += this.scrollParent.scrollTop();
		}

		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
			po = { top: 0, left: 0 };

		return {
			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
		};

	},

	_getRelativeOffset: function() {

		if(this.cssPosition == "relative") {
			var p = this.currentItem.position();
			return {
				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
			};
		} else {
			return { top: 0, left: 0 };
		}

	},

	_cacheMargins: function() {
		this.margins = {
			left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
			top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
		};
	},

	_cacheHelperProportions: function() {
		this.helperProportions = {
			width: this.helper.outerWidth(),
			height: this.helper.outerHeight()
		};
	},

	_setContainment: function() {

		var o = this.options;
		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
		if(o.containment == 'document' || o.containment == 'window') this.containment = [
			0 - this.offset.relative.left - this.offset.parent.left,
			0 - this.offset.relative.top - this.offset.parent.top,
			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
		];

		if(!(/^(document|window|parent)$/).test(o.containment)) {
			var ce = $(o.containment)[0];
			var co = $(o.containment).offset();
			var over = ($(ce).css("overflow") != 'hidden');

			this.containment = [
				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
			];
		}

	},

	_convertPositionTo: function(d, pos) {

		if(!pos) pos = this.position;
		var mod = d == "absolute" ? 1 : -1;
		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);

		return {
			top: (
				pos.top																	// The absolute mouse position
				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
			),
			left: (
				pos.left																// The absolute mouse position
				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
			)
		};

	},

	_generatePosition: function(event) {

		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);

		// This is another very weird special case that only happens for relative elements:
		// 1. If the css position is relative
		// 2. and the scroll parent is the document or similar to the offset parent
		// we have to refresh the relative offset during the scroll so there are no jumps
		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
			this.offset.relative = this._getRelativeOffset();
		}

		var pageX = event.pageX;
		var pageY = event.pageY;

		/*
		 * - Position constraining -
		 * Constrain the position to a mix of grid, containment.
		 */

		if(this.originalPosition) { //If we are not dragging yet, we won't check for options

			if(this.containment) {
				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
			}

			if(o.grid) {
				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;

				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
			}

		}

		return {
			top: (
				pageY																// The absolute mouse position
				- this.offset.click.top													// Click offset (relative to the element)
				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
			),
			left: (
				pageX																// The absolute mouse position
				- this.offset.click.left												// Click offset (relative to the element)
				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
			)
		};

	},

	_rearrange: function(event, i, a, hardRefresh) {

		a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));

		//Various things done here to improve the performance:
		// 1. we create a setTimeout, that calls refreshPositions
		// 2. on the instance, we have a counter variable, that get's higher after every append
		// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
		// 4. this lets only the last addition to the timeout stack through
		this.counter = this.counter ? ++this.counter : 1;
		var self = this, counter = this.counter;

		window.setTimeout(function() {
			if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
		},0);

	},

	_clear: function(event, noPropagation) {

		this.reverting = false;
		// We delay all events that have to be triggered to after the point where the placeholder has been removed and
		// everything else normalized again
		var delayedTriggers = [], self = this;

		// We first have to update the dom position of the actual currentItem
		// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
		if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
		this._noFinalSort = null;

		if(this.helper[0] == this.currentItem[0]) {
			for(var i in this._storedCSS) {
				if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
			}
			this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
		} else {
			this.currentItem.show();
		}

		if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
		if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
		if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
			if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
			for (var i = this.containers.length - 1; i >= 0; i--){
				if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
					delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
					delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this));  }; }).call(this, this.containers[i]));
				}
			};
		};

		//Post events to containers
		for (var i = this.containers.length - 1; i >= 0; i--){
			if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
			if(this.containers[i].containerCache.over) {
				delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
				this.containers[i].containerCache.over = 0;
			}
		}

		//Do what was originally in plugins
		if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
		if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset cursor
		if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index

		this.dragging = false;
		if(this.cancelHelperRemoval) {
			if(!noPropagation) {
				this._trigger("beforeStop", event, this._uiHash());
				for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
				this._trigger("stop", event, this._uiHash());
			}
			return false;
		}

		if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());

		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
		this.placeholder[0].parentNode.removeChild(this.placeholder[0]);

		if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;

		if(!noPropagation) {
			for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
			this._trigger("stop", event, this._uiHash());
		}

		this.fromOutside = false;
		return true;

	},

	_trigger: function() {
		if ($.widget.prototype._trigger.apply(this, arguments) === false) {
			this.cancel();
		}
	},

	_uiHash: function(inst) {
		var self = inst || this;
		return {
			helper: self.helper,
			placeholder: self.placeholder || $([]),
			position: self.position,
			absolutePosition: self.positionAbs, //deprecated
			offset: self.positionAbs,
			item: self.currentItem,
			sender: inst ? inst.element : null
		};
	}

}));

$.extend($.ui.sortable, {
	getter: "serialize toArray",
	version: "1.7.2",
	eventPrefix: "sort",
	defaults: {
		appendTo: "parent",
		axis: false,
		cancel: ":input,option",
		connectWith: false,
		containment: false,
		cursor: 'auto',
		cursorAt: false,
		delay: 0,
		distance: 1,
		dropOnEmpty: true,
		forcePlaceholderSize: false,
		forceHelperSize: false,
		grid: false,
		handle: false,
		helper: "original",
		items: '> *',
		opacity: false,
		placeholder: false,
		revert: false,
		scroll: true,
		scrollSensitivity: 20,
		scrollSpeed: 20,
		scope: "default",
		tolerance: "intersect",
		zIndex: 1000
	}
});

})(jQuery);
/*
 * jQuery UI Accordion 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Accordion
 *
 * Depends:
 *	ui.core.js
 */
(function($) {

$.widget("ui.accordion", {

	_init: function() {

		var o = this.options, self = this;
		this.running = 0;

		// if the user set the alwaysOpen option on init
		// then we need to set the collapsible option
		// if they set both on init, collapsible will take priority
		if (o.collapsible == $.ui.accordion.defaults.collapsible &&
			o.alwaysOpen != $.ui.accordion.defaults.alwaysOpen) {
			o.collapsible = !o.alwaysOpen;
		}

		if ( o.navigation ) {
			var current = this.element.find("a").filter(o.navigationFilter);
			if ( current.length ) {
				if ( current.filter(o.header).length ) {
					this.active = current;
				} else {
					this.active = current.parent().parent().prev();
					current.addClass("ui-accordion-content-active");
				}
			}
		}

		this.element.addClass("ui-accordion ui-widget ui-helper-reset");
		
		// in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
		if (this.element[0].nodeName == "UL") {
			this.element.children("li").addClass("ui-accordion-li-fix");
		}

		this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
			.bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
			.bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
			.bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
			.bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });

		this.headers
			.next()
				.addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");

		this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
		this.active.next().addClass('ui-accordion-content-active');

		//Append icon elements
		$("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
		this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);

		// IE7-/Win - Extra vertical space in lists fixed
		if ($.browser.msie) {
			this.element.find('a').css('zoom', '1');
		}

		this.resize();

		//ARIA
		this.element.attr('role','tablist');

		this.headers
			.attr('role','tab')
			.bind('keydown', function(event) { return self._keydown(event); })
			.next()
			.attr('role','tabpanel');

		this.headers
			.not(this.active || "")
			.attr('aria-expanded','false')
			.attr("tabIndex", "-1")
			.next()
			.hide();

		// make sure at least one header is in the tab order
		if (!this.active.length) {
			this.headers.eq(0).attr('tabIndex','0');
		} else {
			this.active
				.attr('aria-expanded','true')
				.attr('tabIndex', '0');
		}

		// only need links in taborder for Safari
		if (!$.browser.safari)
			this.headers.find('a').attr('tabIndex','-1');

		if (o.event) {
			this.headers.bind((o.event) + ".accordion", function(event) { return self._clickHandler.call(self, event, this); });
		}

	},

	destroy: function() {
		var o = this.options;

		this.element
			.removeClass("ui-accordion ui-widget ui-helper-reset")
			.removeAttr("role")
			.unbind('.accordion')
			.removeData('accordion');

		this.headers
			.unbind(".accordion")
			.removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
			.removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");

		this.headers.find("a").removeAttr("tabindex");
		this.headers.children(".ui-icon").remove();
		var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
		if (o.autoHeight || o.fillHeight) {
			contents.css("height", "");
		}
	},
	
	_setData: function(key, value) {
		if(key == 'alwaysOpen') { key = 'collapsible'; value = !value; }
		$.widget.prototype._setData.apply(this, arguments);	
	},

	_keydown: function(event) {

		var o = this.options, keyCode = $.ui.keyCode;

		if (o.disabled || event.altKey || event.ctrlKey)
			return;

		var length = this.headers.length;
		var currentIndex = this.headers.index(event.target);
		var toFocus = false;

		switch(event.keyCode) {
			case keyCode.RIGHT:
			case keyCode.DOWN:
				toFocus = this.headers[(currentIndex + 1) % length];
				break;
			case keyCode.LEFT:
			case keyCode.UP:
				toFocus = this.headers[(currentIndex - 1 + length) % length];
				break;
			case keyCode.SPACE:
			case keyCode.ENTER:
				return this._clickHandler({ target: event.target }, event.target);
		}

		if (toFocus) {
			$(event.target).attr('tabIndex','-1');
			$(toFocus).attr('tabIndex','0');
			toFocus.focus();
			return false;
		}

		return true;

	},

	resize: function() {

		var o = this.options, maxHeight;

		if (o.fillSpace) {
			
			if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
			maxHeight = this.element.parent().height();
			if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
	
			this.headers.each(function() {
				maxHeight -= $(this).outerHeight();
			});

			var maxPadding = 0;
			this.headers.next().each(function() {
				maxPadding = Math.max(maxPadding, $(this).innerHeight() - $(this).height());
			}).height(Math.max(0, maxHeight - maxPadding))
			.css('overflow', 'auto');

		} else if ( o.autoHeight ) {
			maxHeight = 0;
			this.headers.next().each(function() {
				maxHeight = Math.max(maxHeight, $(this).outerHeight());
			}).height(maxHeight);
		}

	},

	activate: function(index) {
		// call clickHandler with custom event
		var active = this._findActive(index)[0];
		this._clickHandler({ target: active }, active);
	},

	_findActive: function(selector) {
		return selector
			? typeof selector == "number"
				? this.headers.filter(":eq(" + selector + ")")
				: this.headers.not(this.headers.not(selector))
			: selector === false
				? $([])
				: this.headers.filter(":eq(0)");
	},

	_clickHandler: function(event, target) {

		var o = this.options;
		if (o.disabled) return false;

		// called only when using activate(false) to close all parts programmatically
		if (!event.target && o.collapsible) {
			this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
				.find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
			this.active.next().addClass('ui-accordion-content-active');
			var toHide = this.active.next(),
				data = {
					options: o,
					newHeader: $([]),
					oldHeader: o.active,
					newContent: $([]),
					oldContent: toHide
				},
				toShow = (this.active = $([]));
			this._toggle(toShow, toHide, data);
			return false;
		}

		// get the click target
		var clicked = $(event.currentTarget || target);
		var clickedIsActive = clicked[0] == this.active[0];

		// if animations are still active, or the active header is the target, ignore click
		if (this.running || (!o.collapsible && clickedIsActive)) {
			return false;
		}

		// switch classes
		this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
			.find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
		this.active.next().addClass('ui-accordion-content-active');
		if (!clickedIsActive) {
			clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
				.find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
			clicked.next().addClass('ui-accordion-content-active');
		}

		// find elements to show and hide
		var toShow = clicked.next(),
			toHide = this.active.next(),
			data = {
				options: o,
				newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
				oldHeader: this.active,
				newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
				oldContent: toHide.find('> *')
			},
			down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );

		this.active = clickedIsActive ? $([]) : clicked;
		this._toggle(toShow, toHide, data, clickedIsActive, down);

		return false;

	},

	_toggle: function(toShow, toHide, data, clickedIsActive, down) {

		var o = this.options, self = this;

		this.toShow = toShow;
		this.toHide = toHide;
		this.data = data;

		var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };

		// trigger changestart event
		this._trigger("changestart", null, this.data);

		// count elements to animate
		this.running = toHide.size() === 0 ? toShow.size() : toHide.size();

		if (o.animated) {

			var animOptions = {};

			if ( o.collapsible && clickedIsActive ) {
				animOptions = {
					toShow: $([]),
					toHide: toHide,
					complete: complete,
					down: down,
					autoHeight: o.autoHeight || o.fillSpace
				};
			} else {
				animOptions = {
					toShow: toShow,
					toHide: toHide,
					complete: complete,
					down: down,
					autoHeight: o.autoHeight || o.fillSpace
				};
			}

			if (!o.proxied) {
				o.proxied = o.animated;
			}

			if (!o.proxiedDuration) {
				o.proxiedDuration = o.duration;
			}

			o.animated = $.isFunction(o.proxied) ?
				o.proxied(animOptions) : o.proxied;

			o.duration = $.isFunction(o.proxiedDuration) ?
				o.proxiedDuration(animOptions) : o.proxiedDuration;

			var animations = $.ui.accordion.animations,
				duration = o.duration,
				easing = o.animated;

			if (!animations[easing]) {
				animations[easing] = function(options) {
					this.slide(options, {
						easing: easing,
						duration: duration || 700
					});
				};
			}

			animations[easing](animOptions);

		} else {

			if (o.collapsible && clickedIsActive) {
				toShow.toggle();
			} else {
				toHide.hide();
				toShow.show();
			}

			complete(true);

		}

		toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
		toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();

	},

	_completed: function(cancel) {

		var o = this.options;

		this.running = cancel ? 0 : --this.running;
		if (this.running) return;

		if (o.clearStyle) {
			this.toShow.add(this.toHide).css({
				height: "",
				overflow: ""
			});
		}

		this._trigger('change', null, this.data);
	}

});


$.extend($.ui.accordion, {
	version: "1.7.2",
	defaults: {
		active: null,
		alwaysOpen: true, //deprecated, use collapsible
		animated: 'slide',
		autoHeight: true,
		clearStyle: false,
		collapsible: false,
		event: "click",
		fillSpace: false,
		header: "> li > :first-child,> :not(li):even",
		icons: {
			header: "ui-icon-triangle-1-e",
			headerSelected: "ui-icon-triangle-1-s"
		},
		navigation: false,
		navigationFilter: function() {
			return this.href.toLowerCase() == location.href.toLowerCase();
		}
	},
	animations: {
		slide: function(options, additions) {
			options = $.extend({
				easing: "swing",
				duration: 300
			}, options, additions);
			if ( !options.toHide.size() ) {
				options.toShow.animate({height: "show"}, options);
				return;
			}
			if ( !options.toShow.size() ) {
				options.toHide.animate({height: "hide"}, options);
				return;
			}
			var overflow = options.toShow.css('overflow'),
				percentDone,
				showProps = {},
				hideProps = {},
				fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
				originalWidth;
			// fix width before calculating height of hidden element
			var s = options.toShow;
			originalWidth = s[0].style.width;
			s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
			
			$.each(fxAttrs, function(i, prop) {
				hideProps[prop] = 'hide';
				
				var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
				showProps[prop] = {
					value: parts[1],
					unit: parts[2] || 'px'
				};
			});
			options.toShow.css({ height: 0, overflow: 'hidden' }).show();
			options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
				step: function(now, settings) {
					// only calculate the percent when animating height
					// IE gets very inconsistent results when animating elements
					// with small values, which is common for padding
					if (settings.prop == 'height') {
						percentDone = (settings.now - settings.start) / (settings.end - settings.start);
					}
					
					options.toShow[0].style[settings.prop] =
						(percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
				},
				duration: options.duration,
				easing: options.easing,
				complete: function() {
					if ( !options.autoHeight ) {
						options.toShow.css("height", "");
					}
					options.toShow.css("width", originalWidth);
					options.toShow.css({overflow: overflow});
					options.complete();
				}
			});
		},
		bounceslide: function(options) {
			this.slide(options, {
				easing: options.down ? "easeOutBounce" : "swing",
				duration: options.down ? 1000 : 200
			});
		},
		easeslide: function(options) {
			this.slide(options, {
				easing: "easeinout",
				duration: 700
			});
		}
	}
});

})(jQuery);
/*
 * jQuery UI Dialog 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Dialog
 *
 * Depends:
 *	ui.core.js
 *	ui.draggable.js
 *	ui.resizable.js
 */
(function($) {

var setDataSwitch = {
		dragStart: "start.draggable",
		drag: "drag.draggable",
		dragStop: "stop.draggable",
		maxHeight: "maxHeight.resizable",
		minHeight: "minHeight.resizable",
		maxWidth: "maxWidth.resizable",
		minWidth: "minWidth.resizable",
		resizeStart: "start.resizable",
		resize: "drag.resizable",
		resizeStop: "stop.resizable"
	},
	
	uiDialogClasses =
		'ui-dialog ' +
		'ui-widget ' +
		'ui-widget-content ' +
		'ui-corner-all ';

$.widget("ui.dialog", {

	_init: function() {
		this.originalTitle = this.element.attr('title');

		var self = this,
			options = this.options,

			title = options.title || this.originalTitle || '&nbsp;',
			titleId = $.ui.dialog.getTitleId(this.element),

			uiDialog = (this.uiDialog = $('<div/>'))
				.appendTo(document.body)
				.hide()
				.addClass(uiDialogClasses + options.dialogClass)
				.css({
					position: 'absolute',
					overflow: 'hidden',
					zIndex: options.zIndex
				})
				// setting tabIndex makes the div focusable
				// setting outline to 0 prevents a border on focus in Mozilla
				.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
					(options.closeOnEscape && event.keyCode
						&& event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
				})
				.attr({
					role: 'dialog',
					'aria-labelledby': titleId
				})
				.mousedown(function(event) {
					self.moveToTop(false, event);
				}),

			uiDialogContent = this.element
				.show()
				.removeAttr('title')
				.addClass(
					'ui-dialog-content ' +
					'ui-widget-content')
				.appendTo(uiDialog),

			uiDialogTitlebar = (this.uiDialogTitlebar = $('<div></div>'))
				.addClass(
					'ui-dialog-titlebar ' +
					'ui-widget-header ' +
					'ui-corner-all ' +
					'ui-helper-clearfix'
				)
				.prependTo(uiDialog),

			uiDialogTitlebarClose = $('<a href="#"/>')
				.addClass(
					'ui-dialog-titlebar-close ' +
					'ui-corner-all'
				)
				.attr('role', 'button')
				.hover(
					function() {
						uiDialogTitlebarClose.addClass('ui-state-hover');
					},
					function() {
						uiDialogTitlebarClose.removeClass('ui-state-hover');
					}
				)
				.focus(function() {
					uiDialogTitlebarClose.addClass('ui-state-focus');
				})
				.blur(function() {
					uiDialogTitlebarClose.removeClass('ui-state-focus');
				})
				.mousedown(function(ev) {
					ev.stopPropagation();
				})
				.click(function(event) {
					self.close(event);
					return false;
				})
				.appendTo(uiDialogTitlebar),

			uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('<span/>'))
				.addClass(
					'ui-icon ' +
					'ui-icon-closethick'
				)
				.text(options.closeText)
				.appendTo(uiDialogTitlebarClose),

			uiDialogTitle = $('<span/>')
				.addClass('ui-dialog-title')
				.attr('id', titleId)
				.html(title)
				.prependTo(uiDialogTitlebar);

		uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();

		(options.draggable && $.fn.draggable && this._makeDraggable());
		(options.resizable && $.fn.resizable && this._makeResizable());

		this._createButtons(options.buttons);
		this._isOpen = false;

		(options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe());
		(options.autoOpen && this.open());
		
	},

	destroy: function() {
		(this.overlay && this.overlay.destroy());
		this.uiDialog.hide();
		this.element
			.unbind('.dialog')
			.removeData('dialog')
			.removeClass('ui-dialog-content ui-widget-content')
			.hide().appendTo('body');
		this.uiDialog.remove();

		(this.originalTitle && this.element.attr('title', this.originalTitle));
	},

	close: function(event) {
		var self = this;
		
		if (false === self._trigger('beforeclose', event)) {
			return;
		}

		(self.overlay && self.overlay.destroy());
		self.uiDialog.unbind('keypress.ui-dialog');

		(self.options.hide
			? self.uiDialog.hide(self.options.hide, function() {
				self._trigger('close', event);
			})
			: self.uiDialog.hide() && self._trigger('close', event));

		$.ui.dialog.overlay.resize();

		self._isOpen = false;
		
		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
		if (self.options.modal) {
			var maxZ = 0;
			$('.ui-dialog').each(function() {
				if (this != self.uiDialog[0]) {
					maxZ = Math.max(maxZ, $(this).css('z-index'));
				}
			});
			$.ui.dialog.maxZ = maxZ;
		}
	},

	isOpen: function() {
		return this._isOpen;
	},

	// the force parameter allows us to move modal dialogs to their correct
	// position on open
	moveToTop: function(force, event) {

		if ((this.options.modal && !force)
			|| (!this.options.stack && !this.options.modal)) {
			return this._trigger('focus', event);
		}
		
		if (this.options.zIndex > $.ui.dialog.maxZ) {
			$.ui.dialog.maxZ = this.options.zIndex;
		}
		(this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));

		//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
		//  http://ui.jquery.com/bugs/ticket/3193
		var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') };
		this.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
		this.element.attr(saveScroll);
		this._trigger('focus', event);
	},

	open: function() {
		if (this._isOpen) { return; }

		var options = this.options,
			uiDialog = this.uiDialog;

		this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null;
		(uiDialog.next().length && uiDialog.appendTo('body'));
		this._size();
		this._position(options.position);
		uiDialog.show(options.show);
		this.moveToTop(true);

		// prevent tabbing out of modal dialogs
		(options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
			if (event.keyCode != $.ui.keyCode.TAB) {
				return;
			}

			var tabbables = $(':tabbable', this),
				first = tabbables.filter(':first')[0],
				last  = tabbables.filter(':last')[0];

			if (event.target == last && !event.shiftKey) {
				setTimeout(function() {
					first.focus();
				}, 1);
			} else if (event.target == first && event.shiftKey) {
				setTimeout(function() {
					last.focus();
				}, 1);
			}
		}));

		// set focus to the first tabbable element in the content area or the first button
		// if there are no tabbable elements, set focus on the dialog itself
		$([])
			.add(uiDialog.find('.ui-dialog-content :tabbable:first'))
			.add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
			.add(uiDialog)
			.filter(':first')
			.focus();

		this._trigger('open');
		this._isOpen = true;
	},

	_createButtons: function(buttons) {
		var self = this,
			hasButtons = false,
			uiDialogButtonPane = $('<div></div>')
				.addClass(
					'ui-dialog-buttonpane ' +
					'ui-widget-content ' +
					'ui-helper-clearfix'
				);

		// if we already have a button pane, remove it
		this.uiDialog.find('.ui-dialog-buttonpane').remove();

		(typeof buttons == 'object' && buttons !== null &&
			$.each(buttons, function() { return !(hasButtons = true); }));
		if (hasButtons) {
			$.each(buttons, function(name, fn) {
				$('<button type="button"></button>')
					.addClass(
						'ui-state-default ' +
						'ui-corner-all'
					)
					.text(name)
					.click(function() { fn.apply(self.element[0], arguments); })
					.hover(
						function() {
							$(this).addClass('ui-state-hover');
						},
						function() {
							$(this).removeClass('ui-state-hover');
						}
					)
					.focus(function() {
						$(this).addClass('ui-state-focus');
					})
					.blur(function() {
						$(this).removeClass('ui-state-focus');
					})
					.appendTo(uiDialogButtonPane);
			});
			uiDialogButtonPane.appendTo(this.uiDialog);
		}
	},

	_makeDraggable: function() {
		var self = this,
			options = this.options,
			heightBeforeDrag;

		this.uiDialog.draggable({
			cancel: '.ui-dialog-content',
			handle: '.ui-dialog-titlebar',
			containment: 'document',
			start: function() {
				heightBeforeDrag = options.height;
				$(this).height($(this).height()).addClass("ui-dialog-dragging");
				(options.dragStart && options.dragStart.apply(self.element[0], arguments));
			},
			drag: function() {
				(options.drag && options.drag.apply(self.element[0], arguments));
			},
			stop: function() {
				$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
				(options.dragStop && options.dragStop.apply(self.element[0], arguments));
				$.ui.dialog.overlay.resize();
			}
		});
	},

	_makeResizable: function(handles) {
		handles = (handles === undefined ? this.options.resizable : handles);
		var self = this,
			options = this.options,
			resizeHandles = typeof handles == 'string'
				? handles
				: 'n,e,s,w,se,sw,ne,nw';

		this.uiDialog.resizable({
			cancel: '.ui-dialog-content',
			alsoResize: this.element,
			maxWidth: options.maxWidth,
			maxHeight: options.maxHeight,
			minWidth: options.minWidth,
			minHeight: options.minHeight,
			start: function() {
				$(this).addClass("ui-dialog-resizing");
				(options.resizeStart && options.resizeStart.apply(self.element[0], arguments));
			},
			resize: function() {
				(options.resize && options.resize.apply(self.element[0], arguments));
			},
			handles: resizeHandles,
			stop: function() {
				$(this).removeClass("ui-dialog-resizing");
				options.height = $(this).height();
				options.width = $(this).width();
				(options.resizeStop && options.resizeStop.apply(self.element[0], arguments));
				$.ui.dialog.overlay.resize();
			}
		})
		.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
	},

	_position: function(pos) {
		var wnd = $(window), doc = $(document),
			pTop = doc.scrollTop(), pLeft = doc.scrollLeft(),
			minTop = pTop;

		if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) {
			pos = [
				pos == 'right' || pos == 'left' ? pos : 'center',
				pos == 'top' || pos == 'bottom' ? pos : 'middle'
			];
		}
		if (pos.constructor != Array) {
			pos = ['center', 'middle'];
		}
		if (pos[0].constructor == Number) {
			pLeft += pos[0];
		} else {
			switch (pos[0]) {
				case 'left':
					pLeft += 0;
					break;
				case 'right':
					pLeft += wnd.width() - this.uiDialog.outerWidth();
					break;
				default:
				case 'center':
					pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2;
			}
		}
		if (pos[1].constructor == Number) {
			pTop += pos[1];
		} else {
			switch (pos[1]) {
				case 'top':
					pTop += 0;
					break;
				case 'bottom':
					pTop += wnd.height() - this.uiDialog.outerHeight();
					break;
				default:
				case 'middle':
					pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2;
			}
		}

		// prevent the dialog from being too high (make sure the titlebar
		// is accessible)
		pTop = Math.max(pTop, minTop);
		this.uiDialog.css({top: pTop, left: pLeft});
	},

	_setData: function(key, value){
		(setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value));
		switch (key) {
			case "buttons":
				this._createButtons(value);
				break;
			case "closeText":
				this.uiDialogTitlebarCloseText.text(value);
				break;
			case "dialogClass":
				this.uiDialog
					.removeClass(this.options.dialogClass)
					.addClass(uiDialogClasses + value);
				break;
			case "draggable":
				(value
					? this._makeDraggable()
					: this.uiDialog.draggable('destroy'));
				break;
			case "height":
				this.uiDialog.height(value);
				break;
			case "position":
				this._position(value);
				break;
			case "resizable":
				var uiDialog = this.uiDialog,
					isResizable = this.uiDialog.is(':data(resizable)');

				// currently resizable, becoming non-resizable
				(isResizable && !value && uiDialog.resizable('destroy'));

				// currently resizable, changing handles
				(isResizable && typeof value == 'string' &&
					uiDialog.resizable('option', 'handles', value));

				// currently non-resizable, becoming resizable
				(isResizable || this._makeResizable(value));
				break;
			case "title":
				$(".ui-dialog-title", this.uiDialogTitlebar).html(value || '&nbsp;');
				break;
			case "width":
				this.uiDialog.width(value);
				break;
		}

		$.widget.prototype._setData.apply(this, arguments);
	},

	_size: function() {
		/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
		 * divs will both have width and height set, so we need to reset them
		 */
		var options = this.options;

		// reset content sizing
		this.element.css({
			height: 0,
			minHeight: 0,
			width: 'auto'
		});

		// reset wrapper sizing
		// determine the height of all the non-content elements
		var nonContentHeight = this.uiDialog.css({
				height: 'auto',
				width: options.width
			})
			.height();

		this.element
			.css({
				minHeight: Math.max(options.minHeight - nonContentHeight, 0),
				height: options.height == 'auto'
					? 'auto'
					: Math.max(options.height - nonContentHeight, 0)
			});
	}
});

$.extend($.ui.dialog, {
	version: "1.7.2",
	defaults: {
		autoOpen: true,
		bgiframe: false,
		buttons: {},
		closeOnEscape: true,
		closeText: 'close',
		dialogClass: '',
		draggable: true,
		hide: null,
		height: 'auto',
		maxHeight: false,
		maxWidth: false,
		minHeight: 150,
		minWidth: 150,
		modal: false,
		position: 'center',
		resizable: true,
		show: null,
		stack: true,
		title: '',
		width: 300,
		zIndex: 1000
	},

	getter: 'isOpen',

	uuid: 0,
	maxZ: 0,

	getTitleId: function($el) {
		return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
	},

	overlay: function(dialog) {
		this.$el = $.ui.dialog.overlay.create(dialog);
	}
});

$.extend($.ui.dialog.overlay, {
	instances: [],
	maxZ: 0,
	events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
		function(event) { return event + '.dialog-overlay'; }).join(' '),
	create: function(dialog) {
		if (this.instances.length === 0) {
			// prevent use of anchors and inputs
			// we use a setTimeout in case the overlay is created from an
			// event that we're going to be cancelling (see #2804)
			setTimeout(function() {
				// handle $(el).dialog().dialog('close') (see #4065)
				if ($.ui.dialog.overlay.instances.length) {
					$(document).bind($.ui.dialog.overlay.events, function(event) {
						var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
						return (dialogZ > $.ui.dialog.overlay.maxZ);
					});
				}
			}, 1);

			// allow closing by pressing the escape key
			$(document).bind('keydown.dialog-overlay', function(event) {
				(dialog.options.closeOnEscape && event.keyCode
						&& event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
			});

			// handle window resize
			$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
		}

		var $el = $('<div></div>').appendTo(document.body)
			.addClass('ui-widget-overlay').css({
				width: this.width(),
				height: this.height()
			});

		(dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe());

		this.instances.push($el);
		return $el;
	},

	destroy: function($el) {
		this.instances.splice($.inArray(this.instances, $el), 1);

		if (this.instances.length === 0) {
			$([document, window]).unbind('.dialog-overlay');
		}

		$el.remove();
		
		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
		var maxZ = 0;
		$.each(this.instances, function() {
			maxZ = Math.max(maxZ, this.css('z-index'));
		});
		this.maxZ = maxZ;
	},

	height: function() {
		// handle IE 6
		if ($.browser.msie && $.browser.version < 7) {
			var scrollHeight = Math.max(
				document.documentElement.scrollHeight,
				document.body.scrollHeight
			);
			var offsetHeight = Math.max(
				document.documentElement.offsetHeight,
				document.body.offsetHeight
			);

			if (scrollHeight < offsetHeight) {
				return $(window).height() + 'px';
			} else {
				return scrollHeight + 'px';
			}
		// handle "good" browsers
		} else {
			return $(document).height() + 'px';
		}
	},

	width: function() {
		// handle IE 6
		if ($.browser.msie && $.browser.version < 7) {
			var scrollWidth = Math.max(
				document.documentElement.scrollWidth,
				document.body.scrollWidth
			);
			var offsetWidth = Math.max(
				document.documentElement.offsetWidth,
				document.body.offsetWidth
			);

			if (scrollWidth < offsetWidth) {
				return $(window).width() + 'px';
			} else {
				return scrollWidth + 'px';
			}
		// handle "good" browsers
		} else {
			return $(document).width() + 'px';
		}
	},

	resize: function() {
		/* If the dialog is draggable and the user drags it past the
		 * right edge of the window, the document becomes wider so we
		 * need to stretch the overlay. If the user then drags the
		 * dialog back to the left, the document will become narrower,
		 * so we need to shrink the overlay to the appropriate size.
		 * This is handled by shrinking the overlay before setting it
		 * to the full document size.
		 */
		var $overlays = $([]);
		$.each($.ui.dialog.overlay.instances, function() {
			$overlays = $overlays.add(this);
		});

		$overlays.css({
			width: 0,
			height: 0
		}).css({
			width: $.ui.dialog.overlay.width(),
			height: $.ui.dialog.overlay.height()
		});
	}
});

$.extend($.ui.dialog.overlay.prototype, {
	destroy: function() {
		$.ui.dialog.overlay.destroy(this.$el);
	}
});

})(jQuery);
/*
 * jQuery UI Slider 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Slider
 *
 * Depends:
 *	ui.core.js
 */

(function($) {

$.widget("ui.slider", $.extend({}, $.ui.mouse, {

	_init: function() {

		var self = this, o = this.options;
		this._keySliding = false;
		this._handleIndex = null;
		this._detectOrientation();
		this._mouseInit();

		this.element
			.addClass("ui-slider"
				+ " ui-slider-" + this.orientation
				+ " ui-widget"
				+ " ui-widget-content"
				+ " ui-corner-all");

		this.range = $([]);

		if (o.range) {

			if (o.range === true) {
				this.range = $('<div></div>');
				if (!o.values) o.values = [this._valueMin(), this._valueMin()];
				if (o.values.length && o.values.length != 2) {
					o.values = [o.values[0], o.values[0]];
				}
			} else {
				this.range = $('<div></div>');
			}

			this.range
				.appendTo(this.element)
				.addClass("ui-slider-range");

			if (o.range == "min" || o.range == "max") {
				this.range.addClass("ui-slider-range-" + o.range);
			}

			// note: this isn't the most fittingly semantic framework class for this element,
			// but worked best visually with a variety of themes
			this.range.addClass("ui-widget-header");

		}

		if ($(".ui-slider-handle", this.element).length == 0)
			$('<a href="#"></a>')
				.appendTo(this.element)
				.addClass("ui-slider-handle");

		if (o.values && o.values.length) {
			while ($(".ui-slider-handle", this.element).length < o.values.length)
				$('<a href="#"></a>')
					.appendTo(this.element)
					.addClass("ui-slider-handle");
		}

		this.handles = $(".ui-slider-handle", this.element)
			.addClass("ui-state-default"
				+ " ui-corner-all");

		this.handle = this.handles.eq(0);

		this.handles.add(this.range).filter("a")
			.click(function(event) {
				event.preventDefault();
			})
			.hover(function() {
				if (!o.disabled) {
					$(this).addClass('ui-state-hover');
				}
			}, function() {
				$(this).removeClass('ui-state-hover');
			})
			.focus(function() {
				if (!o.disabled) {
					$(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus');
				} else {
					$(this).blur();
				}
			})
			.blur(function() {
				$(this).removeClass('ui-state-focus');
			});

		this.handles.each(function(i) {
			$(this).data("index.ui-slider-handle", i);
		});

		this.handles.keydown(function(event) {

			var ret = true;

			var index = $(this).data("index.ui-slider-handle");

			if (self.options.disabled)
				return;

			switch (event.keyCode) {
				case $.ui.keyCode.HOME:
				case $.ui.keyCode.END:
				case $.ui.keyCode.UP:
				case $.ui.keyCode.RIGHT:
				case $.ui.keyCode.DOWN:
				case $.ui.keyCode.LEFT:
					ret = false;
					if (!self._keySliding) {
						self._keySliding = true;
						$(this).addClass("ui-state-active");
						self._start(event, index);
					}
					break;
			}

			var curVal, newVal, step = self._step();
			if (self.options.values && self.options.values.length) {
				curVal = newVal = self.values(index);
			} else {
				curVal = newVal = self.value();
			}

			switch (event.keyCode) {
				case $.ui.keyCode.HOME:
					newVal = self._valueMin();
					break;
				case $.ui.keyCode.END:
					newVal = self._valueMax();
					break;
				case $.ui.keyCode.UP:
				case $.ui.keyCode.RIGHT:
					if(curVal == self._valueMax()) return;
					newVal = curVal + step;
					break;
				case $.ui.keyCode.DOWN:
				case $.ui.keyCode.LEFT:
					if(curVal == self._valueMin()) return;
					newVal = curVal - step;
					break;
			}

			self._slide(event, index, newVal);

			return ret;

		}).keyup(function(event) {

			var index = $(this).data("index.ui-slider-handle");

			if (self._keySliding) {
				self._stop(event, index);
				self._change(event, index);
				self._keySliding = false;
				$(this).removeClass("ui-state-active");
			}

		});

		this._refreshValue();

	},

	destroy: function() {

		this.handles.remove();
		this.range.remove();

		this.element
			.removeClass("ui-slider"
				+ " ui-slider-horizontal"
				+ " ui-slider-vertical"
				+ " ui-slider-disabled"
				+ " ui-widget"
				+ " ui-widget-content"
				+ " ui-corner-all")
			.removeData("slider")
			.unbind(".slider");

		this._mouseDestroy();

	},

	_mouseCapture: function(event) {

		var o = this.options;

		if (o.disabled)
			return false;

		this.elementSize = {
			width: this.element.outerWidth(),
			height: this.element.outerHeight()
		};
		this.elementOffset = this.element.offset();

		var position = { x: event.pageX, y: event.pageY };
		var normValue = this._normValueFromMouse(position);

		var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
		var self = this, index;
		this.handles.each(function(i) {
			var thisDistance = Math.abs(normValue - self.values(i));
			if (distance > thisDistance) {
				distance = thisDistance;
				closestHandle = $(this);
				index = i;
			}
		});

		// workaround for bug #3736 (if both handles of a range are at 0,
		// the first is always used as the one with least distance,
		// and moving it is obviously prevented by preventing negative ranges)
		if(o.range == true && this.values(1) == o.min) {
			closestHandle = $(this.handles[++index]);
		}

		this._start(event, index);

		self._handleIndex = index;

		closestHandle
			.addClass("ui-state-active")
			.focus();
		
		var offset = closestHandle.offset();
		var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
			left: event.pageX - offset.left - (closestHandle.width() / 2),
			top: event.pageY - offset.top
				- (closestHandle.height() / 2)
				- (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
				- (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
				+ (parseInt(closestHandle.css('marginTop'),10) || 0)
		};

		normValue = this._normValueFromMouse(position);
		this._slide(event, index, normValue);
		return true;

	},

	_mouseStart: function(event) {
		return true;
	},

	_mouseDrag: function(event) {

		var position = { x: event.pageX, y: event.pageY };
		var normValue = this._normValueFromMouse(position);
		
		this._slide(event, this._handleIndex, normValue);

		return false;

	},

	_mouseStop: function(event) {

		this.handles.removeClass("ui-state-active");
		this._stop(event, this._handleIndex);
		this._change(event, this._handleIndex);
		this._handleIndex = null;
		this._clickOffset = null;

		return false;

	},
	
	_detectOrientation: function() {
		this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
	},

	_normValueFromMouse: function(position) {

		var pixelTotal, pixelMouse;
		if ('horizontal' == this.orientation) {
			pixelTotal = this.elementSize.width;
			pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
		} else {
			pixelTotal = this.elementSize.height;
			pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
		}

		var percentMouse = (pixelMouse / pixelTotal);
		if (percentMouse > 1) percentMouse = 1;
		if (percentMouse < 0) percentMouse = 0;
		if ('vertical' == this.orientation)
			percentMouse = 1 - percentMouse;

		var valueTotal = this._valueMax() - this._valueMin(),
			valueMouse = percentMouse * valueTotal,
			valueMouseModStep = valueMouse % this.options.step,
			normValue = this._valueMin() + valueMouse - valueMouseModStep;

		if (valueMouseModStep > (this.options.step / 2))
			normValue += this.options.step;

		// Since JavaScript has problems with large floats, round
		// the final value to 5 digits after the decimal point (see #4124)
		return parseFloat(normValue.toFixed(5));

	},

	_start: function(event, index) {
		var uiHash = {
			handle: this.handles[index],
			value: this.value()
		};
		if (this.options.values && this.options.values.length) {
			uiHash.value = this.values(index);
			uiHash.values = this.values();
		}
		this._trigger("start", event, uiHash);
	},

	_slide: function(event, index, newVal) {

		var handle = this.handles[index];

		if (this.options.values && this.options.values.length) {

			var otherVal = this.values(index ? 0 : 1);

			if ((this.options.values.length == 2 && this.options.range === true) && 
				((index == 0 && newVal > otherVal) || (index == 1 && newVal < otherVal))){
 				newVal = otherVal;
			}

			if (newVal != this.values(index)) {
				var newValues = this.values();
				newValues[index] = newVal;
				// A slide can be canceled by returning false from the slide callback
				var allowed = this._trigger("slide", event, {
					handle: this.handles[index],
					value: newVal,
					values: newValues
				});
				var otherVal = this.values(index ? 0 : 1);
				if (allowed !== false) {
					this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
				}
			}

		} else {

			if (newVal != this.value()) {
				// A slide can be canceled by returning false from the slide callback
				var allowed = this._trigger("slide", event, {
					handle: this.handles[index],
					value: newVal
				});
				if (allowed !== false) {
					this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
				}
					
			}

		}

	},

	_stop: function(event, index) {
		var uiHash = {
			handle: this.handles[index],
			value: this.value()
		};
		if (this.options.values && this.options.values.length) {
			uiHash.value = this.values(index);
			uiHash.values = this.values();
		}
		this._trigger("stop", event, uiHash);
	},

	_change: function(event, index) {
		var uiHash = {
			handle: this.handles[index],
			value: this.value()
		};
		if (this.options.values && this.options.values.length) {
			uiHash.value = this.values(index);
			uiHash.values = this.values();
		}
		this._trigger("change", event, uiHash);
	},

	value: function(newValue) {

		if (arguments.length) {
			this._setData("value", newValue);
			this._change(null, 0);
		}

		return this._value();

	},

	values: function(index, newValue, animated, noPropagation) {

		if (arguments.length > 1) {
			this.options.values[index] = newValue;
			this._refreshValue(animated);
			if(!noPropagation) this._change(null, index);
		}

		if (arguments.length) {
			if (this.options.values && this.options.values.length) {
				return this._values(index);
			} else {
				return this.value();
			}
		} else {
			return this._values();
		}

	},

	_setData: function(key, value, animated) {

		$.widget.prototype._setData.apply(this, arguments);

		switch (key) {
			case 'disabled':
				if (value) {
					this.handles.filter(".ui-state-focus").blur();
					this.handles.removeClass("ui-state-hover");
					this.handles.attr("disabled", "disabled");
				} else {
					this.handles.removeAttr("disabled");
				}
			case 'orientation':

				this._detectOrientation();
				
				this.element
					.removeClass("ui-slider-horizontal ui-slider-vertical")
					.addClass("ui-slider-" + this.orientation);
				this._refreshValue(animated);
				break;
			case 'value':
				this._refreshValue(animated);
				break;
		}

	},

	_step: function() {
		var step = this.options.step;
		return step;
	},

	_value: function() {

		var val = this.options.value;
		if (val < this._valueMin()) val = this._valueMin();
		if (val > this._valueMax()) val = this._valueMax();

		return val;

	},

	_values: function(index) {

		if (arguments.length) {
			var val = this.options.values[index];
			if (val < this._valueMin()) val = this._valueMin();
			if (val > this._valueMax()) val = this._valueMax();

			return val;
		} else {
			return this.options.values;
		}

	},

	_valueMin: function() {
		var valueMin = this.options.min;
		return valueMin;
	},

	_valueMax: function() {
		var valueMax = this.options.max;
		return valueMax;
	},

	_refreshValue: function(animate) {

		var oRange = this.options.range, o = this.options, self = this;

		if (this.options.values && this.options.values.length) {
			var vp0, vp1;
			this.handles.each(function(i, j) {
				var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
				var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
				$(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
				if (self.options.range === true) {
					if (self.orientation == 'horizontal') {
						(i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
						(i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
					} else {
						(i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
						(i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
					}
				}
				lastValPercent = valPercent;
			});
		} else {
			var value = this.value(),
				valueMin = this._valueMin(),
				valueMax = this._valueMax(),
				valPercent = valueMax != valueMin
					? (value - valueMin) / (valueMax - valueMin) * 100
					: 0;
			var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
			this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);

			(oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
			(oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
			(oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
			(oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
		}

	}
	
}));

$.extend($.ui.slider, {
	getter: "value values",
	version: "1.7.2",
	eventPrefix: "slide",
	defaults: {
		animate: false,
		delay: 0,
		distance: 0,
		max: 100,
		min: 0,
		orientation: 'horizontal',
		range: false,
		step: 1,
		value: 0,
		values: null
	}
});

})(jQuery);
/*
 * jQuery UI Tabs 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Tabs
 *
 * Depends:
 *	ui.core.js
 */
(function($) {

$.widget("ui.tabs", {

	_init: function() {
		if (this.options.deselectable !== undefined) {
			this.options.collapsible = this.options.deselectable;
		}
		this._tabify(true);
	},

	_setData: function(key, value) {
		if (key == 'selected') {
			if (this.options.collapsible && value == this.options.selected) {
				return;
			}
			this.select(value);
		}
		else {
			this.options[key] = value;
			if (key == 'deselectable') {
				this.options.collapsible = value;
			}
			this._tabify();
		}
	},

	_tabId: function(a) {
		return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
			this.options.idPrefix + $.data(a);
	},

	_sanitizeSelector: function(hash) {
		return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
	},

	_cookie: function() {
		var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
		return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
	},

	_ui: function(tab, panel) {
		return {
			tab: tab,
			panel: panel,
			index: this.anchors.index(tab)
		};
	},

	_cleanup: function() {
		// restore all former loading tabs labels
		this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
				.find('span:data(label.tabs)')
				.each(function() {
					var el = $(this);
					el.html(el.data('label.tabs')).removeData('label.tabs');
				});
	},

	_tabify: function(init) {

		this.list = this.element.children('ul:first');
		this.lis = $('li:has(a[href])', this.list);
		this.anchors = this.lis.map(function() { return $('a', this)[0]; });
		this.panels = $([]);

		var self = this, o = this.options;

		var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
		this.anchors.each(function(i, a) {
			var href = $(a).attr('href');

			// For dynamically created HTML that contains a hash as href IE < 8 expands
			// such href to the full page url with hash and then misinterprets tab as ajax.
			// Same consideration applies for an added tab with a fragment identifier
			// since a[href=#fragment-identifier] does unexpectedly not match.
			// Thus normalize href attribute...
			var hrefBase = href.split('#')[0], baseEl;
			if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
					(baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
				href = a.hash;
				a.href = href;
			}

			// inline tab
			if (fragmentId.test(href)) {
				self.panels = self.panels.add(self._sanitizeSelector(href));
			}

			// remote tab
			else if (href != '#') { // prevent loading the page itself if href is just "#"
				$.data(a, 'href.tabs', href); // required for restore on destroy

				// TODO until #3808 is fixed strip fragment identifier from url
				// (IE fails to load from such url)
				$.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data

				var id = self._tabId(a);
				a.href = '#' + id;
				var $panel = $('#' + id);
				if (!$panel.length) {
					$panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
						.insertAfter(self.panels[i - 1] || self.list);
					$panel.data('destroy.tabs', true);
				}
				self.panels = self.panels.add($panel);
			}

			// invalid tab href
			else {
				o.disabled.push(i);
			}
		});

		// initialization from scratch
		if (init) {

			// attach necessary classes for styling
			this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
			this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
			this.lis.addClass('ui-state-default ui-corner-top');
			this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');

			// Selected tab
			// use "selected" option or try to retrieve:
			// 1. from fragment identifier in url
			// 2. from cookie
			// 3. from selected class attribute on <li>
			if (o.selected === undefined) {
				if (location.hash) {
					this.anchors.each(function(i, a) {
						if (a.hash == location.hash) {
							o.selected = i;
							return false; // break
						}
					});
				}
				if (typeof o.selected != 'number' && o.cookie) {
					o.selected = parseInt(self._cookie(), 10);
				}
				if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
					o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
				}
				o.selected = o.selected || 0;
			}
			else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
				o.selected = -1;
			}

			// sanity check - default to first tab...
			o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;

			// Take disabling tabs via class attribute from HTML
			// into account and update option properly.
			// A selected tab cannot become disabled.
			o.disabled = $.unique(o.disabled.concat(
				$.map(this.lis.filter('.ui-state-disabled'),
					function(n, i) { return self.lis.index(n); } )
			)).sort();

			if ($.inArray(o.selected, o.disabled) != -1) {
				o.disabled.splice($.inArray(o.selected, o.disabled), 1);
			}

			// highlight selected tab
			this.panels.addClass('ui-tabs-hide');
			this.lis.removeClass('ui-tabs-selected ui-state-active');
			if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
				this.panels.eq(o.selected).removeClass('ui-tabs-hide');
				this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');

				// seems to be expected behavior that the show callback is fired
				self.element.queue("tabs", function() {
					self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
				});
				
				this.load(o.selected);
			}

			// clean up to avoid memory leaks in certain versions of IE 6
			$(window).bind('unload', function() {
				self.lis.add(self.anchors).unbind('.tabs');
				self.lis = self.anchors = self.panels = null;
			});

		}
		// update selected after add/remove
		else {
			o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
		}

		// update collapsible
		this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');

		// set or update cookie after init and add/remove respectively
		if (o.cookie) {
			this._cookie(o.selected, o.cookie);
		}

		// disable tabs
		for (var i = 0, li; (li = this.lis[i]); i++) {
			$(li)[$.inArray(i, o.disabled) != -1 &&
				!$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
		}

		// reset cache if switching from cached to not cached
		if (o.cache === false) {
			this.anchors.removeData('cache.tabs');
		}

		// remove all handlers before, tabify may run on existing tabs after add or option change
		this.lis.add(this.anchors).unbind('.tabs');

		if (o.event != 'mouseover') {
			var addState = function(state, el) {
				if (el.is(':not(.ui-state-disabled)')) {
					el.addClass('ui-state-' + state);
				}
			};
			var removeState = function(state, el) {
				el.removeClass('ui-state-' + state);
			};
			this.lis.bind('mouseover.tabs', function() {
				addState('hover', $(this));
			});
			this.lis.bind('mouseout.tabs', function() {
				removeState('hover', $(this));
			});
			this.anchors.bind('focus.tabs', function() {
				addState('focus', $(this).closest('li'));
			});
			this.anchors.bind('blur.tabs', function() {
				removeState('focus', $(this).closest('li'));
			});
		}

		// set up animations
		var hideFx, showFx;
		if (o.fx) {
			if ($.isArray(o.fx)) {
				hideFx = o.fx[0];
				showFx = o.fx[1];
			}
			else {
				hideFx = showFx = o.fx;
			}
		}

		// Reset certain styles left over from animation
		// and prevent IE's ClearType bug...
		function resetStyle($el, fx) {
			$el.css({ display: '' });
			if ($.browser.msie && fx.opacity) {
				$el[0].style.removeAttribute('filter');
			}
		}

		// Show a tab...
		var showTab = showFx ?
			function(clicked, $show) {
				$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
				$show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
					.animate(showFx, showFx.duration || 'normal', function() {
						resetStyle($show, showFx);
						self._trigger('show', null, self._ui(clicked, $show[0]));
					});
			} :
			function(clicked, $show) {
				$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
				$show.removeClass('ui-tabs-hide');
				self._trigger('show', null, self._ui(clicked, $show[0]));
			};

		// Hide a tab, $show is optional...
		var hideTab = hideFx ?
			function(clicked, $hide) {
				$hide.animate(hideFx, hideFx.duration || 'normal', function() {
					self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
					$hide.addClass('ui-tabs-hide');
					resetStyle($hide, hideFx);
					self.element.dequeue("tabs");
				});
			} :
			function(clicked, $hide, $show) {
				self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
				$hide.addClass('ui-tabs-hide');
				self.element.dequeue("tabs");
			};

		// attach tab event handler, unbind to avoid duplicates from former tabifying...
		this.anchors.bind(o.event + '.tabs', function() {
			var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
					$show = $(self._sanitizeSelector(this.hash));

			// If tab is already selected and not collapsible or tab disabled or
			// or is already loading or click callback returns false stop here.
			// Check if click handler returns false last so that it is not executed
			// for a disabled or loading tab!
			if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
				$li.hasClass('ui-state-disabled') ||
				$li.hasClass('ui-state-processing') ||
				self._trigger('select', null, self._ui(this, $show[0])) === false) {
				this.blur();
				return false;
			}

			o.selected = self.anchors.index(this);

			self.abort();

			// if tab may be closed
			if (o.collapsible) {
				if ($li.hasClass('ui-tabs-selected')) {
					o.selected = -1;

					if (o.cookie) {
						self._cookie(o.selected, o.cookie);
					}

					self.element.queue("tabs", function() {
						hideTab(el, $hide);
					}).dequeue("tabs");
					
					this.blur();
					return false;
				}
				else if (!$hide.length) {
					if (o.cookie) {
						self._cookie(o.selected, o.cookie);
					}
					
					self.element.queue("tabs", function() {
						showTab(el, $show);
					});

					self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
					
					this.blur();
					return false;
				}
			}

			if (o.cookie) {
				self._cookie(o.selected, o.cookie);
			}

			// show new tab
			if ($show.length) {
				if ($hide.length) {
					self.element.queue("tabs", function() {
						hideTab(el, $hide);
					});
				}
				self.element.queue("tabs", function() {
					showTab(el, $show);
				});
				
				self.load(self.anchors.index(this));
			}
			else {
				throw 'jQuery UI Tabs: Mismatching fragment identifier.';
			}

			// Prevent IE from keeping other link focussed when using the back button
			// and remove dotted border from clicked link. This is controlled via CSS
			// in modern browsers; blur() removes focus from address bar in Firefox
			// which can become a usability and annoying problem with tabs('rotate').
			if ($.browser.msie) {
				this.blur();
			}

		});

		// disable click in any case
		this.anchors.bind('click.tabs', function(){return false;});

	},

	destroy: function() {
		var o = this.options;

		this.abort();
		
		this.element.unbind('.tabs')
			.removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
			.removeData('tabs');

		this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');

		this.anchors.each(function() {
			var href = $.data(this, 'href.tabs');
			if (href) {
				this.href = href;
			}
			var $this = $(this).unbind('.tabs');
			$.each(['href', 'load', 'cache'], function(i, prefix) {
				$this.removeData(prefix + '.tabs');
			});
		});

		this.lis.unbind('.tabs').add(this.panels).each(function() {
			if ($.data(this, 'destroy.tabs')) {
				$(this).remove();
			}
			else {
				$(this).removeClass([
					'ui-state-default',
					'ui-corner-top',
					'ui-tabs-selected',
					'ui-state-active',
					'ui-state-hover',
					'ui-state-focus',
					'ui-state-disabled',
					'ui-tabs-panel',
					'ui-widget-content',
					'ui-corner-bottom',
					'ui-tabs-hide'
				].join(' '));
			}
		});

		if (o.cookie) {
			this._cookie(null, o.cookie);
		}
	},

	add: function(url, label, index) {
		if (index === undefined) {
			index = this.anchors.length; // append by default
		}

		var self = this, o = this.options,
			$li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
			id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);

		$li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);

		// try to find an existing element before creating a new one
		var $panel = $('#' + id);
		if (!$panel.length) {
			$panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
		}
		$panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');

		if (index >= this.lis.length) {
			$li.appendTo(this.list);
			$panel.appendTo(this.list[0].parentNode);
		}
		else {
			$li.insertBefore(this.lis[index]);
			$panel.insertBefore(this.panels[index]);
		}

		o.disabled = $.map(o.disabled,
			function(n, i) { return n >= index ? ++n : n; });

		this._tabify();

		if (this.anchors.length == 1) { // after tabify
			$li.addClass('ui-tabs-selected ui-state-active');
			$panel.removeClass('ui-tabs-hide');
			this.element.queue("tabs", function() {
				self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
			});
				
			this.load(0);
		}

		// callback
		this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
	},

	remove: function(index) {
		var o = this.options, $li = this.lis.eq(index).remove(),
			$panel = this.panels.eq(index).remove();

		// If selected tab was removed focus tab to the right or
		// in case the last tab was removed the tab to the left.
		if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
			this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
		}

		o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
			function(n, i) { return n >= index ? --n : n; });

		this._tabify();

		// callback
		this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
	},

	enable: function(index) {
		var o = this.options;
		if ($.inArray(index, o.disabled) == -1) {
			return;
		}

		this.lis.eq(index).removeClass('ui-state-disabled');
		o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });

		// callback
		this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
	},

	disable: function(index) {
		var self = this, o = this.options;
		if (index != o.selected) { // cannot disable already selected tab
			this.lis.eq(index).addClass('ui-state-disabled');

			o.disabled.push(index);
			o.disabled.sort();

			// callback
			this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
		}
	},

	select: function(index) {
		if (typeof index == 'string') {
			index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
		}
		else if (index === null) { // usage of null is deprecated, TODO remove in next release
			index = -1;
		}
		if (index == -1 && this.options.collapsible) {
			index = this.options.selected;
		}

		this.anchors.eq(index).trigger(this.options.event + '.tabs');
	},

	load: function(index) {
		var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');

		this.abort();

		// not remote or from cache
		if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
			this.element.dequeue("tabs");
			return;
		}

		// load remote from here on
		this.lis.eq(index).addClass('ui-state-processing');

		if (o.spinner) {
			var span = $('span', a);
			span.data('label.tabs', span.html()).html(o.spinner);
		}

		this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
			url: url,
			success: function(r, s) {
				$(self._sanitizeSelector(a.hash)).html(r);

				// take care of tab labels
				self._cleanup();

				if (o.cache) {
					$.data(a, 'cache.tabs', true); // if loaded once do not load them again
				}

				// callbacks
				self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
				try {
					o.ajaxOptions.success(r, s);
				}
				catch (e) {}

				// last, so that load event is fired before show...
				self.element.dequeue("tabs");
			}
		}));
	},

	abort: function() {
		// stop possibly running animations
		this.element.queue([]);
		this.panels.stop(false, true);

		// terminate pending requests from other tabs
		if (this.xhr) {
			this.xhr.abort();
			delete this.xhr;
		}

		// take care of tab labels
		this._cleanup();

	},

	url: function(index, url) {
		this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
	},

	length: function() {
		return this.anchors.length;
	}

});

$.extend($.ui.tabs, {
	version: '1.7.2',
	getter: 'length',
	defaults: {
		ajaxOptions: null,
		cache: false,
		cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
		collapsible: false,
		disabled: [],
		event: 'click',
		fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
		idPrefix: 'ui-tabs-',
		panelTemplate: '<div></div>',
		spinner: '<em>Loading&#8230;</em>',
		tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
	}
});

/*
 * Tabs Extensions
 */

/*
 * Rotate
 */
$.extend($.ui.tabs.prototype, {
	rotation: null,
	rotate: function(ms, continuing) {

		var self = this, o = this.options;
		
		var rotate = self._rotate || (self._rotate = function(e) {
			clearTimeout(self.rotation);
			self.rotation = setTimeout(function() {
				var t = o.selected;
				self.select( ++t < self.anchors.length ? t : 0 );
			}, ms);
			
			if (e) {
				e.stopPropagation();
			}
		});
		
		var stop = self._unrotate || (self._unrotate = !continuing ?
			function(e) {
				if (e.clientX) { // in case of a true click
					self.rotate(null);
				}
			} :
			function(e) {
				t = o.selected;
				rotate();
			});

		// start rotation
		if (ms) {
			this.element.bind('tabsshow', rotate);
			this.anchors.bind(o.event + '.tabs', stop);
			rotate();
		}
		// stop rotation
		else {
			clearTimeout(self.rotation);
			this.element.unbind('tabsshow', rotate);
			this.anchors.unbind(o.event + '.tabs', stop);
			delete this._rotate;
			delete this._unrotate;
		}
	}
});

})(jQuery);
/*
 * jQuery UI Datepicker 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Datepicker
 *
 * Depends:
 *	ui.core.js
 */

(function($) { // hide the namespace

$.extend($.ui, { datepicker: { version: "1.7.2" } });

var PROP_NAME = 'datepicker';

/* Date picker manager.
   Use the singleton instance of this class, $.datepicker, to interact with the date picker.
   Settings for (groups of) date pickers are maintained in an instance object,
   allowing multiple different settings on the same page. */

function Datepicker() {
	this.debug = false; // Change this to true to start debugging
	this._curInst = null; // The current instance in use
	this._keyEvent = false; // If the last event was a key event
	this._disabledInputs = []; // List of date picker inputs that have been disabled
	this._datepickerShowing = false; // True if the popup picker is showing , false if not
	this._inDialog = false; // True if showing within a "dialog", false if not
	this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
	this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
	this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
	this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
	this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
	this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
	this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
	this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
	this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
	this.regional = []; // Available regional settings, indexed by language code
	this.regional[''] = { // Default regional settings
		closeText: 'Done', // Display text for close link
		prevText: 'Prev', // Display text for previous month link
		nextText: 'Next', // Display text for next month link
		currentText: 'Today', // Display text for current month link
		monthNames: ['January','February','March','April','May','June',
			'July','August','September','October','November','December'], // Names of months for drop-down and formatting
		monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
		dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
		dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
		dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
		dateFormat: 'mm/dd/yy', // See format options on parseDate
		firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
		isRTL: false // True if right-to-left language, false if left-to-right
	};
	this._defaults = { // Global defaults for all the date picker instances
		showOn: 'focus', // 'focus' for popup on focus,
			// 'button' for trigger button, or 'both' for either
		showAnim: 'show', // Name of jQuery animation for popup
		showOptions: {}, // Options for enhanced animations
		defaultDate: null, // Used when field is blank: actual date,
			// +/-number for offset from today, null for today
		appendText: '', // Display text following the input box, e.g. showing the format
		buttonText: '...', // Text for trigger button
		buttonImage: '', // URL for trigger button image
		buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
		hideIfNoPrevNext: false, // True to hide next/previous month links
			// if not applicable, false to just disable them
		navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
		gotoCurrent: false, // True if today link goes back to current selection instead
		changeMonth: false, // True if month can be selected directly, false if only prev/next
		changeYear: false, // True if year can be selected directly, false if only prev/next
		showMonthAfterYear: false, // True if the year select precedes month, false for month then year
		yearRange: '-10:+10', // Range of years to display in drop-down,
			// either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
		showOtherMonths: false, // True to show dates in other months, false to leave blank
		calculateWeek: this.iso8601Week, // How to calculate the week of the year,
			// takes a Date and returns the number of the week for it
		shortYearCutoff: '+10', // Short year values < this are in the current century,
			// > this are in the previous century,
			// string value starting with '+' for current year + value
		minDate: null, // The earliest selectable date, or null for no limit
		maxDate: null, // The latest selectable date, or null for no limit
		duration: 'normal', // Duration of display/closure
		beforeShowDay: null, // Function that takes a date and returns an array with
			// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
			// [2] = cell title (optional), e.g. $.datepicker.noWeekends
		beforeShow: null, // Function that takes an input field and
			// returns a set of custom settings for the date picker
		onSelect: null, // Define a callback function when a date is selected
		onChangeMonthYear: null, // Define a callback function when the month or year is changed
		onClose: null, // Define a callback function when the datepicker is closed
		numberOfMonths: 1, // Number of months to show at a time
		showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
		stepMonths: 1, // Number of months to step back/forward
		stepBigMonths: 12, // Number of months to step back/forward for the big links
		altField: '', // Selector for an alternate field to store selected dates into
		altFormat: '', // The date format to use for the alternate field
		constrainInput: true, // The input is constrained by the current date format
		showButtonPanel: false // True to show button panel, false to not show it
	};
	$.extend(this._defaults, this.regional['']);
	this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
}

$.extend(Datepicker.prototype, {
	/* Class name added to elements to indicate already configured with a date picker. */
	markerClassName: 'hasDatepicker',

	/* Debug logging (if enabled). */
	log: function () {
		if (this.debug)
			console.log.apply('', arguments);
	},

	/* Override the default settings for all instances of the date picker.
	   @param  settings  object - the new settings to use as defaults (anonymous object)
	   @return the manager object */
	setDefaults: function(settings) {
		extendRemove(this._defaults, settings || {});
		return this;
	},

	/* Attach the date picker to a jQuery selection.
	   @param  target    element - the target input field or division or span
	   @param  settings  object - the new settings to use for this date picker instance (anonymous) */
	_attachDatepicker: function(target, settings) {
		// check for settings on the control itself - in namespace 'date:'
		var inlineSettings = null;
		for (var attrName in this._defaults) {
			var attrValue = target.getAttribute('date:' + attrName);
			if (attrValue) {
				inlineSettings = inlineSettings || {};
				try {
					inlineSettings[attrName] = eval(attrValue);
				} catch (err) {
					inlineSettings[attrName] = attrValue;
				}
			}
		}
		var nodeName = target.nodeName.toLowerCase();
		var inline = (nodeName == 'div' || nodeName == 'span');
		if (!target.id)
			target.id = 'dp' + (++this.uuid);
		var inst = this._newInst($(target), inline);
		inst.settings = $.extend({}, settings || {}, inlineSettings || {});
		if (nodeName == 'input') {
			this._connectDatepicker(target, inst);
		} else if (inline) {
			this._inlineDatepicker(target, inst);
		}
	},

	/* Create a new instance object. */
	_newInst: function(target, inline) {
		var id = target[0].id.replace(/([:\[\]\.])/g, '\\\\$1'); // escape jQuery meta chars
		return {id: id, input: target, // associated target
			selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
			drawMonth: 0, drawYear: 0, // month being drawn
			inline: inline, // is datepicker inline or not
			dpDiv: (!inline ? this.dpDiv : // presentation div
			$('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
	},

	/* Attach the date picker to an input field. */
	_connectDatepicker: function(target, inst) {
		var input = $(target);
		inst.append = $([]);
		inst.trigger = $([]);
		if (input.hasClass(this.markerClassName))
			return;
		var appendText = this._get(inst, 'appendText');
		var isRTL = this._get(inst, 'isRTL');
		if (appendText) {
			inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
			input[isRTL ? 'before' : 'after'](inst.append);
		}
		var showOn = this._get(inst, 'showOn');
		if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
			input.focus(this._showDatepicker);
		if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
			var buttonText = this._get(inst, 'buttonText');
			var buttonImage = this._get(inst, 'buttonImage');
			inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
				$('<img/>').addClass(this._triggerClass).
					attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
				$('<button type="button"></button>').addClass(this._triggerClass).
					html(buttonImage == '' ? buttonText : $('<img/>').attr(
					{ src:buttonImage, alt:buttonText, title:buttonText })));
			input[isRTL ? 'before' : 'after'](inst.trigger);
			inst.trigger.click(function() {
				if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
					$.datepicker._hideDatepicker();
				else
					$.datepicker._showDatepicker(target);
				return false;
			});
		}
		input.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).
			bind("setData.datepicker", function(event, key, value) {
				inst.settings[key] = value;
			}).bind("getData.datepicker", function(event, key) {
				return this._get(inst, key);
			});
		$.data(target, PROP_NAME, inst);
	},

	/* Attach an inline date picker to a div. */
	_inlineDatepicker: function(target, inst) {
		var divSpan = $(target);
		if (divSpan.hasClass(this.markerClassName))
			return;
		divSpan.addClass(this.markerClassName).append(inst.dpDiv).
			bind("setData.datepicker", function(event, key, value){
				inst.settings[key] = value;
			}).bind("getData.datepicker", function(event, key){
				return this._get(inst, key);
			});
		$.data(target, PROP_NAME, inst);
		this._setDate(inst, this._getDefaultDate(inst));
		this._updateDatepicker(inst);
		this._updateAlternate(inst);
	},

	/* Pop-up the date picker in a "dialog" box.
	   @param  input     element - ignored
	   @param  dateText  string - the initial date to display (in the current format)
	   @param  onSelect  function - the function(dateText) to call when a date is selected
	   @param  settings  object - update the dialog date picker instance's settings (anonymous object)
	   @param  pos       int[2] - coordinates for the dialog's position within the screen or
	                     event - with x/y coordinates or
	                     leave empty for default (screen centre)
	   @return the manager object */
	_dialogDatepicker: function(input, dateText, onSelect, settings, pos) {
		var inst = this._dialogInst; // internal instance
		if (!inst) {
			var id = 'dp' + (++this.uuid);
			this._dialogInput = $('<input type="text" id="' + id +
				'" size="1" style="position: absolute; top: -100px;"/>');
			this._dialogInput.keydown(this._doKeyDown);
			$('body').append(this._dialogInput);
			inst = this._dialogInst = this._newInst(this._dialogInput, false);
			inst.settings = {};
			$.data(this._dialogInput[0], PROP_NAME, inst);
		}
		extendRemove(inst.settings, settings || {});
		this._dialogInput.val(dateText);

		this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
		if (!this._pos) {
			var browserWidth = window.innerWidth || document.documentElement.clientWidth ||	document.body.clientWidth;
			var browserHeight = window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;
			var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
			var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
			this._pos = // should use actual width/height below
				[(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
		}

		// move input on screen for focus, but hidden behind dialog
		this._dialogInput.css('left', this._pos[0] + 'px').css('top', this._pos[1] + 'px');
		inst.settings.onSelect = onSelect;
		this._inDialog = true;
		this.dpDiv.addClass(this._dialogClass);
		this._showDatepicker(this._dialogInput[0]);
		if ($.blockUI)
			$.blockUI(this.dpDiv);
		$.data(this._dialogInput[0], PROP_NAME, inst);
		return this;
	},

	/* Detach a datepicker from its control.
	   @param  target    element - the target input field or division or span */
	_destroyDatepicker: function(target) {
		var $target = $(target);
		var inst = $.data(target, PROP_NAME);
		if (!$target.hasClass(this.markerClassName)) {
			return;
		}
		var nodeName = target.nodeName.toLowerCase();
		$.removeData(target, PROP_NAME);
		if (nodeName == 'input') {
			inst.append.remove();
			inst.trigger.remove();
			$target.removeClass(this.markerClassName).
				unbind('focus', this._showDatepicker).
				unbind('keydown', this._doKeyDown).
				unbind('keypress', this._doKeyPress);
		} else if (nodeName == 'div' || nodeName == 'span')
			$target.removeClass(this.markerClassName).empty();
	},

	/* Enable the date picker to a jQuery selection.
	   @param  target    element - the target input field or division or span */
	_enableDatepicker: function(target) {
		var $target = $(target);
		var inst = $.data(target, PROP_NAME);
		if (!$target.hasClass(this.markerClassName)) {
			return;
		}
		var nodeName = target.nodeName.toLowerCase();
		if (nodeName == 'input') {
			target.disabled = false;
			inst.trigger.filter('button').
				each(function() { this.disabled = false; }).end().
				filter('img').css({opacity: '1.0', cursor: ''});
		}
		else if (nodeName == 'div' || nodeName == 'span') {
			var inline = $target.children('.' + this._inlineClass);
			inline.children().removeClass('ui-state-disabled');
		}
		this._disabledInputs = $.map(this._disabledInputs,
			function(value) { return (value == target ? null : value); }); // delete entry
	},

	/* Disable the date picker to a jQuery selection.
	   @param  target    element - the target input field or division or span */
	_disableDatepicker: function(target) {
		var $target = $(target);
		var inst = $.data(target, PROP_NAME);
		if (!$target.hasClass(this.markerClassName)) {
			return;
		}
		var nodeName = target.nodeName.toLowerCase();
		if (nodeName == 'input') {
			target.disabled = true;
			inst.trigger.filter('button').
				each(function() { this.disabled = true; }).end().
				filter('img').css({opacity: '0.5', cursor: 'default'});
		}
		else if (nodeName == 'div' || nodeName == 'span') {
			var inline = $target.children('.' + this._inlineClass);
			inline.children().addClass('ui-state-disabled');
		}
		this._disabledInputs = $.map(this._disabledInputs,
			function(value) { return (value == target ? null : value); }); // delete entry
		this._disabledInputs[this._disabledInputs.length] = target;
	},

	/* Is the first field in a jQuery collection disabled as a datepicker?
	   @param  target    element - the target input field or division or span
	   @return boolean - true if disabled, false if enabled */
	_isDisabledDatepicker: function(target) {
		if (!target) {
			return false;
		}
		for (var i = 0; i < this._disabledInputs.length; i++) {
			if (this._disabledInputs[i] == target)
				return true;
		}
		return false;
	},

	/* Retrieve the instance data for the target control.
	   @param  target  element - the target input field or division or span
	   @return  object - the associated instance data
	   @throws  error if a jQuery problem getting data */
	_getInst: function(target) {
		try {
			return $.data(target, PROP_NAME);
		}
		catch (err) {
			throw 'Missing instance data for this datepicker';
		}
	},

	/* Update or retrieve the settings for a date picker attached to an input field or division.
	   @param  target  element - the target input field or division or span
	   @param  name    object - the new settings to update or
	                   string - the name of the setting to change or retrieve,
	                   when retrieving also 'all' for all instance settings or
	                   'defaults' for all global defaults
	   @param  value   any - the new value for the setting
	                   (omit if above is an object or to retrieve a value) */
	_optionDatepicker: function(target, name, value) {
		var inst = this._getInst(target);
		if (arguments.length == 2 && typeof name == 'string') {
			return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
				(inst ? (name == 'all' ? $.extend({}, inst.settings) :
				this._get(inst, name)) : null));
		}
		var settings = name || {};
		if (typeof name == 'string') {
			settings = {};
			settings[name] = value;
		}
		if (inst) {
			if (this._curInst == inst) {
				this._hideDatepicker(null);
			}
			var date = this._getDateDatepicker(target);
			extendRemove(inst.settings, settings);
			this._setDateDatepicker(target, date);
			this._updateDatepicker(inst);
		}
	},

	// change method deprecated
	_changeDatepicker: function(target, name, value) {
		this._optionDatepicker(target, name, value);
	},

	/* Redraw the date picker attached to an input field or division.
	   @param  target  element - the target input field or division or span */
	_refreshDatepicker: function(target) {
		var inst = this._getInst(target);
		if (inst) {
			this._updateDatepicker(inst);
		}
	},

	/* Set the dates for a jQuery selection.
	   @param  target   element - the target input field or division or span
	   @param  date     Date - the new date
	   @param  endDate  Date - the new end date for a range (optional) */
	_setDateDatepicker: function(target, date, endDate) {
		var inst = this._getInst(target);
		if (inst) {
			this._setDate(inst, date, endDate);
			this._updateDatepicker(inst);
			this._updateAlternate(inst);
		}
	},

	/* Get the date(s) for the first entry in a jQuery selection.
	   @param  target  element - the target input field or division or span
	   @return Date - the current date or
	           Date[2] - the current dates for a range */
	_getDateDatepicker: function(target) {
		var inst = this._getInst(target);
		if (inst && !inst.inline)
			this._setDateFromField(inst);
		return (inst ? this._getDate(inst) : null);
	},

	/* Handle keystrokes. */
	_doKeyDown: function(event) {
		var inst = $.datepicker._getInst(event.target);
		var handled = true;
		var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
		inst._keyEvent = true;
		if ($.datepicker._datepickerShowing)
			switch (event.keyCode) {
				case 9:  $.datepicker._hideDatepicker(null, '');
						break; // hide on tab out
				case 13: var sel = $('td.' + $.datepicker._dayOverClass +
							', td.' + $.datepicker._currentClass, inst.dpDiv);
						if (sel[0])
							$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
						else
							$.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
						return false; // don't submit the form
						break; // select the value on enter
				case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
						break; // hide on escape
				case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
							-$.datepicker._get(inst, 'stepBigMonths') :
							-$.datepicker._get(inst, 'stepMonths')), 'M');
						break; // previous month/year on page up/+ ctrl
				case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
							+$.datepicker._get(inst, 'stepBigMonths') :
							+$.datepicker._get(inst, 'stepMonths')), 'M');
						break; // next month/year on page down/+ ctrl
				case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
						handled = event.ctrlKey || event.metaKey;
						break; // clear on ctrl or command +end
				case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
						handled = event.ctrlKey || event.metaKey;
						break; // current on ctrl or command +home
				case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
						handled = event.ctrlKey || event.metaKey;
						// -1 day on ctrl or command +left
						if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
									-$.datepicker._get(inst, 'stepBigMonths') :
									-$.datepicker._get(inst, 'stepMonths')), 'M');
						// next month/year on alt +left on Mac
						break;
				case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
						handled = event.ctrlKey || event.metaKey;
						break; // -1 week on ctrl or command +up
				case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
						handled = event.ctrlKey || event.metaKey;
						// +1 day on ctrl or command +right
						if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
									+$.datepicker._get(inst, 'stepBigMonths') :
									+$.datepicker._get(inst, 'stepMonths')), 'M');
						// next month/year on alt +right
						break;
				case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
						handled = event.ctrlKey || event.metaKey;
						break; // +1 week on ctrl or command +down
				default: handled = false;
			}
		else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
			$.datepicker._showDatepicker(this);
		else {
			handled = false;
		}
		if (handled) {
			event.preventDefault();
			event.stopPropagation();
		}
	},

	/* Filter entered characters - based on date format. */
	_doKeyPress: function(event) {
		var inst = $.datepicker._getInst(event.target);
		if ($.datepicker._get(inst, 'constrainInput')) {
			var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
			var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
			return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
		}
	},

	/* Pop-up the date picker for a given input field.
	   @param  input  element - the input field attached to the date picker or
	                  event - if triggered by focus */
	_showDatepicker: function(input) {
		input = input.target || input;
		if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
			input = $('input', input.parentNode)[0];
		if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
			return;
		var inst = $.datepicker._getInst(input);
		var beforeShow = $.datepicker._get(inst, 'beforeShow');
		extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
		$.datepicker._hideDatepicker(null, '');
		$.datepicker._lastInput = input;
		$.datepicker._setDateFromField(inst);
		if ($.datepicker._inDialog) // hide cursor
			input.value = '';
		if (!$.datepicker._pos) { // position below input
			$.datepicker._pos = $.datepicker._findPos(input);
			$.datepicker._pos[1] += input.offsetHeight; // add the height
		}
		var isFixed = false;
		$(input).parents().each(function() {
			isFixed |= $(this).css('position') == 'fixed';
			return !isFixed;
		});
		if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
			$.datepicker._pos[0] -= document.documentElement.scrollLeft;
			$.datepicker._pos[1] -= document.documentElement.scrollTop;
		}
		var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
		$.datepicker._pos = null;
		inst.rangeStart = null;
		// determine sizing offscreen
		inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
		$.datepicker._updateDatepicker(inst);
		// fix width for dynamic number of date pickers
		// and adjust position before showing
		offset = $.datepicker._checkOffset(inst, offset, isFixed);
		inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
			'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
			left: offset.left + 'px', top: offset.top + 'px'});
		if (!inst.inline) {
			var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
			var duration = $.datepicker._get(inst, 'duration');
			var postProcess = function() {
				$.datepicker._datepickerShowing = true;
				if ($.browser.msie && parseInt($.browser.version,10) < 7) // fix IE < 7 select problems
					$('iframe.ui-datepicker-cover').css({width: inst.dpDiv.width() + 4,
						height: inst.dpDiv.height() + 4});
			};
			if ($.effects && $.effects[showAnim])
				inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
			else
				inst.dpDiv[showAnim](duration, postProcess);
			if (duration == '')
				postProcess();
			if (inst.input[0].type != 'hidden')
				inst.input[0].focus();
			$.datepicker._curInst = inst;
		}
	},

	/* Generate the date picker content. */
	_updateDatepicker: function(inst) {
		var dims = {width: inst.dpDiv.width() + 4,
			height: inst.dpDiv.height() + 4};
		var self = this;
		inst.dpDiv.empty().append(this._generateHTML(inst))
			.find('iframe.ui-datepicker-cover').
				css({width: dims.width, height: dims.height})
			.end()
			.find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
				.bind('mouseout', function(){
					$(this).removeClass('ui-state-hover');
					if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
					if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
				})
				.bind('mouseover', function(){
					if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
						$(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
						$(this).addClass('ui-state-hover');
						if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
						if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
					}
				})
			.end()
			.find('.' + this._dayOverClass + ' a')
				.trigger('mouseover')
			.end();
		var numMonths = this._getNumberOfMonths(inst);
		var cols = numMonths[1];
		var width = 17;
		if (cols > 1) {
			inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
		} else {
			inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
		}
		inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
			'Class']('ui-datepicker-multi');
		inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
			'Class']('ui-datepicker-rtl');
		if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
			$(inst.input[0]).focus();
	},

	/* Check positioning to remain on screen. */
	_checkOffset: function(inst, offset, isFixed) {
		var dpWidth = inst.dpDiv.outerWidth();
		var dpHeight = inst.dpDiv.outerHeight();
		var inputWidth = inst.input ? inst.input.outerWidth() : 0;
		var inputHeight = inst.input ? inst.input.outerHeight() : 0;
		var viewWidth = (window.innerWidth || document.documentElement.clientWidth || document.body.clientWidth) + $(document).scrollLeft();
		var viewHeight = (window.innerHeight || document.documentElement.clientHeight || document.body.clientHeight) + $(document).scrollTop();

		offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
		offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
		offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;

		// now check if datepicker is showing outside window viewport - move to a better place if so.
		offset.left -= (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? Math.abs(offset.left + dpWidth - viewWidth) : 0;
		offset.top -= (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? Math.abs(offset.top + dpHeight + inputHeight*2 - viewHeight) : 0;

		return offset;
	},

	/* Find an object's position on the screen. */
	_findPos: function(obj) {
        while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
            obj = obj.nextSibling;
        }
        var position = $(obj).offset();
	    return [position.left, position.top];
	},

	/* Hide the date picker from view.
	   @param  input  element - the input field attached to the date picker
	   @param  duration  string - the duration over which to close the date picker */
	_hideDatepicker: function(input, duration) {
		var inst = this._curInst;
		if (!inst || (input && inst != $.data(input, PROP_NAME)))
			return;
		if (inst.stayOpen)
			this._selectDate('#' + inst.id, this._formatDate(inst,
				inst.currentDay, inst.currentMonth, inst.currentYear));
		inst.stayOpen = false;
		if (this._datepickerShowing) {
			duration = (duration != null ? duration : this._get(inst, 'duration'));
			var showAnim = this._get(inst, 'showAnim');
			var postProcess = function() {
				$.datepicker._tidyDialog(inst);
			};
			if (duration != '' && $.effects && $.effects[showAnim])
				inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
					duration, postProcess);
			else
				inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
					(showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
			if (duration == '')
				this._tidyDialog(inst);
			var onClose = this._get(inst, 'onClose');
			if (onClose)
				onClose.apply((inst.input ? inst.input[0] : null),
					[(inst.input ? inst.input.val() : ''), inst]);  // trigger custom callback
			this._datepickerShowing = false;
			this._lastInput = null;
			if (this._inDialog) {
				this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
				if ($.blockUI) {
					$.unblockUI();
					$('body').append(this.dpDiv);
				}
			}
			this._inDialog = false;
		}
		this._curInst = null;
	},

	/* Tidy up after a dialog display. */
	_tidyDialog: function(inst) {
		inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
	},

	/* Close date picker if clicked elsewhere. */
	_checkExternalClick: function(event) {
		if (!$.datepicker._curInst)
			return;
		var $target = $(event.target);
		if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
				!$target.hasClass($.datepicker.markerClassName) &&
				!$target.hasClass($.datepicker._triggerClass) &&
				$.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
			$.datepicker._hideDatepicker(null, '');
	},

	/* Adjust one of the date sub-fields. */
	_adjustDate: function(id, offset, period) {
		var target = $(id);
		var inst = this._getInst(target[0]);
		if (this._isDisabledDatepicker(target[0])) {
			return;
		}
		this._adjustInstDate(inst, offset +
			(period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
			period);
		this._updateDatepicker(inst);
	},

	/* Action for current link. */
	_gotoToday: function(id) {
		var target = $(id);
		var inst = this._getInst(target[0]);
		if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
			inst.selectedDay = inst.currentDay;
			inst.drawMonth = inst.selectedMonth = inst.currentMonth;
			inst.drawYear = inst.selectedYear = inst.currentYear;
		}
		else {
		var date = new Date();
		inst.selectedDay = date.getDate();
		inst.drawMonth = inst.selectedMonth = date.getMonth();
		inst.drawYear = inst.selectedYear = date.getFullYear();
		}
		this._notifyChange(inst);
		this._adjustDate(target);
	},

	/* Action for selecting a new month/year. */
	_selectMonthYear: function(id, select, period) {
		var target = $(id);
		var inst = this._getInst(target[0]);
		inst._selectingMonthYear = false;
		inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
		inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
			parseInt(select.options[select.selectedIndex].value,10);
		this._notifyChange(inst);
		this._adjustDate(target);
	},

	/* Restore input focus after not changing month/year. */
	_clickMonthYear: function(id) {
		var target = $(id);
		var inst = this._getInst(target[0]);
		if (inst.input && inst._selectingMonthYear && !$.browser.msie)
			inst.input[0].focus();
		inst._selectingMonthYear = !inst._selectingMonthYear;
	},

	/* Action for selecting a day. */
	_selectDay: function(id, month, year, td) {
		var target = $(id);
		if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
			return;
		}
		var inst = this._getInst(target[0]);
		inst.selectedDay = inst.currentDay = $('a', td).html();
		inst.selectedMonth = inst.currentMonth = month;
		inst.selectedYear = inst.currentYear = year;
		if (inst.stayOpen) {
			inst.endDay = inst.endMonth = inst.endYear = null;
		}
		this._selectDate(id, this._formatDate(inst,
			inst.currentDay, inst.currentMonth, inst.currentYear));
		if (inst.stayOpen) {
			inst.rangeStart = this._daylightSavingAdjust(
				new Date(inst.currentYear, inst.currentMonth, inst.currentDay));
			this._updateDatepicker(inst);
		}
	},

	/* Erase the input field and hide the date picker. */
	_clearDate: function(id) {
		var target = $(id);
		var inst = this._getInst(target[0]);
		inst.stayOpen = false;
		inst.endDay = inst.endMonth = inst.endYear = inst.rangeStart = null;
		this._selectDate(target, '');
	},

	/* Update the input field with the selected date. */
	_selectDate: function(id, dateStr) {
		var target = $(id);
		var inst = this._getInst(target[0]);
		dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
		if (inst.input)
			inst.input.val(dateStr);
		this._updateAlternate(inst);
		var onSelect = this._get(inst, 'onSelect');
		if (onSelect)
			onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);  // trigger custom callback
		else if (inst.input)
			inst.input.trigger('change'); // fire the change event
		if (inst.inline)
			this._updateDatepicker(inst);
		else if (!inst.stayOpen) {
			this._hideDatepicker(null, this._get(inst, 'duration'));
			this._lastInput = inst.input[0];
			if (typeof(inst.input[0]) != 'object')
				inst.input[0].focus(); // restore focus
			this._lastInput = null;
		}
	},

	/* Update any alternate field to synchronise with the main field. */
	_updateAlternate: function(inst) {
		var altField = this._get(inst, 'altField');
		if (altField) { // update alternate field too
			var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
			var date = this._getDate(inst);
			dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
			$(altField).each(function() { $(this).val(dateStr); });
		}
	},

	/* Set as beforeShowDay function to prevent selection of weekends.
	   @param  date  Date - the date to customise
	   @return [boolean, string] - is this date selectable?, what is its CSS class? */
	noWeekends: function(date) {
		var day = date.getDay();
		return [(day > 0 && day < 6), ''];
	},

	/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
	   @param  date  Date - the date to get the week for
	   @return  number - the number of the week within the year that contains this date */
	iso8601Week: function(date) {
		var checkDate = new Date(date.getFullYear(), date.getMonth(), date.getDate());
		var firstMon = new Date(checkDate.getFullYear(), 1 - 1, 4); // First week always contains 4 Jan
		var firstDay = firstMon.getDay() || 7; // Day of week: Mon = 1, ..., Sun = 7
		firstMon.setDate(firstMon.getDate() + 1 - firstDay); // Preceding Monday
		if (firstDay < 4 && checkDate < firstMon) { // Adjust first three days in year if necessary
			checkDate.setDate(checkDate.getDate() - 3); // Generate for previous year
			return $.datepicker.iso8601Week(checkDate);
		} else if (checkDate > new Date(checkDate.getFullYear(), 12 - 1, 28)) { // Check last three days in year
			firstDay = new Date(checkDate.getFullYear() + 1, 1 - 1, 4).getDay() || 7;
			if (firstDay > 4 && (checkDate.getDay() || 7) < firstDay - 3) { // Adjust if necessary
				return 1;
			}
		}
		return Math.floor(((checkDate - firstMon) / 86400000) / 7) + 1; // Weeks to given date
	},

	/* Parse a string value into a date object.
	   See formatDate below for the possible formats.

	   @param  format    string - the expected format of the date
	   @param  value     string - the date in the above format
	   @param  settings  Object - attributes include:
	                     shortYearCutoff  number - the cutoff year for determining the century (optional)
	                     dayNamesShort    string[7] - abbreviated names of the days from Sunday (optional)
	                     dayNames         string[7] - names of the days from Sunday (optional)
	                     monthNamesShort  string[12] - abbreviated names of the months (optional)
	                     monthNames       string[12] - names of the months (optional)
	   @return  Date - the extracted date value or null if value is blank */
	parseDate: function (format, value, settings) {
		if (format == null || value == null)
			throw 'Invalid arguments';
		value = (typeof value == 'object' ? value.toString() : value + '');
		if (value == '')
			return null;
		var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
		var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
		var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
		var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
		var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
		var year = -1;
		var month = -1;
		var day = -1;
		var doy = -1;
		var literal = false;
		// Check whether a format character is doubled
		var lookAhead = function(match) {
			var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
			if (matches)
				iFormat++;
			return matches;
		};
		// Extract a number from the string value
		var getNumber = function(match) {
			lookAhead(match);
			var origSize = (match == '@' ? 14 : (match == 'y' ? 4 : (match == 'o' ? 3 : 2)));
			var size = origSize;
			var num = 0;
			while (size > 0 && iValue < value.length &&
					value.charAt(iValue) >= '0' && value.charAt(iValue) <= '9') {
				num = num * 10 + parseInt(value.charAt(iValue++),10);
				size--;
			}
			if (size == origSize)
				throw 'Missing number at position ' + iValue;
			return num;
		};
		// Extract a name from the string value and convert to an index
		var getName = function(match, shortNames, longNames) {
			var names = (lookAhead(match) ? longNames : shortNames);
			var size = 0;
			for (var j = 0; j < names.length; j++)
				size = Math.max(size, names[j].length);
			var name = '';
			var iInit = iValue;
			while (size > 0 && iValue < value.length) {
				name += value.charAt(iValue++);
				for (var i = 0; i < names.length; i++)
					if (name == names[i])
						return i + 1;
				size--;
			}
			throw 'Unknown name at position ' + iInit;
		};
		// Confirm that a literal character matches the string value
		var checkLiteral = function() {
			if (value.charAt(iValue) != format.charAt(iFormat))
				throw 'Unexpected literal at position ' + iValue;
			iValue++;
		};
		var iValue = 0;
		for (var iFormat = 0; iFormat < format.length; iFormat++) {
			if (literal)
				if (format.charAt(iFormat) == "'" && !lookAhead("'"))
					literal = false;
				else
					checkLiteral();
			else
				switch (format.charAt(iFormat)) {
					case 'd':
						day = getNumber('d');
						break;
					case 'D':
						getName('D', dayNamesShort, dayNames);
						break;
					case 'o':
						doy = getNumber('o');
						break;
					case 'm':
						month = getNumber('m');
						break;
					case 'M':
						month = getName('M', monthNamesShort, monthNames);
						break;
					case 'y':
						year = getNumber('y');
						break;
					case '@':
						var date = new Date(getNumber('@'));
						year = date.getFullYear();
						month = date.getMonth() + 1;
						day = date.getDate();
						break;
					case "'":
						if (lookAhead("'"))
							checkLiteral();
						else
							literal = true;
						break;
					default:
						checkLiteral();
				}
		}
		if (year == -1)
			year = new Date().getFullYear();
		else if (year < 100)
			year += new Date().getFullYear() - new Date().getFullYear() % 100 +
				(year <= shortYearCutoff ? 0 : -100);
		if (doy > -1) {
			month = 1;
			day = doy;
			do {
				var dim = this._getDaysInMonth(year, month - 1);
				if (day <= dim)
					break;
				month++;
				day -= dim;
			} while (true);
		}
		var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
		if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
			throw 'Invalid date'; // E.g. 31/02/*
		return date;
	},

	/* Standard date formats. */
	ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
	COOKIE: 'D, dd M yy',
	ISO_8601: 'yy-mm-dd',
	RFC_822: 'D, d M y',
	RFC_850: 'DD, dd-M-y',
	RFC_1036: 'D, d M y',
	RFC_1123: 'D, d M yy',
	RFC_2822: 'D, d M yy',
	RSS: 'D, d M y', // RFC 822
	TIMESTAMP: '@',
	W3C: 'yy-mm-dd', // ISO 8601

	/* Format a date object into a string value.
	   The format can be combinations of the following:
	   d  - day of month (no leading zero)
	   dd - day of month (two digit)
	   o  - day of year (no leading zeros)
	   oo - day of year (three digit)
	   D  - day name short
	   DD - day name long
	   m  - month of year (no leading zero)
	   mm - month of year (two digit)
	   M  - month name short
	   MM - month name long
	   y  - year (two digit)
	   yy - year (four digit)
	   @ - Unix timestamp (ms since 01/01/1970)
	   '...' - literal text
	   '' - single quote

	   @param  format    string - the desired format of the date
	   @param  date      Date - the date value to format
	   @param  settings  Object - attributes include:
	                     dayNamesShort    string[7] - abbreviated names of the days from Sunday (optional)
	                     dayNames         string[7] - names of the days from Sunday (optional)
	                     monthNamesShort  string[12] - abbreviated names of the months (optional)
	                     monthNames       string[12] - names of the months (optional)
	   @return  string - the date in the above format */
	formatDate: function (format, date, settings) {
		if (!date)
			return '';
		var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
		var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
		var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
		var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
		// Check whether a format character is doubled
		var lookAhead = function(match) {
			var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
			if (matches)
				iFormat++;
			return matches;
		};
		// Format a number, with leading zero if necessary
		var formatNumber = function(match, value, len) {
			var num = '' + value;
			if (lookAhead(match))
				while (num.length < len)
					num = '0' + num;
			return num;
		};
		// Format a name, short or long as requested
		var formatName = function(match, value, shortNames, longNames) {
			return (lookAhead(match) ? longNames[value] : shortNames[value]);
		};
		var output = '';
		var literal = false;
		if (date)
			for (var iFormat = 0; iFormat < format.length; iFormat++) {
				if (literal)
					if (format.charAt(iFormat) == "'" && !lookAhead("'"))
						literal = false;
					else
						output += format.charAt(iFormat);
				else
					switch (format.charAt(iFormat)) {
						case 'd':
							output += formatNumber('d', date.getDate(), 2);
							break;
						case 'D':
							output += formatName('D', date.getDay(), dayNamesShort, dayNames);
							break;
						case 'o':
							var doy = date.getDate();
							for (var m = date.getMonth() - 1; m >= 0; m--)
								doy += this._getDaysInMonth(date.getFullYear(), m);
							output += formatNumber('o', doy, 3);
							break;
						case 'm':
							output += formatNumber('m', date.getMonth() + 1, 2);
							break;
						case 'M':
							output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
							break;
						case 'y':
							output += (lookAhead('y') ? date.getFullYear() :
								(date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
							break;
						case '@':
							output += date.getTime();
							break;
						case "'":
							if (lookAhead("'"))
								output += "'";
							else
								literal = true;
							break;
						default:
							output += format.charAt(iFormat);
					}
			}
		return output;
	},

	/* Extract all possible characters from the date format. */
	_possibleChars: function (format) {
		var chars = '';
		var literal = false;
		for (var iFormat = 0; iFormat < format.length; iFormat++)
			if (literal)
				if (format.charAt(iFormat) == "'" && !lookAhead("'"))
					literal = false;
				else
					chars += format.charAt(iFormat);
			else
				switch (format.charAt(iFormat)) {
					case 'd': case 'm': case 'y': case '@':
						chars += '0123456789';
						break;
					case 'D': case 'M':
						return null; // Accept anything
					case "'":
						if (lookAhead("'"))
							chars += "'";
						else
							literal = true;
						break;
					default:
						chars += format.charAt(iFormat);
				}
		return chars;
	},

	/* Get a setting value, defaulting if necessary. */
	_get: function(inst, name) {
		return inst.settings[name] !== undefined ?
			inst.settings[name] : this._defaults[name];
	},

	/* Parse existing date and initialise date picker. */
	_setDateFromField: function(inst) {
		var dateFormat = this._get(inst, 'dateFormat');
		var dates = inst.input ? inst.input.val() : null;
		inst.endDay = inst.endMonth = inst.endYear = null;
		var date = defaultDate = this._getDefaultDate(inst);
		var settings = this._getFormatConfig(inst);
		try {
			date = this.parseDate(dateFormat, dates, settings) || defaultDate;
		} catch (event) {
			this.log(event);
			date = defaultDate;
		}
		inst.selectedDay = date.getDate();
		inst.drawMonth = inst.selectedMonth = date.getMonth();
		inst.drawYear = inst.selectedYear = date.getFullYear();
		inst.currentDay = (dates ? date.getDate() : 0);
		inst.currentMonth = (dates ? date.getMonth() : 0);
		inst.currentYear = (dates ? date.getFullYear() : 0);
		this._adjustInstDate(inst);
	},

	/* Retrieve the default date shown on opening. */
	_getDefaultDate: function(inst) {
		var date = this._determineDate(this._get(inst, 'defaultDate'), new Date());
		var minDate = this._getMinMaxDate(inst, 'min', true);
		var maxDate = this._getMinMaxDate(inst, 'max');
		date = (minDate && date < minDate ? minDate : date);
		date = (maxDate && date > maxDate ? maxDate : date);
		return date;
	},

	/* A date may be specified as an exact value or a relative one. */
	_determineDate: function(date, defaultDate) {
		var offsetNumeric = function(offset) {
			var date = new Date();
			date.setDate(date.getDate() + offset);
			return date;
		};
		var offsetString = function(offset, getDaysInMonth) {
			var date = new Date();
			var year = date.getFullYear();
			var month = date.getMonth();
			var day = date.getDate();
			var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
			var matches = pattern.exec(offset);
			while (matches) {
				switch (matches[2] || 'd') {
					case 'd' : case 'D' :
						day += parseInt(matches[1],10); break;
					case 'w' : case 'W' :
						day += parseInt(matches[1],10) * 7; break;
					case 'm' : case 'M' :
						month += parseInt(matches[1],10);
						day = Math.min(day, getDaysInMonth(year, month));
						break;
					case 'y': case 'Y' :
						year += parseInt(matches[1],10);
						day = Math.min(day, getDaysInMonth(year, month));
						break;
				}
				matches = pattern.exec(offset);
			}
			return new Date(year, month, day);
		};
		date = (date == null ? defaultDate :
			(typeof date == 'string' ? offsetString(date, this._getDaysInMonth) :
			(typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
		date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
		if (date) {
			date.setHours(0);
			date.setMinutes(0);
			date.setSeconds(0);
			date.setMilliseconds(0);
		}
		return this._daylightSavingAdjust(date);
	},

	/* Handle switch to/from daylight saving.
	   Hours may be non-zero on daylight saving cut-over:
	   > 12 when midnight changeover, but then cannot generate
	   midnight datetime, so jump to 1AM, otherwise reset.
	   @param  date  (Date) the date to check
	   @return  (Date) the corrected date */
	_daylightSavingAdjust: function(date) {
		if (!date) return null;
		date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
		return date;
	},

	/* Set the date(s) directly. */
	_setDate: function(inst, date, endDate) {
		var clear = !(date);
		var origMonth = inst.selectedMonth;
		var origYear = inst.selectedYear;
		date = this._determineDate(date, new Date());
		inst.selectedDay = inst.currentDay = date.getDate();
		inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
		inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
		if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
			this._notifyChange(inst);
		this._adjustInstDate(inst);
		if (inst.input) {
			inst.input.val(clear ? '' : this._formatDate(inst));
		}
	},

	/* Retrieve the date(s) directly. */
	_getDate: function(inst) {
		var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
			this._daylightSavingAdjust(new Date(
			inst.currentYear, inst.currentMonth, inst.currentDay)));
			return startDate;
	},

	/* Generate the HTML for the current state of the date picker. */
	_generateHTML: function(inst) {
		var today = new Date();
		today = this._daylightSavingAdjust(
			new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
		var isRTL = this._get(inst, 'isRTL');
		var showButtonPanel = this._get(inst, 'showButtonPanel');
		var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
		var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
		var numMonths = this._getNumberOfMonths(inst);
		var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
		var stepMonths = this._get(inst, 'stepMonths');
		var stepBigMonths = this._get(inst, 'stepBigMonths');
		var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
		var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
			new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
		var minDate = this._getMinMaxDate(inst, 'min', true);
		var maxDate = this._getMinMaxDate(inst, 'max');
		var drawMonth = inst.drawMonth - showCurrentAtPos;
		var drawYear = inst.drawYear;
		if (drawMonth < 0) {
			drawMonth += 12;
			drawYear--;
		}
		if (maxDate) {
			var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
				maxDate.getMonth() - numMonths[1] + 1, maxDate.getDate()));
			maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
			while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
				drawMonth--;
				if (drawMonth < 0) {
					drawMonth = 11;
					drawYear--;
				}
			}
		}
		inst.drawMonth = drawMonth;
		inst.drawYear = drawYear;
		var prevText = this._get(inst, 'prevText');
		prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
			this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
			this._getFormatConfig(inst)));
		var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
			'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
			' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
			(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
		var nextText = this._get(inst, 'nextText');
		nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
			this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
			this._getFormatConfig(inst)));
		var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
			'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
			' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
			(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
		var currentText = this._get(inst, 'currentText');
		var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
		currentText = (!navigationAsDateFormat ? currentText :
			this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
		var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
		var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
			(this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
			'>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
		var firstDay = parseInt(this._get(inst, 'firstDay'),10);
		firstDay = (isNaN(firstDay) ? 0 : firstDay);
		var dayNames = this._get(inst, 'dayNames');
		var dayNamesShort = this._get(inst, 'dayNamesShort');
		var dayNamesMin = this._get(inst, 'dayNamesMin');
		var monthNames = this._get(inst, 'monthNames');
		var monthNamesShort = this._get(inst, 'monthNamesShort');
		var beforeShowDay = this._get(inst, 'beforeShowDay');
		var showOtherMonths = this._get(inst, 'showOtherMonths');
		var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
		var endDate = inst.endDay ? this._daylightSavingAdjust(
			new Date(inst.endYear, inst.endMonth, inst.endDay)) : currentDate;
		var defaultDate = this._getDefaultDate(inst);
		var html = '';
		for (var row = 0; row < numMonths[0]; row++) {
			var group = '';
			for (var col = 0; col < numMonths[1]; col++) {
				var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
				var cornerClass = ' ui-corner-all';
				var calender = '';
				if (isMultiMonth) {
					calender += '<div class="ui-datepicker-group ui-datepicker-group-';
					switch (col) {
						case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
						case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
						default: calender += 'middle'; cornerClass = ''; break;
					}
					calender += '">';
				}
				calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
					(/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
					(/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
					this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
					selectedDate, row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
					'</div><table class="ui-datepicker-calendar"><thead>' +
					'<tr>';
				var thead = '';
				for (var dow = 0; dow < 7; dow++) { // days of the week
					var day = (dow + firstDay) % 7;
					thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
						'<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
				}
				calender += thead + '</tr></thead><tbody>';
				var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
				if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
					inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
				var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
				var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
				var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
				for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
					calender += '<tr>';
					var tbody = '';
					for (var dow = 0; dow < 7; dow++) { // create date picker days
						var daySettings = (beforeShowDay ?
							beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
						var otherMonth = (printDate.getMonth() != drawMonth);
						var unselectable = otherMonth || !daySettings[0] ||
							(minDate && printDate < minDate) || (maxDate && printDate > maxDate);
						tbody += '<td class="' +
							((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
							(otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
							((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
							(defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
							// or defaultDate is current printedDate and defaultDate is selectedDate
							' ' + this._dayOverClass : '') + // highlight selected day
							(unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') +  // highlight unselectable days
							(otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
							(printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
							' ' + this._currentClass : '') + // highlight selected day
							(printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
							((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
							(unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
							inst.id + '\',' + drawMonth + ',' + drawYear + ', this);return false;"') + '>' + // actions
							(otherMonth ? (showOtherMonths ? printDate.getDate() : '&#xa0;') : // display for other months
							(unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
							(printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
							(printDate.getTime() >= currentDate.getTime() && printDate.getTime() <= endDate.getTime() ? // in current range
							' ui-state-active' : '') + // highlight selected day
							'" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display for this month
						printDate.setDate(printDate.getDate() + 1);
						printDate = this._daylightSavingAdjust(printDate);
					}
					calender += tbody + '</tr>';
				}
				drawMonth++;
				if (drawMonth > 11) {
					drawMonth = 0;
					drawYear++;
				}
				calender += '</tbody></table>' + (isMultiMonth ? '</div>' + 
							((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
				group += calender;
			}
			html += group;
		}
		html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
			'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
		inst._keyEvent = false;
		return html;
	},

	/* Generate the month and year header. */
	_generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
			selectedDate, secondary, monthNames, monthNamesShort) {
		minDate = (inst.rangeStart && minDate && selectedDate < minDate ? selectedDate : minDate);
		var changeMonth = this._get(inst, 'changeMonth');
		var changeYear = this._get(inst, 'changeYear');
		var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
		var html = '<div class="ui-datepicker-title">';
		var monthHtml = '';
		// month selection
		if (secondary || !changeMonth)
			monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
		else {
			var inMinYear = (minDate && minDate.getFullYear() == drawYear);
			var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
			monthHtml += '<select class="ui-datepicker-month" ' +
				'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
				'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
			 	'>';
			for (var month = 0; month < 12; month++) {
				if ((!inMinYear || month >= minDate.getMonth()) &&
						(!inMaxYear || month <= maxDate.getMonth()))
					monthHtml += '<option value="' + month + '"' +
						(month == drawMonth ? ' selected="selected"' : '') +
						'>' + monthNamesShort[month] + '</option>';
			}
			monthHtml += '</select>';
		}
		if (!showMonthAfterYear)
			html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? '&#xa0;' : '');
		// year selection
		if (secondary || !changeYear)
			html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
		else {
			// determine range of years to display
			var years = this._get(inst, 'yearRange').split(':');
			var year = 0;
			var endYear = 0;
			if (years.length != 2) {
				year = drawYear - 10;
				endYear = drawYear + 10;
			} else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
				year = drawYear + parseInt(years[0], 10);
				endYear = drawYear + parseInt(years[1], 10);
			} else {
				year = parseInt(years[0], 10);
				endYear = parseInt(years[1], 10);
			}
			year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
			endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
			html += '<select class="ui-datepicker-year" ' +
				'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
				'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
				'>';
			for (; year <= endYear; year++) {
				html += '<option value="' + year + '"' +
					(year == drawYear ? ' selected="selected"' : '') +
					'>' + year + '</option>';
			}
			html += '</select>';
		}
		if (showMonthAfterYear)
			html += (secondary || changeMonth || changeYear ? '&#xa0;' : '') + monthHtml;
		html += '</div>'; // Close datepicker_header
		return html;
	},

	/* Adjust one of the date sub-fields. */
	_adjustInstDate: function(inst, offset, period) {
		var year = inst.drawYear + (period == 'Y' ? offset : 0);
		var month = inst.drawMonth + (period == 'M' ? offset : 0);
		var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
			(period == 'D' ? offset : 0);
		var date = this._daylightSavingAdjust(new Date(year, month, day));
		// ensure it is within the bounds set
		var minDate = this._getMinMaxDate(inst, 'min', true);
		var maxDate = this._getMinMaxDate(inst, 'max');
		date = (minDate && date < minDate ? minDate : date);
		date = (maxDate && date > maxDate ? maxDate : date);
		inst.selectedDay = date.getDate();
		inst.drawMonth = inst.selectedMonth = date.getMonth();
		inst.drawYear = inst.selectedYear = date.getFullYear();
		if (period == 'M' || period == 'Y')
			this._notifyChange(inst);
	},

	/* Notify change of month/year. */
	_notifyChange: function(inst) {
		var onChange = this._get(inst, 'onChangeMonthYear');
		if (onChange)
			onChange.apply((inst.input ? inst.input[0] : null),
				[inst.selectedYear, inst.selectedMonth + 1, inst]);
	},

	/* Determine the number of months to show. */
	_getNumberOfMonths: function(inst) {
		var numMonths = this._get(inst, 'numberOfMonths');
		return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
	},

	/* Determine the current maximum date - ensure no time components are set - may be overridden for a range. */
	_getMinMaxDate: function(inst, minMax, checkRange) {
		var date = this._determineDate(this._get(inst, minMax + 'Date'), null);
		return (!checkRange || !inst.rangeStart ? date :
			(!date || inst.rangeStart > date ? inst.rangeStart : date));
	},

	/* Find the number of days in a given month. */
	_getDaysInMonth: function(year, month) {
		return 32 - new Date(year, month, 32).getDate();
	},

	/* Find the day of the week of the first of a month. */
	_getFirstDayOfMonth: function(year, month) {
		return new Date(year, month, 1).getDay();
	},

	/* Determines if we should allow a "next/prev" month display change. */
	_canAdjustMonth: function(inst, offset, curYear, curMonth) {
		var numMonths = this._getNumberOfMonths(inst);
		var date = this._daylightSavingAdjust(new Date(
			curYear, curMonth + (offset < 0 ? offset : numMonths[1]), 1));
		if (offset < 0)
			date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
		return this._isInRange(inst, date);
	},

	/* Is the given date in the accepted range? */
	_isInRange: function(inst, date) {
		// during range selection, use minimum of selected date and range start
		var newMinDate = (!inst.rangeStart ? null : this._daylightSavingAdjust(
			new Date(inst.selectedYear, inst.selectedMonth, inst.selectedDay)));
		newMinDate = (newMinDate && inst.rangeStart < newMinDate ? inst.rangeStart : newMinDate);
		var minDate = newMinDate || this._getMinMaxDate(inst, 'min');
		var maxDate = this._getMinMaxDate(inst, 'max');
		return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
	},

	/* Provide the configuration settings for formatting/parsing. */
	_getFormatConfig: function(inst) {
		var shortYearCutoff = this._get(inst, 'shortYearCutoff');
		shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
			new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
		return {shortYearCutoff: shortYearCutoff,
			dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
			monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
	},

	/* Format the given date for display. */
	_formatDate: function(inst, day, month, year) {
		if (!day) {
			inst.currentDay = inst.selectedDay;
			inst.currentMonth = inst.selectedMonth;
			inst.currentYear = inst.selectedYear;
		}
		var date = (day ? (typeof day == 'object' ? day :
			this._daylightSavingAdjust(new Date(year, month, day))) :
			this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
		return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
	}
});

/* jQuery extend now ignores nulls! */
function extendRemove(target, props) {
	$.extend(target, props);
	for (var name in props)
		if (props[name] == null || props[name] == undefined)
			target[name] = props[name];
	return target;
};

/* Determine whether an object is an array. */
function isArray(a) {
	return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
		(a.constructor && a.constructor.toString().match(/\Array\(\)/))));
};

/* Invoke the datepicker functionality.
   @param  options  string - a command, optionally followed by additional parameters or
                    Object - settings for attaching new datepicker functionality
   @return  jQuery object */
$.fn.datepicker = function(options){

	/* Initialise the date picker. */
	if (!$.datepicker.initialized) {
		$(document).mousedown($.datepicker._checkExternalClick).
			find('body').append($.datepicker.dpDiv);
		$.datepicker.initialized = true;
	}

	var otherArgs = Array.prototype.slice.call(arguments, 1);
	if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
		return $.datepicker['_' + options + 'Datepicker'].
			apply($.datepicker, [this[0]].concat(otherArgs));
	if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
		return $.datepicker['_' + options + 'Datepicker'].
			apply($.datepicker, [this[0]].concat(otherArgs));
	return this.each(function() {
		typeof options == 'string' ?
			$.datepicker['_' + options + 'Datepicker'].
				apply($.datepicker, [this].concat(otherArgs)) :
			$.datepicker._attachDatepicker(this, options);
	});
};

$.datepicker = new Datepicker(); // singleton instance
$.datepicker.initialized = false;
$.datepicker.uuid = new Date().getTime();
$.datepicker.version = "1.7.2";

// Workaround for #4055
// Add another global to avoid noConflict issues with inline event handlers
window.DP_jQuery = $;

})(jQuery);
/*
 * jQuery UI Progressbar 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Progressbar
 *
 * Depends:
 *   ui.core.js
 */
(function($) {

$.widget("ui.progressbar", {

	_init: function() {

		this.element
			.addClass("ui-progressbar"
				+ " ui-widget"
				+ " ui-widget-content"
				+ " ui-corner-all")
			.attr({
				role: "progressbar",
				"aria-valuemin": this._valueMin(),
				"aria-valuemax": this._valueMax(),
				"aria-valuenow": this._value()
			});

		this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);

		this._refreshValue();

	},

	destroy: function() {

		this.element
			.removeClass("ui-progressbar"
				+ " ui-widget"
				+ " ui-widget-content"
				+ " ui-corner-all")
			.removeAttr("role")
			.removeAttr("aria-valuemin")
			.removeAttr("aria-valuemax")
			.removeAttr("aria-valuenow")
			.removeData("progressbar")
			.unbind(".progressbar");

		this.valueDiv.remove();

		$.widget.prototype.destroy.apply(this, arguments);

	},

	value: function(newValue) {
		if (newValue === undefined) {
			return this._value();
		}
		
		this._setData('value', newValue);
		return this;
	},

	_setData: function(key, value) {

		switch (key) {
			case 'value':
				this.options.value = value;
				this._refreshValue();
				this._trigger('change', null, {});
				break;
		}

		$.widget.prototype._setData.apply(this, arguments);

	},

	_value: function() {

		var val = this.options.value;
		if (val < this._valueMin()) val = this._valueMin();
		if (val > this._valueMax()) val = this._valueMax();

		return val;

	},

	_valueMin: function() {
		var valueMin = 0;
		return valueMin;
	},

	_valueMax: function() {
		var valueMax = 100;
		return valueMax;
	},

	_refreshValue: function() {
		var value = this.value();
		this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
		this.valueDiv.width(value + '%');
		this.element.attr("aria-valuenow", value);
	}

});

$.extend($.ui.progressbar, {
	version: "1.7.2",
	defaults: {
		value: 0
	}
});

})(jQuery);
/*
 * jQuery UI Effects 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/
 */
;jQuery.effects || (function($) {

$.effects = {
	version: "1.7.2",

	// Saves a set of properties in a data storage
	save: function(element, set) {
		for(var i=0; i < set.length; i++) {
			if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
		}
	},

	// Restores a set of previously saved properties from a data storage
	restore: function(element, set) {
		for(var i=0; i < set.length; i++) {
			if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
		}
	},

	setMode: function(el, mode) {
		if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
		return mode;
	},

	getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
		// this should be a little more flexible in the future to handle a string & hash
		var y, x;
		switch (origin[0]) {
			case 'top': y = 0; break;
			case 'middle': y = 0.5; break;
			case 'bottom': y = 1; break;
			default: y = origin[0] / original.height;
		};
		switch (origin[1]) {
			case 'left': x = 0; break;
			case 'center': x = 0.5; break;
			case 'right': x = 1; break;
			default: x = origin[1] / original.width;
		};
		return {x: x, y: y};
	},

	// Wraps the element around a wrapper that copies position properties
	createWrapper: function(element) {

		//if the element is already wrapped, return it
		if (element.parent().is('.ui-effects-wrapper'))
			return element.parent();

		//Cache width,height and float properties of the element, and create a wrapper around it
		var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
		element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
		var wrapper = element.parent();

		//Transfer the positioning of the element to the wrapper
		if (element.css('position') == 'static') {
			wrapper.css({ position: 'relative' });
			element.css({ position: 'relative'} );
		} else {
			var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
			var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
			wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
			element.css({position: 'relative', top: 0, left: 0 });
		}

		wrapper.css(props);
		return wrapper;
	},

	removeWrapper: function(element) {
		if (element.parent().is('.ui-effects-wrapper'))
			return element.parent().replaceWith(element);
		return element;
	},

	setTransition: function(element, list, factor, value) {
		value = value || {};
		$.each(list, function(i, x){
			unit = element.cssUnit(x);
			if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
		});
		return value;
	},

	//Base function to animate from one class to another in a seamless transition
	animateClass: function(value, duration, easing, callback) {

		var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
		var ea = (typeof easing == "string" ? easing : null);

		return this.each(function() {

			var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
			if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
			if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }

			//Let's get a style offset
			var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
			if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
			var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
			if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);

			// The main function to form the object for animation
			for(var n in newStyle) {
				if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
				&& n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
				&& newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
				&& (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
				&& (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
				) offset[n] = newStyle[n];
			}

			that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
				// Change style attribute back to original. For stupid IE, we need to clear the damn object.
				if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
				if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
				if(cb) cb.apply(this, arguments);
			});

		});
	}
};


function _normalizeArguments(a, m) {

	var o = a[1] && a[1].constructor == Object ? a[1] : {}; if(m) o.mode = m;
	var speed = a[1] && a[1].constructor != Object ? a[1] : (o.duration ? o.duration : a[2]); //either comes from options.duration or the secon/third argument
		speed = $.fx.off ? 0 : typeof speed === "number" ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
	var callback = o.callback || ( $.isFunction(a[1]) && a[1] ) || ( $.isFunction(a[2]) && a[2] ) || ( $.isFunction(a[3]) && a[3] );

	return [a[0], o, speed, callback];
	
}

//Extend the methods of jQuery
$.fn.extend({

	//Save old methods
	_show: $.fn.show,
	_hide: $.fn.hide,
	__toggle: $.fn.toggle,
	_addClass: $.fn.addClass,
	_removeClass: $.fn.removeClass,
	_toggleClass: $.fn.toggleClass,

	// New effect methods
	effect: function(fx, options, speed, callback) {
		return $.effects[fx] ? $.effects[fx].call(this, {method: fx, options: options || {}, duration: speed, callback: callback }) : null;
	},

	show: function() {
		if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
			return this._show.apply(this, arguments);
		else {
			return this.effect.apply(this, _normalizeArguments(arguments, 'show'));
		}
	},

	hide: function() {
		if(!arguments[0] || (arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])))
			return this._hide.apply(this, arguments);
		else {
			return this.effect.apply(this, _normalizeArguments(arguments, 'hide'));
		}
	},

	toggle: function(){
		if(!arguments[0] ||
			(arguments[0].constructor == Number || (/(slow|normal|fast)/).test(arguments[0])) ||
			($.isFunction(arguments[0]) || typeof arguments[0] == 'boolean')) {
			return this.__toggle.apply(this, arguments);
		} else {
			return this.effect.apply(this, _normalizeArguments(arguments, 'toggle'));
		}
	},

	addClass: function(classNames, speed, easing, callback) {
		return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
	},
	removeClass: function(classNames,speed,easing,callback) {
		return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
	},
	toggleClass: function(classNames,speed,easing,callback) {
		return ( (typeof speed !== "boolean") && speed ) ? $.effects.animateClass.apply(this, [{ toggle: classNames },speed,easing,callback]) : this._toggleClass(classNames, speed);
	},
	morph: function(remove,add,speed,easing,callback) {
		return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
	},
	switchClass: function() {
		return this.morph.apply(this, arguments);
	},

	// helper functions
	cssUnit: function(key) {
		var style = this.css(key), val = [];
		$.each( ['em','px','%','pt'], function(i, unit){
			if(style.indexOf(unit) > 0)
				val = [parseFloat(style), unit];
		});
		return val;
	}
});

/*
 * jQuery Color Animations
 * Copyright 2007 John Resig
 * Released under the MIT and GPL licenses.
 */

// We override the animation for all of these color styles
$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor', 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'], function(i,attr){
		$.fx.step[attr] = function(fx) {
				if ( fx.state == 0 ) {
						fx.start = getColor( fx.elem, attr );
						fx.end = getRGB( fx.end );
				}

				fx.elem.style[attr] = "rgb(" + [
						Math.max(Math.min( parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0],10), 255), 0),
						Math.max(Math.min( parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1],10), 255), 0),
						Math.max(Math.min( parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2],10), 255), 0)
				].join(",") + ")";
			};
});

// Color Conversion functions from highlightFade
// By Blair Mitchelmore
// http://jquery.offput.ca/highlightFade/

// Parse strings looking for color tuples [255,255,255]
function getRGB(color) {
		var result;

		// Check if we're already dealing with an array of colors
		if ( color && color.constructor == Array && color.length == 3 )
				return color;

		// Look for rgb(num,num,num)
		if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
				return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];

		// Look for rgb(num%,num%,num%)
		if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
				return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];

		// Look for #a0b1c2
		if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
				return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];

		// Look for #fff
		if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
				return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];

		// Look for rgba(0, 0, 0, 0) == transparent in Safari 3
		if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
				return colors['transparent'];

		// Otherwise, we're most likely dealing with a named color
		return colors[$.trim(color).toLowerCase()];
}

function getColor(elem, attr) {
		var color;

		do {
				color = $.curCSS(elem, attr);

				// Keep going until we find an element that has color, or we hit the body
				if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
						break;

				attr = "backgroundColor";
		} while ( elem = elem.parentNode );

		return getRGB(color);
};

// Some named colors to work with
// From Interface by Stefan Petre
// http://interface.eyecon.ro/

var colors = {
	aqua:[0,255,255],
	azure:[240,255,255],
	beige:[245,245,220],
	black:[0,0,0],
	blue:[0,0,255],
	brown:[165,42,42],
	cyan:[0,255,255],
	darkblue:[0,0,139],
	darkcyan:[0,139,139],
	darkgrey:[169,169,169],
	darkgreen:[0,100,0],
	darkkhaki:[189,183,107],
	darkmagenta:[139,0,139],
	darkolivegreen:[85,107,47],
	darkorange:[255,140,0],
	darkorchid:[153,50,204],
	darkred:[139,0,0],
	darksalmon:[233,150,122],
	darkviolet:[148,0,211],
	fuchsia:[255,0,255],
	gold:[255,215,0],
	green:[0,128,0],
	indigo:[75,0,130],
	khaki:[240,230,140],
	lightblue:[173,216,230],
	lightcyan:[224,255,255],
	lightgreen:[144,238,144],
	lightgrey:[211,211,211],
	lightpink:[255,182,193],
	lightyellow:[255,255,224],
	lime:[0,255,0],
	magenta:[255,0,255],
	maroon:[128,0,0],
	navy:[0,0,128],
	olive:[128,128,0],
	orange:[255,165,0],
	pink:[255,192,203],
	purple:[128,0,128],
	violet:[128,0,128],
	red:[255,0,0],
	silver:[192,192,192],
	white:[255,255,255],
	yellow:[255,255,0],
	transparent: [255,255,255]
};

/*
 * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
 *
 * Uses the built in easing capabilities added In jQuery 1.1
 * to offer multiple easing options
 *
 * TERMS OF USE - jQuery Easing
 *
 * Open source under the BSD License.
 *
 * Copyright 2008 George McGinley Smith
 * All rights reserved.
 *
 * Redistribution and use in source and binary forms, with or without modification,
 * are permitted provided that the following conditions are met:
 *
 * Redistributions of source code must retain the above copyright notice, this list of
 * conditions and the following disclaimer.
 * Redistributions in binary form must reproduce the above copyright notice, this list
 * of conditions and the following disclaimer in the documentation and/or other materials
 * provided with the distribution.
 *
 * Neither the name of the author nor the names of contributors may be used to endorse
 * or promote products derived from this software without specific prior written permission.
 *
 * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
 * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
 * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
 * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
 * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
 * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
 * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
 * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
 * OF THE POSSIBILITY OF SUCH DAMAGE.
 *
*/

// t: current time, b: begInnIng value, c: change In value, d: duration
$.easing.jswing = $.easing.swing;

$.extend($.easing,
{
	def: 'easeOutQuad',
	swing: function (x, t, b, c, d) {
		//alert($.easing.default);
		return $.easing[$.easing.def](x, t, b, c, d);
	},
	easeInQuad: function (x, t, b, c, d) {
		return c*(t/=d)*t + b;
	},
	easeOutQuad: function (x, t, b, c, d) {
		return -c *(t/=d)*(t-2) + b;
	},
	easeInOutQuad: function (x, t, b, c, d) {
		if ((t/=d/2) < 1) return c/2*t*t + b;
		return -c/2 * ((--t)*(t-2) - 1) + b;
	},
	easeInCubic: function (x, t, b, c, d) {
		return c*(t/=d)*t*t + b;
	},
	easeOutCubic: function (x, t, b, c, d) {
		return c*((t=t/d-1)*t*t + 1) + b;
	},
	easeInOutCubic: function (x, t, b, c, d) {
		if ((t/=d/2) < 1) return c/2*t*t*t + b;
		return c/2*((t-=2)*t*t + 2) + b;
	},
	easeInQuart: function (x, t, b, c, d) {
		return c*(t/=d)*t*t*t + b;
	},
	easeOutQuart: function (x, t, b, c, d) {
		return -c * ((t=t/d-1)*t*t*t - 1) + b;
	},
	easeInOutQuart: function (x, t, b, c, d) {
		if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
		return -c/2 * ((t-=2)*t*t*t - 2) + b;
	},
	easeInQuint: function (x, t, b, c, d) {
		return c*(t/=d)*t*t*t*t + b;
	},
	easeOutQuint: function (x, t, b, c, d) {
		return c*((t=t/d-1)*t*t*t*t + 1) + b;
	},
	easeInOutQuint: function (x, t, b, c, d) {
		if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
		return c/2*((t-=2)*t*t*t*t + 2) + b;
	},
	easeInSine: function (x, t, b, c, d) {
		return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
	},
	easeOutSine: function (x, t, b, c, d) {
		return c * Math.sin(t/d * (Math.PI/2)) + b;
	},
	easeInOutSine: function (x, t, b, c, d) {
		return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
	},
	easeInExpo: function (x, t, b, c, d) {
		return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
	},
	easeOutExpo: function (x, t, b, c, d) {
		return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
	},
	easeInOutExpo: function (x, t, b, c, d) {
		if (t==0) return b;
		if (t==d) return b+c;
		if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
		return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
	},
	easeInCirc: function (x, t, b, c, d) {
		return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
	},
	easeOutCirc: function (x, t, b, c, d) {
		return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
	},
	easeInOutCirc: function (x, t, b, c, d) {
		if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
		return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
	},
	easeInElastic: function (x, t, b, c, d) {
		var s=1.70158;var p=0;var a=c;
		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
		if (a < Math.abs(c)) { a=c; var s=p/4; }
		else var s = p/(2*Math.PI) * Math.asin (c/a);
		return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
	},
	easeOutElastic: function (x, t, b, c, d) {
		var s=1.70158;var p=0;var a=c;
		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
		if (a < Math.abs(c)) { a=c; var s=p/4; }
		else var s = p/(2*Math.PI) * Math.asin (c/a);
		return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
	},
	easeInOutElastic: function (x, t, b, c, d) {
		var s=1.70158;var p=0;var a=c;
		if (t==0) return b;  if ((t/=d/2)==2) return b+c;  if (!p) p=d*(.3*1.5);
		if (a < Math.abs(c)) { a=c; var s=p/4; }
		else var s = p/(2*Math.PI) * Math.asin (c/a);
		if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
		return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
	},
	easeInBack: function (x, t, b, c, d, s) {
		if (s == undefined) s = 1.70158;
		return c*(t/=d)*t*((s+1)*t - s) + b;
	},
	easeOutBack: function (x, t, b, c, d, s) {
		if (s == undefined) s = 1.70158;
		return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
	},
	easeInOutBack: function (x, t, b, c, d, s) {
		if (s == undefined) s = 1.70158;
		if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
		return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
	},
	easeInBounce: function (x, t, b, c, d) {
		return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
	},
	easeOutBounce: function (x, t, b, c, d) {
		if ((t/=d) < (1/2.75)) {
			return c*(7.5625*t*t) + b;
		} else if (t < (2/2.75)) {
			return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
		} else if (t < (2.5/2.75)) {
			return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
		} else {
			return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
		}
	},
	easeInOutBounce: function (x, t, b, c, d) {
		if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
		return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
	}
});

/*
 *
 * TERMS OF USE - EASING EQUATIONS
 *
 * Open source under the BSD License.
 *
 * Copyright 2001 Robert Penner
 * All rights reserved.
 *
 * Redistribution and use in source and binary forms, with or without modification,
 * are permitted provided that the following conditions are met:
 *
 * Redistributions of source code must retain the above copyright notice, this list of
 * conditions and the following disclaimer.
 * Redistributions in binary form must reproduce the above copyright notice, this list
 * of conditions and the following disclaimer in the documentation and/or other materials
 * provided with the distribution.
 *
 * Neither the name of the author nor the names of contributors may be used to endorse
 * or promote products derived from this software without specific prior written permission.
 *
 * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
 * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
 * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
 * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
 * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
 * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
 * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
 * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
 * OF THE POSSIBILITY OF SUCH DAMAGE.
 *
 */

})(jQuery);
/*
 * jQuery UI Effects Blind 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Blind
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.blind = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
		var direction = o.options.direction || 'vertical'; // Default direction

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
		var ref = (direction == 'vertical') ? 'height' : 'width';
		var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
		if(mode == 'show') wrapper.css(ref, 0); // Shift

		// Animation
		var animation = {};
		animation[ref] = mode == 'show' ? distance : 0;

		// Animate
		wrapper.animate(animation, o.duration, o.options.easing, function() {
			if(mode == 'hide') el.hide(); // Hide
			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
			if(o.callback) o.callback.apply(el[0], arguments); // Callback
			el.dequeue();
		});

	});

};

})(jQuery);
/*
 * jQuery UI Effects Bounce 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Bounce
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.bounce = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
		var direction = o.options.direction || 'up'; // Default direction
		var distance = o.options.distance || 20; // Default distance
		var times = o.options.times || 5; // Default # of times
		var speed = o.duration || 250; // Default speed per bounce
		if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		$.effects.createWrapper(el); // Create Wrapper
		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
		if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
		if (mode == 'hide') distance = distance / (times * 2);
		if (mode != 'hide') times--;

		// Animate
		if (mode == 'show') { // Show Bounce
			var animation = {opacity: 1};
			animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
			el.animate(animation, speed / 2, o.options.easing);
			distance = distance / 2;
			times--;
		};
		for (var i = 0; i < times; i++) { // Bounces
			var animation1 = {}, animation2 = {};
			animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
			animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
			el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
			distance = (mode == 'hide') ? distance * 2 : distance / 2;
		};
		if (mode == 'hide') { // Last Bounce
			var animation = {opacity: 0};
			animation[ref] = (motion == 'pos' ? '-=' : '+=')  + distance;
			el.animate(animation, speed / 2, o.options.easing, function(){
				el.hide(); // Hide
				$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
				if(o.callback) o.callback.apply(this, arguments); // Callback
			});
		} else {
			var animation1 = {}, animation2 = {};
			animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
			animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
			el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
				$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
				if(o.callback) o.callback.apply(this, arguments); // Callback
			});
		};
		el.queue('fx', function() { el.dequeue(); });
		el.dequeue();
	});

};

})(jQuery);
/*
 * jQuery UI Effects Clip 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Clip
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.clip = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left','height','width'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
		var direction = o.options.direction || 'vertical'; // Default direction

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
		var animate = el[0].tagName == 'IMG' ? wrapper : el;
		var ref = {
			size: (direction == 'vertical') ? 'height' : 'width',
			position: (direction == 'vertical') ? 'top' : 'left'
		};
		var distance = (direction == 'vertical') ? animate.height() : animate.width();
		if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift

		// Animation
		var animation = {};
		animation[ref.size] = mode == 'show' ? distance : 0;
		animation[ref.position] = mode == 'show' ? 0 : distance / 2;

		// Animate
		animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
			if(mode == 'hide') el.hide(); // Hide
			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
			if(o.callback) o.callback.apply(el[0], arguments); // Callback
			el.dequeue();
		}});

	});

};

})(jQuery);
/*
 * jQuery UI Effects Drop 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Drop
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.drop = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left','opacity'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
		var direction = o.options.direction || 'left'; // Default Direction

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		$.effects.createWrapper(el); // Create Wrapper
		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
		if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift

		// Animation
		var animation = {opacity: mode == 'show' ? 1 : 0};
		animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;

		// Animate
		el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
			if(mode == 'hide') el.hide(); // Hide
			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
			if(o.callback) o.callback.apply(this, arguments); // Callback
			el.dequeue();
		}});

	});

};

})(jQuery);
/*
 * jQuery UI Effects Explode 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Explode
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.explode = function(o) {

	return this.queue(function() {

	var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
	var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;

	o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
	var el = $(this).show().css('visibility', 'hidden');
	var offset = el.offset();

	//Substract the margins - not fixing the problem yet.
	offset.top -= parseInt(el.css("marginTop"),10) || 0;
	offset.left -= parseInt(el.css("marginLeft"),10) || 0;

	var width = el.outerWidth(true);
	var height = el.outerHeight(true);

	for(var i=0;i<rows;i++) { // =
		for(var j=0;j<cells;j++) { // ||
			el
				.clone()
				.appendTo('body')
				.wrap('<div></div>')
				.css({
					position: 'absolute',
					visibility: 'visible',
					left: -j*(width/cells),
					top: -i*(height/rows)
				})
				.parent()
				.addClass('ui-effects-explode')
				.css({
					position: 'absolute',
					overflow: 'hidden',
					width: width/cells,
					height: height/rows,
					left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
					top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
					opacity: o.options.mode == 'show' ? 0 : 1
				}).animate({
					left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
					top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
					opacity: o.options.mode == 'show' ? 1 : 0
				}, o.duration || 500);
		}
	}

	// Set a timeout, to call the callback approx. when the other animations have finished
	setTimeout(function() {

		o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
				if(o.callback) o.callback.apply(el[0]); // Callback
				el.dequeue();

				$('div.ui-effects-explode').remove();

	}, o.duration || 500);


	});

};

})(jQuery);
/*
 * jQuery UI Effects Fold 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Fold
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.fold = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
		var size = o.options.size || 15; // Default fold size
		var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
		var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
		var widthFirst = ((mode == 'show') != horizFirst);
		var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
		var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
		var percent = /([0-9]+)%/.exec(size);
		if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
		if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift

		// Animation
		var animation1 = {}, animation2 = {};
		animation1[ref[0]] = mode == 'show' ? distance[0] : size;
		animation2[ref[1]] = mode == 'show' ? distance[1] : 0;

		// Animate
		wrapper.animate(animation1, duration, o.options.easing)
		.animate(animation2, duration, o.options.easing, function() {
			if(mode == 'hide') el.hide(); // Hide
			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
			if(o.callback) o.callback.apply(el[0], arguments); // Callback
			el.dequeue();
		});

	});

};

})(jQuery);
/*
 * jQuery UI Effects Highlight 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Highlight
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.highlight = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['backgroundImage','backgroundColor','opacity'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
		var color = o.options.color || "#ffff99"; // Default highlight color
		var oldColor = el.css("backgroundColor");

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		el.css({backgroundImage: 'none', backgroundColor: color}); // Shift

		// Animation
		var animation = {backgroundColor: oldColor };
		if (mode == "hide") animation['opacity'] = 0;

		// Animate
		el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
			if(mode == "hide") el.hide();
			$.effects.restore(el, props);
		if (mode == "show" && $.browser.msie) this.style.removeAttribute('filter');
			if(o.callback) o.callback.apply(this, arguments);
			el.dequeue();
		}});

	});

};

})(jQuery);
/*
 * jQuery UI Effects Pulsate 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Pulsate
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.pulsate = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this);

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
		var times = o.options.times || 5; // Default # of times
		var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;

		// Adjust
		if (mode == 'hide') times--;
		if (el.is(':hidden')) { // Show fadeIn
			el.css('opacity', 0);
			el.show(); // Show
			el.animate({opacity: 1}, duration, o.options.easing);
			times = times-2;
		}

		// Animate
		for (var i = 0; i < times; i++) { // Pulsate
			el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
		};
		if (mode == 'hide') { // Last Pulse
			el.animate({opacity: 0}, duration, o.options.easing, function(){
				el.hide(); // Hide
				if(o.callback) o.callback.apply(this, arguments); // Callback
			});
		} else {
			el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
				if(o.callback) o.callback.apply(this, arguments); // Callback
			});
		};
		el.queue('fx', function() { el.dequeue(); });
		el.dequeue();
	});

};

})(jQuery);
/*
 * jQuery UI Effects Scale 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Scale
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.puff = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this);

		// Set options
		var options = $.extend(true, {}, o.options);
		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
		var percent = parseInt(o.options.percent,10) || 150; // Set default puff percent
		options.fade = true; // It's not a puff if it doesn't fade! :)
		var original = {height: el.height(), width: el.width()}; // Save original

		// Adjust
		var factor = percent / 100;
		el.from = (mode == 'hide') ? original : {height: original.height * factor, width: original.width * factor};

		// Animation
		options.from = el.from;
		options.percent = (mode == 'hide') ? percent : 100;
		options.mode = mode;

		// Animate
		el.effect('scale', options, o.duration, o.callback);
		el.dequeue();
	});

};

$.effects.scale = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this);

		// Set options
		var options = $.extend(true, {}, o.options);
		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
		var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
		var direction = o.options.direction || 'both'; // Set default axis
		var origin = o.options.origin; // The origin of the scaling
		if (mode != 'effect') { // Set default origin and restore for show/hide
			options.origin = origin || ['middle','center'];
			options.restore = true;
		}
		var original = {height: el.height(), width: el.width()}; // Save original
		el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state

		// Adjust
		var factor = { // Set scaling factor
			y: direction != 'horizontal' ? (percent / 100) : 1,
			x: direction != 'vertical' ? (percent / 100) : 1
		};
		el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state

		if (o.options.fade) { // Fade option to support puff
			if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
			if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
		};

		// Animation
		options.from = el.from; options.to = el.to; options.mode = mode;

		// Animate
		el.effect('size', options, o.duration, o.callback);
		el.dequeue();
	});

};

$.effects.size = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
		var props1 = ['position','top','left','overflow','opacity']; // Always restore
		var props2 = ['width','height','overflow']; // Copy for children
		var cProps = ['fontSize'];
		var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
		var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
		var restore = o.options.restore || false; // Default restore
		var scale = o.options.scale || 'both'; // Default scale mode
		var origin = o.options.origin; // The origin of the sizing
		var original = {height: el.height(), width: el.width()}; // Save original
		el.from = o.options.from || original; // Default from state
		el.to = o.options.to || original; // Default to state
		// Adjust
		if (origin) { // Calculate baseline shifts
			var baseline = $.effects.getBaseline(origin, original);
			el.from.top = (original.height - el.from.height) * baseline.y;
			el.from.left = (original.width - el.from.width) * baseline.x;
			el.to.top = (original.height - el.to.height) * baseline.y;
			el.to.left = (original.width - el.to.width) * baseline.x;
		};
		var factor = { // Set scaling factor
			from: {y: el.from.height / original.height, x: el.from.width / original.width},
			to: {y: el.to.height / original.height, x: el.to.width / original.width}
		};
		if (scale == 'box' || scale == 'both') { // Scale the css box
			if (factor.from.y != factor.to.y) { // Vertical props scaling
				props = props.concat(vProps);
				el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
				el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
			};
			if (factor.from.x != factor.to.x) { // Horizontal props scaling
				props = props.concat(hProps);
				el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
				el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
			};
		};
		if (scale == 'content' || scale == 'both') { // Scale the content
			if (factor.from.y != factor.to.y) { // Vertical props scaling
				props = props.concat(cProps);
				el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
				el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
			};
		};
		$.effects.save(el, restore ? props : props1); el.show(); // Save & Show
		$.effects.createWrapper(el); // Create Wrapper
		el.css('overflow','hidden').css(el.from); // Shift

		// Animate
		if (scale == 'content' || scale == 'both') { // Scale the children
			vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
			hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
			props2 = props.concat(vProps).concat(hProps); // Concat
			el.find("*[width]").each(function(){
				child = $(this);
				if (restore) $.effects.save(child, props2);
				var c_original = {height: child.height(), width: child.width()}; // Save original
				child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
				child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
				if (factor.from.y != factor.to.y) { // Vertical props scaling
					child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
					child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
				};
				if (factor.from.x != factor.to.x) { // Horizontal props scaling
					child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
					child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
				};
				child.css(child.from); // Shift children
				child.animate(child.to, o.duration, o.options.easing, function(){
					if (restore) $.effects.restore(child, props2); // Restore children
				}); // Animate children
			});
		};

		// Animate
		el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
			if(mode == 'hide') el.hide(); // Hide
			$.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
			if(o.callback) o.callback.apply(this, arguments); // Callback
			el.dequeue();
		}});

	});

};

})(jQuery);
/*
 * jQuery UI Effects Shake 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Shake
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.shake = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
		var direction = o.options.direction || 'left'; // Default direction
		var distance = o.options.distance || 20; // Default distance
		var times = o.options.times || 3; // Default # of times
		var speed = o.duration || o.options.duration || 140; // Default speed per shake

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		$.effects.createWrapper(el); // Create Wrapper
		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';

		// Animation
		var animation = {}, animation1 = {}, animation2 = {};
		animation[ref] = (motion == 'pos' ? '-=' : '+=')  + distance;
		animation1[ref] = (motion == 'pos' ? '+=' : '-=')  + distance * 2;
		animation2[ref] = (motion == 'pos' ? '-=' : '+=')  + distance * 2;

		// Animate
		el.animate(animation, speed, o.options.easing);
		for (var i = 1; i < times; i++) { // Shakes
			el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
		};
		el.animate(animation1, speed, o.options.easing).
		animate(animation, speed / 2, o.options.easing, function(){ // Last shake
			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
			if(o.callback) o.callback.apply(this, arguments); // Callback
		});
		el.queue('fx', function() { el.dequeue(); });
		el.dequeue();
	});

};

})(jQuery);
/*
 * jQuery UI Effects Slide 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Slide
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.slide = function(o) {

	return this.queue(function() {

		// Create element
		var el = $(this), props = ['position','top','left'];

		// Set options
		var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
		var direction = o.options.direction || 'left'; // Default Direction

		// Adjust
		$.effects.save(el, props); el.show(); // Save & Show
		$.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
		if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift

		// Animation
		var animation = {};
		animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;

		// Animate
		el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
			if(mode == 'hide') el.hide(); // Hide
			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
			if(o.callback) o.callback.apply(this, arguments); // Callback
			el.dequeue();
		}});

	});

};

})(jQuery);
/*
 * jQuery UI Effects Transfer 1.7.2
 *
 * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
 * Dual licensed under the MIT (MIT-LICENSE.txt)
 * and GPL (GPL-LICENSE.txt) licenses.
 *
 * http://docs.jquery.com/UI/Effects/Transfer
 *
 * Depends:
 *	effects.core.js
 */
(function($) {

$.effects.transfer = function(o) {
	return this.queue(function() {
		var elem = $(this),
			target = $(o.options.to),
			endPosition = target.offset(),
			animation = {
				top: endPosition.top,
				left: endPosition.left,
				height: target.innerHeight(),
				width: target.innerWidth()
			},
			startPosition = elem.offset(),
			transfer = $('<div class="ui-effects-transfer"></div>')
				.appendTo(document.body)
				.addClass(o.options.className)
				.css({
					top: startPosition.top,
					left: startPosition.left,
					height: elem.innerHeight(),
					width: elem.innerWidth(),
					position: 'absolute'
				})
				.animate(animation, o.duration, o.options.easing, function() {
					transfer.remove();
					(o.callback && o.callback.apply(elem[0], arguments));
					elem.dequeue();
				});
	});
};

})(jQuery);


/* jquery/jquery.easyslider.js */

/*
 * 	Easy Slider 1.5 - jQuery plugin
 *	written by Alen Grakalic	
 *	http://cssglobe.com/post/4004/easy-slider-15-the-easiest-jquery-plugin-for-sliding
 *
 *	Copyright (c) 2009 Alen Grakalic (http://cssglobe.com)
 *	Dual licensed under the MIT (MIT-LICENSE.txt)
 *	and GPL (GPL-LICENSE.txt) licenses.
 *
 *	Built for jQuery library
 *	http://jquery.com
 *
 */
 
/*
 *	markup example for $("#slider").easySlider();
 *	
 * 	<div id="slider">
 *		<ul>
 *			<li><img src="images/01.jpg" alt="" /></li>
 *			<li><img src="images/02.jpg" alt="" /></li>
 *			<li><img src="images/03.jpg" alt="" /></li>
 *			<li><img src="images/04.jpg" alt="" /></li>
 *			<li><img src="images/05.jpg" alt="" /></li>
 *		</ul>
 *	</div>
 *
 */

(function($) {

	$.fn.easySlider = function(options){
	  
		// default configuration properties
		var defaults = {			
			prevId: 		'prevBtn',
			prevText: 		'Previous',
			nextId: 		'nextBtn',	
			nextText: 		'Next',
			controlsShow:	true,
			controlsBefore:	'',
			controlsAfter:	'',	
			controlsFade:	true,
			firstId: 		'firstBtn',
			firstText: 		'First',
			firstShow:		false,
			lastId: 		'lastBtn',	
			lastText: 		'Last',
			lastShow:		false,				
			vertical:		false,
			speed: 			800,
			auto:			false,
			pause:			2000,
			continuous:		false
		}; 
		
		var options = $.extend(defaults, options);  
				
		this.each(function() {  
			var obj = $(this); 				
			var s = $("li", obj).length;
			var w = $("li", obj).width(); 
			var h = $("li", obj).height(); 
			obj.width(w); 
			obj.height(h); 
			obj.css("overflow","hidden");
			var ts = s-1;
			var t = 0;
			$("ul", obj).css('width',s*w);			
			if(!options.vertical) $("li", obj).css('float','left');
			
			if(options.controlsShow){
				var html = options.controlsBefore;
				if(options.firstShow) html += '<span id="'+ options.firstId +'"><a href=\"javascript:void(0);\">'+ options.firstText +'</a></span>';
				html += ' <span id="'+ options.prevId +'"><a href=\"javascript:void(0);\">'+ options.prevText +'</a></span>';
				html += ' <span id="'+ options.nextId +'"><a href=\"javascript:void(0);\">'+ options.nextText +'</a></span>';
				if(options.lastShow) html += ' <span id="'+ options.lastId +'"><a href=\"javascript:void(0);\">'+ options.lastText +'</a></span>';
				html += options.controlsAfter;						
				$(obj).after(html);										
			};
	
			$("a","#"+options.nextId).click(function(){		
				animate("next",true);
			});
			$("a","#"+options.prevId).click(function(){		
				animate("prev",true);				
			});	
			$("a","#"+options.firstId).click(function(){		
				animate("first",true);
			});				
			$("a","#"+options.lastId).click(function(){		
				animate("last",true);				
			});		
			
			function animate(dir,clicked){
				var ot = t;				
				switch(dir){
					case "next":
						t = (ot>=ts) ? (options.continuous ? 0 : ts) : t+1;						
						break; 
					case "prev":
						t = (t<=0) ? (options.continuous ? ts : 0) : t-1;
						break; 
					case "first":
						t = 0;
						break; 
					case "last":
						t = ts;
						break; 
					default:
						break; 
				};	
				
				var diff = Math.abs(ot-t);
				var speed = diff*options.speed;						
				if(!options.vertical) {
					p = (t*w*-1);
					$("ul",obj).animate(
						{ marginLeft: p }, 
						speed
					);				
				} else {
					p = (t*h*-1);
					$("ul",obj).animate(
						{ marginTop: p }, 
						speed
					);					
				};
				
				if(!options.continuous && options.controlsFade){					
					if(t==ts){
						$("a","#"+options.nextId).hide();
						$("a","#"+options.lastId).hide();
					} else {
						$("a","#"+options.nextId).show();
						$("a","#"+options.lastId).show();					
					};
					if(t==0){
						$("a","#"+options.prevId).hide();
						$("a","#"+options.firstId).hide();
					} else {
						$("a","#"+options.prevId).show();
						$("a","#"+options.firstId).show();
					};					
				};				
				
				if(clicked) clearTimeout(timeout);
				if(options.auto && dir=="next" && !clicked){;
					timeout = setTimeout(function(){
						animate("next",false);
					},diff*options.speed+options.pause);
				};
				
			};
			// init
			var timeout;
			if(options.auto){;
				timeout = setTimeout(function(){
					animate("next",false);
				},options.pause);
			};		
		
			if(!options.continuous && options.controlsFade){					
				$("a","#"+options.prevId).hide();
				$("a","#"+options.firstId).hide();				
			};				
			
		});
	  
	};

})(jQuery);


/* jquery/jquery.listOrderChangerPanel.js */

/*
 * 	listOrderChangerPanel - jQuery plugin (AVL)
 *
 *	Built for jQuery library
 *	http://jquery.com
 *
 */
 
/*
 *	markup example for $("#listOrderChangerPanel").listOrderChangerPanel();
 *	
 * 	<div id="listOrderChangerPanel">
 * 		<span id="priorityDisplay"></span>
 * 		<a href="javascript:void(0);" id="increasePriority">▲</a><a href="javascript:void(0);" id="decreasePriority">▼</a>
 * 	</div>
 *
 */

(function($) {

	$.fn.listOrderChangerPanel = function(options){
	  
		// default configuration properties
		var defaults = {
			formName:			'',
			selectName:			'',
			priorityDisplay:	'priorityDisplay',
			changeStatusField:	'',
			up:					'increasePriority',
			down:				'decreasePriority',
			first:				1
		}; 
		
		var options = $.extend(defaults, options);  
				
		this.each(function(){  
			var obj = $(this);
			$("#"+options.up+","+"#"+options.down, obj)
			.mouseup(function(){
				if(parseInt(options.first) == "NaN"){alert("Error: listOrderChangerPanel: argument 'first' must be of type integer");return false;}
				var f = options.formName == "" ? $("form") : $("form[name='"+options.formName+"']");
				var s = options.selectName == "" ? $("select:eq(0)", f) : $("select[name='"+options.selectName+"']", f);
				var si = $(s).attr("selectedIndex");
				if(typeof(f) != "object"){alert("Error: listOrderChangerPanel: Formular nicht gefunden.");return false;}
				if(typeof(s) != "object"){alert("Error: listOrderChangerPanel: Select-Element nicht gefunden.");return false;}
				var optionsLen = $("option", s).length;
				if($(this).attr("id") == options.up)
				{
					if(si >= options.first)
					{
						$(":selected", s).insertBefore($(":selected", s).prev());
						si--;
					}
				}
				else
				{
					if(si+1 >= options.first)
					{
						$(":selected", s).insertAfter($(":selected", s).next());
						if(si < optionsLen-1) si++;
					}
				}
				$(s).attr("selectedIndex", si);
				if(options.priorityDisplay != "")
				{
					var pd = $("#"+options.priorityDisplay);
					if(typeof(pd) == "object" && si+1 >= options.first)
						$(pd).stop(true,true).fadeIn("slow").html(si+1-options.first+1).fadeOut("slow");
				}
				if(options.changeStatusField != "")
				{
					var changeStatusField = $("#"+options.changeStatusField);
					if(typeof(changeStatusField) == "object") $(changeStatusField).val(1);
					else {alert("Error: listOrderChangerPanel: Select-Element nicht gefunden.");return false;}
				}
			});
		});
	  
	};

})(jQuery);



/* jquery/jquery.customButtons.js */


/**
 * customButton - jQuery plugin (AVL)
 * 
 * Built for jQuery library
 *	http://jquery.com
 * 
 */

// REQUIRED CSS:

//#content a.button:link,
//#content a.button:visited,
//#content a.button:hover,
//#content a.button:active
//{
//	text-decoration: none !important;
//	white-space: nowrap;
//}
//
//#content form span.button
//{
//	white-space: nowrap;
//}
//
//#content a.button span,
//#content form span.button input
//{
//	color: #FFF;
//	background-color: #0088CC;
//	font-weight: bold;
//	font-family: Tahoma;
//	font-size: 10px;
//	padding:2px 3px 3px 3px;
//	background-image: url(../img/b_bg_0088CC_a.gif);
//	background-repeat: repeat-x;
//	background-position: 0px 0px;
//}
//
//#content form span.button input
//{
//	background-color: #FFF;
//	height:18px;
//	padding:0px 1px 2px 1px;
//	background-position: 0px 1px;
//	border: none;
//	cursor: pointer;
//	vertical-align:bottom;
//	/*fix extra padding for ie*/
//	width:auto;
// 	overflow:visible;
//}
//
///*for IE 8*/
//#content form span.button input
//{
//	padding /*\**/: 2px 5px 2px 3px\9
//}
///*for IE 7*/
//*:first-child+html #content form span.button input
//{
//	background-position: 0 0;
//	margin-top: 1px;
//	padding: 0px 5px 2px 3px;
//}
///*for IE 6 - overwrites previous IE 8*/
//* html #content form span.button input
//{
//	background-position: 0 0;
//	margin-top: 1px;
//	padding: 0px 5px 2px 3px;
//}
//
//#content a.button img,
//#content form span.button img
//{
//	border:none;
//	vertical-align:-5px;
//}
//
///*for IE 7*/
//*:first-child+html #content form span.button img
//{
//	margin-top:1px;
//}
///*for IE 6*/
//* html #content form span.button img
//{
//	margin-top:1px;
//}
//
//#content a.buttonLink span,
//#content form span.buttonLink input
//{
//	background-color: #0088CC;
//	background-image: url(../img/b_bg_0088CC_a.gif);
//}
//
//#content form span.buttonLink input
//{
//	background-color: #FFF;
//}
//
//#content a.buttonAction span,
//#content form span.buttonAction input
//{
//	background-color: #0CAF00;
//	background-image: url(../img/b_bg_0CAF00_a.gif);
//}
//
//#content form span.buttonAction input
//{
//	background-color: #FFF;
//}
//
//#content a.buttonActionBg0088CC span,
//#content form span.buttonActionBg0088CC input
//{
//	background-color: #0088CC;
//	background-image: url(../img/b_bg_0CAF00_bg_0088CC_a.gif);
//}
//
//#content form span.buttonActionBg0088CC input
//{
//	background-color: #0088CC;
//}
//
//#content a.buttonCaution span,
//#content form span.buttonCaution input
//{
//	background-color: #D91E36;
//	background-image: url(../img/b_bg_D91E36_a.gif);
//}
//
//#content form span.buttonCaution input
//{
//	background-color: #FFF;
//}
//
//#content a.buttonInactive span,
//#content form span.buttonInactive input
//{
//	background-color: #CCCCCD;
//	background-image: url(../img/b_bg_CCCCCD_a.gif);
//}
//
//#content form span.buttonCaution input
//{
//	background-color: #CCCCCD;
//}


(function($) {

	$.fn.customButtons = function(){
				
		var regExpImgPos = /((^|\/)b_)(bg|rgt|lft)/;
		var regExpImgPosReplaceLft = "$1lft";
		var regExpImgPosReplaceRgt = "$1rgt";
		var regExpCssUrl = /^url\(("?([^"]*)"?|'?([^"]*)'?)\)$/;
		var regExpCssUrlReplace = "$2";
		
		var buttonObj = $("a.button:not(:has(img))");
		var inputButtonObj = $("form span.button:not(:has(img))");
		
		//wrap span around text
		$(buttonObj).wrapInner('<span></span>');
		//add span, lft- and rgt-images
		$(buttonObj).each(function(){
			var imgUrl = $("> span", this).css("background-image").replace(regExpCssUrl, regExpCssUrlReplace);
			$(this).prepend( '<img src="'+imgUrl.replace(regExpImgPos,regExpImgPosReplaceLft)+'" alt="" />');
			$(this).append( '<img src="'+imgUrl.replace(regExpImgPos,regExpImgPosReplaceRgt)+'" alt="" />');
		});
		
		//hover functionality
		var regExpImg = /(a|b)(\.[a-z]{3,4}("|')?\)?)$/i;
		var regExpImgReplaceA = "a$2";
		var regExpImgReplaceB = "b$2";
		
		$(buttonObj)
		.mouseover(function(){
			$("> span", this).css("background-image", $("> span", this).css("background-image").replace(regExpImg, regExpImgReplaceB));
			$("> img:first-child", this).attr("src", $("> img:first-child", this).attr("src").replace(regExpImg, regExpImgReplaceB));
			$("> img:last-child", this).attr("src", $("> img:last-child", this).attr("src").replace(regExpImg, regExpImgReplaceB));
		})
		.mouseout(function(){
			$("> span", this).css("background-image", $("> span", this).css("background-image").replace(regExpImg, regExpImgReplaceA));
			$("> img:first-child", this).attr("src", $("> img:first-child", this).attr("src").replace(regExpImg, regExpImgReplaceA));
			$("> img:last-child", this).attr("src", $("> img:last-child", this).attr("src").replace(regExpImg, regExpImgReplaceA));
		});
		
		//INPUT (button,submit) Elements
		$(inputButtonObj).each(function(){
			var imgUrl = $("> input", this).css("background-image").replace(regExpCssUrl, regExpCssUrlReplace);
			$(this).prepend( '<img src="'+imgUrl.replace(regExpImgPos,regExpImgPosReplaceLft)+'" alt="" />');
			$(this).append( '<img src="'+imgUrl.replace(regExpImgPos,regExpImgPosReplaceRgt)+'" alt="" />');
		});
		
		$(inputButtonObj)
		.mouseover(function(){
			$("> input", this).css("background-image", $("> input", this).css("background-image").replace(regExpImg, regExpImgReplaceB));
			$("> img:first-child", this).attr("src", $("> img:first-child", this).attr("src").replace(regExpImg, regExpImgReplaceB));
			$("> img:last-child", this).attr("src", $("> img:last-child", this).attr("src").replace(regExpImg, regExpImgReplaceB));
		})
		.mouseout(function(){
			$("> input", this).css("background-image", $("> input", this).css("background-image").replace(regExpImg, regExpImgReplaceA));
			$("> img:first-child", this).attr("src", $("> img:first-child", this).attr("src").replace(regExpImg, regExpImgReplaceA));
			$("> img:last-child", this).attr("src", $("> img:last-child", this).attr("src").replace(regExpImg, regExpImgReplaceA));
		});
		
		$("> input", inputButtonObj)
		.focus(function(){
			$(this).blur();
		});
	}
	
})(jQuery);



/* jquery/jquery.truncator.js */

// HTML Truncator for jQuery
// by Henrik Nyh <http://henrik.nyh.se> 2008-02-28.
// Free to modify and redistribute with credit.

(function($) {

  var trailing_whitespace = true;

  $.fn.truncate = function(options) {

    var opts = $.extend({}, $.fn.truncate.defaults, options);
    
    $(this).each(function() {

      var content_length = $.trim(squeeze($(this).text())).length;
      if (content_length <= opts.max_length)
        return;  // bail early if not overlong

      var actual_max_length = opts.max_length - opts.more.length - 4;  // 4 for " ..." and "    "
      var truncated_node = recursivelyTruncate(this, actual_max_length);
      var full_node = $(this).hide();

      truncated_node.insertAfter(full_node);
      
      findNodeForMore(truncated_node).append('... <a href="#show more content" class="arrowLink">'+opts.more+'</a>');
      findNodeForLess(full_node).append('    <a href="#show less content" class="arrowLink">'+opts.less+'</a>');
      
      truncated_node.find('a:last').click(function() {
        truncated_node.hide(); full_node.show(); return false;
      });
      full_node.find('a:last').click(function() {
        truncated_node.show(); full_node.hide(); return false;
      });

    });
  };

  // Note that the " (…more)" bit counts towards the max length – so a max
  // length of 10 would truncate "1234567890" to "12 (…more)".
  $.fn.truncate.defaults = {
    max_length: 100,
    more: '…more',
    less: 'less'
  };

  function recursivelyTruncate(node, max_length) {
    return (node.nodeType == 3) ? truncateText(node, max_length) : truncateNode(node, max_length);
  }

  function truncateNode(node, max_length) {
    var node = $(node);
    var new_node = node.clone().empty();
    var truncatedChild;
    node.contents().each(function() {
      var remaining_length = max_length - new_node.text().length;
      if (remaining_length == 0) return;  // breaks the loop
      truncatedChild = recursivelyTruncate(this, remaining_length);
      if (truncatedChild) new_node.append(truncatedChild);
    });
    return new_node;
  }

  function truncateText(node, max_length) {
    var text = squeeze(node.data);
    if (trailing_whitespace)  // remove initial whitespace if last text
      text = text.replace(/^ /, '');  // node had trailing whitespace.
    trailing_whitespace = !!text.match(/ $/);
    var text = text.slice(0, max_length);
    // Ensure HTML entities are encoded
    // http://debuggable.com/posts/encode-html-entities-with-jquery:480f4dd6-13cc-4ce9-8071-4710cbdd56cb
    text = $('<div/>').text(text).html();
    return text;
  }

  // Collapses a sequence of whitespace into a single space.
  function squeeze(string) {
    return string.replace(/\s+/g, ' ');
  }
  
  // Finds the last, innermost block-level element
  function findNodeForMore(node) {
    var $node = $(node);
    var last_child = $node.children(":last");
    if (!last_child) return node;
    var display = last_child.css('display');
    if (!display || display=='inline') return $node;
    return findNodeForMore(last_child);
  };

  // Finds the last child if it's a p; otherwise the parent
  function findNodeForLess(node) {
    var $node = $(node);
    var last_child = $node.children(":last");
    if (last_child && last_child.is('p')) return last_child;
    return node;
  };

})(jQuery);


/* jquery.custom.forms.js */

/**
 * form related things
 */
 
/**
 * Input Text / textarea mouseover
 */

$(document).ready(function(){
	//switch inputText
	$("input.inputText")
	.focus(function(){
		$(this).addClass("inputTextFocus");
		$(this).removeClass("inputText");
	})
	.blur(function(){
		$(this).addClass("inputText");
		$(this).removeClass("inputTextFocus");
	});
	//switch inputTextarea
	$("textarea.inputTextarea")
	.focus(function(){
		$(this).addClass("inputTextareaFocus");
		$(this).removeClass("inputTextarea");
	})
	.blur(function(){
		$(this).addClass("inputTextarea");
		$(this).removeClass("inputTextareaFocus");
	});
});

/* jquery.custom.hover.js */

/**
 * tooltips
 */
 
 /**
  * change background-color on mouse-over for li elements of class fileList
  * required:
  * + jquery.js
  * + jquery.qtip.js
  */
  
$(document).ready(function(){
	$("ul.fileList li")
	.live('mouseover', function(){
		$(this).css("background-color","#E7F2F8")
			   .css("cursor","pointer");
	})
	.live('mouseout', function(){
		$(this).css("background-color","")
			   .css("cursor","default");
	});
});



/* jquery.custom.tooltips.js */

/**
 * tooltips
 */
 
 /**
  * tooltips (error boxes) for label-tags, if they have a class named 'error'
  * required:
  * + jquery.js
  * + jquery.qtip.js
  */
  
$(document).ready(function(){
$("label[class*='error'][title]")
	.qtip({
		style:
		{
			title:
			{
				'background-color':'#D91E36',
				'color':'white',
				'padding':'2px 2px 2px 10px'
			},
			tip:
			{
				corner: 'rightBottom',
				size:
				{
					x:10,
					y:10
				}
			},
			'color':'#D91E36',
			'background-color':'white',
			border:
			{
			   width: 1,
			   color: '#D91E36'
			}
		},
		position:
		{
			/*target: 'mouse',*/
      		corner: {target: 'rightTop', tooltip: 'rightBottom'},
      		adjust: {x: -10, y: 0}
		},
		show:
		{
			delay:0
		},
		content:
		{
			title:{text:'Fehler'}
		}
	})
	.mouseover(function(){
		$(this).css('cursor', 'help');
	});
});



$(document).ready(function(){

$("ul.fileList li[title], a.tooltip[title]")
.live('mouseover', function()
		{
	$("ul.fileList li[title], a.tooltip[title]").each(function(){
		$(this)
			.qtip({
				style:
				{
					title:
					{
						'background-color':'white',
						'background':'url(../img/b_fragezeichen.gif) no-repeat 2px 2px',
						'color':'#0088CC',
						'padding':'2px 2px 2px 18px',
						'border-bottom':'1px dotted #7F9DB9'
					},
					tip:
					{
						'color':'#0088CC',
						corner: 'bottomLeft',
						size:
						{
							x:10,
							y:10
						}
					},
					'color':'#333333',
					'background-color':'white',
					border:
					{
					   width: 1,
					   color: '#7F9DB9'
					}
				},
				position:
				{
					target: 'mouse',
		      		corner: {target: 'bottomLeft', tooltip: 'bottomLeft'},
		      		adjust: {x: 15, y: 5}
				},
				show:
				{
					delay:0
				},
				content:
				{
					title: $(this).attr('title').split('\n',2)[0],
					text: $(this).attr('title').split('\n',2)[1]
			    }
			})
			.attr("title","");
	});
		});
});



/* jquery.custom.buttons.js */


$(document).ready(function(){
	$.fn.customButtons();
});

/* jquery.custom.slider.js */

/**
 * @require jquery/jquery.easyslider.js
 */
$(document).ready(function(){
	$("#slider").easySlider({
		prevId: 		'prevBtn',
		prevText: 		'',
		nextId: 		'nextBtn',	
		nextText: 		'',
		vertical:		true,
		speed: 			800
	});
});

/* ajax.js */

function Ajax()
{
	
	this.url = "";
	this.params = "";
	this.method = "GET";
	this.onSuccess = null;
	this.onError = function(msg)
	{
		alert(msg);
	}
}

Ajax.prototype.doRequest = function()
{
	if(!this.url)
	{
		this.onError("Es wurde kein URL angegeben. Der Request wird abgebrochen.");
		return false;
	};
	if (!this.method)
	{
		this.method = "GET";
	} 
	else 
	{
		this.method = this.method.toUpperCase();
	}
	
	//XMLHttpRequest-Objekt erstellen
	var xmlHttpRequest=getXMLHttpRequest();
	if(!xmlHttpRequest)
	{
		this.onError("Es konnte kein XMLHttpRequest-Objekt erstellt werden.");
		return false;
	}
	
	//Zugriff auf Klasse fuer readyStateHandler ermoeglichen
	var _this = this;
	
	//Fallunterscheidung nach Uebertragungsmethode
	switch (this.method) 
	{
		case "GET":	xmlHttpRequest.open(this.method, this.url+"?"+this.params, true);
				xmlHttpRequest.onreadystatechange = readyStateHandler;
				xmlHttpRequest.send(null);
		break;
		case "POST": 	xmlHttpRequest.open(this.method, this.url, true);
				xmlHttpRequest.onreadystatechange = readyStateHandler;
				xmlHttpRequest.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded');
		xmlHttpRequest.send(this.params);
		break;
	}

	//Private Methode zur Verarbeitung der erhaltenen Daten
	function readyStateHandler()
	{
		if (xmlHttpRequest.readyState < 4)
		{
			return false;
		}
		if (xmlHttpRequest.status == 200 || xmlHttpRequest.status == 304)
		{
			if (_this.onSuccess)
			{
				_this.onSuccess(xmlHttpRequest.responseText, xmlHttpRequest.responseXML);
			}
		} 
		else
		{
			if (_this.onError)
			{
				_this.onError("["+xmlHttpRequest.status+" "+xmlHttpRequest.statusText+"] Es trat ein Fehler bei der Datenuebertragung auf.");
			}
		}
	}
}

//Gibt browserunabhaengig ein XMLHttpRequest-Objekt zurueck
function getXMLHttpRequest()
{
	if (window.XMLHttpRequest)
	{
		//XMLHttpRequest fuer Firefox, Opera, Safari, ...
		return new XMLHttpRequest();
	} 
	else if(window.ActiveXObject)
	{
		try
		{
			//XMLHTTP (neu) fuer Internet Explorer
			return new ActiveXObject("Msxml2.XMLHTTP");
		} 
		catch(e)
		{
			try
			{	//XMLHTTP (alt) fuer Internet Explorer
				return new ActiveXObject("Microsoft.XMLHTTP");
			}
			catch (e)
			{
				return null;
			}
		}
	}
	return null;
}

/**
 * For executing js scripts in an ajax response
 */ 
function launchJavascript(responseText) {
	var ScriptFragment = '(?:<script.*?>)((\n|.)*?)(?:</script>)';
	var match    = new RegExp(ScriptFragment, 'img');
	var scripts  = responseText.match(match);
	if(scripts)
	{
		var js = '';
		for(var s = 0; s < scripts.length; s++)
		{
			var match = new RegExp(ScriptFragment, 'im');
			js += scripts[s].match(match)[1];
		}
	//uncomment for debug purposes
	//window.alert(js);
	eval(js);
	}
}

/* blur_links.js */

/*function BlurLinks()
{
	// Text- u. Grafik-Links
	links=document.getElementsByTagName('a');
	for(i=0;i<links.length;i++)
	{
		links[i].onfocus=new Function("this.blur();");
	}
	// ImageMaps
	links=document.getElementsByTagName('area');
	for(i=0;i<links.length;i++)
	{
		links[i].onfocus=new Function("this.blur();");
	}

	// Klick-Buttons
	links=document.getElementsByName('Verweis');
	for(i=0;i<links.length;i++)
	{
		links[i].onfocus=new Function("this.blur();");
	}
}*/
$(document).ready(function(){
	$("a,area").focus(function(e){
		$(this).blur();
		});
});
//onload=BlurLinks;

/* calculator.js */

/***calculator functions***/

/***MAIN***************************************************************************************************************************/

var isNN = (navigator.appName.indexOf("Netscape")!=-1);
function autoTab(input,len, e) {
	var keyCode = (isNN) ? e.which : e.keyCode; 
	var filter = (isNN) ? [0,8,9] : [0,8,9,16,17,18,37,38,39,40,46];
	if(input.value.length >= len && !containsElement(filter,keyCode)) {
		input.value = input.value.slice(0, len);
		input.form[(getIndex(input)+1) % input.form.length].focus();
	}
	function containsElement(arr, ele) {
		var found = false, index = 0;
		while(!found && index < arr.length)
			if(arr[index] == ele)
			found = true;
			else
			index++;
		return found;
	}
	function getIndex(input) {
		var index = -1, i = 0, found = false;
		while (i < input.form.length && index == -1)
			if (input.form[i] == input)index = i;
			else i++;
		return index;
	}
return true;
}

/***DHTML***************************************************************************************************************************/


var DHTML = 0, DOM = 0, MS = 0, NS = 0, OP = 0;

function DHTML_init() {

 if (window.opera) {
     OP = 1;
 }
 if(document.getElementById) {
   DHTML = 1;
   DOM = 1;
 }
 if(document.all && !OP) {
   DHTML = 1;
   MS = 1;
 }
if (window.netscape && window.screen && !DOM && !OP){
   DHTML = 1;
   NS = 1;
 }
}

function getElem(p1,p2,p3) {
 var Elem;
 if(DOM) {
   if(p1.toLowerCase()=="id") {
     if (typeof document.getElementById(p2) == "object")
     Elem = document.getElementById(p2);
     else Elem = void(0);
     return(Elem);
   }
   else if(p1.toLowerCase()=="name") {
     if (typeof document.getElementsByName(p2) == "object")
     Elem = document.getElementsByName(p2)[p3];
     else Elem = void(0);
     return(Elem);
   }
   else if(p1.toLowerCase()=="tagname") {
     if (typeof document.getElementsByTagName(p2) == "object" ||
        (OP && typeof document.getElementsByTagName(p2) == "function"))
     Elem = document.getElementsByTagName(p2)[p3];
     else Elem = void(0);
     return(Elem);
   }
   else return void(0);
 }
 else if(MS) {
   if(p1.toLowerCase()=="id") {
     if (typeof document.all[p2] == "object")
     Elem = document.all[p2];
     else Elem = void(0);
     return(Elem);
   }
   else if(p1.toLowerCase()=="tagname") {
     if (typeof document.all.tags(p2) == "object")
     Elem = document.all.tags(p2)[p3];
     else Elem = void(0);
     return(Elem);
   }
   else if(p1.toLowerCase()=="name") {
     if (typeof document[p2] == "object")
     Elem = document[p2];
     else Elem = void(0);
     return(Elem);
   }
   else return void(0);
 }
 else if(NS) {
   if(p1.toLowerCase()=="id" || p1.toLowerCase()=="name") {
   if (typeof document[p2] == "object")
     Elem = document[p2];
     else Elem = void(0);
     return(Elem);
   }
   else if(p1.toLowerCase()=="index") {
    if (typeof document.layers[p2] == "object")
     Elem = document.layers[p2];
    else Elem = void(0);
     return(Elem);
   }
   else return void(0);
 }
}

function getCont(p1,p2,p3) {
   var Cont;
   if(DOM && getElem(p1,p2,p3) && getElem(p1,p2,p3).firstChild) {
     if(getElem(p1,p2,p3).firstChild.nodeType == 3)
       Cont = getElem(p1,p2,p3).firstChild.nodeValue;
     else
       Cont = "";
     return(Cont);
   }
   else if(MS && getElem(p1,p2,p3)) {
     Cont = getElem(p1,p2,p3).innerText;
     return(Cont);
   }
   else return void(0);
}

function getAttr(p1,p2,p3,p4) {
   var Attr;
   if((DOM || MS) && getElem(p1,p2,p3)) {
     Attr = getElem(p1,p2,p3).getAttribute(p4);
     return(Attr);
   }
   else if (NS && getElem(p1,p2)) {
       if (typeof getElem(p1,p2)[p3] == "object")
        Attr=getElem(p1,p2)[p3][p4]
       else
        Attr=getElem(p1,p2)[p4]
         return Attr;
       }
   else return void(0);
}

function setCont(p1,p2,p3,p4) {
   if(DOM && getElem(p1,p2,p3) && getElem(p1,p2,p3).firstChild)
     getElem(p1,p2,p3).firstChild.nodeValue = p4;
   else if(MS && getElem(p1,p2,p3))
     getElem(p1,p2,p3).innerText = p4;
   else if(NS && getElem(p1,p2,p3)) {
     getElem(p1,p2,p3).document.open();
     getElem(p1,p2,p3).document.write(p4);
     getElem(p1,p2,p3).document.close();
   }
}

DHTML_init();




/***für alle rechner***************************************************************************************************************************/

ns4 = (document.layers)? true:false;
ie4 = (document.all)? true:false;

function selectStart()
{
	return false;
}


/***52100 Einmalanlage bei angenommener Wertentwicklung [Einmalanlage]***************************************************************************************************************************/


function rechne_einmalanlage(myform) {
	var Aufschlag = myform.Aufschlag.options[myform.Aufschlag.selectedIndex].value
	var Betrag = parseFloat (myform.Anlagebetrag.value)
	var Einmalanlage = parseFloat (myform.Anlagebetrag.value /(1+(Aufschlag/100)))
	var Start = parseInt(myform.JahrAnlageBeginn.value);
	var Ende = parseInt(myform.JahrAnlageEnde.value);
	var JahreInMonaten = ((Ende-Start)-1)*12;
	var Jahre = (Ende-Start)+1;
	var Depotkosten = Jahre * 17.25;
	
	var MStart = parseInt(13-myform.MonatAnlageBeginn.value);
	var MEnde = parseInt(myform.MonatAnlageEnde.value);
	
	var Monate = JahreInMonaten+MStart+MEnde;

	var Wertentwicklung = (parseFloat(myform.Wertentwicklung.value)-parseFloat(myform.Inflation.options[myform.Inflation.selectedIndex].value))/100;

	var Ergebnis = (Einmalanlage) * Math.pow ((1 + Wertentwicklung),(Monate/12));	
	var Ergebnis = Math.round(Ergebnis);
	
	myform.Ergebnis.value = formatStr(Ergebnis) + ',-';
}

function getFormVals_einmalanlage(form,count) { if (isFormValid_einmalanlage(form,count)){ return true } 
else{ return false } } 

function isFormValid_einmalanlage(myform,count)
{
	for (var i=0;i< count;i++)
	{
		if((myform[i].name != 'fonds')&&(myform[i].name != 'action')&&(myform[i].name != 'minmonat')&&(myform[i].name != 'minjahr')&&(myform[i].name != 'einzminmonat')&&(myform[i].name != 'einzminjahr')&&(myform[i].name != 'maxmonat')&&(myform[i].name != 'maxjahr'))
		{ 
			if((myform[i].value.charAt(0)==0)||(myform[i].value ==''))
			{ 
				if (myform[i].name == 'Anlagebetrag') alert('Bitte geben Sie einen Anlagebetrag ein!');
				if (myform[i].name == 'monatlAusz') alert('Bitte geben Sie einen Auszahlungsbetrag ein!');
				if (myform[i].name == 'Wertentwicklung') alert('Bitte geben Sie eine angenommene Wertentwicklung an!');
				if (myform[i].name == 'JahrAnlageEnde') alert('Bitte geben Sie ein Jahr für das Anlageende ein!');
				if (myform[i].name == 'JahrAnlageBeginn') alert('Bitte geben Sie ein Jahr für den Anlagebeginn ein!'); 
				if (myform[i].name == 'MonatAnlageBeginn') alert('Bitte geben Sie einen Monat für den Anlagebeginn ein!');
				if (myform[i].name == 'MonatAnlageEnde') alert('Bitte geben Sie einen Monat für das Anlageende ein!');
				myform[i].focus();
				myform[i].select();
				return false;
			}
		}
	}
	if (myform.JahrAnlageEnde!=null)
	{
		var JahrAnlageEnde = parseInt(myform.JahrAnlageEnde.value);
		var JahrAnlageBeginn = parseInt(myform.JahrAnlageBeginn.value);
		var MonatAnlageBeginn = parseInt(myform.MonatAnlageBeginn.value);
		var MonatAnlageEnde = parseInt(myform.MonatAnlageEnde.value);
	} 
	else if(myform.maxjahr!=null)
	{
		var JahrAnlageEnde = parseInt(myform.maxjahr.options[myform.maxjahr.selectedIndex].text);
		var JahrAnlageBeginn = parseInt(myform.minjahr.options[myform.minjahr.selectedIndex].text);
		var MonatAnlageBeginn = parseInt(myform.minmonat.options[myform.minmonat.selectedIndex].text);
		var MonatAnlageEnde = parseInt(myform.maxmonat.options[myform.maxmonat.selectedIndex].text);
	}
	else
	{ 
		return true;
	}
	if(JahrAnlageEnde < JahrAnlageBeginn)
	{
		alert('Bitte wählen Sie mindestens einen Anlagezeitraum von einem Jahr');
		return false;
	} 
	if(JahrAnlageEnde-JahrAnlageBeginn >= 2)
	{
		return true;
	}
	else
	{
		if(JahrAnlageEnde == JahrAnlageBeginn && MonatAnlageEnde - MonatAnlageBeginn < 11)
		{
			alert('Bitte wählen Sie mindestens einen Anlagezeitraum von einem Jahr1');
			return false;
		}
		else if((JahrAnlageEnde - JahrAnlageBeginn == 1) && (MonatAnlageEnde - MonatAnlageBeginn > -2))
		{
			return true;
		}
		else if(MonatAnlageEnde - MonatAnlageBeginn <= -2)
		{
			alert('Bitte wählen Sie mindestens einen Anlagezeitraum von einem Jahr');
			return true;
		} 
		else
		{
			return true;
		}
	}
} 


var ergebnisswitch= 2;

function calc_einmalanlage(form_name) {
    if (document.layers) {
        if (getFormVals_einmalanlage(document.Rechnerform.document.forms[form_name],6)) {
            rechne_einmalanlage(document.Rechnerform.document.forms[form_name])
        }
    } else {
        if (getFormVals_einmalanlage(document.forms[form_name],6)) {
            rechne_einmalanlage(document.forms[form_name])
        }
    }
}

function resetForm(form_name) {
    if (document.layers) {
        document.Rechnerform.document.forms[form_name].reset()
    } else {
        document.forms[form_name].reset()
    }
}
	
/***52300 Auszahlplan mit Kapitalverzehr bei angenommener Wertentwicklung [Auszahlplan mit Kapitalverzehr]***************************************************************************************************************************/

function formatStr_auszahlplan(Ergebnis){
var Erg = Ergebnis.toString();
	var	fErgebnis = "";
	var x = Erg.length;
		
	for(var i=0;i<x;i++){
		var Stelle = (x-(i+1));
			if((Stelle % 3 == 0)&&(Stelle!=0)){
				if(Erg.charAt(0)== '-' && i == 0)
				{
				fErgebnis = '-' + fErgebnis;
				}
				else
				{
				fErgebnis += Erg.charAt(i) + '.'
				}
				}
			else {
				fErgebnis += Erg.charAt(i);
			}
	}
	return fErgebnis;
}

function rechne_auszahlplan_mit_kapitalverzehr(myform) {
	var Anlagebetrag = parseFloat(myform.Anlagebetrag.value);
	
	var Start = parseInt(myform.JahrAnlageBeginn.value);
	var Ende = parseInt(myform.JahrAnlageEnde.value);
	var JahreInMonaten = ((Ende-Start)-1)*12;
	var Jahre = (Ende-Start)+1;
	var MStart = parseInt(13-myform.MonatAnlageBeginn.value);
	var MEnde = parseInt(myform.MonatAnlageEnde.value);
	var Monate = parseInt(JahreInMonaten+MStart+MEnde);
	var Summe = Monate;

	var Wertentwicklung = (parseFloat(myform.Wertentwicklung.value)/100);

	if(Wertentwicklung == 0) {
		var Ergebnis = Anlagebetrag/Monate;
		Ergebnis = Math.round(Ergebnis);
		myform.mtlAusZ.value = formatStr_auszahlplan(Ergebnis) + ',-';
	}
	else
	{

	var Ergebnis =   (Wertentwicklung * Math.pow ((1+Wertentwicklung),(Monate/12)) *
			  		Anlagebetrag) /
			      	((Math.pow ((1+Wertentwicklung),(Monate/12))-1) * 
			       	(12 + 5.5 * Wertentwicklung));

	var Ergebnis = Math.round(Ergebnis);
	
	myform.mtlAusZ.value = formatStr_auszahlplan(Ergebnis) + ',-';
	}
}

function calc_auszahlplan_mit_kapitalverzehr(form_name) {
    if (document.layers) {
        if (getFormVals(document.Rechnerform.document.forms[form_name],6)) {
            rechne_auszahlplan_mit_kapitalverzehr(document.Rechnerform.document.forms[form_name])
        }
    } else {
        if (getFormVals(document.forms[form_name],6)) {
            rechne_auszahlplan_mit_kapitalverzehr(document.forms[form_name])
        }
    }
}

/***52300 Auszahlplan mit Kapitalerhalt bei angenommener Wertentwicklung [Auszahlplan mit Kapitalerhalt]***************************************************************************************************************************/

function rechne_auszahlplan_mit_kapitalerhalt(myform) {

	var Anlagebetrag = parseFloat(myform.Anlagebetrag.value);
	var Wertentwicklung = (parseFloat(myform.Wertentwicklung.value)/100);

	if(Wertentwicklung == 0) {
		myform.mtlAusZ.value = "0,-";
	}
	else
	{
	var Ergebnis =  (Anlagebetrag * Wertentwicklung)/12;
	var Ergebnis = Math.round(Ergebnis);
	
	myform.mtlAusZ.value = formatStr_auszahlplan(Ergebnis) + ',-';
	}
}
		
function calc_auszahlplan_mit_kapitalerhalt(form_name) {
    if (document.layers) { 
        if (getFormVals(document.Rechnerform.document.forms[form_name],2)) {
            rechne_auszahlplan_mit_kapitalerhalt(document.Rechnerform.document.forms[form_name])
        }
    } else {
        if (getFormVals(document.forms[form_name],2)) {
            rechne_auszahlplan_mit_kapitalerhalt(document.forms[form_name])
        }
    }
}


/***52200 Sparplan bei angenommener Wertentwicklung [Sparplan]***************************************************************************************************************************/

function rechne_sparplan(myform) {
	var Aufschlag = myform.Aufschlag.options[myform.Aufschlag.selectedIndex].value
	
	var mtlEinzOhneAuf = parseFloat(myform.Anlagebetrag.value);
	var mtlEinz =  parseFloat (myform.Anlagebetrag.value /(1+(Aufschlag/100)));
	var Start = parseInt(myform.JahrAnlageBeginn.value);
	var Ende = parseInt(myform.JahrAnlageEnde.value);
	var JahreInMonaten = ((Ende-Start)-1)*12;
	
	var Jahre = (Ende-Start)+1;
	var Depotkosten = (Jahre * 17.25)/12;
	
	var MStart = parseInt(13-myform.MonatAnlageBeginn.value);
	var MEnde = parseInt(myform.MonatAnlageEnde.value);

	var Monate = JahreInMonaten+MStart+MEnde;

	var Summe = Monate*mtlEinzOhneAuf;
	var Wertentwicklung = (parseFloat(myform.Wertentwicklung.value)-parseFloat(myform.Inflation.options[myform.Inflation.selectedIndex].value))/100;
	
	if(Wertentwicklung == 0) {
		Wertentwicklung = 0.00000001
	}
	
	var Ergebnis = (mtlEinz) *
					 (12 + 6.5 * Wertentwicklung) *
					 (
					 	(1-Math.pow (
					 		(1/(1+Wertentwicklung)),((Monate/12)+1))
						) 
						
						/
					 	
						(1-(1/(1+Wertentwicklung))) -1
					) *
					Math.pow ((1+Wertentwicklung),Monate/12);
					
	var Ergebnis = Math.round(Ergebnis);
	myform.Ergebnis.value = formatStr(Ergebnis) + ',-';
	myform.Summe.value = formatStr(Summe) + ',-';
}

function calc_sparplan(form_name) {
    if (document.layers) {
        if (getFormVals(document.Rechnerform.document.forms[form_name],6)) {
            rechne_sparplan(document.Rechnerform.document.forms[form_name])
        }
    } else {
        if (getFormVals(document.forms[form_name],6)) {
            rechne_sparplan(document.forms[form_name])
        }
    }
}

/***VALIDATION***************************************************************************************************************************/


function formatStr(Ergebnis){
var Erg = Ergebnis.toString();
	var	fErgebnis = "";
	var x = Erg.length;
		
	for(var i=0;i<x;i++){
		var Stelle = (x-(i+1));
			if((Stelle % 3 == 0)&&(Stelle!=0)){
				fErgebnis += Erg.charAt(i) + '.'
				}
			else {
				fErgebnis += Erg.charAt(i);
			}
	}
	return fErgebnis;
}

function checkKey(evt,field) {

   var theKey;
   if(!evt) evt = window.event;
   theKey = evt.keyCode || evt.which;
   if (theKey == 8) //backspace
	   return true;
   else if(theKey == 46) //delete
   {
	   field.value = field.value.substr(0,field.value.length == 0 ? 0 : field.value.length-1);
	   return true;
   }
   else
   {   //ersetze selektierten text durch leere zeichenkette.
	   var selectedText = "";
	   if(field.selectionStart != 'undefined' && field.selectionEnd != 'undefined' && field.selectionStart < field.selectionEnd)
		   field.value = field.value.substring(0, field.selectionStart) + field.value.substring(field.selectionEnd);
	   else if(document.selection)
	   {
		   field.focus();
		   range = document.selection.createRange();
		   if(range.parentElement() != field)
			    return false;
		   var orig = field.value.replace(/rn/g, "n"); 
		   range.text = "";
	   }
   }
   if (( theKey < 48  || theKey > 57 ) || ( field.value.length == 0 && theKey == 48))
	   return false;
   else if(isValid(theKey,field))
	   return true;
   else
	   return false;
}


function checkBetrag(myform,field,rechnertyp) {
var wert=parseInt(field.value);
var meldung='';
var mindestwert=0;
var waehrung = 2;
if (rechnertyp=='einmal'){

	if (waehrung==1){
		if (wert < 5000){
			meldung='Der Anlagebetrag muss mindestens 5.000 EUR betragen!';
			mindestwert=5000;
		}
	}
	else{ 
		if (wert < 2500){
			meldung='Der Anlagebetrag muss mindestens 2.500 EUR betragen!';
			mindestwert=2500;
		}
	}
}
if (rechnertyp=='spar'){
	if (waehrung==1){
		if (wert < 100){
			meldung='Die monatliche Einzahlung muss mindestens 100 EUR betragen!';
			mindestwert=100;
		}
	}
	else{ 
		if (wert < 50){
			meldung='Die monatliche Einzahlung muss mindestens 50 EUR betragen!';
			mindestwert=50;
		}
	}
}
if (rechnertyp=='auszbetrag'){
	if (waehrung==1){
		if (wert < 20000){
			meldung='Der Anlagebetrag muss mindestens 20.000 EUR betragen!';
			mindestwert=20000;
		}
	}
	else{ 
		if (wert < 10000){
			meldung='Der Anlagebetrag muss mindestens 10.000 EUR betragen!';
			mindestwert=10000;
		}
	}
}
if (rechnertyp=='Auszahlung'){
	if (waehrung==1){
		if (wert < 100){
			meldung='Der Auszahlungsbetrag muss mindestens 100 EUR betragen!';
			mindestwert=100;
		}
	}
	else{ 
		if (wert < 50){
			meldung='Der Auszahlungsbetrag muss mindestens 50 EUR betragen!';
			mindestwert=50;
		}
	}
}


if (meldung > ''){
	alert(meldung);
	field.value=mindestwert;
}
}

function checkWertentw(theKey,field){
var wert=parseInt(field.value)
	if (wert > 25){
		alert('Der Maximalwert für die Wertentwicklung beträgt 25%')
		field.value=25;
	}
}


function isValid(theKey,field) {
	if (field.name == "Anlagebetrag" || field.name == "Wertentwicklung" || field.name == "monatlAusz"){
		return true;
	}
	if (( field.name == 'MonatAnlageBeginn' )&&(isMonthValid(theKey,field))) {
			return true;
		}

	else if (( field.name == 'MonatAnlageEnde' )&&(isMonthValid(theKey,field))) {
			return true;
		}
	
	else if (( field.name == 'JahrAnlageBeginn' )&&(isYearValid(theKey,field))) {
			return true;
		}
	else if (( field.name == 'JahrAnlageEnde' )&&(isYearValid(theKey,field))) {
			return true;
		}
	

	else{
			return false;
	}

 
}
 
function isMonthValid(theKey,field) {
	if ( (field.value >= 1 && theKey > 50)
			||(field.value >= 2 )) {
		return false;
   
			}
	else {
      return true;
	}
}


function isYearValid(theKey,field) {
	if  ( (field.value == 1 && theKey < 57 ) 
			|| (field.value.length == 0 && theKey > 50)
			|| (field.value == 2 && theKey > 48 )
			|| (field.value == 19 && theKey < 55 )
			|| (field.value == 20 && theKey > 53 )) {
		return false;
   
			}
	else {
      return true;
	}
}

function getFormVals(form,count) {
	if (isFormValid(form,count)){
		return true;
	}
	else{
		return false;
	}	
	
}


function isFormValid(myform,count) {
	for (var i=0;i< count;i++){
		if ((myform[i].name != 'fonds')&&(myform[i].name != 'action')&&(myform[i].name != 'minmonat')&&(myform[i].name != 'minjahr')&&(myform[i].name != 'einzminmonat')&&(myform[i].name != 'einzminjahr')&&(myform[i].name != 'maxmonat')&&(myform[i].name != 'maxjahr')){
			if((myform[i].value.charAt(0)==0)||(myform[i].value =='')){
				if (myform[i].name == 'Anlagebetrag')
					alert('Bitte geben Sie einen Anlagebetrag ein!');
				if (myform[i].name == 'monatlAusz')
					alert('Bitte geben Sie einen Auszahlungsbetrag ein!');
				if (myform[i].name == 'Wertentwicklung')
					alert('Bitte geben Sie eine angenommene Wertentwicklung an!');
				if (myform[i].name == 'JahrAnlageEnde')
					alert('Bitte geben Sie ein Jahr für das Anlageende ein!');
				if (myform[i].name == 'JahrAnlageBeginn')
					alert('Bitte geben Sie ein Jahr für den Anlagebeginn ein!');
				if (myform[i].name == 'MonatAnlageBeginn')
					alert('Bitte geben Sie einen Monat für den Anlagebeginn ein!');
				if (myform[i].name == 'MonatAnlageEnde')
					alert('Bitte geben Sie einen Monat für das Anlageende ein!');
			myform[i].focus()
			myform[i].select()
			return false
			}
		}
	}

	if (myform.JahrAnlageEnde!=null){
		var JahrAnlageEnde = parseInt(myform.JahrAnlageEnde.value)
		var JahrAnlageBeginn =  parseInt(myform.JahrAnlageBeginn.value)
		var MonatAnlageBeginn = parseInt(myform.MonatAnlageBeginn.value)
		var MonatAnlageEnde = parseInt(myform.MonatAnlageEnde.value)
	}
	else if (myform.maxjahr!=null){
		var JahrAnlageEnde = parseInt(myform.maxjahr.options[myform.maxjahr.selectedIndex].text);
		var JahrAnlageBeginn =  parseInt(myform.minjahr.options[myform.minjahr.selectedIndex].text);
		var MonatAnlageBeginn = parseInt(myform.minmonat.options[myform.minmonat.selectedIndex].text);
		var MonatAnlageEnde = parseInt(myform.maxmonat.options[myform.maxmonat.selectedIndex].text);
		}
		else
		{
			return true;
		}


		if (JahrAnlageEnde < JahrAnlageBeginn){
			alert('Bitte wählen Sie mindestens einen Anlagezeitraum von einem Jahr');
			return false;
	   }
		if(JahrAnlageEnde-JahrAnlageBeginn >= 2){

			return true
		}
		else 
//		if(JahrAnlageEnde == JahrAnlageBeginn && MonatAnlageEnde - MonatAnlageBeginn < 11){
//			alert('Bitte wählen Sie mindestens einen Anlagezeitraum von einem Jahr1');
//			return false;
//			}
//			else 
				if ((JahrAnlageEnde - JahrAnlageBeginn == 1) && (MonatAnlageEnde - MonatAnlageBeginn > -2))
				return true;
				else if (MonatAnlageEnde - MonatAnlageBeginn <= -2){
//					alert('Bitte wählen Sie mindestens einen Anlagezeitraum von einem Jahr');
					return true;
				}
		 else
		 {
		 return true;
		 }
}



/* confirm.js */

function confirm_action(label)
{
	answer = true;
	result = confirm(label);
	if(!result)
	{
		answer = false;		
	}
	return answer;
}

/* dhtml.js */

/*DHTML scripts copyright L.Bagamery (lsblsb@gmx.de))*/


/****
 * switchClassName()
 * purpose: switch the className of an object with given id, optionally you can hand over a array with ids that should all get another (old) classname at the same time
 * @access public
 * @param string switchId
 * @param string newClassName
 * @param [optional] string oldClassName
 * @param [optional] (string-array|object-array) switchIds
 * @return object
 *
 */
 
function switchClassName(switchId, newClassName, /*optional*/ oldClassName, switchIds)
{
	var obj = null;
	if(typeof(switchId) == "object")
		obj = switchId;
	else
		obj = document.getElementById(switchId);
	obj.className = newClassName;
	if(oldClassName && switchIds)
	{
		for(i=0; i<switchIds.length; i++)
		{
			if(typeof switchIds[i] == "object")
			{
				currObj = switchIds[i];
			}
			else
			{
				currObj = document.getElementById(switchIds[i]);
			}
			if(currObj && currObj != obj) 
			{
				currObj.className = oldClassName;
			}
		}
	}
}

function switchDisplay(switchId,/*optional*/ switchIds,/*optional*/ forcedDisplay)
{
	var obj = document.getElementById(switchId);
	if(!forcedDisplay && forcedDisplay != "")
	{
		var oldDisplay = obj.style.display;
		var newDisplay = '';
		if(oldDisplay == '') newDisplay = 'none';
	}
	else
	{
		forcedDisplay == '' ? oldDisplay = 'none' : oldDisplay = '';
		newDisplay = forcedDisplay;
	}
	obj.style.display = newDisplay;
	
	if(switchIds && switchIds[0])
	{
		for(i=0; i<switchIds.length; i++)
		{
			currObj = document.getElementById(switchIds[i]);
			if(currObj && currObj != obj) 
			{
				currObj.style.display = oldDisplay;
			}
		}
	}
}

function getMainSwitchButtons(mainSwitchButtonIdPrefix)
{
	var imgs = document.images;
	var imgsLen = imgs.length;
	var mainSwitchButtons = new Array();
	for(i=0; i<imgsLen; i++)
	{
		if(imgs[i].id && imgs[i].id.indexOf(mainSwitchButtonIdPrefix) != -1)
		{
			mainSwitchButtons[mainSwitchButtons.length] = imgs[i];
		}
	}
	return mainSwitchButtons;
}

/**
 * @param string mainSwitchButtonIdPrefix
 * @param string switchButtonImgId
 * @param string extendViewId
 * @param [ string plusSign ]
 * @param [ string minusSign ]
 * @param [ array textChanges: array[array[<elementId>,<textVarianteA>,<textVarianteB>], array...] ]
 *
 */

function switchView(mainSwitchButtonIdPrefix, switchButtonImgId, extendViewId, plusSign, minusSign, textChanges)
{
	if(!plusSign) plusSign = "plus";
	if(!minusSign) minusSign = "minus";
	var switchButtonImg = document.images[switchButtonImgId];
	//var mainSwitchButtonImg = document.images[mainSwitchButtonId];
	var mainSwitchButtons = getMainSwitchButtons(mainSwitchButtonIdPrefix);
	var mainSwitchButtonsLen = mainSwitchButtons.length;
	var objStyle = document.getElementById(extendViewId).style;
	var formerDisplay = objStyle.display;
	var newSign = minusSign;
	var oldSign = plusSign;
	var newDisplay = "";
	var msg = "schliessen";
	if(formerDisplay != "none")
	{
		newDisplay = "none";
		newSign = plusSign;
		oldSign = minusSign;
		msg = "öffnen";
	}
	//switch texts
	if(textChanges)
		if(typeof(textChanges) == "object")
			for(var i=0;i<textChanges.length;i++)
			{
				textChange = textChanges[i];
				if(typeof(textChange) == "object" && textChange.length == 3 && textChange[0])
				{	var objId = textChange[0];
					if(document.getElementById(objId) && document.getElementById(objId).firstChild && document.getElementById(objId).firstChild.nodeValue == textChange[1])
						changeTextById(textChange[0], textChange[2]);
					else
						changeTextById(textChange[0], textChange[1]);
				}
			}
	//switch_buttons
	switchButtonImg.src = switchButtonImg.src.replace(new RegExp(oldSign),newSign);
	switchButtonImg.title = msg;
	switchButtonImg.alt = msg;
	objStyle.display = newDisplay;
	//main_switch_buttons
	for(i=0;i<mainSwitchButtonsLen;i++)
	{
		mainSwitchButtons[i].src = mainSwitchButtons[i].src.replace(new RegExp(oldSign),plusSign);
		mainSwitchButtons[i].title = "alle öffnen";
		mainSwitchButtons[i].alt = "alle öffnen";
	}
}

/**
 * @param string formName
 * @param string mainSwitchButtonIdPrefix
 * @param string switchButtonImgIdPrefix
 * @param string extendViewIdPrefix
 * @param [ string displayedIsinsCsvField ]
 * @param [ string plusSign ]
 * @param [ string minusSign ]
 * @param [ array textChanges: array[array[<elementId>,<textVarianteA>,<textVarianteB>], array...] ]
 *
 */

function switchAll(formName, mainSwitchButtonIdPrefix, switchButtonImgIdPrefix, extendViewIdPrefix, displayedIsinsCsvField, plusSign, minusSign, textChanges)
{
	if(!plusSign) plusSign = "plus";
	if(!minusSign) minusSign = "minus";
	if(!displayedIsinsCsvField) displayedIsinsCsvField = "displayed_isins";
	var isins = document.forms[formName].elements[displayedIsinsCsvField].value.split(",");
	//var mainSwitchButton = document.images[mainSwitchButtonId];
	var mainSwitchButtons = getMainSwitchButtons(mainSwitchButtonIdPrefix);
	var mainSwitchButtonsLen = mainSwitchButtons.length;
	var oldSign = plusSign;
	var newSign = minusSign;
	var newDisplay = "";
	var msg = "schliessen";
	if(mainSwitchButtons[0].src.indexOf(plusSign) == -1)
	{
		oldSign = minusSign;
		newSign = plusSign;
		newDisplay = "none";
		msg = "öffnen";
	}
	//switch texts
	if(textChanges)
		if(typeof(textChanges) == "object")
			for(var i=0;i<textChanges.length;i++)
			{
				textChange = textChanges[i];
				if(typeof(textChange) == "object" && textChange.length == 3 && textChange[0])
				{	var objId = textChange[0];
					if(document.getElementById(objId) && document.getElementById(objId).firstChild && document.getElementById(objId).firstChild.nodeValue == textChange[1])
						changeTextById(textChange[0], textChange[2]);
					else
						changeTextById(textChange[0], textChange[1]);
				}
			}
	var isins_len = isins.length;
	//switch_buttons and image-src's
	for(i=0;i<isins_len;i++)
	{
		var currSwitchButtonImg = document.images[switchButtonImgIdPrefix+isins[i]];
		var currExtendViewId = extendViewIdPrefix+isins[i];
		currSwitchButtonImg.src = currSwitchButtonImg.src.replace(new RegExp(oldSign),newSign);
		currSwitchButtonImg.title = msg;
		currSwitchButtonImg.alt = msg;
		document.getElementById(currExtendViewId).style.display = newDisplay;
	}
	//main_switch_buttons
	for(i=0;i<mainSwitchButtonsLen;i++)
	{
		mainSwitchButtons[i].src = mainSwitchButtons[i].src.replace(new RegExp(oldSign),newSign);
		mainSwitchButtons[i].title = "alle "+msg;
		mainSwitchButtons[i].alt = "alle "+msg;
	}
}

function changeTextById(id, str)
{
	document.getElementById(id).firstChild.nodeValue = str;
}

function changeImgById(id, src)
{
	document.getElementById(id).src = src;
}

function changeStyleById(id, styleNames, styleValues)
{
	var element = document.getElementById(id);
	if(typeof(styleNames) != "object")
		styleNames = new Array(styleNames);
	if(typeof(styleValues) != "object")
		styleValues = new Array(styleValues);
	for(var i=0;i<styleNames.length;i++)
	{
		var command = "element.style."+styleNames[i]+" = '"+styleValues[i]+"';"
		eval(command);
	}
}



/* filetree.js */

/******************************************************************************************************************************************
* ---------------------------------------------------------jsTreeClasses [filetree.js]-----------------------------------------------------
*				    			!! COPYRIGHT lars bagamery 2004 [lsblsb@gmx.de] !!    
*******************************************************************************************************************************************/

/***benoetigt tree-class!***/

//erweitere Tree-Klasse um Klassenvariablen////////////////////////////////////////////////////////////////////////////////////////////////

	Tree.prototype.idPrefix = "ftid_";
	Tree.prototype.idPrefixSwitch = "switch_";
	Tree.prototype.idPrefixFolder = "folder_";
	Tree.prototype.idPrefixImages = "";
	Tree.prototype.imagesDir = "img/";
	Tree.prototype.sensitiveSymbols = true;
	Tree.prototype.reverseDisplayUserFunc = null; //funktion, die nach aufruf von reverseDisplay() aufgerufen wird.
	Tree.prototype.reverseDisplayUserFuncArgs = new Array(); //zugehoerige parameter-werte
	Tree.prototype.targetNode = null;

//erweitere Tree-Klasse um getFileTree-Funktion////////////////////////////////////////////////////////////////////////////////////////////

	Tree.prototype.getFileTree = function(pStartNode, pArrKeypairs, pMaxDepth, pActNode, pChildNum, pDepth)
	{
		if(!pStartNode || pStartNode == "")
		{
			pStartNode = this.rootNode;
		}
		if(!pMaxDepth)
		{
			pMaxDepth = -1;
		}
		if(!pActNode)
		{
			var pActNode = pStartNode;
			var pDepth = 0;
			//output-->
			output = "";
			//<--output
		}
		var parentNode = pActNode.getParent();
		var rightNeighbour = pActNode.getRightNeighbour();
		var leftNeighbour = pActNode.getLeftNeighbour();
		var children = pActNode.getChildren();
		var childrenLen = children.length;
		//lege Eigenschaften active u. opened an fuer aktuelle node
		pActNode.addProperty("active", false);
		pActNode.addProperty("opened", false);
		//wenn pStartNode nicht root war, dann setzte fuer  erste Node parentNode u. leftNeighbour auf null
		if(pActNode == pStartNode)
		{
			parentNode = null;
			leftNeighbour = null;
		}
		
		var actId = pActNode.getId();
			
		//set menu_empty or v_line - list
		var pStartNodeNeighbours = new Array();
		var actRightNeighbour = pStartNode;
		while(actRightNeighbour != null)
		{	
			pStartNodeNeighbours[pStartNodeNeighbours.length] = actRightNeighbour;
			actRightNeighbour = actRightNeighbour.getRightNeighbour();
		}
		var fillerImgList = new Array();
		var actParentNode = pActNode;
		while(actParentNode.getParent() != null && !(inArray(actParentNode, pStartNodeNeighbours)))
		{
			actParentNode = actParentNode.getParent();
			if(actParentNode.getRightNeighbour() == null)
				fillerImgList[fillerImgList.length] = this.imagesDir + this.idPrefixImages + "menu_empty.gif";
			else
				fillerImgList[fillerImgList.length] = this.imagesDir + this.idPrefixImages + "menu_v_line.gif";
		}
		fillerImgList.reverse();
		
		var actStyle = "style=\"display:none;\"";
		if(pActNode == pStartNode || (inArray(pActNode, pStartNodeNeighbours)))
		{
			actStyle = "";
		}
		//output-->
		output += "<div id=\"" +actId+ "\" " +actStyle+ ">\n";
		
		for(i=0; i<=pDepth; i++)
		{
			if(pActNode != this.rootNode || childrenLen != 0)
			{
				if(i == (pDepth))
				{
					var num1 = 0;
					var num3 = 0;
					(leftNeighbour != null || parentNode != null) ? num1 = 1 : num1 = 0;
					(rightNeighbour != null) ? num3 = 1 : num3 = 0;
		
					output += "<a href=\"javascript:" +this.getName()+ ".reverseDisplay('" +actId+ "');\"><img src=\"";
					if(childrenLen != 0)
					{
						output += this.imagesDir + this.idPrefixImages + "menu_plus_" +num1+ "1" +num3+ ".gif";
					}
					else
					{
						if(pActNode == this.rootNode)
							output += this.imagesDir + this.idPrefixImages + "menu_empty.gif";
						else
							output += this.imagesDir + this.idPrefixImages + "menu_nosub_" +num1+ "1" +num3+ ".gif";
					}
					output += "\" id=\"" +this.idPrefixSwitch + actId+ "\" style=\"border:0;margin:0;vertical-align:top;\" /></a>";
				}
				else
				{
					output += "<img src=\"";
					output += fillerImgList[i];
					output += "\" style=\"border:0;margin:0;vertical-align:top;\" />";
				}
			}
		}
		
		var itemNum3 = 0;
		//(childrenLen > 0) ? itemNum3 = 1 : itemNum3 = 0;
	
		if(this.sensitiveSymbols == true)
			output += "<a href=\"javascript:" +this.getName()+ ".activateItem('" +actId+ "');\">";
		output += "<img src=\"";
		output += this.imagesDir + this.idPrefixImages+ "menu_item_";
		if(pActNode == this.rootNode && childrenLen == 0) output += "root_";
		output += "00" +itemNum3+".gif\"";
		output += " id=\"" +this.idPrefixFolder+ "" +actId+ "\" style=\"border:0;margin:0;vertical-align:top;\" />";
		if(this.sensitiveSymbols == true)
			output += "</a>";
		output += "<span id=\"" +this.idPrefix + actId+ "\">";
		
		if(!pArrKeypairs[actId])
			output += "<span style=\"font-size:11px;font-family:arial;color:#FF0000;\">["+actId+"]</span>";
		else
			output += "<span style=\"vertical-align:middle;margin-left:3px;\">"+pArrKeypairs[actId]+"</span>";

		output += "</span>";
		output += "</div>\n";
		//<--output
		
		
		var firstChild = children[0];
		if((childrenLen > 0) && ((pDepth < pMaxDepth) || (pMaxDepth == -1)))
		{
			pDepth++;
			pActNode = firstChild;
			this.getFileTree(pStartNode, pArrKeypairs, pMaxDepth, pActNode, pChildNum, pDepth);
			pDepth--;
		}
		if(rightNeighbour != null)
		{
			pActNode = rightNeighbour;
			
			this.getFileTree(pStartNode, pArrKeypairs, pMaxDepth, pActNode, pChildNum, pDepth);
		}
		return output;
	}
	
	/**
	 * @desc haenge baum in dokument ein
	 * @param Object targetNode
	 * @param Array nodeHtml (structure: \[<id>:<html>,[<id>:<html>, ...]\])
	 * @param Bool omitRootNode = false
	 * @param Array openedULPositions (list of positions in sub-dom-tree of ul's that should be displayed
	 */
	Tree.prototype.hookTree = function(targetNode, /*optional*/nodeHtml, omitRootNode, openedULPositions)
	{
		if(typeof targetNode == "object")
			this.targetNode = targetNode;
		else
			return false;
		
		this.reset();
		var node = this.getCurrent();
		
		var li = null;
		var html = null;
		var uls = [];
		
		var treeInteractivity = function()
		{
			var obj = this;
			// if the element is not na <a>, return
			if (obj.tagName != 'A'
				|| obj.className == 'leaf') return;
			// change class
			obj.className = obj.className == 'plus' ? 'minus' : 'plus';
			// get associated <li>
			var liObj = obj.parentNode;
			var ulObjs = liObj.getElementsByTagName('ul');
			// if there is no internal <ul>, return
			if(!ulObjs.length) return;
			// hide/show internal <ul>
			ulObjs[0].style.display = ulObjs[0].style.display == 'none' ? 'block' : 'none';
			//reset display values of <li>'s for IE-display-bug.
			if (document.all && !navigator.userAgent.match(/Opera/))
			{
				var firstUL = obj;
				while(firstUL.parentNode.tagName == 'LI' || firstUL.parentNode.tagName == 'UL')
					firstUL = firstUL.parentNode;
				var firstULChildren = firstUL.getElementsByTagName('ul');
				for(var i=0;i<firstULChildren.length;i++)
				{	
					var prevDisplay = firstULChildren[i].style ? firstULChildren[i].style.display : 'block';
					firstULChildren[i].style.display = (prevDisplay == 'none') ? 'block' : 'none'; 
					firstULChildren[i].style.display = prevDisplay;
				}
			}
		};
		
		var i_ul = 0;
		while(this.hasNext())
		{
			var status = "plus";
			var depth = node.getProperty("depth");
			
			if(!omitRootNode || !node.isRootNode())
			{
				if(!node.getLeftNeighbour())
				{
					uls[depth] = document.createElement("ul");
					if(!node.isRootNode() && !omitRootNode || (omitRootNode && !node.getParent().isRootNode()))
						uls[depth].style.display = 'none';
					for(var i in openedULPositions)
						if(openedULPositions[i] == i_ul)
							uls[depth].style.display = 'block';
						else if(openedULPositions[i] == i_ul+1)
							status = 'minus';
					if(node.isRootNode() || omitRootNode && node.getParent().isRootNode())
					{
						uls[depth].className = "tree";
						targetNode.appendChild(uls[depth]);
					}
					else
						li.appendChild(uls[depth]);
					i_ul++;
				}
				
				li = document.createElement("li");
				if(!node.getRightNeighbour())
					li.className = "last";
				if(!node.hasChildren())
					status = 'leaf';
				html = '<a class="'+status+'"></a>';
				html+= nodeHtml[node.getId()] ? nodeHtml[node.getId()] : node.getId();
				li.innerHTML = html;
				li.firstChild.onclick = treeInteractivity;
				uls[depth].appendChild(li);
			}
			node = this.getNext();
		}
	}
	
	Tree.prototype.getULPositionsByCssStyleDisplay = function(cssStyleDisplay)
	{
		var result = [];
			
		if(typeof this.targetNode == "object")
		{
			var targets = this.targetNode.getElementsByTagName('ul');
			if(typeof cssStyleDisplay == "object")
			{
				for(var i=0;i<targets.length;i++)
					for(currCssStyleDisplay in cssStyleDisplay)
						if(targets[i].style.display == currCssStyleDisplay)
							result[result.length] = i;
			}
			else
			{
				for(var i=0;i<targets.length;i++)
					if(targets[i].style.display == cssStyleDisplay)
						result[result.length] = i;
			}
		}
		return result;
	}
	
	Tree.prototype.getClosedULPositions = function()
	{
		return this.getULPositionsByCssStyleDisplay('none');
	}
	
	Tree.prototype.getOpenedULPositions = function()
	{
		return this.getULPositionsByCssStyleDisplay(new Array('block','inline',''));
	}
	
	Tree.prototype.openTree = function()
	{
		var result = [];
		if(typeof this.targetNode == "object")
		{
			var aTargets = this.getElementsByClass('(plus|minus)', this.targetNode, 'a');
			var ulTargets = this.targetNode.getElementsByTagName('ul');
			for(var i=0;i<aTargets.length;i++)
				aTargets[i].className = 'minus';
			for(var i=1;i<ulTargets.length;i++)
				ulTargets[i].style.display = 'block';
		}
		return result;
	}
	
	Tree.prototype.closeTree = function()
	{
		var result = [];
		if(typeof this.targetNode == "object")
		{
			var aTargets = this.getElementsByClass('(plus|minus)', this.targetNode, 'a');
			var ulTargets = this.targetNode.getElementsByTagName('ul');
			for(var i=0;i<aTargets.length;i++)
				aTargets[i].className = 'plus';
			for(var i=1;i<ulTargets.length;i++)
				ulTargets[i].style.display = 'none';
		}
		return result;
	}
	
	/**
	 * @desc prüfe, ob irgendeine node geöffnet ist
	 */
	Tree.prototype.nodesOpened = function()
	{
		var result = false;
		if(typeof this.targetNode == "object")
		{
			var ulTargets = this.targetNode.getElementsByTagName('ul');
			for(var i=1;i<ulTargets.length;i++)
				if(ulTargets[i].style.display != 'none' && ulTargets[i].style.display != 'hidden')
				{
					result = true;
					break;
				}
		}
		return result;
	}
	
//erweitere Tree-Klasse um getsubtreeObjects-Funktion (alle unterobjekte einer Node zurueckgeben)///////////////////////////////////////////

	Tree.prototype.getSubtreeObjects = function(pStartNode, pMaxDepth, pActNode, pChildNum, pDepth)
	{
		if(!pStartNode)
		{
			pStartNode = this.rootNode;
		}
		if(!pMaxDepth)
		{
			pMaxDepth = -1;
		}
		if(!pActNode)
		{
			subtreeObjects = new Array();
			pActNodeChildren = pStartNode.getChildren();
			pActNode = null;
			if(pActNodeChildren[0])
			{
				pActNode = pActNodeChildren[0];
			}
			pDepth = 0;
		}
		if(pActNode != null)
		{
		var rightNeighbour = pActNode.getRightNeighbour();
			
			//save return value in variable
			subtreeObjects[subtreeObjects.length] = pActNode;
			//end save
			
			var children = pActNode.getChildren();
			var firstChild = children[0];
			if((children.length > 0) && ((pDepth < pMaxDepth) || (pMaxDepth == -1)))
			{
				pDepth++;
				pActNode = firstChild;
				this.getSubtreeObjects(pStartNode, pMaxDepth, pActNode, pChildNum, pDepth);
				pDepth--;
			}
			if(rightNeighbour != null)
			{
				pActNode = rightNeighbour;
				this.getSubtreeObjects(pStartNode, pMaxDepth, pActNode, pChildNum, pDepth);
			}
		}
		return subtreeObjects;
	}
	
//erweitere Tree-Klasse um reverseDisplay-Funktion (subtree oeffnen/schliessen)/////////////////////////////////////////////////////////////

	Tree.prototype.reverseDisplay = function(pId, /*optional*/neverClose)
	{
		var actNode = this.getNodeById(pId);
		if(!actNode) return;
		var actNodeChildren = actNode.getChildren();
		var actNodeSubtreeObjects = this.getSubtreeObjects(actNode);
		//1. alle childs von pId u. deren childs ausblenden oder einblenden
		var actNodeFirstChildDisplay = "";
		
		if(actNodeChildren[0] != null)
		{
			var actNodeFirstChildDisplay = document.getElementById(actNodeChildren[0].getId()).style.display;
		}
		
		if(neverClose == true && actNodeFirstChildDisplay == "")
		{
			//nothing
		}
		else
		{
			if(actNodeChildren.length > 0)
			{
				///////////////////////////////////////////////
				//set act button to '-'
				var objPath = document.getElementById(this.idPrefixSwitch + pId);
				var oldSrc = objPath.src;
				var oldImg = oldSrc.substr(oldSrc.lastIndexOf("/")+1);
				var oldPath = oldSrc.substring(0,oldSrc.lastIndexOf("/")+1);
				var newImg = "";
				
				if(oldImg.indexOf("plus") != -1)
				{
					var s = oldImg.split("plus");
					newImg = s[0] +"minus"+ s[1];
					actNode.setProperty("opened", true);
				}
				else if(oldImg.indexOf("minus") != -1)
				{
					var s = oldImg.split("minus");
					newImg = s[0] +"plus"+ s[1];
					actNode.setProperty("opened", false);
				}
				else
				{
					newImg = oldImg;
				}
				objPath.src = oldPath + newImg;
				
				///////////////////////////////////////////////
				//set act menu_item image to '001' or '000'
				objPath = document.getElementById(this.idPrefixFolder + pId);
				oldSrc = objPath.src;
				oldImg = oldSrc.substr(oldSrc.lastIndexOf("/")+1);
				oldPath = oldSrc.substring(0,oldSrc.lastIndexOf("/")+1);
				newImg = "";
				if(oldImg.indexOf("001") != -1)
				{
					var s = oldImg.split("001");
					newImg = s[0] +"000"+ s[1];
				}
				else if(oldImg.indexOf("000") != -1)
				{
					var s = oldImg.split("000");
					newImg = s[0] +"001"+ s[1];
				}
				else
				{
					newImg = oldImg;
				}
	
				objPath.src = oldPath + newImg;
	
				///////////////////////////////////////////////
		
				if(actNodeFirstChildDisplay  == "none")
				{
					///////////////////////////////////////////////
					//show all sub-buttons of next level
					for(var i=0; i<actNodeChildren.length; i++)
						document.getElementById(actNodeChildren[i].getId()).style.display = "";
				}
				else
				{
					for(var i=0; i<actNodeSubtreeObjects.length; i++)
					{
						///////////////////////////////////////////////
						//hide all sub-buttons
						var actId = actNodeSubtreeObjects[i].getId();
						document.getElementById(actId).style.display = "none";
						actNodeSubtreeObjects[i].setProperty("opened", false);
						///////////////////////////////////////////////
						//set all sub-buttons to '+'
						objPath = document.getElementById(this.idPrefixSwitch + actId);
						oldSrc = objPath.src;
						oldImg = oldSrc.substr(oldSrc.lastIndexOf("/")+1);
						oldPath = oldSrc.substring(0,oldSrc.lastIndexOf("/")+1);
						newImg = "";
						if(oldImg.indexOf("minus") != -1)
						{
							var s = oldImg.split("minus");
							newImg = s[0] +"plus"+ s[1];
						}
						else
						{
							newImg = oldImg;
						}
						objPath.src = oldPath + newImg;
						
						///////////////////////////////////////////////
						//set all sub-menu_item images to '000'
						objPath = document.getElementById(this.idPrefixFolder + actId);
						oldSrc = objPath.src;
						oldImg = oldSrc.substr(oldSrc.lastIndexOf("/")+1);
						oldPath = oldSrc.substring(0,oldSrc.lastIndexOf("/")+1);
						newImg = "";
						if(oldImg.indexOf("001") != -1)
						{
							var s = oldImg.split("001");
							newImg = s[0] +"000"+ s[1];
						}
						else
						{
							newImg = oldImg;
						}
						objPath.src = oldPath + newImg;
					}
				}
			}
		}
		
		//call user-func
		if (typeof this.reverseDisplayUserFunc == "function")
			if(this.reverseDisplayUserFuncArgs.length > 0)
				this.reverseDisplayUserFunc(this.reverseDisplayUserFuncArgs);
			else
				this.reverseDisplayUserFunc();
	}

	/**
	 * @param Function func
	 * @param optional Array args
	 */
	
	Tree.prototype.setReverseDisplayUserFunc = function(func, args)
	{
		if (typeof func == "function")
		{
			this.reverseDisplayUserFunc = func;
			this.reverseDisplayUserFuncArgs = args;
		}
	}
	
	/**
	 * @desc erweitere Tree-Klasse um activateItem-Funktion (einen folder aktivieren (img tausch))
	 *
	 * @param string pId
	 * @param optional Function func : Funktion, die nach Ablauf dieser Funktion aufgerufen werden soll
	 * [@param optional param, ...] beliebige Parameter f�r func 
	 */	
	Tree.prototype.activateItem = function(pId)
	{
		var actNode = this.getNodeById(pId);
		var treeNodes = this.getNodes();
			
		//switch act menu_item image to active and deactivate all others
		//and activate current
		var objPath = document.getElementById(this.idPrefixFolder + pId);
		
		var oldSrc = objPath.src;
		var oldImg = oldSrc.substr(oldSrc.lastIndexOf("/")+1);
		var oldPath = oldSrc.substring(0,oldSrc.lastIndexOf("/")+1);
		var newImg = "";
		
		if(oldImg.indexOf("active") == -1)
		{
			oldImgFilename = oldImg.substring(0, oldImg.lastIndexOf("."));
			oldImgExt = oldImg.substr(oldImg.lastIndexOf("."));
			newImg = oldImgFilename + "_active" + oldImgExt;
			objPath.src = oldPath + newImg;
			actNode.setProperty("active", true);
		}
		//deactivate all others
		var treeNodes = this.getNodes();
		for(i=0; i<treeNodes.length; i++)
		{
			if(treeNodes[i] != actNode)
			{
				objPath = document.getElementById(this.idPrefixFolder + treeNodes[i].getId());
				oldSrc = objPath.src;
				oldImg = oldSrc.substr(oldSrc.lastIndexOf("/")+1);
				oldPath = oldSrc.substring(0,oldSrc.lastIndexOf("/")+1);
				newImg = "";
				if(oldImg.indexOf("active") != -1)
				{
					var s = oldImg.split("_active");
					newImg = s[0] + s[1];
					objPath.src = oldPath + newImg;
					treeNodes[i].setProperty("active", false);
				}
			}
		}
	}
	
	/**
	 * @desc oeffne alle subtrees oder alle subtrees derjenigen node-ids die uebergeben wurden
	 * @param optional Array ids
	 */
	 
	Tree.prototype.open = function(/*optional*/ids)
	{	//array wurde uebergeben?
		if(!(typeof ids == "object" && ids instanceof Array))
		{
			ids = new Array();
			for(var i in this.nodes)
				if(this.nodes[i].getChildren().length > 0)
					ids[ids.length] = this.nodes[i].getId();
		}
		for(var i in ids)
			this.reverseDisplay(ids[i], true);
	}
	 
	/**
	 * @desc schliesse alle subtrees alle subtrees derjenigen node-ids die uebergeben wurden
	 * @param optional Array ids
	 */
	  
	Tree.prototype.close = function(/*optional*/ids)
	{	//array wurde uebergeben?
		if(!(typeof ids == "object" && ids instanceof Array))
			ids = new Array(this.getRootNode().getId());
		for(var i in ids)
			this.reverseDisplay(ids[i]);
	}
	
	/**
	 * @desc gebe geoeffnete nodes zurueck
	 */
	
	Tree.prototype.getOpenedNodes = function()
	{
		var result = new Array();
		for(var i in this.nodes)
			if(this.nodes[i].getProperty("opened"))
				result[result.length] = this.nodes[i];
		return result;
	}

	/**
	 * @desc gebe aktive node (als objekt) zurueck
	 */
	Tree.prototype.getActiveNode = function()
	{
		var nodes = this.getNodes();
		var activeObject = false;
		for(i=0; i<nodes.length; i++)
			if(nodes[i] && nodes[i].getProperty("active") == true)
				activeObject = nodes[i];
		return activeObject;
	}

	/**
	 * @desc gebe aktive node-id zurueck
	 */
	Tree.prototype.getActiveNodeId = function()
	{
		var activeObject = this.getActiveNode();
		var nodeId = null;
		if(activeObject)
			return activeObject.getId();
	}


/* tree.js */

/************************************************************************************************************
* -----------------------------------------------jsTreeClasses-----------------------------------------------
*								!! COPYRIGHT lars bagamery 2004 [lsblsb@gmx.de] !!	
*************************************************************************************************************/

/* * *
 * CLASS Tree
 * @param [optional] string pSerializedTree
 * @param string strObjName
 */
	
	function Tree(pSerializedTree, strObjName)
	{
		this.name = strObjName; //String Name des zu erstellenden objekts
		this.rootNode = null;
		this.currentNode = this.rootNode;
		this.pointer = 0;
		this.nodes = new Array();
		this.serializedTree = "";
		
		/**
		 * return elements by class-name
		 */
		this.getElementsByClass = function(searchClass, node, tag)
		{
	        var classElements = new Array();
	        if (node == null) node = document;
	        if (tag == null) tag = '*';
	        var els = node.getElementsByTagName(tag);
	        var elsLen = els.length;
	        var pattern = new RegExp("(^|\\s)"+searchClass+"(\\s|$)");
	        for (var i=0, j=0; i<elsLen; i++)
                if(pattern.test(els[i].className))
                {
					classElements[j] = els[i];
					j++;
                }
	        return classElements;
		}
		
		/* * *
		 * getName()
		 * returns the Name of this Object (should be the name of the instance variable!)
		 * @return String
		 */
		
		this.getName = function()
		{
			return this.name;
		}
		
		/* * *
		 * getNodes()
		 * return all nodes of this tree in an array
		 * @return Array
		 */
		
		this.getNodes = function()
		{
			return this.nodes;
		}
		
		this.hasNodes = function()
		{
			return this.nodes.length != 0;
		}
		
		/* * *
		 * setRootNode()
		 * set the root node
		 * @param Node pNodeObj
		 * @return void
		 */
		
		this.setRootNode = function(pNodeObj)
		{
			this.rootNode = pNodeObj;
			this.currentNode = this.rootNode;
			this.nodes[this.nodes.length] = pNodeObj;
		}
		
		/* * *
		 * getRootNode()
		 * get the root node
		 * @return Node pNodeObj | NULL
		 */
		
		this.getRootNode = function()
		{
			return this.rootNode;
		}
		
		/* * *
		 * addNode()
		 * adds a node to the tree
		 * @access public
		 * @param Node pNodeObj
		 * @param Nod pParentNodeObj
		 * @return Boolean
		 */
		 
		this.addNode = function(pNodeObj, pParentNodeObj)
		{
			if(pParentNodeObj && this.rootNode != null)
			{
				var pParentNodeObjChildren = pParentNodeObj.getChildren();
				var pParentNodeObjChildrenLen = pParentNodeObjChildren.length;
				if(pParentNodeObjChildrenLen > 0)
				{
					var pNodeObjLeftNeighbour = pParentNodeObjChildren[pParentNodeObjChildrenLen-1];
					pNodeObjLeftNeighbour.setRightNeighbour(pNodeObj);
					pNodeObj.setLeftNeighbour(pNodeObjLeftNeighbour);
				}
				pNodeObj.setParent(pParentNodeObj);
				pParentNodeObj.setChild(pNodeObj);
				this.nodes[this.nodes.length] = pNodeObj;
				return true;
			}
			else
			{
				return false;
			}
		}
		
		/* * *
		 * getNodeById()
		 * returns a node identified by its id.
		 * @access public
		 * @param String|Int pId
		 * @return Node
		 */
		
		this.getNodeById = function(pId)
		{
			var nodeObj = false;
			var nodesLen = this.nodes.length;
			for(i=0; i<nodesLen; i++)
				if(this.nodes[i].getId() == pId)
					nodeObj = this.nodes[i];
			return nodeObj;
		}
		
		/**
		 * check if current node has previous node
		 * @return bool
		 */
		
		this.hasPrevious = function()
		{ 	
			var result = this.getPrevious(false);
			return result ? true : false;
		}
		
		/**
		 * return previous node
		 * @param optional movePointer = true
		 * @return Node
		 */
		
		this.getPrevious = function(movePointer)
		{	//@todo
			var result = null;
			
			if(typeof movePointer != "boolean") movePointer = true;
			
			var currNode = this.currentNode;
			var i=0;
			
			while(currNode.getChild(currNode.getChildren().length-1) && !(i == 0 && this.getNext(false) && this.getNext(false).getLeftNeighbour() == null))
			{
				result = currNode = currNode.getChild(currNode.getChildren().length-1);
				i++;
			}
			
			if(!result)
			{
				result = currNode.getLeftNeighbour();
				if(result && i==0)
				{
					currNode = result;
					while(currNode.getChild(currNode.getChildren().length-1))
						result = currNode = currNode.getChild(currNode.getChildren().length-1);
				}
			}
			
			if(!result)
				result = currNode.getParent();
			
			if(result && movePointer)
			{
				this.pointer--;
				this.currentNode = result;
			}
			return result;
		}
		
		/**
		 * return current node 
		 * @return Node
		 */
		
		this.getCurrent = function()
		{
			return this.currentNode;
		}
		
		/**
		 * check if current node has next node
		 * @return bool
		 */
		
		this.hasNext = function()
		{
			var result = this.getNext(false);
			return result ? true : false;
		}
		
		/**
		 * return next node
		 * @param optional movePointer = true
		 * @return Node
		 */
		
		this.getNext = function(movePointer)
		{
			var result = null;
			
			if(typeof movePointer != "boolean") movePointer = true;
			
			var currNode = this.currentNode;
			if(currNode.getChild(0) && !(currNode == this.rootNode && this.pointer > 0))
				result = currNode.getChild(0);
			else if(currNode.getRightNeighbour())
				result = currNode.getRightNeighbour();
			else
				while(currNode.getParent())
					if(currNode.getParent().getRightNeighbour())
					{
						result = currNode.getParent().getRightNeighbour();
						break;
					}
					else
						result = currNode = currNode.getParent();
			if(result && movePointer)
			{
				this.currentNode = result;
				this.pointer++;
			}
			return result;
		}
		
		/**
		 * reset internal pointer to root-node
		 */
		 
		this.reset = function()
		{
			this.currentNode = this.rootNode;
			this.pointer = 0;
		}
		
		/* * *
		 * convertSerializedTree()
		 * converts a serializedTree String into a Tree-Object
		 * Tree should be empty when using this function
		 * returns the tree object itself
		 * @access public
		 * @param String serializedTree
		 * @return Tree
		 */
		
		this.convertSerializedTree = function(serializedTree, pointer, lastVals, lastObjs, depth, treeObj)
		{
			if(!pointer)
			{
				var pointer = 0;
				var depth = 0;
				var lastVals = new Array();
				var lastObjs = new Array();
				var treeObj = this;
			}
			
			if(pointer != serializedTree.length)
			{
				//lese naechsten value aus
				var actLengthLen = parseInt(serializedTree.charAt(pointer));
				pointer ++;
				var actValLen = parseInt(serializedTree.substr(pointer, actLengthLen));
				pointer += actLengthLen;
				var actVal = serializedTree.substr(pointer, actValLen);
				pointer += actValLen;
				
				lastValsArrLen = lastVals.length;
				lastObjsArrLen = lastObjs.length;
				
				if(inArray(actVal, lastVals))
				{
					lastVals.length = lastValsArrLen-1;
					lastObjs.length = lastObjsArrLen-1;
					depth--;
				}
				else
				{	
					lastVals[lastValsArrLen] = actVal;
					
					//objects
					if(lastObjsArrLen == 0)
					{
						var parentNode = null;
					}
					else
					{
						parentNode = lastObjs[lastObjsArrLen-1];
					}
					//create new node
					actNode = new Node(actVal);
					//set depth property
					actNode.setProperty("depth",depth);
					//add node to tree
					if(lastObjsArrLen == 0)
					{	//create root node
						treeObj.setRootNode(actNode);
					}
					else
					{
						treeObj.addNode(actNode, parentNode);
					}
					//add node to lastObjs-array
					lastObjs[lastObjsArrLen] = actNode;
					depth++;
				}
				return this.convertSerializedTree(serializedTree, pointer, lastVals, lastObjs, depth, treeObj);
			}
			return treeObj;
		}
		
		/* * *
		 * getSubtree()
		 * returns a subtree of this tree as Default output. pStartNode will be the root of the returned tree
		 * @access public
		 * @param Node pStartNode
		 * @param [optional] Int pMaxDepth
		 * @return String
		 */
		
		this.getSubtree = function(pStartNode, pMaxDepth, pActNode, pChildNum, pDepth)
		{
			if(!pStartNode)
			{
				pStartNode = this.rootNode;
			}
			if(!pMaxDepth)
			{
				pMaxDepth = -1;
			}
			if(!pActNode)
			{
				subTreeDefaultOutput = "";
				pActNode = pStartNode;
				pDepth = 0;
			}
			var rightNeighbour = pActNode.getRightNeighbour();
			//save return value in variable
			for(i=0; i<pDepth; i++)
			{
				subTreeDefaultOutput += "> ";
			}
			subTreeDefaultOutput += pActNode.getId()+"<br>";
			//end save
			var children = pActNode.getChildren();
			var firstChild = children[0];
			if((children.length > 0) && ((pDepth < pMaxDepth) || (pMaxDepth == -1)))
			{
				pDepth++;
				pActNode = firstChild;
				this.getSubtree(pStartNode, pMaxDepth, pActNode, pChildNum, pDepth);
				pDepth--;
			}
			if(rightNeighbour != null)
			{
				pActNode = rightNeighbour;
				this.getSubtree(pStartNode, pMaxDepth, pActNode, pChildNum, pDepth);
			}
			return subTreeDefaultOutput;
		}
		
		//wenn serializedTree bei Objekterstellung uebergeben wurde, dann lese es in den Objektbaum ein
		if(pSerializedTree)
		{
			this.serializedTree = pSerializedTree;
			this.convertSerializedTree(this.serializedTree);
		}
	}
	
/* * *
 * CLASS Tree
 * @param [optional] string pSerializedTree
 * @param String|Int pId
 */

	function Node(pId)
	{
		this.parent = null;
		this.children = new Array();
		this.rightNeighbour = null;
		this.leftNeighbour = null;
		this.id = "";
		this.properties = new Array();
		
		if(pId)
		{
			this.id = pId;
		}
		
		this.addProperty = function(pKey, pValue)
		{
			this.properties[pKey] = pValue;
		}
		
		this.setProperty = function(pKey, pValue)
		{
			return this.properties[pKey] = pValue;
		}
		
		this.getProperty = function(pKey)
		{
			return this.properties[pKey];
		}
		
		this.getProperties = function()
		{
			return this.properties;
		}
		
		this.removeProperty = function(pKey)
		{
			var deleted = false;
			var properties_temp = new Array();

			for (var key in this.properties)
			{
				if(key != pKey)
				{
					properties_temp[key] = this.properties[key];
				}
				else
				{
					deleted = true;
				}
			}
			this.properties = properties_temp;
			return deleted;
		}
		
		this.setParent = function(pNodeObj)
		{
			this.parent = pNodeObj;
		}
		
		this.getParent = function()
		{
			return this.parent;
		}
		
		this.setChild = function(pNodeObj)
		{
			var childrenLen = this.children.length;
			this.children[childrenLen] = pNodeObj;
		}
		
		this.getChild = function(pChildPos)
		{
			return this.children[pChildPos];
		}
		
		this.getChildren = function()
		{
			return this.children;
		}
		
		this.hasChildren = function()
		{
			return this.children.length > 0;
		}
		
		this.setRightNeighbour = function(pNodeObj)
		{
			this.rightNeighbour = pNodeObj;
		}
		
		this.getRightNeighbour = function()
		{
			return this.rightNeighbour;
		}
		
		this.setLeftNeighbour = function(pNodeObj)
		{
			this.leftNeighbour = pNodeObj;
		}
		
		this.getLeftNeighbour = function()
		{
			return this.leftNeighbour;
		}
		
		this.setId = function(pStrId)
		{
			this.id = pStrId;
		}
		
		this.getId = function()
		{
			return this.id;
		}
		
		this.isRootNode = function()
		{
			return this.parent ? false : true;
		}
	}
	
///////////functions to handle serialized tree strings/////////////////////////////////

//array-funktion: sucht ein element in einem eindim. array
	function inArray(needle, arrHaystack)
	{
		var result = false;
		var arrHaystackLen = arrHaystack.length;
		for(var i=0; i<arrHaystackLen; i++)
		{
			if(arrHaystack[i] == needle)
			{
				result = needle;
			}
		}
		return result;
	}
	
//wandle serializedTree String in Tree-Objekt um/////////////////////////////////

	function serializedTreeToObject(serializedTree, pointer, lastVals, lastObjs, depth, treeObj)
	{
		//hole i-ten intwert aus String
		if(!pointer)
		{
			var pointer = 0;
			var depth = 0;
			var lastVals = new Array();
			var lastObjs = new Array();
			var treeObj = new Tree();
		}
		
		if(pointer != serializedTree.length)
		{
			//lese naechsten value aus
			var actLengthLen = parseInt(serializedTree.charAt(pointer));
			pointer += actLengthLen;
			var actValLen = parseInt(serializedTree.substr(pointer, actLengthLen));
			pointer += actLengthLen;
			var actVal = serializedTree.substr(pointer, actValLen);
			pointer += actValLen;
			
			lastValsArrLen = lastVals.length;
			lastObjsArrLen = lastObjs.length;
			
			if(inArray(actVal, lastVals))
			{
				lastVals.length = lastValsArrLen-1;
				lastObjs.length = lastObjsArrLen-1;
				depth--;
			}
			else
			{
				lastVals[lastValsArrLen] = actVal;
				
				//objects
				if(lastObjsArrLen == 0)
				{
					var parentNode = null;
				}
				else
				{
					parentNode = lastObjs[lastObjsArrLen-1];
				}
				//create new node
				actNode = new Node(actVal);
				//add node to tree
				if(lastObjsArrLen == 0)
				{	//create root node
					treeObj.setRootNode(actNode);
				}
				else
				{
					treeObj.addNode(actNode, parentNode);
				}
				//add node to lastObjs-array
				lastObjs[lastObjsArrLen] = actNode;
				depth++;
			}
			
			return serializedTreeToObject(serializedTree, pointer, lastVals, lastObjs, depth, treeObj)
		}
		return treeObj;
	}

/////////////////////////////////////////////////////////////////////////////////////////////////////////



/* forms.js */

/***Formular abschicken an angegebene adresse ***/
function submitForm(formName, /*optional*/ formAction, formMethod, targetWin)
{
	var formDefaultMethod = "post";
	if(!formMethod)
	{
		formMethod = formDefaultMethod;
	}
	else
	{
		if(formMethod != "get" || formMethod != "post")
		{
			formMethod = formDefaultMethod;
		}
	}
	var f = document.forms[formName];
	if(targetWin) f = targetWin.document.forms[formName]; 

	if(formAction)
		f.action = formAction;
	if(f.method)
	{
		try{
		f.method = formMethod;
		}
		catch(e)
		{}
	}
	/*if(document.getElementsByTagName('body') && document.getElementsByTagName('body')[0].style)
		document.getElementsByTagName('body')[0].style.cursor = 'wait';*/
	f.submit();
}

/***Formular loeschen***/
function resetForm(formName, /*optional*/targetWin)
{
	var f = document.forms[formName];
	if(targetWin) f = targetWin.document.forms[formName]; 
	f.reset();
	return false;
}

/***Funktionen fuer multiPageForm (mpf)***/
function multiPageForm(formName, /*optional*/ formAction, formMethod, targetWin)
{
	this.formName = formName;
	this.formAction = formAction;
	this.formMethod = formMethod;
	this.targetWin = targetWin;
	this.pageIdFieldName = "page_id";
	this.nextPageIdFieldName = "next_page_id";
	this.formObj = document.forms[formName];
	this.formElements = this.formObj.elements;

	this.submitForm = function()
	{
		var formMethod = "post";
		if(this.formMethod && (this.formMethod == "get" || this.formMethod == "post")) 
			formMethod = this.formMethod;
		var f = this.formObj;
		if(this.targetWin && this.targetWin != "") f = this.targetWin.document.forms[this.formName]; 
	
		if(this.formAction)
			f.action = this.formAction;
		if(f.method)
		{
			try{
			f.method = formMethod;
			}
			catch(e){}
		}
		f.submit();
	}

	this.goTo = function(pageId, nextPageId, /*optional*/ fieldValues)
	{
		if(!pageId) pageId = "";
		if(!nextPageId) nextPageId = "";
		/*if(nextPageId == "" && pageId != "")
		{
			nextPageId = pageId;
			pageId = "";
		}*/
		this.formElements[this.pageIdFieldName].value = pageId;
		this.formElements[this.nextPageIdFieldName].value = nextPageId;
		if(fieldValues && fieldValues.match(/(.*?\=.*?\&?)+/))
		{
			var fields = new Array();
			var parts = fieldValues.split("&");
			for(i=0;i<parts.length;i++)
			{
				var valKeyPair = parts[i].split("=");
				fields[valKeyPair[0]] = valKeyPair[1];
			}
			for(var key in fields)
			{
				this.formElements[key].value = fields[key];
			}
		}
		this.submitForm();
	}
}

/***Formular abschicken an angegebene adresse u. unbegr. Anzahl von Field-Values setzten***/
function setFieldValuesAndSubmitForm(formName, fieldNames, fieldValues, /*optional*/ formAction, formMethod, targetWin)
{
	var f = document.forms[formName];
	if(fieldNames && fieldValues)
	{
		if(typeof(fieldNames) != "string" && typeof(fieldValues) != "string")
		{
			for(var i=0;i<fieldNames.length;i++)
			{
				if(fieldValues[i]) f.elements[fieldNames[i]].value = fieldValues[i];
			}
		}
		else
		{
			f.elements[fieldNames].value = fieldValues;
		}
	}
	submitForm(formName, formAction, formMethod, targetWin);
}

/***Klasse u. Inhalt von Formularfeldern ändern (in Verbindung mit onFocus/onBlur)***/
function setCondition(formName, formElement, elementClassName, origValue)
{
	var path = document.forms[formName].elements[formElement];
	var val = path.value;
	var isEmpty = true;
	if(val != origValue)
	{
		for(i=0;i<val.length;i++)
		{
			if(val.charAt(i) != " ")
			{
				isEmpty = false;
			}
		}
		if(isEmpty)
		{
			path.value = origValue;
		}
	}
	else
	{
		path.value = "";
	}
	path.className = elementClassName;
}

/***Funktion, um die Referenz auf einen submit-button mit dem type=image zu bekommen***/

function getImageSubmitButton(/*String*/ formName)
{
	var f = document.forms[formName];
	var c = f.childNodes;
	var imageInputElement = null;
	search:
	for(var i1 in c)
	{
		if(c[i1].nodeName == "INPUT")
		{
			var a = c[i1].attributes;
			for(var i2 in a)
			{
				try{var n = a[i2].name;}
				catch(e){n = "type";}
				try
				{
					var av = a[i2].nodeValue;
					if(n == "type" && av == "image")
					{
						//image input element gefunden
						imageInputElement = c[i1];
						break search;
					}
				}
				catch(e){break search;}
			}
		}
	}
	return imageInputElement;
}

/**
 * loesche schon vorgegebene Felder eines Formulars
 * @name: resetInitalizedFields
 * @param String formName: name of the target-form
 * @param Array arrFieldNames: all field-names of the form
 * @param Boolean excludeFields: wether arrFieldNames should be an exclude oder include list (default: included in reset)
 */

function resetInitalizedFields(formName, arrFieldNames, excludeFields)
{
	var f = document.forms[formName];
	var els = f.elements;
	if(!arrFieldNames) arrFieldNames = new Array();
	if(typeof(arrFieldNames) != "object") arrFieldNames = new Array(arrFieldNames);
	var arrFieldNamesLen = arrFieldNames.length;
	if(!excludeFields) excludeFields = false;
	
	for(var i=0;i<els.length;i++)
	{
		trunc = excludeFields;
		var el = els[i];
		for(ii=0;ii<arrFieldNamesLen;ii++)
			if(el.name == arrFieldNames[ii])
				trunc = !excludeFields;
		if(trunc || arrFieldNamesLen == 0)
		{
			if(el.type && (el.type == "radio" || el.type == "checkbox"))
			{	 //to do...
				var checkboxGroup = el;
				if(checkboxGroup.value)
					checkboxGroup = new Array(checkboxGroup);
				for(iii=0;iii<checkboxGroup.length;iii++)
					checkboxGroup[iii].checked = false;
			}
			else
			{
				el.value = "";
			}
		}
	}
}

/***Ueberpruefung ob Eingabestring eine gueltige Datumsangabe ist [aktuell: datum darf nur in der vergangenheit liegen!]***/
function checkDate(str_date)
{
	var preg_date_format = /^[0-9]{2}\.[0-9]{2}\.[0-9]{4}$/;
	if(!str_date.match(preg_date_format))
	{
		//fehler im aufbau des date-strings
		return false;
	}
	else
	{
		//Ueberpruefe validen string weiter
		var date = new Date();
		var day_now = date.getDate();
		var month_now = (date.getMonth()+1);
		var year_now = date.getFullYear();
		
		var day = str_date.substr(0,2);
		var month = str_date.substr(3,2);
		var year = str_date.substr(6,4);
		day.charAt(0) == "0" ? day =  parseInt(day.charAt(1)) : parseInt(day);
		month.charAt(0) == "0" ? month = parseInt(month.charAt(1)) : parseInt(month);
		if((day > 31 || day < 1) || (month > 12 || month < 1) || (year < 1970))
		{
			return false;
		}
		else
		{
			var ts_now = Date.UTC(year_now,(month_now-1),day_now,00,00,00);
			var ts = Date.UTC(year,(month-1),day,00,00,00);
			if(ts > ts_now)
			{
				return false;
			}
			else
			{
				return true;
			}
		}
	}
}

/***Ueberpruefung ob Eingabestring eine gueltige Zeitangabe ist [erlaubt: HH:MM oder HH:MM:SS]**/

function checkTime(strTime)
{
	var pregTimeFormat = /^([0-9]{2}\:[0-9]{2}){1}(\:[0-9]{2})?$/;
	if(!strTime.match(pregTimeFormat))
	{
		//fehler im aufbau des date-strings
		return false;
	}
	else
	{
		var strTimeLen = strTime.length;
		var timeFormat = "short";
		if(strTimeLen == 8)
		{ 
			timeFormat = "long";
		}
		var h = "";
		var m = "";
		var s = "";
		strTime.charAt(0) == "0" ? h = parseInt(strTime.substr(1,1)) : h = parseInt(strTime.substr(0,2));
		strTime.charAt(3) == "0" ? m = parseInt(strTime.substr(4,1)) : m = parseInt(strTime.substr(3,2));
		if(timeFormat == "long")
		{
			s = strTime.substr(6,2);
			strTime.charAt(6) == "0" ? s = parseInt(strTime.substr(7,1)) : h = parseInt(strTime.substr(6,2));
		}
		if((h >= 0 && h <= 23) && (m >= 0 && m <= 59))
		{
			if((timeFormat == "long") && !(s >= 0 && s <= 59))
			{
				return false;
			}
			return true;
		}
	}
}


//check if a time period is valid
function checkPeriod(str_period_start, str_period_end)
{
	var preg_date_format = /^[0-9]{2}\.[0-9]{2}\.[0-9]{4}$/;
	if(!str_period_start.match(preg_date_format) || !str_period_end.match(preg_date_format))
	{
		//fehler im aufbau des date-strings
		return false;
	}
	else
	{
		var day_start = str_period_start.substr(0,2);
		var month_start = str_period_start.substr(3,2);
		var year_start = str_period_start.substr(6,4);
		day_start.charAt(0) == "0" ? day_start =  parseInt(day_start.charAt(1)) : parseInt(day_start);
		month_start.charAt(0) == "0" ? month_start = parseInt(month_start.charAt(1)) : parseInt(month_start);
		
		var day_end = str_period_end.substr(0,2);
		var month_end = str_period_end.substr(3,2);
		var year_end = str_period_end.substr(6,4);
		day_end.charAt(0) == "0" ? day_end =  parseInt(day_end.charAt(1)) : parseInt(day_end);
		month_end.charAt(0) == "0" ? month_end = parseInt(month_end.charAt(1)) : parseInt(month_end);
		
		var ts_start = Date.UTC(year_start,(month_start-1),day_start,00,00,00);
		var ts_end = Date.UTC(year_end,(month_end-1),day_end,00,00,00);
		
		if(ts_start > ts_end)
		{
			return false;
		}
		else
		{
			return true;
		}
	}
}

//validate formular time intervall
function validateTimeInterval(form, ePeriodStart, ePeriodEnd)
{
	if(!ePeriodStart) ePeriodStart = "period_start";
	if(!ePeriodEnd) ePeriodEnd = "period_end";
	
	var f = form;
	var period_start = f.elements[ePeriodStart].value;
	var period_end = f.elements[ePeriodEnd].value;
	
	if(period_start == "TT.MM.JJJJ")
	{
		period_start = "01.01.1970";
	}
	if(period_end == "TT.MM.JJJJ")
	{
		period_end = get_time("date");
	}
	
	var period_ok = false;
	var period_start_ok = checkDate(period_start); 
	var period_end_ok = checkDate(period_end);
	
	if(period_start_ok == true && period_end_ok == true)
	{
		if(checkPeriod(period_start, period_end))
		{
			period_ok = true;
		}
	}
	
	if(!period_start_ok || !period_end_ok || !period_ok)
	{
		var msg = "Bitte Überprüfen Sie Ihre Angaben in den Datums-Feldern!\n\n";
		msg += "Ihre Angabe: "+period_start+" - "+period_end+"\n\n";
		msg += "Sie haben entweder ein Datum in ungueltigem Format eingeben\n";
		msg += "oder der angegebene Zeitraum ist ungueltig oder überschreitet das gueltige Zeitfenster\n";
		msg += "(Zeitfenster: 01.01.1970 - heute)";
		alert(msg);
		f.elements[ePeriodStart].focus();
		return false;
	}
}

//manage custom button

function activateCustomButton(idButtonLeft, idButtonMiddle, idButtonRight)
{
	var bLeft = document.getElementById(idButtonLeft);
	var bMiddle = document.getElementById(idButtonMiddle);
	var bRight = document.getElementById(idButtonRight);
	bLeft.src = "img/button_left_over.gif";
	bMiddle.className = "customButtonOver";
	bRight.src = "img/button_right_over.gif";
}

function deactivateCustomButton(idButtonLeft, idButtonMiddle, idButtonRight)
{
	var bLeft = document.getElementById(idButtonLeft);
	var bMiddle = document.getElementById(idButtonMiddle);
	var bRight = document.getElementById(idButtonRight);
	bLeft.src = "img/button_left.gif";
	bMiddle.className = "customButton";
	bRight.src = "img/button_right.gif";
}

//check fields

function switchFieldsCondition(formName, fieldArray, condition)
{
	if(!condition) condition = true;
	var f = document.forms[formName];
	if(fieldArray && typeof(fieldArray) == "string") fieldArray = new Array(fieldArray);
	if(fieldArray)
	{
		for(i=0;i<fieldArray.length;i++)
		{
			var currFieldObj = f.elements[fieldArray[i]];
			currFieldObj.checked = condition;
		}
	}
}

//get select object

function getSelectObject(formName, selectName)
{
	var selectObj = null;
	var f = document.forms[formName];
	if(f) selectObj = f.elements[selectName];
	return selectObj;
}

//get selected index

function getSelectedIndex(selectObj)
{
	var selectObjIndex = -1;
	if(selectObj) selectObjIndex = selectObj.selectedIndex;
	return selectObjIndex;
}

//get selected value of a select-list

function getSelectValue(formName, selectName)
{
	var selectObjValue = null;
	var selectObj = getSelectObject(formName, selectName)
	var selectObjIndex = getSelectedIndex(selectObj);
	if(selectObjIndex != -1) selectObjValue = selectObj[selectObjIndex].value;
	return selectObjValue;
}

//get selected text of a select-list

function getSelectText(formName, selectName)
{
	var selectObjText = null;
	var selectObj = getSelectObject(formName, selectName)
	var selectObjIndex = getSelectedIndex(selectObj);
	if(selectObjIndex != -1) selectObjText = selectObj[selectObjIndex].text;
	return selectObjText;
}

//move an selected option of a select list to another select list

function move_option(formName, selectNameFrom, selectNameTo)
{
	var f = document.forms[formName];
	var selectFrom = f.elements[selectNameFrom];
	var selectTo = f.elements[selectNameTo];
	var fromIndex = selectFrom.selectedIndex;
	if(fromIndex != -1)
	{
		var option = new Option(selectFrom[fromIndex].text, selectFrom[fromIndex].value);
		var title = (selectFrom[fromIndex].title) ? selectFrom[fromIndex].title : "";
		option.setAttribute("title", title);
		selectFrom[fromIndex] = null;
		selectTo[selectTo.length] = option;
	}
}

//add an option to a select list

function addSelectOption(formName, selectName, optionText, optionValue, newPosition, selectedValue)
{
	if(!newPosition) newPosition = 0;
	var f = document.forms[formName];
	var selectObj= f.elements[selectName];
	var objIndex = selectObj.selectedIndex;
	if(objIndex != -1)
	{
		var option = new Option(optionText, optionValue);
		var selectObjLen = selectObj.length;
		var i=0;
		var tmpOption = false;
		while(i<=selectObjLen && !tmpOption)
		{
			if(i==newPosition)
			{
				tmpOption = selectObj[i];
				selectObj[i] = option;
			}
			i++;
		}
		if(tmpOption)
		{
			var tmp = new Object();
			for(i; i<=selectObjLen; i++)
			{
				tmp = selectObj[i];
				selectObj[i] = tmpOption;
				tmpOption = tmp;
			}
		}
	}
	
	if(selectedValue)
	for(var i=0; i<selectObj.length; i++)
	{
		if(selectObj[i].value == selectedValue) selectObj[i].selected = true;
	}
}

//get number of options
function getOptionsNum(formName, selectName)
{
	var result = false;
	var f = document.forms[formName];
	var selObj = f.elements[selectName];
	result = selObj.options.length;
	return result;
}

// add an option to a select list
function addSelectOption(formName, selectName, optionName, optionValue)
{
	var f = document.forms[formName];
	var selObj = f.elements[selectName];
	var selOptions = selObj.options;
	var selOptionsLen = selOptions.length;
	
	if(!optionValue) optionValue = "";
	var optionObj = new Option(optionName, optionValue);
	selOptions[selOptionsLen] = optionObj;
}

//remove an option of a select list

function removeSelectOption(formName, selectName, optionIdentifier, identifierType, selected)
{
	if(!identifierType) identifierType = "value";
	if(selected != false)
		selected = true;
		
	var f = document.forms[formName];
	var selectObj= f.elements[selectName];
	var objIndex = true;
	if(selected) objIndex = selectObj.selectedIndex;
	if(objIndex != -1)
		for(var i=0; i<selectObj.length; i++)
		{
			if(selectObj[i][identifierType] == optionIdentifier)
				selectObj[i] = null;
		}
}

//get all selected options from a multiple select.

/*function getSelectedOptions(formName, selectName, deselect)
{
	if(deselect != false) deselect = false;
	var selectedOptions = new Array();
	var formObj = document.forms[formName];
	var selObj = formObj.elements[selectName];
	while (selObj.selectedIndex != -1)
	{
		selectedOptions[selectedOptions.length] = selObj.options[selObj.selectedIndex];
		selObj.options[selObj.selectedIndex].selected = false; 
	}
	//reselect options
	if(!deselect)
	{
		selectedOptionsLen = selectedOptions.length;
		for(var i=0;i<selectedOptionsLen;i++)
			selectedOptions[i].selected = true;
	}
	return selectedOptions;
}*/

function getSelectedOptions(formName, selectName)
{
    var selectedOptions = new Array();
    var formObj = document.forms[formName];
	var selObj = formObj.elements[selectName];
	var optionsLen = selObj.options.length
    for (var i=0; i<optionsLen; i++) 
	      if (selObj.options[i].selected) selectedOptions[selectedOptions.length] = selObj.options[i];
    return selectedOptions;
}

//check if an option exists
function selectOptionExists(formName, selectName, optionIdentifier, identifierType)
{
	exists = false;
	if(!identifierType) identifierType = "value";
	var f = document.forms[formName];
	var selObj = f.elements[selectName];
	var selOptions = selObj.options;
	var selOptionsLen = selOptions.length;
	for(var i=0;i<selOptionsLen;i++)
		if(selOptions[i][identifierType] == optionIdentifier)
			exists = true;
	return exists;
}

//select options of different select-lists (usefull if values should be sent with request)
function selectExistingOptions(formName, selectNames)
{
	var f = document.forms[formName];
	if(!selectNames[0]) selectNames = new Array(selectNames);
	var selectNamesLen = selectNames.length;
	for(var i1=0;i1<selectNamesLen;i1++)
	{
		var selObj = f.elements[selectNames[i1]];
		for(var i2=0;i2<selObj.options.length;i2++)
			selObj.options[i2].selected = "selected";
	}
}

/***moveSelectOptions()***
* @purpose: move selected Options of a Select to another Select.
* default behaviour is, that all selected options are moved.
* you can also specify optionKeys (values or texts - specified by optionKeyType) 
* that should be moved, selected are ignored in this case.
* @access: public
* @param: string formName
* @param: string fromSelectName
* @param: string toSelectName
* [@param: array optionKeys]
* [@param: string optionKeyType ('value'|'text'); default: 'value']
* [@param: string fromEmptyNoteValue (Hinweis in Form einer Option (value-wert), wenn keine Option mehr vorhanden)]
* [@param: string fromEmptyNoteText (Hinweis in Form einer Option (text-wert), wenn keine Option mehr vorhanden)]
* [@param: string toEmptyNoteValue (Hinweis in Form einer Option (value-wert), wenn in to-Select-Feld keine Option mehr vorhanden)]
* [@param: string toEmptyNoteText (Hinweis in Form einer Option (text-wert), wenn in to-Select-Feld keine Option mehr vorhanden)]
*/

function moveSelectOptions(formName, fromSelectName, toSelectName, /*optional*/optionKeys, optionKeyType, fromEmptyNoteValue, fromEmptyNoteText, toEmptyNoteValue, toEmptyNoteText)
{
	var confirmLimitStep = 3000;
	if(!optionKeyType) optionKeyType = "value";
	var formObj = document.forms[formName];
	var fromSelObj = formObj.elements[fromSelectName];
	var toSelObj = formObj.elements[toSelectName];
	var toSelObjOptions = toSelObj.options;
	var	selOptions = new Array();
	var fromSelObjOptions = fromSelObj.options;
	var fromSelObjOptionsLen = fromSelObjOptions.length;
	//if optionKeys not given, search for selected options
	if(!optionKeys) selOptions = getSelectedOptions(formName, fromSelectName);
	else
	{
		var optionKeysLen = optionKeys.length;
		for(var i1=0; i1<fromSelObjOptionsLen; i1++)
			for(var i2=0; i2<optionKeysLen; i2++)
				if(fromSelObjOptions[i1][optionKeyType] == optionKeys[i2])
					selOptions[selOptions.length] = fromSelObjOptions[i1][optionKeyType];
	}
	//copy each selected option to its new location
	var selOption;
	var nextMaxValue = confirmLimitStep;
	for(var i1=0; i1<selOptions.length; i1++)
	{
		selOption = new Option(selOptions[i1].text, selOptions[i1].value);
		if(!fromEmptyNoteText || (fromEmptyNoteText && (fromEmptyNoteText != selOption.text)))
		{
			//delete option from fromSelect
			selOptions[i1] = null;
			for(var i2=0; i2<fromSelObjOptions.length; i2++)
				if(fromSelObjOptions[i2][optionKeyType] == selOption[optionKeyType])
				{
					//delete option from select
					fromSelObjOptions[i2] = null;
					break;
				}
			//if option was last option in from-Select and fromEmptyNoteText is given, then add option with fromEmptyNoteText
			if(fromEmptyNoteText && fromEmptyNoteValue && fromSelObjOptions.length == 0)
				fromSelObjOptions[fromSelObjOptions.length] = new Option(fromEmptyNoteText, fromEmptyNoteValue);
			//if only one toSel-option and toSel-option equals toEmptyNoteText, then delete this option
			if(toEmptyNoteText && toEmptyNoteValue && toSelObjOptions.length == 1 && toSelObjOptions[0].text == toEmptyNoteText && toSelObjOptions[0].value == toEmptyNoteValue)
				toSelObj[0] = null;
			//add option to toSelect
			toSelObjOptions[toSelObjOptions.length] = selOption;
		}
		if(nextMaxValue != -1 && i1 >= nextMaxValue)
			if(!confirm(nextMaxValue+" Empfänger wurden bereits verschoben.\nSoll der Vorgang fortgesetzt werden?")) 
				break;
			else 
				nextMaxValue = nextMaxValue + confirmLimitStep;
	}
}

/***moveSelectOptionsToMultipleSelects()***
* @purpose: move selected Options of a Select to multiple Selects by specifying 
* multiple toSelectNames and corresponding Regular Expressions (using array position) in optionMatches.
* If a Regular Expression matches the value or text (specified by optionMatchType) the appropriate
* option will be moved to the corresponding toSelect-Object
*
* @access: public
* @param: string formName
* @param: string fromSelectName
* @param: array toSelectNames
* @param: RegExp Array optionMatches: an array of regular expressions
* [@param: string optionKeyType: ('value'|'text'); default: 'value']
* [@param: string fromEmptyNoteValue (Hinweis in Form einer Option (value-wert), wenn keine Option mehr vorhanden)]
* [@param: string fromEmptyNoteText (Hinweis in Form einer Option (text-wert), wenn keine Option mehr vorhanden)]
* [@param: array toEmptyNoteValues (Hinweis pro toSelect-Feld jeweils in Form einer Option (value-werte), wenn in entsprechendem to-Select-Feld keine Option mehr vorhanden)]
* [@param: array toEmptyNoteTexts (Hinweis pro toSelect-Feld jeweils in Form einer Option (text-werte), wenn in entsprechendem to-Select-Feld keine Option mehr vorhanden)]
*/


function moveSelectOptionsToMultipleSelects(formName, fromSelectName, toSelectNames, optionMatches, optionKeyType, fromEmptyNoteValue, fromEmptyNoteText, toEmptyNoteValues, toEmptyNoteTexts)
{
	var confirmLimitStep = 3000;
	if(!optionKeyType) optionKeyType = "value";
	if(!toSelectNames[0]) toSelectNames = new Array(toSelectNames);
	var formObj = document.forms[formName];
	var fromSelObj = formObj.elements[fromSelectName];
	var fromSelObjOptions = fromSelObj.options;
	var toSelObjs = new Array();	
	var toSelectNamesLen = toSelectNames.length;
	for(var i1=0; i1<toSelectNamesLen; i1++)
		if(formObj.elements[toSelectNames[i1]])
			toSelObjs[toSelObjs.length] = formObj.elements[toSelectNames[i1]];
	var toSelObjsLen = toSelObjs.length;
	
	selOptions = getSelectedOptions(formName, fromSelectName, optionKeyType);
	//copy each selected option to its new location
	var selOption;
	var nextMaxValue = confirmLimitStep;
	for(var i1=0; i1<selOptions.length; i1++)
	{
		selOption = new Option(selOptions[i1].text, selOptions[i1].value);
		//add option to matching toSelect
		for(var i2=0; i2<toSelObjsLen; i2++)
		{
			var toSelObj = toSelObjs[i2];
			var regExp = new RegExp(optionMatches[i2]);
			if(regExp.exec(selOption[optionKeyType]) != null && (!fromEmptyNoteText || (fromEmptyNoteText && (fromEmptyNoteText != selOption.text))))
			{
				//delete option from fromSelect
				selOptions[i1] = null;
				for(var i3=0; i3<fromSelObjOptions.length; i3++)
					if(fromSelObjOptions[i3][optionKeyType] == selOption[optionKeyType])
					{	//delete option from select
						fromSelObjOptions[i3] = null;
						break;
					}
				//if fromEmptyNoteText is given and option was last option in from-Select-List, then add option with fromEmptyNoteText
				if(fromEmptyNoteValue && fromEmptyNoteText && fromSelObjOptions.length == 0)
					fromSelObjOptions[fromSelObjOptions.length] = new Option(fromEmptyNoteText, fromEmptyNoteValue);
				//if only one toSel-option and toSel-option equals toEmptyNoteTexts[i], then delete this option
				if(toEmptyNoteTexts && toEmptyNoteValues && toSelObj.options.length == 1 && toSelObj[0].text == toEmptyNoteTexts[i2] && toSelObj[0].value == toEmptyNoteValues[i2])
					toSelObj[0] = null;
				toSelObj.options[toSelObj.options.length] = selOption;
				break;
			}
		}
		if(nextMaxValue != -1 && i1 >= nextMaxValue)
			if(!confirm(nextMaxValue+" Empfänger wurden bereits verschoben.\nSoll der Vorgang fortgesetzt werden?")) 
				break;
			else 
				nextMaxValue = nextMaxValue + confirmLimitStep;
	}
}

/**
 * kopiere einen selektierten Wert eines Select-Felds in ein Hidden-Field
 * @param string selectName
 * @param string hiddenFieldName
 * @return boolean
 */

function copySelectedValueIntoHiddenField(formName, selectName, hiddenFieldName, errorOnEmptySelValue)
{
	var result = false;
	var f = document.forms[formName];
	var selValue = getSelectValue(formName, selectName);
	if((selValue != null && selValue != "undefined") && !(errorOnEmptySelValue == true && selValue == ""))
	{
		f[hiddenFieldName].value = selValue;
		result = true;
	}
	return result;
}

/**
 * kopiere einen Wert eines Felds in ein Hidden-Field
 * @param string formName
 * @param string fieldName
 * @param string hiddenFieldName
 * @param boolean errorOnEmptyFieldValue = false
 * @param string errorMsgOnEmptyFieldValue = ""
 * @param boolean submitForm = false
 * @param string formAction = null
 * @param string formMethod = null
 * @param string targetWin = null
 * @return boolean
 */
 
function copyInputValueIntoHiddenField(formName, fieldName, hiddenFieldName/*optional*/, errorOnEmptyFieldValue, errorMsgOnEmptyFieldValue, doSubmitForm, formAction, formMethod, targetWin)
{
	var result = false;
	var f;
	var field;
	var hiddenField;
	
	if(!document.forms[formName])
	{
		alert("function copyInputValueIntoHiddenField: Das Formular '"+formName+"' existiert nicht.");
		return false;
	}
	else
		f = document.forms[formName];
	
	if(!f.elements[fieldName])
	{
		alert("function copyInputValueIntoHiddenField: Das Feld '"+fieldName+"' im Formular '"+formName+"' existiert nicht.");
		return false;
	}
	else
		field = f.elements[fieldName];
		
	if(!f.elements[hiddenFieldName])
	{
		alert("function copyInputValueIntoHiddenField: Das Feld '"+hiddenFieldName+"' im Formular '"+formName+"' existiert nicht.");
		return false;
	}
	else
		hiddenField = f.elements[hiddenFieldName];
	
	hiddenField.value = field.value;
	if((field.value != "") || (errorOnEmptyFieldValue == false && field.value == ""))
	{
		f[hiddenFieldName].value = field.value;
		result = true;
		if(doSubmitForm)
		{
			submitForm(formName, formAction, formMethod, targetWin);
		}
	}
	if(!result && errorOnEmptyFieldValue && errorMsgOnEmptyFieldValue)
		alert(errorMsgOnEmptyFieldValue);
	return result;
}


/**
 * implode a select list to a string and put it into a specified (hidden) field
 * @param formName
 * @param selectName
 * @param targetFieldName
 * @param [optional] separator default:,
 * @param [optional] ignoreValues default: array()
 * @param [optional] selectedOnly default: false
 */

function implodeSelectToHiddenField(formName, selectName, targetFieldName,/*optional*/seperator,/*optional*/ignoreValues,/*optional*/selectedOnly)
{
	if(!seperator) seperator = ",";
	if(typeof(ignoreValues) == "string")
		ignoreValues = new Array(ignoreValues);
	var f = document.forms[formName].elements;
	var options = f[selectName].options;
	var options_len = options.length;
	var str = "";
	if(options_len > 0)
	{
		for(var i=0;i<options_len;i++)
		{
			var ignore = false;
			if(ignoreValues)
			{
				for(var i2=0;i2<ignoreValues.length;i2++)
					if(ignoreValues[i2] == options[i].value)
					{
						ignore = true;
						break;
					}
			}
			if(selectedOnly && !options[i].selected)
				ignore = true;
			if(!ignore) str += options[i].value + ",";
		}
	}
	if(str != "") str = str.substr(0,str.length-1);
	f[targetFieldName].value = str;
}

//implode multiple select lists to strings and put them into specified (hidden) fields

function implodeSelectsToHiddenFields(formName, selectNamePrefix, targetFieldNamePrefix, /*optional*/seperator,/*optional*/ignoreValues,/*optional*/selectedOnly)
{
	if(!seperator) seperator = ",";
	var f = document.forms[formName];
	
	//find checkboxes and targets
	var select_names = new Array();
	var field_names = new Array();
	var selects = new Array();
	var fields = new Array();
	
	var regexp_selects = new RegExp("^"+selectNamePrefix+".*$");
	var regexp_fields = new RegExp("^"+targetFieldNamePrefix+".*$");
	//first use assoc. arrays to prevent double entries
	for(i=0;i<f.length;i++)
	{
		var element = f[i];
		if(element.name.match(regexp_selects))
			select_names[element.name] = element.name;
		if(element.name.match(regexp_fields))
			field_names[element.name] = element.name;
	}

	for(k in select_names)
		selects[selects.length] = f.elements[k];
	for(k in field_names)
		fields[fields.length] = f.elements[k];
	
	//implode all checkboxes to their hidden fields	
	selectNamePrefixLen = selectNamePrefix.length;
	fieldNamePrefixLen = targetFieldNamePrefix.length;

	for(sn in select_names)
	{
		for(fn in field_names)
		{	//use regexp to compare the names, if e.g. one name is 'arrayed',like name[]
			var sn_substr = sn.substr(selectNamePrefixLen);
			var fn_substr = fn.substr(fieldNamePrefixLen);
			(sn_substr.length < fn_substr.length) ? substr_regexp_part = sn_substr : substr_regexp_part = fn_substr;
				regexp_names = new RegExp("^.*"+substr_regexp_part+".*$");
			if(sn.match(regexp_names) && fn.match(regexp_names))
			{
				var curr_select = f.elements[sn];
				var options = f.elements[sn].options;
				var options_len = options.length;
				var str = "";
				if(options_len > 0)
				{
					for(i=0;i<options_len;i++)
					{
						var ignore = false;
						if(ignoreValues)
						{
							for(var i2=0;i2<ignoreValues.length;i2++)
								if(ignoreValues[i2] == options[i].value)
								{
									ignore = true;
									break;
								}
						}
						if(selectedOnly && !options[i].selected)
							ignore = true;
						if(!ignore)
						{
							str+= options[i].value;
							if(i != options_len-1 && !(selectedOnly && options[i+1] && !options[i+1].selected)) 
								str+= ",";
						}
					}
				}
				f.elements[fn].value = str;
			}
		}
	}
}

//implode checkboxes to (hidden) field 
function implodeCheckboxGroupToHiddenField(formName, checkboxGroupName, targetFieldName,/*optional*/selectedOnly, notSelectedOnly, targetWin)
{
	var f = document.forms[formName];
	if(targetWin) f = targetWin.document.forms[formName];
	if(!selectedOnly) selectedOnly = false;
	if(selectedOnly != true) selectedOnly = false;
	if(!notSelectedOnly) notSelectedOnly = false;
	if(notSelectedOnly != true) notSelectedOnly = false;
	var checkboxGroup = f.elements[checkboxGroupName];
	if(checkboxGroup)
	{
		var checkedValues = new Array();
		if(checkboxGroup.value)
		{
			checkboxGroup = new Array(checkboxGroup);
		}
		for(i=0;i<checkboxGroup.length;i++)
		{
			if((!selectedOnly && !notSelectedOnly) || (selectedOnly && checkboxGroup[i].checked) || (notSelectedOnly && !checkboxGroup[i].checked))
				checkedValues[checkedValues.length] = checkboxGroup[i].value;
		}
		checkedValuesStr = checkedValues.join(",");

		f.elements[targetFieldName].value = checkedValuesStr;
	}
}

//implode multiple checkboxes to multiple (hidden) fields by prefix
function implodeCheckboxGroupsToHiddenFields(formName, checkboxGroupNamePrefix, targetFieldNamePrefix,/*optional*/selectedOnly, notSelectedOnly, targetWin)
{
	var f = document.forms[formName];
	if(targetWin) f = targetWin.document.forms[formName];
	if(!selectedOnly) selectedOnly = false;
	if(selectedOnly != true) selectedOnly = false;
	if(!notSelectedOnly) notSelectedOnly = false;
	if(notSelectedOnly != true) notSelectedOnly = false;
	
	//find checkboxes and targets
	var checkboxes_names = new Array();
	var field_names = new Array();
	var checkboxes = new Array();
	var fields = new Array();
	
	var regexp_checkboxes = new RegExp("^"+checkboxGroupNamePrefix+".*$");
	var regexp_fields = new RegExp("^"+targetFieldNamePrefix+".*$");
	//first use assoc. arrays to prevent double entries
	for(i=0;i<f.length;i++)
	{
		var element = f[i];
		if(element.name.match(regexp_checkboxes))
			checkboxes_names[element.name] = element.name;
		if(element.name.match(regexp_fields))
			field_names[element.name] = element.name;
	}
	
	for(k in checkboxes_names)
		checkboxes[checkboxes.length] = f.elements[k];
	for(k in field_names)
		fields[fields.length] = f.elements[k];

	//implode all checkboxes to their hidden fields	
	checkboxGroupNamePrefixLen = checkboxGroupNamePrefix.length;
	targetFieldNamePrefixLen = targetFieldNamePrefix.length;

	for(cn in checkboxes_names)
	{
		for(fn in field_names)
		{	//use regexp to compare the names, if e.g. one name is 'arrayed',like name[]
			var cn_substr = cn.substr(checkboxGroupNamePrefixLen);
			var fn_substr = fn.substr(targetFieldNamePrefixLen);
			(cn_substr.length < fn_substr.length) ? substr_regexp_part = cn_substr : substr_regexp_part = fn_substr;
				regexp_names = new RegExp("^.*"+substr_regexp_part+".*$");
			if(cn.match(regexp_names) && fn.match(regexp_names))
			{
				var values = new Array();
				var curr_checkboxes = f.elements[cn];
				if(curr_checkboxes.value)
				{
					curr_checkboxes = new Array(curr_checkboxes);
				}
				for(i=0;i<curr_checkboxes.length;i++)
				{
					if((!selectedOnly && !notSelectedOnly) || (selectedOnly && curr_checkboxes.checked) || (notSelectedOnly && !curr_checkboxes.checked))
						values[values.length] = curr_checkboxes[i].value;
				}
				valuesStr = values.join(",");
				f.elements[fn].value = valuesStr;
			}
		}
	}
}


//return all checked checkboxes of a checkbox group as object-array
function getChecked(formName, checkboxGroupName)
{
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	var checkedBoxes = new Array();
	for(i=0;i<checkboxGroup.length;i++)
	{
		if(checkboxGroup[i].checked)
		{
			checkedBoxes[checkedBoxes.length] = checkboxGroup[i];
		}
	}
	return checkedBoxes;
}

//return all checked checkbox values of a checkbox group as string-array
function getCheckedValues(formName, checkboxGroupName)
{
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	if(checkboxGroup)
	{
		var checkedValues = new Array();
		for(i=0;i<checkboxGroup.length;i++)
		{
			if(checkboxGroup[i].checked)
				checkedValues[checkedValues.length] = checkboxGroup[i].value;
		}
	}
	return checkedValues;
}

//remark a group of checkboxes
function remarkCheckboxes(formName, checkboxGroupName, checkboxValues)
{
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	for(i=0;i<checkboxGroup.length;i++)
	{
		for(ii=0; ii<checkboxValues.length; ii++)
		{	
			if(checkboxGroup[i].value == checkboxValues[ii])
			{
				checkboxGroup[i].checked = true;
			}
		}
	}
}

//switch the condition of (a) group(s) of checkboxes, released by triggerCheckbox
function switchCheckboxCondition(formName, triggerCheckboxName, checkboxGroupNames, forceCondition)
{
	var f = document.forms[formName];
	var trigger = f.elements[triggerCheckboxName];
	var newCondition = false;
	if(!checkboxGroupNames[0]) checkboxGroupNames = new Array(checkboxGroupNames);
	var checkboxGroupNamesLen = checkboxGroupNames.length;
	for(var i=0;i<checkboxGroupNamesLen;i++)
	{
		var checkboxGroup = f.elements[checkboxGroupNames[i]];
		if(typeof(forceCondition) == undefined)
			if(trigger.checked == true) newCondition = true;
		else
			newCondition = forceCondition;
		if(checkboxGroup.value) checkboxGroup = new Array(checkboxGroup);
		for(var ii=0;ii<checkboxGroup.length;ii++) 
			checkboxGroup[ii].checked = newCondition;
	}
}

/****
 * swapCheck()
 * purpose: swap the check of 2 checkboxes
 * @access public
 * @param string formName
 * @param string checkboxGroupName
 * @return object
 *
 */

function swapCheck(formName, checkboxName1, checkboxName2, forceCheck)
{
	var f = document.forms[formName];
	f.elements[checkboxName1].checked ? f.elements[checkboxName1].checked = true : f.elements[checkboxName1].checked = false;
	f.elements[checkboxName2].checked = false;
}

/****
 * getGroupValues()
 * purpose: return all values of a checkbox- or radiogroup
 * @access public
 * @param string formName
 * @param string checkboxGroupName
 * @return object
 *
 */

function getGroupValues(formName,checkboxGroupName)
{
	var checkboxValues = new Array();
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	if(!checkboxGroup[0]) checkboxGroup = new Array(checkboxGroup);
	checkboxGroupLen = checkboxGroup.length;
	for(var i=0;i<checkboxGroupLen;i++)
	{
		checkboxValues[checkboxValues.length] = checkboxGroup[i].value;
	}
	return checkboxValues;
}

/****
 * getChecked(formName,checkboxGroupName)
 * purpose: return the checked object of a checkbox- or radiogroup
 * @access public
 * @param string formName
 * @param string checkboxGroupName
 * @return object
 *
 */

function getChecked(formName,checkboxGroupName)
{
	var checkedBox = false;
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	if(!checkboxGroup[0]) checkboxGroup = new Array(checkboxGroup);
	checkboxGroupLen = checkboxGroup.length;
	for(var i=0;i<checkboxGroupLen;i++)
	{
		if(checkboxGroup[i].checked) checkedBox = checkboxGroup[i];
	}
	return checkedBox;
}

/****
 * getUnchecked(formName,checkboxGroupName)
 * purpose: return all checkbox- or radio buttons that are not checked within a checkbox group
 * @access public
 * @param string formName
 * @param string checkboxGroupName
 * @return object-array
 *
 */

function getUnchecked(formName,checkboxGroupName)
{
	var uncheckedBoxes = new Array();
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	if(!checkboxGroup[0]) checkboxGroup = new Array(checkboxGroup);
	checkboxGroupLen = checkboxGroup.length;
	for(var i=0;i<checkboxGroupLen;i++)
	{
		if(!checkboxGroup[i].checked) uncheckedBoxes[uncheckedBoxes.length] = checkboxGroup[i];
	}
	return uncheckedBoxes;
}

/****
 * getUncheckedValues(formName,checkboxGroupName)
 * purpose: return all checkbox- or radio button - values that are not checked within a checkbox group
 * @access public
 * @param string formName
 * @param string checkboxGroupName
 * @return string-array
 *
 */

function getUncheckedValues(formName,checkboxGroupName)
{
	var uncheckedBoxesValues = new Array();
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	if(!checkboxGroup[0]) checkboxGroup = new Array(checkboxGroup);
	checkboxGroupLen = checkboxGroup.length;
	for(var i=0;i<checkboxGroupLen;i++)
	{
		if(!checkboxGroup[i].checked) uncheckedBoxesValues[uncheckedBoxesValues.length] = checkboxGroup[i].value;
	}
	return uncheckedBoxesValues;
}

//validate isin / wkn
function isValidIsin(isin)
{
	var result = false;
	var regexp_isin = new RegExp("^[A-Za-z]{2}[A-Za-z0-9]{10}$");
	if(isin.match(regexp_isin))
	{
		result = true;
	}
	return result;
}

function isValidWkn(wkn)
{
	var result = false;
	regexp_wkn = new RegExp("^[0-9A-Za-z]{6}$");
	if(wkn.match(regexp_wkn))
	{
		result = true;
	}
	return result;
}

//parse an integer but note decimal places
function parseIntNoteDec(str, seperator)
{
	var result = 0;
	if(!seperator) seperator = ".";
	var numParts = str.split(seperator);
	var add = 0;
	if(numParts.length > 1)
	{
		var numDecPlaces = numParts[1].length;
		var fullNumStr = numParts[0]+numParts[1];
		var newFullNumStr = "";
		var i=0;
		while(fullNumStr.charAt(i) == "0")
		{
			i++;
			newFullNumStr = fullNumStr.substr(i);
		}
		var fullNum = parseInt(newFullNumStr);
		var quotient = "1";
		for(i=0;i<numDecPlaces;i++)
			quotient += "0";
		quotient = parseInt(quotient);
		result = parseInt(fullNum)/quotient;
	}
	else
	{
		result = parseInt(str);
	}
	return result;
}

//calculate total size of different values switched by checkboxes
function calculateTotalSize(formName, checkboxGroupName, rootIdPrefix, targetId, seperator, roundPrecision, startValue)
{
	if(!startValue || startValue == "") startValue = "0";
	var totalSize = parseIntNoteDec(startValue, seperator);
	var f = document.forms[formName];
	if(!roundPrecision || roundPrecision < 0 || roundPrecision > 10) roundPrecision = 2;
	if(!seperator) seperator = ".";
	var checkboxGroup = f.elements[checkboxGroupName];
	var idValues = new Array();
	if(checkboxGroup.value)
	{
		checkboxGroup = new Array(checkboxGroup);
	}
	for(var i=0;i<checkboxGroup.length;i++)
	{
		var currNode = document.getElementById(rootIdPrefix+checkboxGroup[i].value);
		var currNodeValue = "0";
		if(currNode.firstChild && currNode.firstChild.nodeValue) 
			currNodeValue = currNode.firstChild.nodeValue;
		currNodeValue = parseIntNoteDec(currNodeValue, seperator);
		if(checkboxGroup[i].checked)
		{
			totalSize += currNodeValue;
		}
	}
	var vStr = "1";
	for(var i=0;i<parseInt(roundPrecision);i++)
		vStr += "0";
	var v = parseInt(vStr);
	totalSize = Math.round(totalSize*v)/v;
	var numParts = String(totalSize).split(".");
	if(numParts[1])
	{
		totalSize = numParts[0]+seperator+numParts[1];
		var rest = roundPrecision - numParts[1].length;
		if(rest != 0)
		{
			for(i=0; i<rest; i++)
			totalSize += "0";
		}
	}
	if(totalSize == "0") totalSize="0"+seperator+vStr.substr(1);
	if(targetId)
	{
		document.getElementById(targetId).firstChild.nodeValue = totalSize;
	}
	else
	{
		return totalSize;
	}
}

//switch display of an object.
function switchExtensionView(id, /*optional*/formName, /*optional*/checkboxName)
{
	var obj = document.getElementById(id);
	var newVal = 'none';
	if(formName && checkboxName)
	{
		var f = document.forms[formName];
		var checkboxChecked = f.elements[checkboxName].checked;
		if(checkboxChecked)
		newVal = '';
	}
	else
	{
		var oldVal = obj.style.display;
		if(oldVal == 'none') newVal = '';
	}
	obj.style.display = newVal;
}

/**
 * switch display of one ore more objects on check
 * @obj radioButtonObj: Radio-Button-Objekt
 * @array displayStates: Anzeigestatus. Aufbau: Array{<objId>:<displayStatus>,[<objId>:displayStatus, ...]}
 *
 * @example: switchDisplayOnCheck(this, {'A':'block','B':'none'});
 */
function switchDisplayOnCheck(radioButtonObj, displayStates)
{
	if(!(radioButtonObj instanceof Array))
		radioButtonObj = new Array(radioButtonObj);
	for(var i in radioButtonObj)
		if(radioButtonObj[i].checked)
			for(var displayStateObjId in displayStates)
				document.getElementById(displayStateObjId).style.display = displayStates[displayStateObjId];
}

//show ids if one checkbox of some checkboxes or a checkbox-group is activated
function showIdsIfCheckboxTrue(formName, checkboxNames, objIds)
{
	f = document.forms[formName];
	checkboxObjects = new Array;
	for(i=0;i<checkboxNames.length;i++)
	{
		var checkboxName = checkboxNames[i];
		var checkboxObj = f.elements[checkboxName];
		if(checkboxObj.value)
		{
			checkboxObjects[checkboxObjects.length] = checkboxObj;
		}
		else
		{
			for(ii=0;ii<checkboxObj.length;ii++)
			{
				checkboxObjects[checkboxObjects.length] = checkboxObj[ii];
			}
		}
	}

	var checkboxChecked = false;
	for(i=0;i<checkboxObjects.length;i++)
	{
		if(checkboxObjects[i].checked)
		{
			checkboxChecked = true;
		}
	}
	var displ = "";

	for(i=0;i<objIds.length;i++)
	{
		checkboxChecked ? displ="" : displ="none";
		document.getElementById(objIds[i]).style.display = displ;
	}
}

//check one checkbox within a checkbox group, if all are deactivated
function checkboxGroupMinCheck(formName, checkboxGroupName, minCheckedCheckboxPos)
{
	var result = false;
	var f = document.forms[formName];
	var checkboxGroup = f.elements[checkboxGroupName];
	if(checkboxGroup.value)
	{
		checkboxGroup = new Array(checkboxGroup);
	}
	var oneChecked = false;
	for(var i=0;i<checkboxGroup.length;i++)
	{
		var currCheckbox = checkboxGroup[i];
		if(currCheckbox.checked && i != minCheckedCheckboxPos)
			oneChecked = true;
	}
	if(!oneChecked)
	{
		checkboxGroup[minCheckedCheckboxPos].checked = true;
		result = true;
	}
	return result;
}

	/**
	 * Es gibt eine Checkbox-Gruppe. Eine Checkbox soll mindestens angeklickt sein. Jede aktive Checkbox besitzt ein zugeh�riges Element,
	 * welches sichtbar ist, wenn die zugehörige Checkbox aktiv ist, und unsichtbar ist, wenn die zugehörige Checkbox inaktiv ist.
	 * 
	 * required functions: checkboxGroupMinCheck(), switchDisplay()
	 *
	 * @param string 	formName [name des formulars]
	 * @param string 	switchId [in seiner sichtbarkeit zu switchendes objekt]
	 * @param string 	checkboxGroupName [name der checkbox-Gruppe]
	 * @param int		minCheckedCheckboxPos [position der checkbox in der checkbox-Gruppe, die mindestens aktiv sein soll]
	 * @param string	minCheckedTargetId [target-id des elements, welches sichtbar sein soll, wenn die mindest aktive checkbox aktiv ist]
	 * @param object	das aufrufende Objekt selbst
	 */
	function switchDisplay_CheckboxGroupMinCheck_PreserveDisplayStatus(formName, switchId, checkboxGroupName, minCheckedCheckboxPos, minCheckedTargetId, obj)
	{
		var f = document.forms[formName];
		var checkboxGroup = f.elements[checkboxGroupName];
		if(checkboxGroup.value) checkboxGroup = new Array(checkboxGroup);
		var checkboxGroupLen = checkboxGroup.length;
		var checkDone = checkboxGroupMinCheck(formName, checkboxGroupName, minCheckedCheckboxPos);

		if(checkDone)
		{
			switchDisplay(minCheckedTargetId, null, '');
		}
		var doSwitch = false;
		for(var i=1;i<checkboxGroupLen;i++)
			if(checkboxGroup[i].checked)
			{
				doSwitch = true;
				break;
			}	
		if(doSwitch || obj != f.elements[checkboxGroupName][minCheckedCheckboxPos])
			switchDisplay(switchId);
	}

/*** formFillFields() ***
 * @purpose: fill out multiple fields in a form
 * @access: public
 * @param string formName
 * @param array fields
 * @param array values
 * @return void
 */
function formFillFields(formName, fields, values)
{ 
	if(fields[0] && values[0])
	{
		var f = document.forms[formName];
		for(var i=0;i<fields.length;i++)
		{
			if(values[i]) f.elements[fields[i]].value = values[i];
		}
	}
}

/*** checkRadioSetFieldValues() ***
 * @purpose: set values of multiple fields if a specific radio button of a radio-group is checked
 * @access: public
 * @param string formName
 * @param string radioGroupName
 * @param string radioValue
 * @param array fields
 * @param array values
 * @return void
 */
function checkRadioSetFieldValues(formName, radioGroupName, radioValue, fields, values)
{
	if(fields[0] && values[0])
	{
		var f = document.forms[formName];
		var radioGroup = f.elements[radioGroupName];
		var radioGroupLen = radioGroup.length;
		var radio = false;
		for(var i=0; i<radioGroupLen; i++)
		{
			if(radioGroup[i].value == radioValue)
				radio = radioGroup[i];
		}
		if(radio && radio.checked)
		{
			var fieldsLen = fields.length;
			for(i=0; i<fieldsLen; i++)
			{
				if(f.elements[fields[i]])
				{
					if(values[i]) f.elements[fields[i]].value = values[i];
				}
			}
		}
	}
}

/*** makeFullPrice() ***
 * @purpose: return a full price declaration
 * @access: public
 * @param string|int [numeric] price
 * @param string seperator
 * @param string [optional] postfix
 * @param array fields
 * @param array values
 * @return string
 */

function makeFullPrice(price, seperator, postfix)
{
	var result = price;
	if(!seperator) seperator = ",";
	if(!postfix) postfix = "";
	var price = String(price);
	var priceRegExp = new RegExp("^\\d+?[\\"+seperator+"\\,]?\\d*$");
	if(price.match(priceRegExp))
	{
		price = String(parseFloat(price.replace(/,/,".")));
		var parts = new Array();
		if(price.indexOf(".") != -1) var parts = String(price).split("."); 
		if(parts[1]) 
		{
			if(parts[1].length > 2)
				parts[1] = String(parseInt(parseFloat(parts[1].substr(0,2)+"."+parts[1].substr(2))));
			if(parts[1].length == 1)
			{
				parts[1] = parts[1]+"0";
			}
		}
		else if(!parts[1])
		{
			parts[0] = price;
			parts[1] = "00";
		}
			
		result = parts[0]+seperator+parts[1]+postfix;
	}
	return result;
}

/**
 * @desc tausche Positionen von Options in einem Select-Feld aus.
 * @param string formName
 * @param string selectName
 * @param string direction = 'up'
 * @param boolean numbered = false
 * @return integer newPosition
 */
function swapSelectOptionPosition(formName, selectName, direction, numbered)
{
	if(!direction) direction = "up";
	var r = 0;
	var s = document.forms[formName].elements[selectName];
	var si = s.selectedIndex;
	if(si != -1)
	{
		if(direction == "down")
			var n = si+1;
		else
			var n = si-1;
		if(n >= 0 && n < s.options.length)
		{	
			r = n;
			var t = s.options[si].text;
			var ot = s.options[n].text;
			if(numbered)
			{
				if(t.charAt(1) == ".")
					t = (n+1)+t.slice(1);
				else
					t = (n+1)+t.slice(2);
				if(ot.charAt(1) == ".")
					ot = (si+1)+ot.slice(1);
				else
					ot = (si+1)+ot.slice(2);
			}
			s.options[n].text = t;
			s.options[si].text = ot;
			s.selectedIndex = n;
			//change string value
			if(numbered)
			{
				s = document.forms[formName].elements['manual_order'];
				var sv = s.value;
				var nsv = swapCommaSeperatedStringPositions(sv, si, n);
				s.value = nsv;
			}
		}
		else if(n < 0) r = 0;
		else if(n == s.options.length) r = s.options.length-1;
	}
	else
	{
		alert("Bitte wählen Sie zuerst ein zu verschiebendes Element aus.");
	}

	return r;
}

/**
 * @desc tausche Positionen in Kommagetrenntem String aus
 * @param str
 * @param oldPos
 * @param newPos
 * @return
 */
function swapCommaSeperatedStringPositions(str, oldPos, newPos)
{
	var result = str;
	var arr = str.split(",");
	var oldVal = arr[newPos];
	arr[newPos] = arr[oldPos];
	arr[oldPos] = oldVal;
	result = arr.join(",");
	return result;
}

/* openwin.js */

//fenster oeffnen
function openwin(file, name, width, height, left, top, scrollbars)
{
	if(window.opened_win && !window.opened_win.closed)
	{	
		opened_win.close();
	}
		if(left == null || left == "")
		{
			left = (screen.availWidth/2) - (width/2);
		}
		if(top == null || top == "")
		{
			top = (screen.availHeight/2) - (height/2);
		}
		if(scrollbars == null || scrollbars == "")
		{
			scrollbars = "no";
		}
		
		try
		{
			opened_win = window.open(file, name, "width="+width+", height="+height+", left="+left+", top="+top+", location=no, menubar=no, resizable=no, scrollbars="+scrollbars+", status=yes, toolbar=no");
			if(!opened_win || typeof(opened_win) != 'object' || opened_win.closed)
			{
      			throw "popup_failed"; 
   			}
				
			opened_win.focus();
		}
		catch(e)
		{
			if ( e == "popup_failed" )
			{
      			return false;
   			}
		}
	return opened_win;
}


/* strings.js */

//string funktionen
//trim: Strip whitespace from the beginning and end of a string
function trim(stringToTrim)
{
	return stringToTrim.replace(/^\s+|\s+$/g,"");
}

//replace string hits with repl using regExp.. u can use $n as backreference
function pregReplace(strRegExp, repl, str)
{
	var result = false;
	var regExp = new RegExp(strRegExp);
	result[i] = str.replace(regExp, repl);
	return result;
}

//replace all array-string-objects hits in arr with repl using regExp.. u can use $n as backreference
function arrPregReplace(strRegExp, repl, arr)
{
	var result = new Array();
	var regExp = new RegExp(strRegExp);

	if(arr[0])
	{
		for(var i=0;i<arr.length;i++)
		{		
			result[i] = arr[i].replace(regExp, repl);
		}
	}
	return result;
}

//return an array with all arr-string-objects that matched the reg. expr.
function arrPregMatch(strRegExp, repl, arr)
{
	var result = new Array();
	var regExp = new RegExp(strRegExp);

	if(arr[0])
	{
		for(var i=0;i<arr.length;i++)
		{
			if(arr[i].match(regExp, repl))
				result[i] = arr[i];
		}
	}
	return result;
}

/* time.js */


$(document).ready(function(){
	
	function get_time(format)
	{
		var date = new Date();
		var seconds = date.getSeconds().toString();
		var hours = date.getHours().toString();
		var minutes = date.getMinutes().toString();
		var day = date.getDate().toString();
		var month = (date.getMonth()+1).toString();
		var year = date.getFullYear().toString();
		var str_time = "";
		
		var parts = new Array(year, month, day, hours, minutes, seconds);
		
		for(i=1; i<parts.length; i++)
		{
			if(parts[i].length == 1)
			{
				parts[i] = "0"+parts[i];
			}
		}
		var full_date = parts[2]+"."+parts[1]+"."+parts[0];
		var full_time = parts[3]+":"+parts[4]+":"+parts[5];
		switch(format)
		{
			case "date": str_time = full_date;
			break;
			case "time": str_time = full_time;
			break;
			default:  str_time = full_date+" "+full_time;
		}
		return str_time;
	}

	function write_time(id, format)
	{
		var format = "";
		var id = "timeDisplay";
		var obj = document.getElementById(id);
		if(typeof(obj) == "object" && obj != null)
			obj.firstChild.nodeValue = get_time(format);
	}
	
	var aktiv = window.setInterval(write_time, 1000);
});

/* events.js */

/**
 * add an event
 * @obj: object, where event occurs
 * @evType: type of the event (load, mouseover ...)
 * @fn: the function to be called
 */
 
function addEvent(obj, evType, fn)
{
	if (obj.addEventListener)
	{
		obj.addEventListener(evType, fn, false);
		return true;
	}
	else if (obj.attachEvent)
	{
		var r = obj.attachEvent("on"+evType, fn);
		return r;
	}
	else
	{
		return false;
	}
}

/**
 * remove an event
 * @obj: object, where event occurs
 * @evType: type of the event (load, mouseover ...)
 * @fn: the function to be called
 */
 
function removeEvent(obj, evType, fn)
{
	if (obj.removeEventListener)
	{
		obj.removeEventListener(evType, fn, false);
		return true;
	}
	else if (obj.detachEvent)
	{
		var r = obj.detachEvent("on"+evType, fn);
		return r;
	}
	else
	{
		return false;
	}
}

/**
* Button Mouseover
*/

function initJsButton()
{
	var regExp = new RegExp('(^.*?/?)(b\\d?_\\w*_)a\\.(gif|jpg|jpeg|png)$');
	//all images
	var imgs = document.getElementsByTagName('img');
	if(!imgs) imgs = new Array();
	//input type=images
	var inputs = document.getElementsByTagName('input');
	var inputImgs = new Array();
	var inputsLen = inputs.length;
	for(var i=0;i<inputsLen;i++)
		if(inputs[i].type == "image")
			inputImgs[inputImgs.length] = inputs[i];
	
	var imgsLen = imgs.length;
	var inputImgsLen = inputImgs.length;
	var totalLen = imgsLen + inputImgsLen;
	for(var i=0;i<totalLen;i++)
	{
		var img;	
		(i < imgsLen) ? img = imgs[i] : img = inputImgs[i-imgsLen];
		var res = regExp.exec(img.src);
		if(res)
		{
			var out = img.src;
			var over = res[1]+res[2]+"b."+res[3];
			img['jsButtonOut'] = out;
			img['jsButtonOver'] = over;
			//addEvent(img, 'mouseover', testmenow);
			img.onmouseover = function(){this.style.cursor = "pointer";this.src = this.jsButtonOver};
			//addEvent(img, 'mouseout', function(){this.style.cursor = "default";this.src = this.jsButtonOut});
			img.onmouseout = function(){this.style.cursor = "default";this.src = this.jsButtonOut};
		}
	}
}

addEvent(window, 'load', initJsButton);

function initJsFormTextHandling()
{	//@TODO: hier das ganze über einen regExp machen!!
	var exclude = new Array("anmeldung_name", "anmeldung_email","keyword_alt");
	var excludeLen = exclude.length;
	var inputs = document.getElementsByTagName("input");
	var textareas = document.getElementsByTagName("textarea");
	var inputsLen = 0;
	if(inputs) inputsLen = inputs.length;
	var textareasLen = 0;
	if(textareas) textareasLen = textareas.length;
	var totalLen = inputsLen+textareasLen;
	
	a: for(var i=0;i<totalLen;i++)
	{
		var inputObj;
		//input-text?
		if(i < inputsLen)
			if(inputs[i].type == "text")
				inputObj = inputs[i];
			else continue a;
		else //textarea
			inputObj = textareas[i-inputsLen];
		var doExclude = false;
		for(var ii=0;ii<excludeLen;ii++)
			if(exclude[ii] == inputObj.name)
				doExclude = true;

		if(doExclude)
		{
			//set origValue
			if(inputObj && inputObj.value && inputObj.type && inputObj.type != "hidden" || inputObj && inputObj.value)
				inputObj.origValue = inputObj.value;
			//set to origValue
			addEvent(inputObj, "blur", function(){if(this.value == "" && this.origValue) this.value = this.origValue;});
			//select on click
			addEvent(inputObj, "click", function(){if(this.origValue == this.value) this.value = ''});
		}
	}
}

addEvent(window, 'load', initJsFormTextHandling);

/**
 * Form Sending
 * auto transform url-trails in action in method="get" forms
 *
 */
 
function initGetActionTrailTransformation()
{
	var fs = document.forms;
	for(var i=0;i<fs.length;i++)
	{	
		var f = fs[i];
		if(f.method && f.method.match(/get/i) && f.action)
		{
			var a = f.action;
			var delimPos = a.indexOf('?');
			if(delimPos != -1)
				var trail = a.substr(delimPos+1);
			else
				continue;
			var trailPieces = trail.split('&');
			for(var ii=0;ii<trailPieces.length;ii++)
			{
				var trailHash = trailPieces[ii].split('=');
				if(!f[trailHash[0]])
				{
					var eInput = document.createElement("input");
					eInput.type = "hidden";
					eInput.name = trailHash[0];
					eInput.value = trailHash[1];
					f.appendChild(eInput);
				}
			}
		}
	}
}

addEvent(window, 'load', initGetActionTrailTransformation);

/***********************************************
* IFrame SSI script II- � Dynamic Drive DHTML code library (http://www.dynamicdrive.com)
* Visit DynamicDrive.com for hundreds of original DHTML scripts
* This notice must stay intact for legal use
***********************************************/
/*
//Input the IDs of the IFRAMES you wish to dynamically resize to match its content height:
//Separate each ID with a comma. Examples: ["myframe1", "myframe2"] or ["myframe"] or [] for none:
var iframeids=[];

//Should script hide iframe from browsers that don't support this script (non IE5+/NS6+ browsers. Recommended):
var iframehide="yes";

var getFFVersion=navigator.userAgent.substring(navigator.userAgent.indexOf("Firefox")).split("/")[1]
var FFextraHeight=parseFloat(getFFVersion)>=0.1? 16 : 0 //extra height in px to add to iframe in FireFox 1.0+ browsers

function resizeCaller() {
var dyniframe=new Array()
for (i=0; i<iframeids.length; i++){
if (document.getElementById)
resizeIframe(iframeids[i])
//reveal iframe for lower end browsers? (see var above):
if ((document.all || document.getElementById) && iframehide=="no"){
var tempobj=document.all? document.all[iframeids[i]] : document.getElementById(iframeids[i])
tempobj.style.display="block"
}
}
}

function resizeIframe(frameid){
var currentfr=document.getElementById(frameid)
if (currentfr && !window.opera){
currentfr.style.display="block"
if (currentfr.contentDocument && currentfr.contentDocument.body.offsetHeight) //ns6 syntax
currentfr.height = currentfr.contentDocument.body.offsetHeight+FFextraHeight;
else if (currentfr.Document && currentfr.Document.body.scrollHeight) //ie5+ syntax
currentfr.height = currentfr.Document.body.scrollHeight;
if (currentfr.addEventListener)
currentfr.addEventListener("load", readjustIframe, false)
else if (currentfr.attachEvent){
currentfr.detachEvent("onload", readjustIframe) // Bug fix line
currentfr.attachEvent("onload", readjustIframe)
}
}
}

function readjustIframe(loadevt) {
var crossevt=(window.event)? event : loadevt
var iframeroot=(crossevt.currentTarget)? crossevt.currentTarget : crossevt.srcElement
if (iframeroot)
resizeIframe(iframeroot.id);
}

function loadintoIframe(iframeid, url){
if (document.getElementById)
document.getElementById(iframeid).src=url
}

//addEvent(window, 'load', resizeCaller);
*/

/* menu.js */

function menuLink(actID,linkText,urlInfo,subLength)
{
	this.urlInfo = urlInfo;
	this.actID = actID;
	this.linkText = linkText;
	this.subLength = subLength;
}


function getPath(Id)
{
	var mDepth = Id.length;	
	var p = new Array();		
	if(mDepth>=1){p[0] =  'obj_'+Id.charAt(0);}
	if(mDepth>=2){p[1] = p[0]+Id.charAt(1);}
	if(mDepth>=3){p[2] = p[1]+Id.charAt(2);}
	if(mDepth>=4){p[3] = p[2]+Id.charAt(3);}
	if(mDepth>=5){p[4] = p[3]+Id.charAt(4);}
	if(mDepth>=6){p[5] = p[4]+Id.charAt(5);}
	if(mDepth>=7){p[6] = p[5]+Id.charAt(6);}
	if(mDepth>=8){p[7] = p[6]+Id.charAt(7);}
	if(mDepth>=9){p[8] = p[7]+Id.charAt(8);}
		
	switch(p.length)
	{
		case 1: var ObjPath=M[p[0]];break;
		case 2: var ObjPath=M[p[1]];break;
		case 3: var ObjPath=M[p[2]];break;
		case 4: var ObjPath=M[p[3]];break;
		case 5: var ObjPath=M[p[4]];break;
		case 6: var ObjPath=M[p[5]];break;
		case 7: var ObjPath=M[p[6]];break;	
		case 8: var ObjPath=M[p[7]];break;
		case 9: var ObjPath=M[p[8]];break;							
	}
	
	return ObjPath;
}
//Style Pfad	
function StylePath(layerID) 
	{
		if(!NN4)
		{
			return document.getElementById(layerID).style;
		}
		else
		{
			 e1 = (document.getElementById('pos'));
			 
			 return (e1.layers[layerID]);
		}
	}	
//Style Changes
function changeStyle(Id,Cond)
{
	
	if(!NN4)
	{
	
		var Obj = getPath(Id);
		var ObjID = Obj.actID;
		var Cond = String(Cond);		
		if(Obj.subLength>0 && Obj.actID.length>4){
			document.getElementById(ObjID).className = 'css_submenu_'+Cond;
		}
		else{ 
			document.getElementById(ObjID).className = 'css_menu_'+Cond;
		}
		window.status = Obj.linkText; //statusanzeige
		StylePath(ObjID).cursor = 'pointer'; //cursor
	}
}
//Globals
var actMenus = new Array();
var actLinks = new Array();
t = 0; //Starter
delayTime = 10;
delayer = window.setTimeout('HideAll()',(delayTime*100));

//Show/(Hide) Funktion
function Show(Id)
{	
	out = 0;	
	window.clearTimeout(delayer);

	var Obj = getPath(Id); //aktueller Obj Pfad
	var actML = actMenus.length;
	var actLL = actLinks.length;

	if(t!==0)
	{
		var lastObj = getPath(actMenus[actML-1]);
		var currAct = Id.length;
		var lastAct = actMenus[actML-1].length;
					
		for(i=(actML-1);i>=((actML-1)-(lastAct-currAct));i=i-1)
		{
			var thisObj = getPath(actMenus[i]);
			StylePath(thisObj.actID+'_sub').visibility = 'hidden';
			changeStyle(actMenus[i],0);
			//actMenus.pop();
			actMenus.length = actMenus.length-1;
			t=t-1;
		}	
	}
	
	for(i=(actLL-1);i>=0;i=i-1)
	{
		changeStyle(actLinks[i],0);
		//actLinks.pop();
		actLinks.length = actLinks.length-1;
	}				
			
	if(Obj.subLength!==0)
	{	//Ja:
		StylePath(Obj.actID+'_sub').visibility = 'visible';
		//actMenus.push(Id);
		actMenus[actMenus.length] = Id;
		t++;
	}	
	else
	{	//nein:
		//actLinks.push(Id);
		actLinks[actLinks.length] = Id;
	}	

	changeStyle(Id,1);
}

//timeout
function Hide()
{	
	out = 1;
	delayer = window.setTimeout('HideAll()',(delayTime*100));	
}

//verstecke alle
function HideAll()
{	
	for(i=actMenus.length-1;i>=0;i=i-1)
	{		
		var thisObj = getPath(actMenus[i]);		
		StylePath(thisObj.actID+'_sub').visibility = 'hidden';
		changeStyle(actMenus[i],0);
		//actMenus.pop();
		actMenus.length = actMenus.length-1;
		t=t-1;		
	}
	for(i=((actLinks.length)-1);i>=0;i=i-1)
	{
		changeStyle(actLinks[i],0);
		//actLinks.pop();
		actLinks.length = actLinks.length-1;
	}
}

//Link [link]&[target]
function UrL(Obj) 
{
	s=Obj.lastIndexOf('&');
	actURL = M[('obj_'+(Obj.slice(0,s)))].urlInfo;
	actTarget =  Obj.slice((s+1),(Obj.length));
	
	if(actTarget == '')
	{
		actTarget = '_self';
	}
	
	/*if(document.getElementsByTagName('body') && document.getElementsByTagName('body')[0].style)
		document.getElementsByTagName('body')[0].style.cursor = 'wait';*/
	
	switch(actTarget)
	{
		case '_self': document.location = actURL;
		break;
		case '_top': top.location = actURL;
		break;
		case '_blank': window.open(actURL);
		break;
		case '_parent': parent.location=actURL;
		break;
		default: parent.frames[actTarget].location=actURL;
	}
	
	HideAll();
}

/* printpage.js */

function printPage(cssFile)
{
	var head = document.getElementById("pageHeader");
	var link = document.createElement("link");
	var rel = document.createAttribute("rel"); 
	rel.nodeValue = "stylesheet";
	var type = document.createAttribute("type");
	type.nodeValue = "text/css";
	var media = document.createAttribute("media"); 
	media.nodeValue = "print, embossed";
	var href = document.createAttribute("href"); 
	href.nodeValue = "print.css";
	link.setAttributeNode(rel);
	link.setAttributeNode(media);
	link.setAttributeNode(href);
	link.setAttributeNode(type);
	head.appendChild(link);
	print();
}

/* slider/slider.js */

function addAnEvent(el, evname, func)
{
    if (el.attachEvent) { // IE
        el.attachEvent("on" + evname, func);
    } else if (el.addEventListener) { // Gecko / W3C
        el.addEventListener(evname, func, true);
    } else {
        el["on" + evname] = func;
    }
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *

Originally from:
  http://www.arantius.com/article/lightweight+javascript+slider+control

Copyright (c) 2006 Anthony Lieuallen, http://www.arantius.com/

Permission is hereby granted, free of charge, to any person obtaining a copy of 
this software and associated documentation files (the "Software"), to deal in 
the Software without restriction, including without limitation the rights to 
use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of 
the Software, and to permit persons to whom the Software is furnished to do so, 
subject to the following conditions:

The above copyright notice and this permission notice shall be included in all 
copies or substantial portions of the Software.

THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR 
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS 
FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR 
COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER 
IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN 
CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
function drawSliderByVal(slider) {
	var knob=slider.getElementsByTagName('img')[0];
	var p=(slider.val-slider.min)/(slider.max-slider.min);
	var x=(slider.scrollWidth-19)*p;
	knob.style.left=x+"px";
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
function findPosX(obj)
{
	var curleft = 0;
	if (obj.offsetParent)
	{
		while (obj.offsetParent)
		{
		curleft += obj.offsetLeft
		obj = obj.offsetParent;
		}
	}
	else if (obj.x)
	curleft += obj.x;
	return curleft;
}

function setSliderByClientX(slider, clientX) {
	var p = (clientX-findPosX(slider))/(slider.scrollWidth - 0); 
	slider.val=(slider.max-slider.min)*p + slider.min;
	if (slider.val>slider.max) slider.val=slider.max;
	if (slider.val<slider.min) slider.val=slider.min;

	drawSliderByVal(slider);
	slider.onchange(slider.val, slider.num);
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
function sliderClick(e) {
	var el=sliderFromEvent(e);
	if (!el) return;

	setSliderByClientX(el, e.clientX);
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
function sliderMouseMove(e) {
	var el=sliderFromEvent(e);
	if (!el) return;
	if (activeSlider<0) return;

	setSliderByClientX(el, e.clientX);
	stopEvent(e);
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
function sliderFromEvent(e) {
	if (!e && window.event) e=window.event;
	if (!e) return false;

	var el;
	if (e.target) el=e.target;
	if (e.srcElement) el=e.srcElement;

	if (!el.id || !el.id.match(/slider\d+/)) el=el.parentNode;
	if (!el) return false;
	if (!el.id || !el.id.match(/slider\d+/)) return false;

	return el;
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
function attachSliderEvents() {
	var divs=document.getElementsByTagName('div');
	var divNum;
	for(var i=0; i<divs.length; i++) {
		if (divNum=divs[i].id.match(/\bslider(\d+)\b/)) {
			// set initial properties
			divNum=parseInt(divNum[1]);
			divs[i].min=slider[divNum].min;
			divs[i].max=slider[divNum].max;
			divs[i].val=slider[divNum].val;
			divs[i].onchange=slider[divNum].onchange;
			divs[i].num=divNum;
			// and make sure the display matches
			drawSliderByVal(divs[i]);
			divs[i].onchange(divs[i].val, divNum);

			addAnEvent(divs[i], 'mousedown', function(e){
				sliderClick(e);
				var el=sliderFromEvent(e);
				if (!el) return;
				activeSlider=el.num;
				stopEvent(e);
			});
			addAnEvent(document, 'mouseup', function(e){
				activeSlider=-1;
				stopEvent(e);
			});
			/*addAnEvent(divs[i], 'mouseout', function(e){
				activeSlider=-1;
				stopEvent(e);
			});*/
		}
	}
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
//borrowed from prototype: http://prototype.conio.net/
function stopEvent(event) {
	if (event.preventDefault) {
		event.preventDefault();
		event.stopPropagation();
	} else {
		event.returnValue=false;
		event.cancelBubble=true;
	}
}
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */
addAnEvent(window, 'load', attachSliderEvents);
addAnEvent(document, 'mousemove', sliderMouseMove);
var activeSlider=-1;
/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */